Answer:
The 95% confidence interval is [tex]0.503 < p < 0.535[/tex]
The interpretation is that there is 95% confidence that the true population proportion lie within the confidence interval
Step-by-step explanation:
From the question we are told that
The sample size is n = 1003
The number that indicated television are a luxury is k = 521
Generally the sample mean is mathematically represented as
[tex]\r p = \frac{k}{n}[/tex]
[tex]\r p = \frac{521}{1003}[/tex]
[tex]\r p = 0.519[/tex]
Given the confidence level is 95% then the level of significance is mathematically evaluated as
[tex]\alpha = 100 - 95[/tex]
[tex]\alpha = 5\%[/tex]
[tex]\alpha = 0.05[/tex]
Next we obtain the critical value of [tex]\frac{ \alpha }{2}[/tex] from the normal distribution table, the value is
[tex]Z_{\frac{\alpha }{2} } = 1.96[/tex]
The margin of error is mathematically represented as
[tex]E = Z_{\frac{\alpha }{2} } * \sqrt{ \frac{\r p (1- \r p )}{n} }[/tex]
=> [tex]E = 1.96 * \sqrt{ \frac{ 0.519 (1- 0.519 )}{1003} }[/tex]
=> [tex]E = 0.016[/tex]
The 95% confidence interval is mathematically represented as
[tex]\r p -E < p < \r p +E[/tex]
=> [tex]0.519 - 0.016 < p < 0.519 + 0.016[/tex]
=> [tex]0.503 < p < 0.535[/tex]
1) At AJ Welding Company they employ 253 people, 108 employees receive 2 weeks of paid 1) _______ vacation each year. Find the ratio of those who receive 2 weeks of paid vacation to those whose paid vacation is not 2 weeks.
Answer:
108 : 145
Step-by-step explanation:
253 - 108 = 145
Ratio of those who receive 2 weeks of paid vacation is 108
Ratio of those paid vacation is not 2 weeks is 145
108 : 145
The age of some lecturers are 42,54,50,54,50,42,46,46,48 and 48 calculate the mean age and standard deviation
Answer:
Mean age: 48
Standard deviation: 4
Step-by-step explanation:
a) Mean
The formula for Mean = Sum of terms/ Number of terms
Number of terms
= 42 + 54 + 50 + 54 + 50 + 42 + 46 + 46 + 48+ 48/ 10
= 480/10
= 48
The mean age is 48
b) Standard deviation
The formula for Standard deviation =
√(x - Mean)²/n
Where n = number of terms
Standard deviation =
√[(42 - 48)² + (54 - 48)² + (50 - 48)² +(54 - 48)² + (50 - 48)² +(42 - 48)² + (46 - 48)² + (46 - 48)² + (48 - 48)² + (48 - 48)² / 10]
= √-6² + 6² + 2² + 6² + 2² + -6² + -2² + -2² + 0² + 0²/10
=√36 + 36 + 4 + 36 + 4 + 36 + 4 + 4 + 0 + 0/ 10
=√160/10
= √16
= 4
The standard deviation of the ages is 4
The owner of a deli gathered data about the number of flavored bagels and plain bagels sold during the first hour of business for several days. He organized the data in a scatter plot, with x representing the number of flavored bagels and y representing the number of plain bagels sold. Then he used a graphing tool to find the equation of the line of best fit: y = 1.731x + 6.697. Based on the line of best fit, approximately how many flavored bagels can the deli expect to sell during an hour when 50 plain bagels are sold?
Answer:
Approximately 25 flavored bagels.
Step-by-step explanation:
The scatter plot is a graph on cartesian plane where;
y-axis represents the number of plain bagels sold.
x-axis representing the number of flavored bagels sold.
The equation of the straight line on the graph is;
y = 1.731x + 6.697
The graph formed is as attached below.
The slope of the graph means that for every 1 flavored bagel sold, 1.731 plain bagels are sold within one hour.
When y = 50 ;
50 = 1.731x + 6.697
x = [tex]\frac{50 - 6.697}{1.731}[/tex] = 25.01617562 ≈ 25 flavored bagels.
Answer:
25
Step-by-step explanation:
Fill in the blanks and explain the pattern.
