According the article , why is it difficult for many cities in the U.S today to recycle

Answers

Answer 1

Why recycling isn't working in the U.S.

Many recyclables become contaminated when items are placed in the wrong bin, or when a dirty food container gets into the recycling bin. Contamination can prevent large batches of material from being recycled. Other materials can't be processed in certain facilities.


Related Questions

For each of the environments below: (1) identify your system and surroundings and (2) predict whether it would be endothermic or exothermic.a.Wood burningSystem:Surroundings:Enthalpy Change:b.Water freezingSystem:Surroundings:Enthalpy Change:c.Sweat evaporatingSystem:Surroundings:Enthalpy Change:d.Chemical hand-warmerSystem:Surroundings:Enthalpy Change:

Answers

Answer:

A) Wood burning

system : Wood.

surroundings : atmosphere

Enthalpy : Exothermic

B) Water Freezing system

System : Refrigerator

surroundings :  water in the refrigerator

enthalpy change : Endothermic

C) Sweat evaporating

System :  Human being

surroundings : Air nearby

Enthalpy change : exothermic

D) Chemical Hand-warmer

system : Hand warmer pack

Surroundings : human palms

Enthalpy Change : Exothermic

Explanation:

A) Wood burning

system : Wood

surroundings : atmosphere

Enthalpy : Exothermic

This system give away energy to its surroundings hence its enthalpy change is exothermic

B) Water Freezing system

System : Refrigerator

surroundings :  water in the refrigerator

enthalpy change : Endothermic

The system absorbs heat from what is put inside(surroundings ) of it hence this is na endothermic system

C) Sweat evaporating

System :  Human being

surroundings : Air nearby

Enthalpy change : exothermic

This is an exothermic reaction ( enthalpy change ) because the system gives out heat to the surrounding

D) Chemical Hand-warmer

system : Hand warmer pack

Surroundings : human palms

Enthalpy Change : Exothermic

There is movement of heat from the system to the surrounding hence it is an exothermic reaction

What happens if more solute is added to a saturated solution?

Answers

Answer:

A saturated solution is a mixture in which the maximum amount of a given solute has been dissolved into the solvent. ... At this point adding more solute will not change the concentration of the solution; adding more solute will simply result in more solid at the bottom of the solution.

Answer:

will not change

Explanation:

A saturated solution is a mixture in which the maximum amount of a given solute has been dissolved into the solvent. ... At this point adding more solute will not change the concentration of the solution; adding more solute will simply result in more solid at the bottom of the solution.

how is acid different from base​

Answers

Hehsnsgx d she. Wayy buy is s
As

Two elevators carry five passengers to the fifth floor. However, the elevators do not do the same work. Choose the best factor for
determining the amount of work the elevators did.
A.the speed of the elevator
B.the weight of the passengers
C.the number of buttons pressed
Will mark brainlist pls help!

Answers

Answer:

B the weight of the passengers

1. What organ system is responsible for controlling all of the body
functions?

Answers

Answer:

The human brain is the body's control center, receiving and sending signals to other organs through the nervous system and through secreted hormones. It is responsible for our thoughts, feelings, memory storage and general perception of the world. The human heart is a responsible for pumping blood throughout our body

LEVEL 3
Write the correct order
of letters to the finish line.
A E B E C
Example:
ABCGH
G
H
N
eza


Not correct

Answers

ANSWER - AEGHNZ (is that right?
look this is on quizlet

Atoms in the same GROUP have the same...

A . Size
B. Temperature
C. Number of energy levels
D. Reactivity

Answers

Answer:

reactivity

Explanation:

for example atoms in group 7 react by gaining 1 electron to become stable but they do not have the same number of energy levels

What process is represented by this redox equation?
C6H12O6 + 602 -> 6H20 + 6CO2

A. Rusting
B. Photosynthesis
C. Cellular respiration
D. Combustion

Answers

The redox equation C6H12O6 + 6O2 -> 6H2O + 6CO2 represents the process of cellular respiration. Option C

Cellular respiration is a biochemical process that occurs in living organisms, including plants and animals, to convert organic compounds, such as glucose (C6H12O6), into usable energy in the form of adenosine triphosphate (ATP). It is the primary process by which cells derive energy to carry out their functions.

In the given equation, glucose (C6H12O6) is being oxidized, losing electrons, and releasing carbon dioxide (CO2) as a byproduct. This oxidation process results in the production of energy-rich molecules, such as ATP.

