An ice freezer behind a restaurant has a freon leak, releasing 47.97 g of C2H2F3Cl into the air every week. If the leak is not fixed, how many kilograms of fluorine will be released into the air over 6 months

Answers

Answer 1

Answer:

0.554 kg

Explanation:

We want to find the amount of kilograms of fluorine that will be released into the air over 6 months.

Let's convert to weeks to get;

6 × 4 = 24 weeks

Let's find Mass leak rate of fluorine from the formula;

Mass leak rate = (fluorine mass in freon/molar mass of freon) × leak rate

Molar mass of freon = ((12 × 2) + (1 × 2) + (19 × 3) + (35.5)) = 118.5 g/mol

Thus;

Mass leak rate = ((19 × 3)/(118.5)) × 47.97 = 23.074 g/week

Total fluorine leaked in 6 months = 24 × 23.074 = 553.776 g = 0.554 kg


Related Questions

#6 and #7. How many carbon atoms are in a mixture of 7.00 mol c2F2 and 0.400 mol carbon dioxide and also #7

Answers

Answer:

#6  8.67x10²⁴ atoms

#7  

1. Atom

2. Formula unit

3. Molecule

4. Ion

Explanation:

#6 First we calculate how many carbon moles are there in 7.00 moles of C₂F₂, keeping in mind that there are 2 C moles per C₂F₂ mol:

7.00 mol C₂F₂ * 2 = 14.00 mol C

As for carbon dioxide, there are 0.400 C moles in 0.400 moles of CO₂.

We calculate the total number of C moles:

14.00 mol + 0.400 mol = 14.4 mol C

Finally we calculate the number of atoms in 14.4 C moles, using Avogadro's number:

14.4 mol * 6.023x10²³ atoms/mol = 8.67x10²⁴ atoms

#7

1. Radon - Atom (Ra)2. Formula unit (It is a crystalline solid, BaBr₂)3. Molecule (NH₃)4. Ion (It has a formal charge, +2)

Given the following list of densities, which materials would float in a molten vat of lead provided that they do not themselves melt? Densities (g/mL): lead = 11.4, glass = 2.6, gold = 19.3, charcoal = 0.57, platinum = 21.4.
a. gold and platinum
b. glass and charcoal
c. gold, platinum, glass and coal
d. gold and charcoal
e. None of these

Answers

Answer:

b. glass and charcoal

Explanation:

Step 1: Given data

Density of Pb: 11.4 g/mLDensity of Glass: 2.6 g/mLDensity of Au: 19.3 g/mLDensity of charcoal: 0.57 g/mLDensity of platinum: 21.4 g/mL

Step 2: Determine which material will float in molten lead

Density is an intrinsic property of matter. Less dense materials float in more dense materials. The materials whose density is lower than that of lead and will therefore float on it are glass and charcoal.

Linoleic acid is a polyunsaturated fatty acid found, in ester form, in many fats and oils. Its doubly allylic hydrogens are particularly susceptible to abstraction by radicals, a process that can lead to the oxidative degradation of the fat or oil.

a. True
b. Flase

Answers

Answer:

True.

Explanation:

The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.

Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol

Answers

Answer:

Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol

Explanation:

According to IUPAC rules, the name of a compound is:

Prefix+root word+suffix

1) Select the longest carbon chain and it gives the root word.

2) The substituents give the prefix.

3) The functional group gives the secondary suffix and the type of carbon chain gives the primary suffix.

The structure of the given compounds are shown below:

How many atoms are in each elemental sample?
16.8 g Sr
26.5 g Fe
8.94 g Bi
40.0 g P

Answers

Explanation:

The number of atoms in 1mol of every element can be represented by Avogadro's number, which is [tex]6.022*10^{23}[/tex].

Knowing this, now we can find the atoms in each of these molecules!

[tex]16.8gSr*\frac{1molSr}{87.62gSr} *\frac{6.022*10^{23}atomsSr}{1molSr} =[/tex]

1.15*10^23 atoms of Sr

[tex]26.5gFe*\frac{1molFe}{55.85gFe} *\frac{6.022*10^{23}atomsFe}{1molFe} =[/tex]

2.86*10^23 atoms of Fe

[tex]8.94gBi*\frac{1molBi}{208.98gBi} *\frac{6.022*10^{23}atomsBi}{1molBi} =[/tex]

2.58*10^22 atoms of Bi

[tex]40.0gP*\frac{1molP}{30.97gP} *\frac{6.022*10^{23}atomsP}{1molP}=[/tex]

7.78*10^23 atoms of P

what is the machine used to check melting point called?​

Answers

Answer:

Melting-point apparatus

Rank each of the following gases in order of increasing urms assuming equivalent amounts and all gases are at the same temperature and pressure where 1 has the lowest urms and 4 has the highest urms.

a. Gas 1 : H2S
b. Gas: He
c. Gas 3: NF3
d. Gas 4: H2O

Answers

the answer is option c

The Urms refers to the root mean square speed of the gas. The order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.

What is the Urms?

The Urms refers to the root mean square speed of the gas. This is ultimately dependent on the relative molecular mass of the gases when they are maintained at the same temperature.

Now, let us look at the order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.

