19/3+[14/3 ÷{10-3(3+1/2-1/4)×1/3}]

Answers

Answer 1

Answer:

= 3 11/20

Sorry I am not doing the step by step.


Related Questions

Convert 0.450 to a proper fraction

Answers

Answer:

9/20

Step-by-step explanation:

450/1000

this is not the answer, because it is not simplified

so here we have to find common factor and simplifying

________________________________________________

450/1000 is simplified to 9/20, and it can no longer be simplified.

Please help explanation if possible

Answers

Answer:

18.84 feet.  let me know if you have ay other questions.

Step-by-step explanation:

The way to find the formula for circumference is kinda complicated so it is best to ust memorize the formula, which is 2πr.  or 2 times pi times the radius.  

Your problem gives you the formula, but instead of 2 and r in it you have d, which is the diameter.

The diameter of the circle is 2 times the radius, so that's why it is replaced.

the radius is the distance from the center fo the circle to one edge, and the diameter is the distance through the circle passing through its center.  so it's the center to one end plus the center to another end.  or r+r which is also 2r.

So d = 2r, so in this problem d =6 feet.

So now the formula πd = 3.14*6 feet = 18.84 feet

Complete the table for the given rule.
Rule: y is 0.75 greater than x
x y
0
3
9

Answers

The complete table is

x    y

0    0.75

3     3.75

9     9.75

What is equation?

An equation is a mathematical statement that is made up of two expressions connected by an equal sign.

What is substitution?

Substitution means putting numbers in place of letters to calculate the value of an expression or equation.

According to the given question.

We have values of x.

Also, one rule that y is 0.75 greater than x.

So, we have a equation for finding the value of y  i.e.

[tex]y = x + 0.75..(i)[/tex]

For finding the value of y

At x = 0, substitute x = 0 in equation (i)

[tex]y = 0 + 0.75\\\implies y = 0.75[/tex]

At x = 3, substitute x = 3 in equation (i)

[tex]y = 3+0.75\\\implies y = 3.75[/tex]

At x = 9, substitute x = 9 in equation (i)

[tex]y = 9+0.75\\\implies y = 9.75[/tex]

Hence, the complete table is

x    y

0    0.75

3     3.75

9     9.75

Find out more information about equation and substitution here:

https://brainly.com/question/10852714

#SPJ2

Factors and rewrite the expression 25x-15​

Answers

Answer:

5(5x-3)

Step-by-step explanation:

The common factor in this expression is 5 so divide 5 to all the values

25/5=5

-15/5= -3

Put these values into parenthesis and leave the 5 on the left side and out of the parenthesis

5(5x-3)

Answer:

5(5x - 3)

Step-by-step explanation:

The greatest common factor here is 5. Divide each term by 5 and simplify.

25x/5 = 5x

15/5 = 3

Therefore, the answer is 5(5x - 3).

Reason Can you subtract a positive integer from a positive integer
and get a negive result? Explain your answer.

Answers

Answer:

No

Step-by-step explanation:

No matter the situation, when you multiply a negative by a negativeyou get a positive and a positive by a positive you get a positive. but if its two different like a negative and a positive then its NEGITIVE.

let's say you have 23 and you're multiplying by 2.

It's always increasing so it doesnt ever reach the negitive numbers.

Find an equation of the plane orthogonal to the line
(x,y,z)=(0,9,6)+t(7,−7,−6)

which passes through the point (9, 6, 0).

Give your answer in the form ax+by+cz=d (with a=7).

Answers

The given line is orthogonal to the plane you want to find, so the tangent vector of this line can be used as the normal vector for the plane.

The tangent vector for the line is

d/dt (⟨0, 9, 6⟩ + ⟨7, -7, -6⟩t ) = ⟨7, -7, -6⟩

Then the plane that passes through the origin with this as its normal vector has equation

x, y, z⟩ • ⟨7, -7, -6⟩ = 0

We want the plane to pass through the point (9, 6, 0), so we just translate every vector pointing to the plane itself by adding ⟨9, 6, 0⟩,

(⟨x, y, z⟩ - ⟨9, 6, 0⟩) • ⟨7, -7, -6⟩ = 0

Simplifying this expression and writing it standard form gives

x - 9, y - 6, z⟩ • ⟨7, -7, -6⟩ = 0

7 (x - 9) - 7 (y - 6) - 6z = 0

7x - 63 - 7y + 42 - 6z = 0

7x - 7y - 6z = 21

so that

a = 7, b = -7, c = -6, and d = 21

An equation of the plane orthogonal to the line 7x - 7y - 6z = 21.