Additionally, oxygen (O2) is being reduced, accepting the electrons from glucose and combining with hydrogen (H) to form water (H2O). This reduction process allows for the transfer of electrons and the generation of energy.

The process of cellular respiration is essential for the survival and functioning of organisms, as it provides the necessary energy for various metabolic activities, growth, and maintenance of cellular processes.

It is a fundamental metabolic pathway found in both plants and animals, enabling them to extract energy from organic molecules through the oxidation of glucose or other fuel sources.

Therefore, option C, cellular respiration, is the correct answer that represents the process described by the given redox equation.

For more such questions on redox equation visit:

https://brainly.com/question/21851295

#SPJ8

What are the products of the balanced equation for the combustion of C8H17OH ?
A. 2C4H8(g)+H2O(l)
B. C8H17(s)+NaOH(aq)
C. 8CO2(g)+9H2O(l)
D. 8O2(g)+9H2O(l)

Answers

C8H17OH + 12O2 —> 8CO2 + 9H2O

From these four cycles which are water cycle, carbon cycle, nitrogen cycle, and phosphorus cycle which cycle has more nutrients

Answers

Answer:

Nitrogen cycle

Explanation:

DUE IN 1 MINUTE HELP I'M DESPERATE

Answers

I believe the answer is A.
The answer will be a

how many moles of ammonia can be formed from 4.0 mol H2

how many moles of hydrogen are required to form 8.0 mol NH3

how many moles of nitrogen are required to react with 6.0 mol H2

Answers

Answer: 1. 2.7 moles  of ammonia are formed

2. 12.0 moles  of hydrogen are required

3. 2.0 moles of nitrogen are required

Explanation:

The balanced chemical equation is:

[tex]N_2+3H_2\rightarrow 2NH_3[/tex]

According to stoichiometry:

3 moles of hydrogen form = 2 moles of ammonia

Thus 4.0 moles of hydrogen form =[tex]\frac{2}{3}\times 4.0=2.7moles[/tex] of ammonia

According to stoichiometry:

2 moles of ammonia are formed by = 3 moles of hydrogen

Thus 8.0 moles of ammonia are formed by  =[tex]\frac{3}{2}\times 8.0=12.0moles[/tex] of hydrogen

According to stoichiometry:

3 moles of hydrogen react with = 1 mole of nitrogen

Thus 6.0 moles of hydrogen react with =[tex]\frac{1}{3}\times 6.0=2.0moles[/tex] of nitrogen

Electricity is possible because atoms release and absorb which sub-atomic particle?

Answers

Answer:

Electrons

Electric charge is carried by subatomic particles such as electrons and protons, which can be created and destroyed. For example, when particles are destroyed, equal numbers of positive and negative charges are destroyed, keeping the net amount of charge unchanged.

Identify the Lewis acid in this balanced equation: SnCl4 + 2Cl− → SnCl62−

Answers

Answer:

The answer is SnCI4.

Explanation:

Answer:

it is a

cause it is and cause i'm right

when 70.0 grams of mno2 reacted with 128.0 grams of hcl, the reaction resulted in a 62.7% yield of chlorine gas. what is the actual yield of chlorine gas in grams? Mno2 + HCI —> MnCl2 + h2o + cl2​

Answers

Answer:

35.8g of Cl₂ is the yield

Explanation:

Based on the reaction:

MnO₂ + 4HCl → MnCl₂ + 2H₂O + Cl₂

1 mole of MnO₂ and 4 moles of HCl react producing 1 mole of Cl₂

To solve this question we must find limiting reactant. with limiting reactant we can find the theoretical yield of Cl₂. As the actual yield is the 62.7% we can find actual yield of Cl₂ in grams:

Moles MnO₂ -Molar mass: 86.9368g/mol-:

70.0g * (1mol / 86.9368g) = 0.805 moles

Moles HCl -Molar mass: 36.46g/mol-:

128.0g * (1mol / 36.46g) = 3.51 moles

For a complete reaction of 3.51 moles of HCl are required:

3.51 moles HCl * (1mol MnO₂ / 4mol HCl) = 0.878 moles MnO₂.

As there are just 0.805 moles of MnO₂, MnO₂ is limiting reactant.

