An atom has 6 protons and 9 neutrons in its nucleus. Calculate the mass number of the atom​

Answer:

All of the above.

Explanation:

For a scientific hypothesis to be considered a hypothesis, it has to be testable. When conducting a lab experiment, it also allows the tester to predict what might occur during and after the experimentation. They are also explanatory. For example, theories are hypotheses that have been verified and can explain why something in nature takes place.

molarity = moles of solute / volume of solution

moles of solute = molarity × volume of solution

moles of solute = 0.245 mol/L × 0.1500 L

moles of solute = 0.03675 mol

moles of solute = 0.0368 mol

-----------------------------------------------------------

Step 1: Calculate the molar mass of solute.

molar mass of solute = (40.08 g/mol × 1) + (35.45 g/mol × 2)

molar mass of solute = 110.98 g/mol

Step 2: Calculate the mass of solute.

mass of solute = moles of solute × molar mass of solute

mass of solute = 0.03675 mol × 110.98 g/mol

mass of solute = 4.08 g

Note: The volume of solution must be expressed in liters (L).

Answer:

[tex]\boxed {\sf \bold {0.0368 \ mol \ CaCl_2}}}}[/tex]

[tex]\boxed {\sf \bold {4.08 \ g \ CaCl_2}}}}}[/tex]

Explanation:

Molarity is a measure of concentration in moles per liter.

[tex]molarity= \frac {moles \ of \ solute}{liters \ of \ solution}[/tex]

In this solution, there are 150.0 milliliters of solution and the molarity is 0.245 M CaCl₂ or 0.245 mol CaCl₂ per liter.

First, convert the milliliters to liters. There are 1000 milliliters in 1 liter.

Now, substitute the known values (molarity and liters of solution) into the formula. The moles of solution are unknown, so we can use x.

[tex]0.245 \ mol \ CaCl_2 /L= \frac{ x}{0.150 \ L}[/tex]

We are solving for x, so we must isolate this variable. It is being divided by 0.150 L. The inverse of divisions is multiplication, so we multiply both sides by 0.150 L.

[tex]0.150 \ L *0.245 \ mol \ CaCl_2 /L= \frac{ x}{0.150 \ L} * 0.150 L[/tex]

[tex]0.150 \ L *0.245 \ mol \ CaCl_2 /L=x[/tex]

The units of liters cancel.

[tex]0.150 *0.245 \ mol \ CaCl_2 =x[/tex]

[tex]0.03675 \ mol \ CaCl_2[/tex]

The original measurements have 3 significant figures, so our answer must have the same.

We should round to the ten thousandths place. The 5 to the right of this place tells us to round the 7 up to an 8.

[tex]\bold {0.0368 \ mol \ CaCl_2}[/tex]

We can convert mass to moles using the molar mass. These values are found on the Periodic Table. They are the same as the atomic masses, but the units are grams per mole (g/mol) instead of atomic mass units.

The solute is calcium chloride: CaCl₂. Look up the molar masses of the individual elements.

Notice that chlorine has a subscript of 2. We must multiply the molar mass by 2.

Add calcium's molar mass.

Use the molar mass as a ratio.

[tex]\frac {110.98 \ g\ CaCL_2}{ 1 \ mol \ CaCl_2}[/tex]

Multiply the moles of calcium chloride we calculated above.

[tex]0.0368 \ mol \ CaCl_2 *\frac {110.98 \ g\ CaCL_2}{ 1 \ mol \ CaCl_2}[/tex]

The units of moles of calcium chloride cancel.

[tex]0.0368 *\frac {110.98 \ g\ CaCL_2}{ 1 }[/tex]

[tex]4.084064 \ g\ CaCl_2[/tex]

Round to 3 significant figures again. For this number, it is the hundredths place. The 4 in the thousandths place tells us to leave the 8.

[tex]\bold {4.08 \ g \ CaCl_2}[/tex]

Explanation:

Esterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.

Answer:

The Esterification ProcessEsterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.

