1. When doing polynomial division, the terms should be in order of their exponents, highest
to lowest, with the number last.

Answers

Answer 1

Answer:

True

Step-by-step explanation:

The powers must be arranged from highest to lowest for both the numerator and the denominator, so the terms will line up during the subtraction steps.


Related Questions

pls help i need to finish this asap !!

Answers

Answer:

b = -3

Step-by-step explanation:

Using the graph, when x=2

y = -3

What is the explicit formula for this sequence?
-9, - 3, 3, 9, 15, ...

Answers

Answer:

-15+6d

Step-by-step explanation:

The common difference of the sequence is -3+9=6

The formula is an=a+(n-1)d, an=-9+(n-1)*6=-15+6d

please help me with this problem

Answers

Answer:

Step-by-step explanation:

I'm not sure but i think your right

Nghiệm của bất phương trình | 2x - 3| - 1 <0

Answers

Answer:

x = 1 và 2       x= 1 and 2

Step-by-step explanation:

Đầu tiên trừ đi 1 để được 2x-3 nhỏ hơn -1 sau đó bạn lập phương trình bằng 2x-3 = -1 và 2x-3 = 1 để nhận được kết quả cuối cùng là 1 và 2 do đó x = 1 và 2

First subtract 1 to get 2x-3 is less then -1 then you let the equation equal 2x-3=-1 and 2x-3=1 to get a final answer of 1 and 2 therefore x=1 and 2

In an experiment, a student is to flip a quarter 10 times and record the number of times heads appears. A group of students performs the experiment 21 times, with these results.

6 4 5 6 5 6 4 6 2 4 3 4 5 7 5 8 7 5 3 5 5

Construct a dotplot with these data and then identify the dotplot you created.

Answers

Answer:

The average, mode, and median of the results are 5, meaning that half of the time the quarter will land on heads.

Step-by-step explanation:

The required dot plot shows the result of the experiment performed by flipping a quarter 21 times.


In an experiment, a student is to flip a quarter 10 times and record the number of times heads appears. A group of students performs the experiment 21 times, with these results. 6 4 5 6 5 6 4 6 2 4 3 4 5 7 5 8 7 5 3 5 5.


What is arithmetic?

In mathematics, it deals with numbers of operations according to the statements. There are four major arithmetic operators, addition, subtraction, multiplication, and division,

What is Statistic?

Statistics is the study of mathematics that deals with relations between comprehensive data.

Here,
The dot plot has been made, for the number of outcomes and their frequencies. The dot plot gives the info about the mean mode and median.

Thus, the required a dot plot showing the result of the experiment performed by flipping a quarter 21 times.

Learn more about arithmetic here:

brainly.com/question/14753192

#SPJ2

ntroduction to Functions
Assignment Active
Creating a Function from a Mapping
The mapping shows a relationship between input and
output values.
Input
Output
Which ordered pair could be removed to make this
relation a function?
O (-5,0)
0 (-1, -3)
O (4, -2)
O (6,-1)

Answers

Answer:

To be a function, each input must only have one output. In this case, input 4 has two outputs, so (4 , -2) can be removed for it to be a function.

Let me know if you have any other questions!

The ordered pair (4,2) could be removed to make the given relation a function.

What is the relation?

A relation is a function if for every input (x-value) there is exactly one output (y-value).

If there are two or more ordered pairs with the same x-value but different y-values, then the relation is not a function. In this case, one of those ordered pairs would need to be removed in order to make it a function.

As per the question, the relation was given as {(-5,0), (2, -3), (-1, -3), (4, -2), (4, -2), (6,-1)}, the ordered pair (4,-2) would need to be removed because there are two outputs (-2 and 2) for the input of 4.

Thus, removing (4,2) would result in the function.

Learn more about the relations here:

https://brainly.com/question/29207494

#SPJ7

Read is solving the quadratic equation 0 equals X over two minus 2X -3 using the quadratic formula which shows the correct substitution of the values ABC into the quadratic formula quadratic formula X equals negative B+

Answers

Answer:

[tex]x = \frac{-(-2) \± \sqrt{(-2)^2 - 4*1*-3}}{2*1}[/tex]

Step-by-step explanation:

Given

[tex]0 = x^2 - 2x -3[/tex]

Required

The correct quadratic formula for the above

A quadratic equation is represented as:

[tex]ax^2 + bx + c = 0[/tex]

And the formula is:

[tex]x = \frac{-b \± \sqrt{b^2 - 4ac}}{2a}[/tex]

So, we have:

[tex]0 = x^2 - 2x -3[/tex]

Rewrite as:

[tex]x^2 - 2x - 3 = 0[/tex]

By comparison:

[tex]a= 1; b = -2; c = -3[/tex]

So, we have:

[tex]x = \frac{-b \± \sqrt{b^2 - 4ac}}{2a}[/tex]

[tex]x = \frac{-(-2) \± \sqrt{(-2)^2 - 4*1*-3}}{2*1}[/tex]

Find the nth term of each of the sequences.
(a) 16, 19, 22, 25, 28, ...
(b) 1,3,9,27,81,...