1 mole of MnO₂ produce 1 mole of Cl₂. The theoretical moles of Cl₂ produced are 0.805 moles.

As the yield is of 62.7%, the yield of Cl₂ is:

0.805 moles * (62.7 / 100) = 0.505 moles Cl₂. In grams:

0.505 moles Cl₂ * (70.906g / mol) =

35.8g of Cl₂ is the yield

The sky on Earth is blue because blue light is scattered through the atmosphere as the other colors of light pass
through undisturbed. Which nebulae have something similar happening?
Emission nebulae
Dark nebulae
Reflection nebulae
Planetary nebulae

Answers

Answer:

C

Explanation:

A neutron is a negatively-charged particle in the atom. true or false

Answers

Answer: true

Explanation:

A percent composition analysis yields
22.6% phosphorus (P) and 77.4%
chlorine (CI). What is the empirical
formula for the compound?
А
B
P2C17
PCI:

Answers

Answer:

PCl₃

Explanation:

To determine the empirical formula of a compound, we need to follow a series of steps.

Step 1: Divide each percent composition by the atomic mass of the element

P: 22.6/30.97 = 0.729

Cl: 77.4/35.45 = 2.18

Step 2: Divide all the numbers by the smallest one, i.e. 0.729

P: 0.729/0.729 = 1

Cl: 2.18/0.729 ≈ 3

The empirical formula of the compound is PCl₃.

Write a balanced net ionic equation.
Na3PO4(aq) + FeCl3(aq) = NaCl(aq) + FePO4(s)

Answers

Explanation:

Na3PO4+ FeCl3 = 3NaCl + FePO4

Hope it will help :)❤

The net ionic equation is found to be balanced by both mass and charge. There are equal masses of each element on the product and reactant sides in a balanced net ionic equation.

What is a net ionic equation?

A chemical equation which shows only those elements, compounds, and ions which are directly involved in the chemical reaction is defined as the net ionic equation. The net ionic equation give us information about the ions that exists in aqueous medium.

A net ionic equation does not consider the spectator ions. The ions which do not participate in chemical reactions and are seen on both sides of the reactions are called spectator ions.

The complete ionic equation for the given reaction is:

3Na⁺ (aq) + PO₄³⁻ (aq) + Fe³⁺ (aq) + 3Cl⁻ (aq) → 3Na⁺ (aq) + 3Cl⁻ (aq) + FePO₄ (s)

The net ionic equation is:

PO₄³⁻ (aq) + Fe³⁺ (aq) → FePO₄ (s)

To know more about net ionic equation, visit;

https://brainly.com/question/29299745

#SPJ2

what do protons determine about an element

Answers

The number of protons in an atoms determines the atoms identity. Electrons determine the electrical charge.

Answer:

The number of protons in one atom of an element determines the atom's identity, and the number of electrons determines its electrical charge. The atomic number tells you the number of protons in one atom of an element. It also tells you the number of electrons in a neutral atom of that element.

Explanation:

An organic compound which has the empirical formula CHO has an approximate
molar mass of 145 g/mol. What is its probable molecular formula?

Answers

Answer:

Molecular formula => C₅H₅O₅

Explanation:

From the question given above, the following data were obtained:

Empirical formula = CHO

molar mass of compound = 145 g/mol

Molecular formula =?

The molecular formula of the compound can be obtained as follow:

Molecular formula = Empirical formula × n

Molecular formula = [CHO]ₙ

[CHO]ₙ = 145

[12 + 1 + 16]n = 145

29n = 145

Divide both side by 29

n = 145 / 29

n = 5

Molecular formula = [CHO]ₙ

Molecular formula = [CHO]₅

Molecular formula => C₅H₅O₅

Investigation Question: How do organisms get their genes?
THIS ANSWER SHOULD BE 3 OR MORE SENTENCES.

Answers

Answer:

from the chromosome..l dont know

Genetic information is passed from generation to generation through inherited units of chemical information (in most cases, genes). Organisms produce other similar organisms through sexual reproduction, which allows the line of genetic material to be maintained and generations to be linked.

How does photosynthesis happen? (Also can anyone Pay Pal me 2 more dollars for school supplies.

Answers

Explanation:

make me brainy least pkz

.50 ml of a solution are diluted to a volume of 100 ml. The concentration of the diluted
solution is 2 M. What was the concentration of the original solution?


pls answer asap! will mark as brainly ist!!