XA, XB, XC, __,__,__
Answer:
XD,XE,XF
Step-by-step explanation:
XA,XB,XC,XD,XE,XF
IT IS BECAUSE OF THE ALPHABETICAL ORDER AFTER X
Travis has a budget of $300 that he can spend on perennial flowers and at least 6 annual flowers. Perennial flowers are 18 dollars per plant and annual flowers are 15 dollars per plant. Let x be the amount spent on perennial flowers, and let y be the amount spent on annual flowers. What system of inequalities describes this situation?
Answer:
18x + 15y ≤ 300x ≥ 0; y ≥ 6Step-by-step explanation:
Variables are defined in the problem statement.
18x +15y ≤ 300 . . . . total budget
y ≥ 6 . . . . . . . . . . . . minimum number of annuals
x ≥ 0 . . . . . number of perennials cannot be negative
This system of inequalities describes the situation.
Bighorn sheep are beautiful wild animals found throughout the western United States. Data for this problem are based on information taken from The Desert Bighorn, edited by Monson and Sumner 9University of Arizona Press). Let x be the age of a bighorn sheep (in years), and let y be the mortality rate (percent that die) for this age group. For example, x = 1, y = 14 means that 14% of the bighorn sheep between 1 and 2 years old died. A random sample of Arizona bighorn sheep gave the following information:
x 1 2 3 4 5
y 14 18.9 14.4 19.6 20.0
∑x=15 ; ∑y=87.3;∑x2=55; ∑y2=1569.77; ∑xy=275
(a) Draw a scatter diagram.
(b) Find the equation of the least-squares line, and plot the line on the scatter diagram of part (a).
(c) Find the correlation coefficient r. Find the coefficient of determination . What percentage of variation in y is explained by the variation in x and the least squares model?
Answer:
The answer and explanation are below
Step-by-step explanation:
i followed the data that was given in the question.
∑x=15 ; ∑y=87.3;∑x2=55; ∑y2=1569.77; ∑xy=275
a.) please refer to the attachment for the scatter diagram. Y was plotted against X.
b. The equation is given as:
Y = b₁ + b₀X
∑x=15 ; ∑y=87.3;∑x2=55; ∑y2=1569.77; ∑xy=275
b₁ = n∑xy - (∑x)(∑y)/n(∑x²) - (∑x)²
b₁ = 5 x 275 - 15 x 87.3/5 x 55 - (15²)
= 1375-1309.5/275-225
= 65.5/50
= 1.31
b₀ = 87.3/5 - 1.31(15/5)
= 87.3/5 - 1.31x3
= 13.53
the regression line is
Y = 13.53 + 1.31X
please refer to the attachment for the diagram for the regression line.
c. we are required to find r.
r = n∑XY - (∑X)(∑Y)/√n∑X²-(∑X)² × √n∑y²-(∑y)²
∑x=15 ; ∑y=87.3;∑x2=55; ∑y2=1569.77; ∑xy=275
inserting these values:
r = 5 x 275-(15)(87.3)/√275-225 x √7848.85 - 7621.29
= 65.5/106.69
= 0.6139
Coefficient of determination = r²
r = 0.6139
r² = 0.3769 = 37.69%
Therefore 37.69% variation in y is explained by variation in x and the least square model.
Gerbils were used to assess the effect of Natural Neutral, a drug designed to reduce emotionality in high-drive people. Each of 20 gerbils spent 10 solitary minutes in an open field. The investigator recorded the number of fecal boluses for each animal. Then each animal was given an injection of Natural Neutral and the open field task was repeated.
No Drug Drug
mean number of boluse 6 8
standard deviation of boluses 2 2
The design of this study is:______
a. paired samples;
b. independent samples;
c. testing the significance of a correlation;
d. none of the other alternatives are correct.
Answer: a. paired samples;
Step-by-step explanation:
Paired samples are samples in which each data point in one sample is uniquely paired to a data point in the other sample.
Here, we have a paired sample of fecal boluses for gerbils by characterizing then as "No Drug" and "Drug".
hence, the design of this study is paired samples.
So, option A is correct.
NOTE : Independent samples are opposite of paired samples.
Testing the significance of a correlation require to check relation between two variables.
f as a function of x is equal to the square root of quantity 4 x plus 6, g as a function of x is equal to the square root of quantity 4 x minus 6 Find (f + g)(x). x times the square root of 8 4x square root of 8 times x The square root of quantity 4 times x plus 6 plus the square root of quantity 4 times x minus 6
Answer:
Last one
Step-by-step explanation:
The function f is:
● f (x)= √(4x+6)
The function g is:
● g(x) = √(4x-6)
Add them together:
● f+g (x)= √(4x+6 )+ √(4x-6)
Answer:
[tex]\large \boxed{{\sqrt{4x+6} + \sqrt{4x-6} }}[/tex]
Step-by-step explanation:
[tex]f(x)=\sqrt{4x+6}[/tex]
[tex]g(x)=\sqrt{4x-6}[/tex]
[tex](f+g)(x)[/tex]
[tex]f(x)+g(x)[/tex]
Add both functions.