The given line is orthogonal to the plane you want to find,

So the tangent vector of this line can be used as

The normal vector for the plane.

The tangent vector for the line is,

What is the tangent vector?

A tangent vector is a vector that is tangent to a curve or surface at a given point.

d/dt (⟨0, 9, 6⟩ + ⟨7, -7, -6⟩t ) = ⟨7, -7, -6⟩

Then the plane that passes through the origin with this as its normal vector has the equation

⟨x, y, z⟩ • ⟨7, -7, -6⟩ = 0

We want the plane to pass through the point (9, 6, 0), so we just

translate every vector pointing to the plane itself by adding ⟨9, 6, 0⟩,

(⟨x, y, z⟩ - ⟨9, 6, 0⟩) • ⟨7, -7, -6⟩ = 0

Simplifying this expression and writing it in standard form gives

⟨x - 9, y - 6, z⟩ • ⟨7, -7, -6⟩ = 0

7 (x - 9) - 7 (y - 6) - 6z = 0

7x - 63 - 7y + 42 - 6z = 0

7x - 7y - 6z = 21

So that, a = 7, b = -7, c = -6, and d = 21.

To learn more about the equation of plane visit:

https://brainly.com/question/1603217

Which two shapes make up the digital camera below?

Answers

Rectangular prism and cylinder

Rectangular prism and cylinder make up a camera.

What is rectangular prism and cylinder?

A cube is a rectangular prism with all of its sides being the same length, a triangular prism has a triangle as its base, and a rectangular prism has a rectangle as its foundation. Another form of right prism that has a circle as its basis is a cylinder.

A rectangular prism includes a total of 6 faces, 12 sides, and eight vertices. Like a cuboid, it contains three dimensions- the base width, the height, and the length. The top and base of the rectangular prism exist rectangular. The pairs of opposite faces of a rectangular prism exist as identical or congruent.

A cylinder contains traditionally been a three-dimensional solid, one of the most essential curvilinear geometric shapes. Geometrically, it includes been regarded as a prism with a circle as its base.

Hence, Rectangular prism and cylinder make up a camera.

To learn more about rectangular prisms and cylinders refer to:

https://brainly.com/question/15594686

#SPJ2

find the missing side of the triangle

Answers

Answer:

x = 34

Step-by-step explanation:

Pytago:

x[tex]30^{2} + 16^{2} = x^2\\x = \sqrt{30^2 + 16^2} \\x = 34[/tex]

Give example to verify if the given statement is true or false
1) if two numbers are co-primes , at least one of them should be prime number.

Answers

Answer:

no

Step-by-step explanation:

if two numbers are co-prime that is not necessary that one of them must be a prime number

Your parents deposit 2 50-dollar bills at the bank.
How much money did they deposit?

Answers

$100 is what they deposited!!

Answer: $100

Step-by-step explanation:

Considering 50 + 50 = 100

This means that the amount of money is $100

After how many years, to the nearest whole year, will an investment of $100,000 compounded quarterly at 4% be worth
$213,022?
Provide your answer below:

Answers

9514 1404 393

Answer:

  19 years

Step-by-step explanation:

The compound interest formula tells you the future value of principal P invested at annual rate r compounded n times per year for t years is ...

  A = P(1 +r/n)^(nt)

Solving for t, we get ...

  t = log(A/P)/(n·log(1 +r/n))

Using the given values, we find t to be ...

  t = log(2.13022)/(4·log(1 +0.04/4)) ≈ 19.000

The investment will be worth $213,022 after 19 years.

Triangle ABL is an isosceles triangle in circle A with a radius of 11, PL = 16, and ∠PAL = 93°. Find the area of the circle enclosed by line PL and arc PL. Show all work and round your answer to two decimal places.