The Esterification ProcessEsterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.Once the -OH has been removed, the hydrogen on the alcohol can be removed and that oxygen can be connected to the carbon. Because the oxygen was already connected to a carbon, it is now connected to a carbon on both sides, and an ester is formed.

The Esterification ProcessEsterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.Once the -OH has been removed, the hydrogen on the alcohol can be removed and that oxygen can be connected to the carbon. Because the oxygen was already connected to a carbon, it is now connected to a carbon on both sides, and an ester is formed.The methyl acetate that was formed is an ester. In this image, the green circle represents what was the carboxylic acid (in this case acetic acid), and the red circle represents what was the alcohol (in this case methanol):

This reaction lost an -OH from the carboxylic acid and a hydrogen from the alcohol. These two also combine to form water. So any esterification reaction will also form water as a side product.

Answer:

it's atomic number is 5 and total number is 10

The atom has an atomic number of 20 and has a total of 12 p electrons.

The azimuthal quantum number (l) of the 19th electron is 0 and the magnetic quantum number (m) of the 19th electron is 0.

It is an element of group 2

The number of electrons in the neutral atom is equal to the number of protons and is also the atomic number of an atom.

An atom is known to be electrically neutral. This is because the number of electrons in the atom is equal to the number of protons in the neutral atom.

The number of protons in the neutral atom is called the atomic number of the atom.

For an element that has 20 electrons, its electronic configuration is;

1s2 2s2 2p6 3s2 3p6 4s2.

The 19th electron is in the 4s orbital hence both the azimuthal and magnetic quantum numbers are zero.

The element has outermost electron configuration ns2 so it mus belong to group 2 of the periodic table.

https://brainly.com/question/16979660

Answer:

#6  8.67x10²⁴ atoms

#7  

1. Atom

2. Formula unit

3. Molecule

4. Ion

Explanation:

#6 First we calculate how many carbon moles are there in 7.00 moles of C₂F₂, keeping in mind that there are 2 C moles per C₂F₂ mol:

As for carbon dioxide, there are 0.400 C moles in 0.400 moles of CO₂.

We calculate the total number of C moles:

Finally we calculate the number of atoms in 14.4 C moles, using Avogadro's number:

#7

Answer:

0.74 M

Explanation:

From the question given above, the following data were obtained:

Molarity of stock solution (M₁) = 5.90 M

Volume of stock solution (V₁) = 0.250 L

Volume of diluted solution (V₂) = 2 L

Molarity of diluted solution (M₂) =?

The molarity of the diluted solution can be obtained by using the dilution formula as illustrated below:

M₁V₁ = M₂V₂

5.90 × 0.250 = M₂ × 2

1.475 = M₂ × 2

Divide both side by 2

M₂ = 1.475 / 2

M₂ = 0.74 M

Thus, the molarity of the diluted solution is 0.74 M

Answer:

Melting-point apparatus

Answer:

the product and the reactant must be balanced

if u are required to give the mechanism if the reaction it must be written

The question is incomplete, the complete question his;

Which straight chain alkane below would you predict to be the most viscous? Why? All are liquids exhibiting the general bonding pattern CH3-(CH2)n-CH3

C9H20

C10H22

C5H12

C6H14

C12H26

Answer:

C12H26

Explanation:

Generally, the viscosity of a liquid increases with increase in molecular mass of the substance.

Liquids of high molecular mass do not flow easily. This means that they posses high viscosity.

Thus, since C12H26 has the highest molecular mass among the options given in the question, C12H26 exhibits the greatest viscosity.

Answer:

True.

Explanation:

The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.

Answer:

At higher temperatures, particles move faster and collide more, increasing solubility rates.

Agitation increases solubility rates as well, by bringing fresh solvent into contact with the undissolved solute

The smaller the particle size, the higher (faster) solubility rate. Vice versa, the bigger the particle size, the lower (slower) solubility rate.

Explanation:

Answer:

C₃H₆O₃

Explanation:

To solve this question we need to find, as first, the moles of each atom in order to find empirical formula (Simplest whole-number ratio of atoms present in a molecule).