[tex](\sqrt{4x+6} )+ (\sqrt{4x-6} )[/tex]
This table shows a linear relationship.
The slope of the line is ?
Answer:
2
Step-by-step explanation:
2,8 to 4,12 has a rise of 4 and a run of 2.
4/2 = 2
The slope is 2.
Remember rise/run!
Answer:
2
Step-by-step explanation:
We take take two points and use the slope formula
m = (y2-y1)/(x2-x1)
m = (12-8)/(4-2)
= 4/2
= 2
Which relation is a function?
The number two is a function
First rule of function: for each element of A there is one and only one element of B
For example, in the first one -5 is "collegated" to -2 and 3. So this isn't a function.
Naturally, every element of B can have more element of A
HELP PRECALC NEED IN PROOF FORM
Hello, please consider the following.
We know the following, right ?
[tex](\forall a, b \in \mathbb{R}) \left( sin(a+b)=sin(a)sin(b)+cos(a)cos(b) \right)[/tex]
So, here, it gives.
[tex]Asin(\omega t+\phi)=Asin(\phi){\sf \bf sin(\omega t)}+Acos(\phi){\sf \bf cos(\omega t)}\\\\=c_2{\sf \bf sin(\omega t)}+c_1{\sf \bf cos(\omega t)}\\\\\text{ *** where }c_2=Asin(\phi) \text{ and } c_1=Acos(\phi) \text{ ***}[/tex]
Do not hesitate if you need further explanation.
3 1/2 ft into inches
Answer:
42 inches
Step-by-step explanation:
1 ft = 12 inch
Answer:
42 inches.
Step-by-step explanation:
Unit of measurement:
1 foot = 12 inches.
3 ft x 12 inches = 36 inches.
1/2 foot x 12 inches = 12/2 = 6 inches.
36 inches + 6 inches = 42 inches
42 inches is your answer.
~
Which equation is equivalent to 3[x + 3(4x – 5)] = 15x – 24?15x – 15 = 15x – 2415x – 5 = 15x – 2439x – 45 = 15x – 2439x – 15 = 15x – 24?
Answer:
3[x + 3(4x – 5)] = (39x-15)
Step-by-step explanation:
The given expression is : 3[x + 3(4x – 5)]
We need to find the equivalent expression for this given expression. We need to simplify it. Firstly, open the brackets. So,
[tex]3[x + 3(4x -5)]=3[x+12x-15][/tex]
Again open the brackets,
[tex]3[x+12x-15]=3x+36x-45[/tex]
Now adding numbers having variables together. So,
[tex]3[x + 3(4x - 5)]=39x-15[/tex]
So, the equivalent expression of 3[x + 3(4x – 5)] is (39x-15).
Life rating in Greece. Greece has faced a severe economic crisis since the end of 2009. A Gallup poll surveyed 1,000 randomly sampled Greeks in 2011 and found that 25% of them said they would rate their lives poorly enough to be considered "suffering".
a. Describe the population parameter of interest. What is the value of the point estimate of this parameter?
b. Check if the conditions required for constructing a confidence interval based on these data are met.
c. Construct a 95% confidence interval for the proportion of Greeks who are "suffering".
d. Without doing any calculations, describe what would happen to the confidence interval if we decided to use a higher confidence level.
e. Without doing any calculations, describe what would happen to the confidence interval if we used a larger sample.