Answers

The area bounded by a chord and arc it intercepts is known as a segment of a circle segment of a circle

The area of the circle enclosed by line PL and arc PL is approximately 37.62 square units

The reason the above value is correct is as follows:

The given parameters in the question are;

The radius of the circle, r = 11

The length of the chord PL = 16

The measure of angle ∠PAL = 93°

Required:

The area of part of the circle enclosed by chord PL and arc PL

Solution:

The shaded area of the given circle is the minor segment of the circle enclosed by line PL and arc PL

The area of a segment of a circle is given by the following formula;

Area of segment = Area of the sector - Area of the triangle

Area of segment = Area of minor sector APL - Area of triangle APL

Area of minor sector APL:

Area of a sector = (θ/360)×π·r²

Where;

r = The radius of the circle

θ = The angle of the sector of the circle

Plugging in the the values of r and θ, we get;

Area of the minor sector APL = (93°/360°) × π × 11² 98.2 square units

Area of Triangle APL:

Area of a triangle = (1/2) × Base length × Height

Therefore;

The area of ΔAPL = (1/2) × 16 × 11 × cos(93°/2) ≈ 60.58 square units

Required shaded area enclosed by line PL and arc PL:

Therefore, the area of shaded segment enclosed by line PL and arc PL is found as follows;

Area of the required segment PL (98.2 - 60.58) square units = 37.62 square units

The area of the circle enclosed by line PL and arc PL ≈ 37.62 square units

Learn more about the finding the area of a segment can be found here:

https://brainly.com/question/22599425

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

The calculation of the area between line segment PL and circle arc PL is described below:

1) Calculation of the area of the circle arc.

2) Calculation of the area of the triangle.

3) Subtracting the area found in 2) from the area found in 1).

Step 1:

The area of a circle arc is determined by the following formula:

[tex]A_{ca} = \frac{\alpha\cdot \pi\cdot r^{2}}{360}[/tex] (1)

Where:

[tex]A_{ca}[/tex] - Area of the circle arc.

[tex]\alpha[/tex] - Arc angle, in sexagesimal degrees.

[tex]r[/tex] - Radius.

If we know that [tex]\alpha = 93^{\circ}[/tex] and [tex]r = 11[/tex], then the area of the circle arc is:

[tex]A_{ca} = \frac{93\cdot \pi\cdot 11^{2}}{360}[/tex]

[tex]A_{ca} \approx 98.201[/tex]

Step 2:

The area of the triangle is determined by Heron's formula:

[tex]A_{t} = \sqrt{s\cdot (s-l)\cdot (s-r)^{2}}[/tex] (2)

[tex]s = \frac{l + 2\cdot r}{2}[/tex]

Where:

[tex]A_{t}[/tex] - Area of the triangle.

[tex]r[/tex] - Radius.

[tex]l[/tex] - Length of the line segment PL.

If we know that [tex]l = 16[/tex] and [tex]r = 11[/tex], then the area of the triangle is:

[tex]s = \frac{16+2\cdot (11)}{2}[/tex]

[tex]s = 19[/tex]

[tex]A_{t} = \sqrt{19\cdot (19-16)\cdot (19-11)^{2}}[/tex]

[tex]A_{t} \approx 60.399[/tex]

Step 3:

And the area between the line segment PL and the circle arc PL is:

[tex]A_{s} = A_{ca}-A_{t}[/tex]

[tex]A_{s} = 98.201 - 60.399[/tex]

[tex]A_{s} = 37.802[/tex]

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

look at the image below

Answers

Answer:

201.1 km²

Step-by-step explanation:

Surface area of a sphere= 4πr², where r = radius

so,

4πr²

= 4×π×4²

= 64π

= 201.1 km² (rounded to the nearest tenth)

Im new to this app!
And im looking for help!!
Please help ASAP!!!
Please!!!!