Answers

Answer:

a) 16, 19, 22, 25, 28, 31, 34, 37, 40

b) 1, 3, 9, 27, 81, 243, 729, 2187

Explanation:

a) Add 3 on every number.

b) Multiply every number by 3.

can someone help me with this?

Answers

Answer:

The answer is 660

Step-by-step explanation:

30×2200÷100= 660

Answer:

660

Step-by-step explanation:

to know 30%

2200÷10×3=660

What is the range of the given data set? OA) 30 OB) 32 OC) 37 OD) 40​

Answers

Answer:

Range = maximum number - minimum number

maximum number = 99minimum number = 62

Range = 99 - 62 = 37

Answer:

37

Step-by-step explanation:

The range is the difference between the highest number and the smallest number.

Looking at the stem and leaf plot we can identify the largest and smallest number

Largest number: 99

Smallest number: 62

If range = largest number - smallest number then range = 99 - 62 = 37

12. PLEASE HELP ME
Which of the following are the coordinates of the vertex of y= x2 - 10x + 2?

A. (–10, 2)

B. (2, –10)

C. (–5, 23)

D. (5, –23)

Answers

Answer:

I think b no. is the correct answer

Answer:

D. (5, –23)

Step-by-step explanation:

The vertex is in essence the turning point of the parabola y = x² − 10x + 2

the x coordinate of the turning point =  

                                                        =  

                                                        =  5

when x = 5, y = (5)² - 10(5) + 2

                     = -23

Thus coordinate or vertex is ( 5, -23)

5 right 23 down

TRIGONOMETRY
Could someone please help me with 5.2 please...it would really help alot:)​

Answers

sin(x+y) - sin(x-y) - 1 = cos(2x)

sin(90) - sin(x-y) - 1 = cos(2x)

1 - sin(x-(90-x)) - 1 = cos(2x)

-sin(2x-90) = cos(2x)

-1*(sin(2x)cos(90) - cos(2x)sin(90)) = cos(2x)

-1*(sin(2x)*0 - cos(2x)*1) = cos(2x)

-1*(0 - cos(2x)) = cos(2x)

-1*(-cos(2x)) = cos(2x)

cos(2x) = cos(2x)

This confirms the identity is true.

Notice that throughout this proof, I only changed the left hand side.

On the 5th line, I used the identity sin(A-B) = sin(A)cos(B)-cos(A)sin(B).

In right triangle ABC, AB = 3 and AC = 9. What is the measure of angle B to the nearest degree?

Answers

Answer:

90 degrees

Step-by-step explanation:

see image

make x A

y B

z C

AB=3 (given)

AC=9 (given)

measure of angel B or y, is 90

if

x= A

y= C

z= B

then the hypotenuse would be shorter than one of the legs

3<9

so B has to be the right angle (90 degrees)

Find the equation of a line perpendicular to 8x - 2y = 4 and passes through the point (4, 3).

Answers

y = -2x-3

Lines that are perpendicular have slopes that are negative reciprocals of each other. Meaning, if a line has slope  , then a line perpendicular to this has slope . That means the slope of our perpendicular line is

The equation of the line that is perpendicular to 8x - 2y = 4 and passes through the point (4, 3) is y = (-1/4)x + 4.

To find the equation of a line that is perpendicular to the line 8x - 2y = 4 and passes through the point (4, 3), we can use the fact that the slopes of perpendicular lines are negative reciprocals of each other.

First, let's rewrite the given equation in slope-intercept form (y = mx + b), where m represents the slope:

8x - 2y = 4

-2y = -8x + 4

Divide both sides by -2:

y = 4x - 2

The slope of the given line is 4.

The slope of a line perpendicular to this line would be the negative reciprocal of 4, which is -1/4.