Answer:
a
The population parameter of interest is the true proportion of Greek who are suffering
While the point estimate of this parameter is proportion of those that would rate their lives poorly enough to be considered "suffering". which is 25%
b
The condition is met
c
The 95% confidence interval is [tex]0.223 < p < 0.277[/tex]
d
If the confidence level is increased which will in turn reduce the level of significance but increase the critical value([tex]Z_{\frac{\alpha }{2} }[/tex]) and this will increase the margin of error( deduced from the formula for margin of error i.e [tex]E \ \alpha \ Z_{\frac{\alpha }{2} }[/tex] ) which will make the confidence interval wider
e
Looking at the formula for margin of error if the we see that if the sample size is increased the margin of error will reduce making the confidence level narrower
Step-by-step explanation:
From the question we are told that
The sample size is n = 1000
The population proportion is [tex]\r p = 0.25[/tex]
Considering question a
The population parameter of interest is the true proportion of Greek who are suffering
While the point estimate of this parameter is proportion of those that would rate their lives poorly enough to be considered "suffering". which is 25%
Considering question b
The condition for constructing a confidence interval is
[tex]n * \r p > 5\ and \ n(1 - \r p ) >5[/tex]
So
[tex]1000 * 0.25 > 5 \ and \ 1000 * (1-0.25 ) > 5[/tex]
[tex]250 > 5 \ and \ 750> 5[/tex]
Hence the condition is met
Considering question c
Given that the confidence level is 95% then the level of significance is mathematically evaluated as
[tex]\alpha = 100 - 95[/tex]
[tex]\alpha = 5 \%[/tex]
[tex]\alpha = 0.05[/tex]
Next we obtain the critical value of [tex]\frac{\alpha }{2}[/tex] from the normal distribution table, the value is
[tex]Z_{\frac{\alpha }{2} } = 1.96[/tex]
Generally the margin of error is mathematically represented as
[tex]E = Z_\frac{ \alpha }{2} * \sqrt{ \frac{\r p (1 - \r p ) }{n} }[/tex]
substituting values
[tex]E = 1.96 * \sqrt{ \frac{ 0.25 (1 - 0.25 ) }{ 1000} }[/tex]
[tex]E = 0.027[/tex]
The 95% confidence interval is mathematically represented as
[tex]\r p - E < p < \r p + E[/tex]
substituting values
[tex]0.25 - 0.027 < p < 0.25 + 0.027[/tex]
substituting values
[tex]0.223 < p < 0.277[/tex]
considering d
If the confidence level is increased which will in turn reduce the level of significance but increase the critical value([tex]Z_{\frac{\alpha }{2} }[/tex]) and this will increase the margin of error( deduced from the formula for margin of error i.e [tex]E \ \alpha \ Z_{\frac{\alpha }{2} }[/tex] ) which will make the confidence interval wider
considering e
Looking at the formula for margin of error if the we see that if the sample size is increased the margin of error will reduce making the confidence level narrower
A taste test asks people from Texas and California which pasta they prefer, brand A or brand B. The table shows the results. A person is randomly selected from those tested. What is the probability that the person is from Texas, given that the person prefers Brand B? PLEASE HELP! I'll name you Brainliest if you're answer is the best!
Answer:
A
Step-by-step explanation:
It would be A because there are 45 people in Texas that prefer brand B. There are 105 people in total that prefer brand B. 45/105 is .42857... so rounded it would be .43, therefore A. I hope this helps.
Answer:
A
Step-by-step explanation:
find the value of x? please help
Answer:
49
Step-by-step explanation:
With these types of problems, you have to subtract the outer and inner values and then divide by 2. So, (125-27)/2 = 49. Hope this helps!
Which equation represents this statement: A number minus 6 is 168? 6 − n = 168 n ÷ 6 = 168 n − 6 = 168 6n = 168
Answer:n-6=168
Step-by-step explanation:
The statement starts with the variable first.
Answer:
n - 6 = 168.
Step-by-step explanation:
Let's say that the value of the number is n.
n minus 6 is 168, so n - 6 = 168.
n - 6 = 168
n = 174.
Hope this helps!
Maxwell Communications paid a dividend of $1.20 last year. Over the next 12 months, the dividend is expected to grow at 13 percent, which is the constant growth rate for the firm (g). The new dividend after 12 months will represent D1. The required rate of return (Ke) is 17 percent. Compute the price of the stock (P0). (Do not round intermediate calculations. Round your answer to 2 decimal places.)