With the molar mass of the substance and the empirical formula we can find the molecular formula as follows:

Moles C -Molar mass:12.0g/mol-

0.24g * (1mol/12.0g) = 0.020 moles C

Moles H = Mass H because molar mass = 1g/mol:

0.040 moles H

Moles O -Molar mass: 16g/mol-

Mass O: 0.60g - 0.24g - 0.040g = 0.32g O

0.32g O * (1mol/16g) = 0.020 moles O

Ratio of atoms (Dividing in moles of C: Lower number of moles):

C = 0.020 moles C / 0.020 moles C = 1

H = 0.040 moles H / 0.020 moles C = 2

O = 0.020 moles O / 0.020 moles C = 1

Empirical formula:

CH₂O.

Molar mass CH2O:

12g/mol + 2*1g/mol + 16g/mol = 30g/mol

As molecular formula has a molar mass 3 times higher than empirical formula, the molecular formula is 3 times empirical formula:

The molecular formula of the organic acid would be C3H6O3

Molecular formula = [empirical formula]n

Where n = molar mass/mass of empirical formula

Empirical formula

C = 0.24/12 = 0.02

H = 0.040/1 = 0.04

O = 0.6 - (0.24+0.04) = 0.32/16 = 0.02

Divide by the smallest

C = 1

H = 2

O = 1

Empirical formula = CH2O

Empirical formula mass = 12 + 2 + 16 = 30

n = 90/30 = 3

Molecular formula = [CH2O]3

                               = C3H6O3

More on molecular formula can be found here: https://brainly.com/question/1247523

Answer:

The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.

The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.

Answer:

To transfer leftover solids to the filtration funnel and wash out crystals after recrystallization, ice cold methanol should be used (the mother liquor used for recrystallization).

Explanation:

Hope this helped

Answer:

the change in the internal energy of the system is 3,752.67 J

Explanation:

Given;

initial volume of the gas, V₁ = 30.6 L

final volume of the gas, V₂ = 1.8 L

constant pressure of the gas, P = 1.8 atm

Energy released by the system, Q = 1.5 kJ = 1,500 J

Apply pressure-volume work equation, to determine the work done on the gas;

w = -PΔV

w = -P(V₂ - V₁)

w = - 1.8 atm(1.8 L - 30.6 L)

w = 51.84 L.atm

w = 51.84 L.atm x 101.325 J/L.atm

w = 5,252.67 J

The change in the internal energy of the system is calculated as;

ΔU = Q + w

Since the heat is given out, Q = - 1,500 J

ΔU = -1,500 J  +  5,252.67 J

ΔU = 3,752.67 J

Therefore, the change in the internal energy of the system is 3,752.67 J

Answer:

i have no answer for part A

part B

the one that has a 4 can be divided by 2 because reducing

part c

you can determine if an equation is written in the correct way by balancing the equation as if it had not been done already.

Answer:

I) 1 mol of SO3(g)

2) 1 mol of CO2(g)

3) 3 mol of O2(g)

4) 1 mol of KBr(aq)

5) Seawater at 23°C

6) 1 mol of CCl4(g)

Explanation:

In molecules having greater numbers of atoms, there is an increase the number of ways by which the molecule vibrates thereby leading to a higher number of possible microstates and overall increase in entropy of the system. Hence, 1 mol of SO3(g) has a higher entropy than 1 mol of SO2.

Gases have a higher entropy than liquids and liquids have a higher entropy than gases.

Also, the greater the molecular weight of a molecule, the higher the entropy. Higher number of moles of a gas as well as the increase in temperature of a substance are also factors that lead to higher entropy.

Answer:

1. not enough dye was added to the drink.

The wrong dye was added to the drink

the water in the drink is evaporating

2. Changing the compound changes the absorbance behavior.

3. Measure the absorbance for the same solution in different cuvette sizes and find the y-intercept.

Explanation:

When the beverage company adds dye to the drink, there should be standard quantity added to the drink so that the color of the drink remains constant. When too much dye is added to the drink, the color will get dark brown or black. When the color of drink get lighter than green this means dye is not added in required quantity.

Answer:

True

Explanation:

The valence orbitals of boron are 2s2 2p1. We have to recall that all the valence orbitals whether full or empty are involved in the formation of molecular orbitals.