Now, we have the slope (-1/4) and a point (4, 3). We can use the point-slope form of a linear equation:

y - y₁ = m(x - x₁)

Substituting the values, we have:

y - 3 = (-1/4)(x - 4)

Expanding and simplifying, we get:

y - 3 = (-1/4)x + 1

Adding 3 to both sides, we have:

y = (-1/4)x + 4

To learn more about equation click on,

https://brainly.com/question/20712656

#SPJ2

x = 3

x = 5

x = 0

x = 2

Answers

Answer:

x=2 is incorrect

Step-by-step explanation:

Y(2)=(3/4)*x^2=(3/4)*4=3

Which of the following is a parent function?
O A. f(x) = e*
O B. f(x) = 2.34
O x
C. f(x) = x4 +3
O D. f(x) = 2e2x

Answers

Answer:

[tex]f(x) = e^x[/tex]

Step-by-step explanation:

Given

Options (a) to (d)

Required

Which is a parent function

A parent function is such that has a single term without coefficients

From the list of given options

[tex]f(x) = e^x[/tex] suits the above definition

Other options (b) to (d) either have coefficients, or have multiple terms

What is the length of CD

Answers

Answer:

Step-by-step explanation:

3(x-2)

Answer:

CD = 7

Step-by-step explanation:

CD and GI are of same lenghth so

3x - 6 = x + 8

transpose

3x - x = 8+6

2x = 14

x = 14/2

x = 7

find the ratio of Rs 20 and 900​

Answers

Answer:

1 : 45

Step-by-step explanation:

Given

Rs 20 and 900 ( divide both by 20 )

= 1 : 45

(x-4)°=1
giải hộ em với ạ

Answers

Answer: 5

Step-by-step explanation:

⇒ (x - 4) = 1

⇒ x = 1 + 4

⇒ x = 5

Therefore value of x = 5

Answered by Gauthmath must click thanks and mark brainliest

Geometry, please answer question ASAP

Answers

Answer:

Triangle ACB =~ triangle DFE, by adding 6 units to each side of both triangles their relationship will not change. They are still similar.

Step-by-step explanation:

The answer isn't great in all honesty but it's been a long time since I took geometry and I don't 100% remember the proper way of stating it. Though I am 100% sure they stay similar.

Sorry couldn't be of more help but figured something was better then nothing

If C.P. = Rs. 480, S.P. =Rs.528 find profit and profit percent​

Answers

In this question first you should find profit amount by using formula and you should use profit amount in profit percentage formula then you should calculate it

What is the area of the following circle?

Answers

Answer:

[tex]16\pi\:\mathrm{units^2}\text{ or }50.24\:\mathrm{ units^2}[/tex]

Step-by-step explanation:

The area of a circle with radius [tex]r[/tex] is given as [tex]A=r^2\pi[/tex].

In the question, we're given [tex]r=4[/tex] and asked to solve for [tex]A[/tex].

Substituting [tex]r=4[/tex] into [tex]A=r^2\pi[/tex], we get:

[tex]A=4^2\pi,\\A=\boxed{16\pi\:\mathrm{units^2}}[/tex]

If we use [tex]\pi=3.14[/tex] as mentioned in the question, we would have:

[tex]A=16\pi=16\cdot 3.14=\boxed{50.24\:\mathrm{units^2}}[/tex]

What is the slope of the line that contains the points (9,-4) and (1,-5)? O A. 8 O B. - O c. 1 1 O D. 8​

Answers

Answer:

1/8

Step-by-step explanation:

-5-(-4)/1-9

Tim works as a server in a restaurant.
A
group
for $112.50. They leave Tim a tip of 20%.
Another group at Table 15 have a bill of
$142.75 and leave a 15% tip. Which table
of people at Table 22 have a bill
left Tim the greater tip

Answers

Answer:

The first group left a greater tip

Step-by-step explanation:

The first group left a tip of 20%. 20% of 112.5 is 22.5

The first group left a tip of 15%. 15% of 142.75 is 21.4125. Round to the nearest hundredth -> 21.41.

Therefore, the first group left a greater tip

I hope this helps!

pls ❤ and give brainliest pls

A wholesaler purchased an electric item for Rs 2,700 and sold to retailer at
10% profit. The retailer sold it at 20% profit to a consumer. How much did the
consumer pay for it.


PLZ PLZ HELP.......​

Answers

Step-by-step explanation:

10 % of 2700 = 270

so he had 2970 rupee

20% of 2970 = 594

so customer have to pay 2970 + 594 = 3564

HELP ME PLEASE I NEED HELP

Consider the end behavior of the function g(x) = 4|x − 2| − 3.

As x approaches negative infinity, f(x) approaches POSITIVE OR NEGATIVE infinity.


As x approaches positive infinity, f(x) approaches POSITIVE OR NEGATIVE infinity.

Answers

Answer:

Step-by-step explanation:

This is a narrower-than-normal absolute value graph, which is a v-shaped graph. It's pointy part, the vertex, lies at (2, -3) and it opens upwards without bounds along both the positive and negative x axes. Therefore, as x approaches negative infinity, f(x) or y (same thing) approaches positive infinity. As x approaches positive infinity, f(x) approaches positive infinity.