Answers

y=x²-10x-7

a>0 so we will be looking for minimum

x=-b/2a=10/2=5

y=25-50-7=-32

Answer: (5;32)

A car insurance company has determined that6% of all drivers were involved in a car accident last year. If14drivers are randomly selected, what is the probability of getting at most 3 who were involved in a car accidentlast year

Answers

Answer:

[tex]P(x \le 3) = 0.9920[/tex]

Step-by-step explanation:

Given

[tex]p = 6\%[/tex] --- proportion of drivers that had accident

[tex]n = 14[/tex] -- selected drivers

Required

[tex]P(x \le 3)[/tex]

The question is an illustration of binomial probability, and it is calculated using:

[tex]P(x ) = ^nC_x * p^x * (1 - p)^{n-x}[/tex]

So, we have:

[tex]P(x \le 3) = P(x = 0) +P(x = 1) +P(x = 2) +P(x = 3)[/tex]

[tex]P(x=0 ) = ^{14}C_0 * (6\%)^0 * (1 - 6\%)^{14-0} = 0.42052319017[/tex]

[tex]P(x=1 ) = ^{14}C_1 * (6\%)^1 * (1 - 6\%)^{14-1} = 0.37578668057[/tex]

[tex]P(x=2 ) = ^{14}C_2 * (6\%)^2 * (1 - 6\%)^{14-2} = 0.15591149513[/tex]

[tex]P(x=3 ) = ^{14}C_3 * (6\%)^3 * (1 - 6\%)^{14-3} = 0.03980719024[/tex]

So, we have:

[tex]P(x \le 3) = 0.42052319017+0.37578668057+0.15591149513+0.03980719024[/tex]

[tex]P(x \le 3) = 0.99202855611[/tex]

[tex]P(x \le 3) = 0.9920[/tex] -- approximated

The segments shown below could form a triangle.
A
C
7
9
12
B
А
a
A. True
B. False

Answers

Answer:

TRUE

Step-by-step explanation:

I SEEN SOME ONE ELSE WIT 5 STARS SAY SO(:

The given segment can form triangle. Therefore, the given statement is true.

What is triangle?

A polygon has three edges as well as three vertices is called a triangle. It's one of the fundamental geometric shapes. In Euclidean geometry, each and every three points that are not collinear produce a distinct triangle and a distinct plane. In other words, every triangle was contained in a plane, and there is only single plane that encompasses that triangle.

All triangles are enclosed in a single plane if all of geometry is the Euclidean plane, however this is no longer true in higher-dimensional Euclidean spaces. Unless when otherwise specified, this article discusses triangles within Euclidean geometry, namely the Euclidean plane. The given segment can form triangle.

Therefore, the given statement is true.

To know more about triangle, here:

https://brainly.com/question/14712269

#SPJ7

Starting with a fresh bar of soap, you weigh the bar each day after you take a shower. Then you find the regression line for predicting weight from number of days elapsed. The slope of this line will be:__________.

Answers

Answer:

The slope will be negative

Step-by-step explanation:

The slope of the regression line tells us about the relationship or behavior of the dependent and independent variables. In the scenario above, where the weight is being compared with the number of days elapsed. What is expected of the weight and quantity of a bar soap each time it is used for a shower is that it will decrease in weight. Therefore, as the number of days increases, and hence, number of showers rise, the weight of soap will decrease. Hence, we'll obtain a negative slope, one in which the increase in a variable leads to decrease in the other.

The polygons in each pair are similar. Find the missing side length.

Answers

Let missing side be x

If both polygons are similar

[tex]\\ \sf\longmapsto \dfrac{3}{4}=\dfrac{18}{x}[/tex]

[tex]\\ \sf\longmapsto 3x=4(18)[/tex]

[tex]\\ \sf\longmapsto 3x=72[/tex]

[tex]\\ \sf\longmapsto x=\dfrac{72}{3}[/tex]

[tex]\\ \sf\longmapsto x=24[/tex]

A popular beach erodes 4 inches per year on average.

An eroding beach.
A. How many years will it take for the coastline to erode one foot?

Answers

Answer:

3 years

Step-by-step explanation:

4 inches per year on average

1 foot = 12 inches

12 divided by 4 equals 3

therefore it is 3 years

Jack’s backpack weighs 15 pounds. Fernando’s backpack weighs less than Jack’s. Which graph shows how much Fernando’s backpack can weigh?