The number of molecular orbitals formed is equal to the number of atomic orbitals that are combined.

Since there are two valence orbitals and there is only one p orbital among the valence orbitals, it is true that only one p orbital is needed to form molecular orbitals in boron.

Answer:

9.36 g

Explanation:

The equation of the reaction is;

C8H18(g) + 25/2 O2(g) ----> 8CO2(g) + 9H2O(g)

Number of moles of octane = 10.3g/ 114 g/mol = 0.09 moles

1 mole of octane yields 9 moles of water

0.09 moles of octane yields 0.09 × 9/1 = 0.81 moles of water

Number of moles of oxygen = 23g/32g/mol = 0.72 moles

12.5 moles of oxygen yields 9 moles of water

0.72 moles of oxygen yields 0.72 × 9/12.5 = 0.52 moles of water

Hence oxygen is the limiting reactant;

Maximum mass of water produced = 0.52 moles of water × 18 g/mol = 9.36 g

Answer:

e. HCOOH and NaCHOO

Explanation:

For a buffer solution, both an acid and its conjugate base are required.

With the information above in mind, we can discard options a) and c), as those combinations are not of an acid and its conjugate base.

Now it is a matter of comparing the pKa (found in literature tables) of the acids of the remaining three acids:

The acid with the pKa closest to the desired pH is HCOOH, so the correct answer is e. HCOOH and NaCHOO

Answer:

6.52g = Actual yield (g)

Explanation:

The yield of a reaction is:

Percent yield = Actual yield (g) / Theoretical Yield (g) * 100

As 1 mol of isopentyl alcohol produce 1 mol of isopentyl acetate (Theoretical Yield), the theroretical yield of isopentyl acetate is 65.0mmol = 0.0650mol. To solve this question we need to convert the moles of isopentyl acetate to mass using its molar mass (130.19g/mol).

With the equation of percent yield we can find the mass obtained as follows:

Theoretical yield:

0.0650mol * (130.19g/mol) = 8.46g of isopentyl alcohol

Mass produced:

77 = Actual yield (g) / 8.462g * 100

6.52g = Actual yield (g)

The mass of isopentyl acetate that can be produced is 6.52 g

See attached photo

From the balanced equation,

1 mole of isopentyl alcohol reacted to produce 1 mole of isopentyl acetate.

Therefore,

65 mmole (i.e 0.065 mole) of isopentyl alcohol will also react to produce 0.065 mole of isopentyl acetate.

Actual yield = percent × theoretical

Actual yield = 77% × 0.065

Actual yield = 0.05005 mole

Mass = mole × molar mass

Mass of isopentyl acetate = 0.05005 × 130.19

Mass of isopentyl acetate = 6.52 g

Learn more about stoichiometry:

https://brainly.com/question/14735801

Answer:

The lone pairs on nitrogen in dimethylacetamide reside in sp3 orbitals which are coplanar with the methyl groups

Explanation:

The compound dimethylacetamide consists of oxygen bearing two lone pairs of electrons and a nitrogen atom bearing a lone pair of electrons and has two methyl groups attached to the nitrogen atom.

The lone pair on the nitrogen atom is accommodated in an sp3 orbital of nitrogen as shown in the question. This sp3 orbital is coplanar with the two methyl groups.

Answer:

Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol

Explanation:

According to IUPAC rules, the name of a compound is:

Prefix+root word+suffix

1) Select the longest carbon chain and it gives the root word.

2) The substituents give the prefix.

3) The functional group gives the secondary suffix and the type of carbon chain gives the primary suffix.

The structure of the given compounds are shown below:

Answer:

Benzoic acid= 37.16%

Naphthalene = 24.43%

3-Nitroaniline= 29.38%

Explanation:

Data given:

percentage recovery of benzonic acid = 9.75/26.24 * 100 = 37.16%

Percentage recovery of napthalene = 6.41/26.24 * 100 = 24.43%

Percentage recovery of 3-nitroaniline = 7.71/26.24 * 100 = 29.38%