The foot of a ladder is placed 10 feet from a wall. If the top of the ladder rests 13 feet up on the wall, find the length of the ladder.

Answers

10 squared + 13 squared = your answer squared.
So do that then take the square root of whatever you get.

I NEED HELP ASAP!!! i dont understand

Answers

Answer:

b

Step-by-step explanation:

A parabola represents a quadratic equation. For a point called the focus and a line called the directrix, the distance from each point of the parabola to the focus is equal to its distance to the directrix. For example, if the directrix of the parabola was y=0 and the focus was (1,1), the distance between each point on the parabola to (1,1) would be equal to its distance from the line y=0.

For a parabola that has a horizontal axis of symmetry (or when y² is in the equation rather than x²), one way to write its equation is of the form

(y-k)²  =4p(x-h), where (h,k) is the vertex. Now, we can try to match up this form with the equation we have,

y² = 24x

(y-k)² = 4p(x-h)

We can start by setting both sides with y equal to each other, as well as both sides containing x

y² = (y-k)²

square root both sides

y = y-k

k=0

24x = 4p(x-h)

divide both sides by 4

6x = p(x-h)

expand

6x = p*x - p*h

Because p*h does not contain an x value, we can say

6x = p * x

p = 6

6x = p*x - p*h

6x = 6x-6*h

subtract 6x from both sidex

6*h=0

h=0

Our equation is thus

y= 4(6)(x), with our vertex being (0,0) = (h,k)

The directrix is equal to x=h-p, and with p being 6, our directrix is thus

x=0-6 = -6

x=-6

Help pls will give brainliest

Answers

Answer:

b

Step-by-step explanation:

area of triangle = 1/2 x c x d =cd/2

area of semicircle = 1/2 x π x r^2 = 1/2 x π x (a/2)^2 = 1/2 x π x a^2/4 =πa^2/8

area of shape = area of triangle + area of semicircle

HURRY I NEED TO KNOW.... what term can you add to 5/6)x -4 to make it equivalent to 1/2x-4?

Answers

Answer:

(-1/3)x

Step-by-step explanation:

You can either solve this algebraically or solve it by testing one possible answer at a time.

First example:  To (5/6)x - 4, add (-1/3)x.  Result:  (3/6)x - 4.  This is correct.

The correct answer is the first one:  (-1/3)x.

Other Questions
a box's volume set is 112 cubic inches. it has an open top. what is the length, width, and height? PLEASE HELP, THIS IS DUE VERY SOON! Using complete sentences in Spanish, describe three things you did last month to stay healthy. If you use a video, you can use images for support, but images are optional. evolution by natural selection is an example of a scientific PLS HELP ME ON THIS QUESTION I WILL MARK YOU AS BRAINLIEST IF YOU KNOW THE ANSWER!! HEEEEEEEEEEELLLLLLLLLLPPPPPPP!!!!!!!!! QUICK!!!!!!Find the coordinates of the image of M(1, 5) after the translation (x, y)(x+3, y2).Thank you!! Which of the following type of matter has weakest interparticle force of attraction O a. Liquid water O b. Iron O c. Steam O d. sand Question 15 of 24What is the benefit of a review of a written work?O A. It allows the writer to change his or her behavior in the future,B. It informs the reader of the work's strengths and weaknesses,c. It provides a summary of the written work for the reader.O D. It shows the writer how to make changes to the piece of writing,SUBMIT Triangle ABC has vertices of A(-6, 7), B(4, -1), and C(-2, -9). Find the length of the median from ZB in triangle ABCA. 4B. 18C. 8D. 768Please select the best answer from the choices provided D what could be some neurodegenerative disorder -7/3+1/2w= -9/5What is w? plz give me fast answer Section A: A(n) is a collection of information, generally stored as computer files. The information it contains can be stored, updated, organized, output, distributed, searched, and analyzed. A filing cabinet full of folders and papers would be classified as a(n) file. A(n) file use Alex drips hydrochloric acid onto a 5.9 g piece of magnesium in a single displacement reaction. How many molecules of HCl are required? 2HCl(aq) + Mg(s) MgCl2(aq) + H2(g)how do you do this? Knowing that AQPT - AARZ, a congruent angle pair is: Help me please.. There are 25 peanut candies in a bowl. 4 red, 3 orange, 4 yellow, 5 green, 6 blue and 3 brown. what is the probability of randomly choosing a blue candy from the bowl? Find the distance between the two points in simplest radical form.(7,-1) and (3,8)Answer:Submit Answerattempt 1 ou find x in the following What is the relationship between the word pairs in this analogy?? In right triangle ABC, the measure of A is 25 and AB = 1. What is the length of AC?(1) 0.9063(2) 0.4226(3) 0.2500(4) 0.2778