Answers

Answer:

A

Step-by-step explanation:

c and d out of the question

b has its circle filled in meaning it could be 15lbs, which it's not

A correct answer by default

Answer:b

Step-by-step explanation: it has a filled in diamond which mean it's that...

HELPPPPP ASP PLZZZZZ

Answers

Answer:

[tex](f-g)(x)[/tex]

[tex]f(x)-g(x)[/tex]

[tex]x^{2} -6x-27-x+9[/tex]

[tex]x^{2} -7x-18[/tex]

----------------------

[tex](f*g)(x)[/tex]

[tex]=f(x)g(x)[/tex]

[tex](x^{2} -6x-27)(x-9)[/tex]

[tex]=x^{3} -15x^{2}+27x+243[/tex]

----------------------

[tex]\frac{f}{g} (x)[/tex]

[tex]\frac{x^{2} -6x-27}{x-9}[/tex]

[tex]\frac{(x-9)(x+3)}{x-9}[/tex]

[tex]x+3[/tex]

-----------------------

[tex](f+g)(x)[/tex]

[tex]f(x)+g(x)[/tex]

[tex]=x^{2} -6x-27+x-9[/tex]

[tex]=x^{2} -5x-36[/tex]

------------------------

OAmalOHopeO

------------------------

Paul can install a 300-square-foot hardwood floor in 18 hours. Matt can install the same floor in 22 hours. How long would it take Paul and Matt to install the floor working together?
4 hours
9.9 hours
13.2 hours
30 hours

Answers

Answer:

9.9 hours

Step-by-step explanation:

The formula to determine the time together is

1/a+1/b = 1/c  where a and b are the times alone and c is the time together

1/18 + 1/22 = 1/c

The least common multiply of the denominators is 198c

198c(1/18 + 1/22 = 1/c)

11c+ 9c = 198

20c = 198

Divide by 20

20c/20 =198/20

c =9.9

Answer:

B - 9.9 hrs

Step-by-step explanation:

took the test.

write your answer as an integer or as a decimal rounded to the nearest tenth​

Answers

Answer:

FH ≈ 6.0

Step-by-step explanation:

Using the sine ratio in the right triangle

sin49° = [tex]\frac{opposite}{hypotenuse}[/tex] = [tex]\frac{FH}{FG}[/tex] = [tex]\frac{FH}{8}[/tex] ( multiply both sides by 8 )

8 × sin49° = FH , then

FH ≈ 6.0 ( to the nearest tenth )

Answer:

6

Step-by-step explanation:

sin = opposite/hypotenuse

opposite = sin * hypotenuse

sin (49) = 0,75471

opposite = 0,75471 * 8 = 6,037677 = 6

2(4×+2)=10
[tex]6 \times + 4 = 10 \\ \\ 6 \times = 10 - 4 \\ \\ 6 \times = 6 \\ \\ [/tex]
that is the answer

Answers

Answer:

x = 3/4

Step-by-step explanation:

2(4x + 2) = 10           Remove the brackets

8x + 4 = 10               Subtract 4 from both sides

8x = 6                       Divide by 8

x = 6/8

x = 3/4

Check

2(4*3/4 + 2) =?10

2( 3 + 2) = 10

2*5 = 10

10 = 10

factorize : ( p- q ) cube​

Answers

Answer:

[tex]( {p - q}^{3} ) \\ = {p}^{2} - 3 {p}^{2} q + 3p {q}^{2} - {q}^{3} [/tex]

Hope my answer helped u :)

please helpppp i need it by tonight its very important

Answers

Answer:

m<1=145

m<2=35

m<3=35

Step-by-step explanation:

measure one is supplementary(the angles add to 180) to measure four.

so we do 180-35=145

measure 2 is congruent to measure four because they are corresponding angles

so measure 2=35

and measure 3 is also congruent to measure 4 because the are corresponding angles

so m<3=35

State if the scenario involves a permutation or a combination. Then find the number of possibilities.

A team of 15 basketball players needs to choose two players to refill the water cooler.