Answers

Answer:

4 M

Explanation:

To answer this problem we can use the following formula:

V₁C₁ = V₂C₂

Where the subscript 1 refers to the volume and concentration before diluting, and 2 refers to volume and concentration after diluting.

Meaning that in this case we can write:

50 mL * C₁ = 100 mL * 2 M

We can now solve for C₁:

C₁ = 4 M

#7 which of the following decreases the rate of solubility of solid molecules in a solution?

Answers

Answer:

7. Option D

Explanation:

Solubility increases with the increase in temperature of the solution. It is so because the increase in temperature leads to increase in kinetic energy which then breaks the solute particles held together by intermolecular attractions.

Hence, option D is correct

In that question how( b) are enantiomers? I want the steps pleas ?

Answers

Answers:

1. firstly Start numbering from that carbon atom which would be nearest to chlorine .

2. then if u observed properly , both chlorine is attached are attached to 2nd carbon atom.

3.but in first one chlorine is on the left side

whereas in the second one chlorine right side.

p.s:

1. well, were u have number carbon three in above pic take it as C1 than C2( if u observed it is were Cl is attached to C2 ) than C3 ,C4.

2. Then similarly in second molecules where u have number C3 in above pic take it as C1 than C2 (if u observed , again Cl is attached to C2 but this time it is one on opposite sides.

now imagine if u kept first molecules on second one.

matching C1 C2 C3 C4 of first molecules with

C1 C2 C3 C4 of second molecule .

u will observed that in both of them Cl is on C2 but they in exactly opposite position

Explanation:

Enantiomers are a pair of molecules that exist in two forms that are mirror images of one another but cannot be superimposed one upon the other.

What are the two types of bonding we have studied?

a. Metallic and covalent

b. Covalent and ionic

c. lonic and metallic

d. Molecular and metallic

Answers

Covalent and ionic.

Please help me l don’t understand please !!!!!!

Answers

Answer: C

Explanation:

he never had evidence in the first place that was nearly enough.

4
In the Hatom , what is the correct order (arrangement) of energy levels​

Answers

I believe you mean atom? 1s 2s 2p 3s 3p
This is the correct order of energy levels 1s<2s=2p<3s=3p=3d<4s=4p=4d=4f<5s=5p=5d=5f
Other Questions
Can someone plz help me with this I need to get an 92 choose all that apply You are dealt one card from a standard 52-card deck. Find the probability of being dealt a picture card. VERY EASY, WILL GIVE 50 POINTS FOR CORRECT ANSWER ASAP AND WILL GIVE BRAINLIEST. 6v=-9 v= what does v = yea..... can sum1 help me pls The Bretton Woods system came into being right after WWI True False What group in the U.S. was most agreeable toward socialism? F Labor activists G Factory owners H Wealthy people I Political officeholders I need help with this please lol the moon's mass is ____? Don't guess!I will mark brainliest if its correct!Don't answer if you don't know!Also no links! What is the mode of the set of data points given below? 1 15 12 6 12 9 12 3 6 12 15 9 15 12 15 PLEASE HELP!!!!!!!How might capitalism have helped end slavery? How did this connect to production and distribution during the Industrial Revolution? HELP DUE IN 10 MINUTES Write each expression as an algebraic (nontrigonometric) expression in u, u > 0.sin(2sec^-1 u/10) C2H5OH(l)+3O2(g)2CO2(g)+3H2O(g)If 9.2g of C2H5OH(l) burns completely in the presence of excess O2(g) according to the equation, how many grams of CO2(g) are produced?A:0.40gB:8.8gC:9.2gD:18g Suppose you are working as an administrative assistant at a small law firm. Your boss has asked you to send an invitation out to all employees about the upcoming holiday party. You would like to spruce up the invitation with a few festive images and a fancy border. Which file format would allow you to create a visually appealing invitation that can easily be e-mailed?JPEGPDFSVGTIFF What is role of the enzyme telomerase is to A chemist mixed two samples together: a gray liquid that boils at 103C and a colorless gas that boils at 19C. She analyzed the results and found two ending substances. One of the ending substances was a pink liquid. This ending substance is made up of the repeating group of atoms shown above. Which of the diagrams to the left shows the repeating groups of atoms that make up the samples the chemist mixed together? The hurricane's storm_____causes most of the storm's damage. Please answer this is my last few points