Answer:
The price of the stock is [tex]P_o = \$ 33.9[/tex]
Step-by-step explanation:
From the question we are told that
The dividend is [tex]k = \$ 1.20[/tex]
The expected growth rate is [tex]r = 13\% = 0.13[/tex]
The required rate of return is [tex]K_e = 17 \% = 0.17[/tex]
The new dividend after 12 months is mathematically represented as
[tex]D_1 = k * (1 + r)[/tex]
substituting values
[tex]D_1 = 1.20 * (1 + 0.13)[/tex]
[tex]D_1 = \$ 1.356[/tex]
The price of the stock the price of stock is mathematically represented as
[tex]P_o = \frac{D_1}{ K_e - r }[/tex]
substituting values
[tex]P_o = \frac{ 1.356}{ 0.17 - 0.13 }[/tex]
[tex]P_o = \$ 33.9[/tex]
At a high school movie night, the refreshments stand sells popcorn and soft drinks. Of the 100 students who came to the movie, 62 bought popcorn and 47 bought a drink. 38 students bought both popcorn and a drink. What is the probability that a student buys a drink, given that he or she buys popcorn? Express your answer as a percent, rounded to the nearest tenth... best answer wins brainliest!!!
Answer:
47% and 62%
Step-by-step explanation:
1. Drink
The probability that a student buys a drink is 0.47
Step-by-step explanation:
The probability that a student buys a drink will be given by;
( the number of students who bought a drink)/(the total number of students)
We are told that;
Of the 100 students who came to the movie, 62 bought popcorn and 47 bought a drink. Therefore, the required probability is;
47/100= 0.47
0.47 = 47%
2. Popcorn
For popcorn probability, it's basically the same.
The probabilty that a student buys popcorn is 0.62
The probability that a student buys popcorn will be given by;
( the number of students who bought popcorn)/(the total number of students)
So therefore,
62/100 = 0.62
0.62 = 62%
Randy is walking home from school. According to the diagram above, what is his total distance from school to home? Show your work and include units. If he had a jet pack, would you use distance or displacement? Why?
Answer:
First, when he walks, we can see in the image that between the school and his house he must walk 4 times a distance of 0.5km, so this is a total of 4¨*0.5km = 2km.
Then he needs to walk 2km.
Now if he has a jet-pack, he can ignore the buildings and just take the shorter path, here we can draw a triangle rectangle, in such a way that the hypotenuse of this triangle is the distance between the home and the school.
One of the catheti is the vertical distance (two blocks of 0.5km, so this catheti has a length of 2*0.5km = 1km), and the other one is the horizontal distance, also 1km.
The actual distance of this path is given by the Pythagorean's theorem:
A^2 + B^2 = H^2
Where A and B are the cathetus, and H is the hypotenuse, then:
H^2 = 1km^2 + 1km^2
H = (√2)km = 1.41km.
Now, in the case that he has a jet-pack, he can actually go to the school using this hypotenuse line as his path, in this case the distance and the displacement would be the same.
This is because the definitions of distance and displacement are:
Distance: "how much ground an object has covered"
Displacement: "Difference between the final position and the initial position"
When he walks, the distance is 2km and the displacement is 1.41km , but when he uses the jet pack, the distance is equal to the displacement, both are 1.41km.
Answer and Step-by-step explanation:
The first thing is we can see in the image, when he walks, that between the house and his school he has to walk four times a distance of 0.5 km. The result of this is a total of 4¨*0.5 km = 2 km. The second thing is that he must walk 2 kilometers. On the other hand, if he has a jetpack, he can simply take the shorter path by ignoring all the buildings. This idea is where we can draw a triangular rectangle on the map in a way so that the hypotenuse of the triangle is the distance between the school and the home. As for the Catheti, it is a vertical distance which in this case is two blocks of 0.5 km. The result is that these catheti have a length of 2*0.5 km = 1 km. The other is the distance of the horizontal line, which is 1 km. The absolute distance of this path is given by Pythagorean's theorem, which is A^2 + B^2 = H^2. Here, A and B are the cathetus, and H is the hypotenuse, then, H^2 = 1 km^2 + 1 km^2. As well, H = (√2)km = 1.41 km. Currently, in the situation where he has a jetpack, he can literally fly to the school utilizing this hypotenuse line for the path he would need to follow. For this specific situation, the displacement, and the distance would be the exact same. The reason for this is that the definitions of displacement and distance are displacement is the difference between the final position and the initial position and distance is how much area an item has covered. Also, when he walks, the distance is 2 km and the displacement is 1.41 km. Also, when he utilizes the jet pack, the distance is equal to the displacement. Both of these are 1.41 km.
☆ =
MODULE
The length of a rectangle is eight centimeter less than
twice the width. The area of the rectangle is 24
centimeters squared. Determine the dimensions of the
rectangle in centimeters.
Answer: The length is 4 centimeters and the width is 6 centimeters.