Permutation/Combination:

Answer:

Answers

Answer:

Permutation ; 210 ways

Step-by-step explanation:

Permutation and combination methods refers to mathematical solution to finding the number of ways of making selection for a group of objects.

Usually, selection process whereby the order of selection does not matter are being treated using permutation, while those which takes the order of selection into cognizance are calculated using combination.

Here, selecting 2 players from 15 ; since order does not matter, we use permutation ;

Recall :

nPr = n! ÷ (n - r)!

Hence,

15P2 = 15! ÷ (15 - 2)!

15P2 = 15! ÷ 13!

15P2 = (15 * 14) = 210 ways

prove that 2^n+1>(n+2).sin(n)​

Answers

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

Shawn has 4 times as many candies as Jason, who has a third as many candies as
lan. If Shawn has 64 candies, how many candies does Ian have?

Answers

Ian has 48 candies. hope that helps!
Ian has 4 candies...........

According to this diagram, what is tan 62°?
62°
17
18
280
90°
15
O A.
8
17
OB.끝
O c. 1
8
15
D.
15
8
O
E.
17
15
F.
15
17

Answers

Answer:

15/8

Step-by-step explanation:

tan(62)=P/B

tan(62)=15/8

Other Questions
how to address gender based violence How long will it take for a home improvement loan for 22,800to earn interest of 608.00at 8 %ordinary interest The length of a rectangle is 3 times the width. The perimeter of the rectangle is 64 cm. Show the equation that would be used to find the dimensions of the rectangle. What word best describes Friar Lawrence? How far can you travel in 19 hours at 63 mph what was the flaw in sending 1500 soldiers to Cuba? Life before the pandemic El perro se port____. Remember that an inference is information given in a story that is not directly stated by the author, but it is still very important in order to understand a story. Place a checkmark next to each inference the reader needed to make in order to understand "The Cask of Amontillado":Montresor and Fortunato are wearing costumes because it is carnival time.One reason Montresor is wearing a costume is to be sure no one recognizes him when he is walking back to his house with Fortunato.Fortunato was a competitive person because he got jealous when he thought Luchesi was going to taste the Amontillado.Montresor leads Fortunato down into the catacombs where many people were buried.Montresor and Fortunato were down in the catacombs until midnight.Montresor was upset because Fortunato had seriously offended him and wanted revenge.No one ever found Fortunato, who Montresor buried alive down in the catacombs.Montresor kept giving Fortunato wine because he knew he could not resist it and wanted Fortunato to keep following him. Part 1: Name two elements that have the same properties as potassium (K). (4 points)Part 2: Determine the number of protons, electrons, and neutrons present in an atom of magnesium (Mg). Explain how you determined your answer using complete sentences. (6 points) What is the area of this polygon On May 7, Jernigan Company purchased on account 640 units of raw materials at $15 per unit. During May, raw materials were requisitioned for production as follows: 224 units for Job 200 at $13 per unit and 294 units for Job 305 at $15 per unit.Required:Journalize the entry on May 7 Which function is shown in the graph below? Please hurry Im being timed!!! Caroline earns $49000 a year, and her friend Jennifer earns $51000 a year but doesn't belong to a health fund. The tax rule this year is $40000 and above pay $5000 plus 40 cents in the dollar in tax on anything over $40000 per annum and $50000 and above pay $ 9000 plus 30 cents in the dollar in tax on anything over $ 50,000per annum, plus 2% of her income if he is not in a health fund. What was Clarence Gideon forced to do during his burglary trial?A) represent himselfB) flee the stateC) remain silentD) declare his guilt She has visited her grandparents, ___?Select one:a. hasn't sheb. has shec. doesn't shed. does she Question 1 of 10Which phrase best completes the diagram?CORPORATION?PARTNERSHIPControlled byshareholdersLimited life spanO A. Complex regulations to startO B. Liability divided among ownersO C. Owner is free to make all decisionsO D. Few resources to hire employeesSUBMIT What is limiting factor What caused the United States to adopt the policy of containment?a desire to prevent prosperity in GermanySoviet rejection of the Marshall Planthe spread of communism across Europethe spread of communism on several continents How does the image of buddah tend to vary from statue to statue