Step-by-step explanation:
If the length of the rectangle is eight centimeters less than twice the width then we could represent it by the equation L= 2w - 8 . And we know that to find the area of a rectangle we multiply the length by the width and they've already given the area so we will represent the width by w since it is unknown.
Now we know the length is 2w- 8 and the width is w so we would multiply them and set them equal to 24.
w(2w-8) = 24
2[tex]w^{2}[/tex] - 8w = 24 subtract 24 from both sides to set the whole equation equal zero and solve. solve using any method. I will solve by factoring.
2[tex]w^{2}[/tex] - 8w -24 = 0 divide each term by 2.
[tex]w^{2}[/tex] - 4w - 12 = 0 Five two numbers that multiply to get -12 and to -4
[tex]w^{2}[/tex] +2w - 6w - 12 = 0 Group the left hand side and factor.
w(w+2) -6( w + 2) = 0 factor out w+2
(w+2)(w-6) = 0 Set them both equal zero.
w + 2 =0 or w - 6 = 0
-2 -2 + 6 +6
w= -2 or w=6
Since we are dealing with distance -2 can't represent a distance so the wide has to 6.
Now it says that the length is 8 less that twice the width.
So 2(6) - 8 = 12 -8 = 4 So the length in this care is 4.
Check.
6 * 4 = 24
24 = 24
What is the volume of a sphere, to the nearest cubic inch, if the radius is 16 inches? Use π = 3.14.
Answer:
vol = 17,148 cu. in.
Step-by-step explanation:
vol = 4 / 3 * pi * r³
vol = 4 / 3 *3.14 * 16³
vol = 17,148 cu. in.
Answer:
The answer is
17149 cubic inchesStep-by-step explanation:
Volume of a sphere is given by
[tex]V = \frac{4}{3} \pi {r}^{3} [/tex]
where r is the radius of the sphere
π = 3.14
From the question
r = 16 inches
Volume of the sphere is
[tex]V = \frac{4}{3} (3.14) {16}^{3} [/tex]
V = 17148.586
We have the final answer as
V = 17149 cubic inches to the nearest cubic inch
Hope this helps you
For what value of x does (x + 3)^2-5=0
Answer:
x = -3±sqrt( 5)
Step-by-step explanation:
(x + 3)^2-5=0
Add 5 to each side
(x + 3)^2-5+5=0+5
(x + 3)^2 = 5
Take the square root of each side
sqrt((x + 3)^2 )=±sqrt( 5)
x+3 = ±sqrt( 5)
Subtract 3 from each side
x+3-3 = -3±sqrt( 5)
x = -3±sqrt( 5)
What is the solution to the system of equations?
5x – 4y = 6
-5x + 4y = -10
O (4,4)
0 (-2,-5)
O infinitely many solutions
O no solution
Hey there! I'm happy to help!
We have a 5x is one equation and a -5x in another equation. We can combine the two equations to cancel out the x and then solve! This is called solving by elimination.
5x-4y=6
+
-5x+4y=-10
0= -4
Since we lost our x and y while solving, there cannot be any solution.
Therefore, the answer is no solution.
Have a wonderful day!
What is the domain of h?
Answer:
{-2, -1, 1, 5, 6}
Step-by-step explanation:
The domain includes the five x-values (inputs): {-2, -1, 1, 5, 6}
Answer:
The x-values -2, -1,1,5 and 6
Step-by-step explanation:
Suppose babies born in a large hospital have a mean weight of 3316 grams, and a standard deviation of 324 grams. If 83 babies are sampled at random from the hospital, what is the probability that the mean weight of the sample babies would differ from the population mean by greater than 54 grams?
Answer: 0.129
Step-by-step explanation:
Let [tex]\overline{X}[/tex] denotes a random variable that represents the mean weight of babies born.
Population mean : [tex]\mu= \text{3316 grams,}[/tex]
Standard deviation: [tex]\text{324 grams}[/tex]
Sample size = 83
Now, the probability that the mean weight of the sample babies would differ from the population mean by greater than 54 grams will be :
[tex]P(|\mu-\overline{X}|>54)=1-P(\dfrac{-54}{\dfrac{324}{\sqrt{83}}}<\dfrac{\overline{X}-\mu}{\dfrac{\sigma}{\sqrt{n}}}<\dfrac{-54}{\dfrac{324}{\sqrt{83}}})\\\\=1-[P(-1.518<Z<1.518)\ \ \ [Z=\dfrac{\overline{X}-\mu}{\dfrac{\sigma}{\sqrt{n}}}]\\\\=1-[P(Z<1.518)-P(z<-1.518)]\\\\=1-[P(Z<1.518)-(1-P(z<1.518))]\\\\=1-[2P(Z<1.518)-1]=2-2P(Z<1.518)\\\\=2-2(0.9355)\ [\text{By z-table}]\\\\=0.129[/tex]
hence, the required probability = 0.129
determine if the following side lengths create an acute,obtuse,or right triangle. a) 20, 21, 28 b) 3, 6, 4 c) 8, 12, 15
Answer:
a) 20, 21, 28 : acute
b) 3, 6, 4 : obtuse
c) 8, 12, 15 : obtuse
Step-by-step explanation:
You can see if a triangle is acute, obtuse, or right using the Pythagorean theorem as follows:
If [tex]a^2+b^2=c^2[/tex] , then the triangle is right.
If [tex]a^2+b^2>c^2[/tex] , then the triangle is acute.
If [tex]a^2+b^2<c^2[/tex] , then the triangle is obtuse.
Solve each to find if the given lengths form an acute, obtuse, or right triangle ( The biggest number is the hypotenuse length, since the hypotenuse is always the longest side in a triangle. This is represented by c):
a) 20, 21, 28
Insert numbers, using 28 as c:
[tex]20^2+21^2[/tex]_[tex]28^2[/tex]
Simplify exponents ([tex]x^2=x*x[/tex]):
[tex]400+441[/tex]_[tex]784[/tex]
Simplify addition:
[tex]841[/tex]_[tex]784[/tex]
Identify relationship:
[tex]841>784[/tex]
The sum of the squares of a and b is greater than the square of c. This triangle is acute.
b) 3, 6, 4
Insert numbers, using 6 as c:
[tex]3^2+4^2[/tex]_[tex]6^2[/tex]
Simplify exponents:
[tex]9+16[/tex]_[tex]36[/tex]
Simplify addition:
[tex]25[/tex]_[tex]36[/tex]
Identify relationship:
[tex]25<36[/tex]
The sum of the squares of a and b is less than the square of c. This triangle is obtuse.
c) 8, 12, 15
Insert numbers, using 15 as c:
[tex]8^2+12^2[/tex]_[tex]15^2[/tex]
Simplify exponents:
[tex]64+144[/tex]_[tex]225[/tex]
Simplify addition:
[tex]208[/tex]_[tex]225[/tex]
Identify relationship:
[tex]208<225[/tex]
The sum of the squares of a and b is less than the square of c. This triangle is obtuse.
:Done.
The correct values are,
a) 20, 21, 28 = Acute
b) 3, 6, 4 = Obtuse
c) 8, 12, 15 = Obtuse
What is mean by Triangle?A triangle is a three sided polygon, which has three vertices and three angles which has the sum 180 degrees.
Given that;
The sides are,
a) 20, 21, 28
b) 3, 6, 4
c) 8, 12, 15
Now,
We know that;
If three sides of a triangle are a, b and c.
Then, We get;
If a² + b² = c², then the triangle is right triangle.
If a² + b² > c², then the triangle is acute triangle.
If a² + b² < c², then the triangle is obtuse triangle.
Here, For option a;
⇒ 20, 21, 28
Clearly, a² + b² = 20² + 21²
= 400 + 441
= 841
And, c² = 28² = 784
Thus, a² + b² > c²
Hence, It shows the acute angle.
For option b;
⇒ 3, 6, 4
Clearly, a² + b² = 3² + 4²
= 9 + 16
= 25
And, c² = 6² = 36
Thus, a² + b² < c²
Hence, It shows the obtuse angle.
For option c;
⇒ 8, 12, 15
Clearly, a² + b² = 8² + 12²
= 64 + 144
= 208
And, c² = 15² = 225
Thus, a² + b² < c²
Hence, It shows the obtuse angle.
Learn more about the triangle visit:
https://brainly.com/question/17335144
#SPJ5
A company finds that the rate at which the quantity of a product that consumers demand changes with respect to price is given by the marginal-demand function Upper D prime (x )equals negative StartFraction 5000 Over x squared EndFraction where x is the price per unit, in dollars. Find the demand function if it is known that 1006 units of the product are demanded by consumers when the price is $5 per unit.
Answer:
q = 5000/x + 6
Step-by-step explanation:
D´= dq/dx = - 5000/x²
dq = -( 5000/x²)*dx
Integrating on both sides of the equation we get:
q = -5000*∫ 1/x²) *dx
q = 5000/x + K in this equation x is the price per unit and q demanded quantity and K integration constant
If when 1006 units are demanded when the rice is 5 then
x = 5 and q = 1006
1006 = 5000/5 +K
1006 - 1000 = K
K = 6
Then the demand function is:
q = 5000/x + 6
If AD=2/3AB, the ratio of the length of BC to the length of DE is A. 1/6 B. 1/4 C. 3/2 D. 3/4
Answer:
The correct answer is c
Step-by-step explanation:
Answer:
C.) 3/2
Explanation:
PLATO
Name:
Unit 1: Geometry Basics
Date:
Per: Homework 3: Distance & Midpoint Formulas
** This is a 2-page document! **
Directions: Find the distance between each pair of points.
1. 1-4.6) and (3.-7)
2. (-6,-5) and (2.0)
M=(-12,-1)
M=
4. (0.-8) and (3.2)
3. (-1, 4) and (1-1)
5.
.
Directions: Find the coordinates of the midpoint of the segment given its endpoints.
6. /15, 8) and B(-1,-4)
7. M(-5,9) and N[-2.7)
8. P(-3,-7) and Q13.-5)
9. F12.-6) and G(-8,5)
Gina Whion (All Things Algobro. LLC) 2014-2017
The midpoint is the point that divide a segment into two equal halves, while the distance between points is the number of units between both points.
The distance between
(1,-4.6) and (3,7) is 11.77(-6,-5) and (2,0) is 9.43(-1, 4) and (1-1) is 5.39(0.-8) and (3,2) is 10.44The coordinate of midpoint of:
(5, 8) and (-1,-4) is (2,2)(-5,9) and (-2,7) is (-.3.5,9)(-3,-7) and (13.-5) is (5,-6)(12,-6) and (-8,5) is (2,-0.5)The distance in a coordinate geometry is calculated using: [tex]d = \sqrt{(x_1 - x_2)^2 + (y_1 - y_2)^2}[/tex].
The distance between points is calculated as follows:
(1,-4.6) and (3,7)
[tex]d = \sqrt{(1 - 3)^2 + (-4.6 - 7)^2}[/tex]
[tex]d = \sqrt{138.56}[/tex]
[tex]d = 11.77[/tex]
(-6,-5) and (2,0)
[tex]d = \sqrt{(-6 - 2)^2 + (-5 - 0)^2}[/tex]
[tex]d = \sqrt{89}[/tex]
[tex]d = 9.43[/tex]
(-1, 4) and (1-1)
[tex]d = \sqrt{(-1 - 1)^2 + (4 - -1)^2}[/tex]
[tex]d = \sqrt{29}[/tex]
[tex]d = 5.39[/tex]
(0.-8) and (3,2)
[tex]d = \sqrt{(0 - 3)^2 + (-8 -2)^2}[/tex]
[tex]d = \sqrt{109}[/tex]
[tex]d = 10.44[/tex]
The midpoint (M) is calculated using: [tex]M = (\frac{x_1 + x_2}{2},\frac{y_1 + y_2}{2})[/tex]
The coordinate of midpoint is calculated as follows:
(5, 8) and (-1,-4)
[tex]M = (\frac{5-1}{2},\frac{8-4}{2})[/tex]
[tex]M = (\frac{4}{2},\frac{4}{2})[/tex]
[tex]M = (2,2)[/tex]
(-5,9) and (-2,7)
[tex]M = (\frac{-5-2}{2},\frac{9+7}{2})[/tex]
[tex]M = (\frac{-7}{2},\frac{16}{2})[/tex]
[tex]M = (-3.5,9)[/tex]
(-3,-7) and (13.-5)
[tex]M = (\frac{-3+13}{2},\frac{-7-5}{2})[/tex]
[tex]M = (\frac{10}{2},\frac{-12}{2})[/tex]
[tex]M = (5,-6)[/tex]
(12,-6) and (-8,5)
[tex]M = (\frac{12-8}{2},\frac{-6+5}{2})[/tex]
[tex]M = (\frac{4}{2},\frac{-1}{2})[/tex]
[tex]M = (2,-0.5)[/tex]
Read more about distance and midpoints in coordinate geometry at:
https://brainly.com/question/3715220