Learnmore about Urms: https://brainly.com/question/365923

If you ran the reaction for this experiment and began with 65.0 mmol of isopentyl alcohol, how many grams of isopentyl acetate could you theoretically produce assuming only a 77.0% attainable yield

Answers

Answer:

6.52g = Actual yield (g)

Explanation:

The yield of a reaction is:

Percent yield = Actual yield (g) / Theoretical Yield (g) * 100

As 1 mol of isopentyl alcohol produce 1 mol of isopentyl acetate (Theoretical Yield), the theroretical yield of isopentyl acetate is 65.0mmol = 0.0650mol. To solve this question we need to convert the moles of isopentyl acetate to mass using its molar mass (130.19g/mol).

With the equation of percent yield we can find the mass obtained as follows:

Theoretical yield:

0.0650mol * (130.19g/mol) = 8.46g of isopentyl alcohol

Mass produced:

77 = Actual yield (g) / 8.462g * 100

6.52g = Actual yield (g)

The mass of isopentyl acetate that can be produced is 6.52 g

Balanced equation

See attached photo

From the balanced equation,

1 mole of isopentyl alcohol reacted to produce 1 mole of isopentyl acetate.

Therefore,

65 mmole (i.e 0.065 mole) of isopentyl alcohol will also react to produce 0.065 mole of isopentyl acetate.

How to determine the actual yield (in mole) Percentage yield = 77%Theoretical yield = 0.065 mole Actual yield =?

Actual yield = percent × theoretical

Actual yield = 77% × 0.065

Actual yield = 0.05005 mole

How to determine the mass Mole of isopentyl acetate = 0.05005 mole Molar mass of isopentyl acetate = 130.19 g/molMass of isopentyl acetate =?

Mass = mole × molar mass

Mass of isopentyl acetate = 0.05005 × 130.19

Mass of isopentyl acetate = 6.52 g

Learn more about stoichiometry:

https://brainly.com/question/14735801

Choose the substance with the higher entropy in each pair. Assume constant temperature, except in part (5)
(i) 1 mol of SO2(g) or 1 mol of SO3(g)
(ii) 1 mol of CO2(s) or 1 mol of CO2(g)
(iii) 3 mol of O2(g) or 2 mol of O3(g)
(iv) 1 mol of KBr(s) or 1 mol of KBr(aq)
(v) Seawater at 2°C or at 23°C
(vi) 1 mol of CF4(g) or 1 mol of CCl4(g)

Answers

Answer:

I) 1 mol of SO3(g)

2) 1 mol of CO2(g)

3) 3 mol of O2(g)

4) 1 mol of KBr(aq)

5) Seawater at 23°C

6) 1 mol of CCl4(g)

Explanation:

In molecules having greater numbers of atoms, there is an increase the number of ways by which the molecule vibrates thereby leading to a higher number of possible microstates and overall increase in entropy of the system. Hence, 1 mol of SO3(g) has a higher entropy than 1 mol of SO2.

Gases have a higher entropy than liquids and liquids have a higher entropy than gases.

Also, the greater the molecular weight of a molecule, the higher the entropy. Higher number of moles of a gas as well as the increase in temperature of a substance are also factors that lead to higher entropy.

An atom has 20 electrons. Find out
i. It’s atomic numbers and total number of p-electrons
ii. The value of azimuthal quantum number (l) and magnetic quantum number (m) of the 19th electron of the atom.
iii. It’s group position in the periodic table.

Answers

Answer:

it's atomic number is 5 and total number is 10

The atom has an atomic number of 20 and has a total of 12 p electrons.

The azimuthal quantum number (l) of the 19th electron is 0 and the magnetic quantum number (m) of the 19th electron is 0.

It is an element of group 2

The number of electrons in the neutral atom is equal to the number of protons and is also the atomic number of an atom.

An atom is known to be electrically neutral. This is because the number of electrons in the atom is equal to the number of protons in the neutral atom.

The number of protons in the neutral atom is called the atomic number of the atom.

For an element that has 20 electrons, its electronic configuration is;

1s2 2s2 2p6 3s2 3p6 4s2.

The 19th electron is in the 4s orbital hence both the azimuthal and magnetic quantum numbers are zero.

The element has outermost electron configuration ns2 so it mus belong to group 2 of the periodic table.

https://brainly.com/question/16979660

A compound that contains only carbon, hydrogen, and oxygen is 58.8% C and 9.87% H by mass. What is the empirical formula of this substance

Answers

Answer: The empirical formula of the compound becomes [tex]C_5H_{10}O_2[/tex]

Explanation:

The empirical formula is the chemical formula of the simplest ratio of the number of atoms of each element present in a compound.

Let the mass of the compound be 100 g

Given values:

% of C = 58.8%

% of H = 9.87%

% of O = [100 - 58.8 - 9.87] = 31.33%

Mass of C = 58.8 g

Mass of H = 9.87 g

Mass of O = 31.33 g

The number of moles is defined as the ratio of the mass of a substance to its molar mass. The equation used is:

[tex]\text{Number of moles}=\frac{\text{Given mass}}{\text{Molar mass}}[/tex] ......(1)

To formulate the empirical formula, we need to follow some steps:

Step 1: Converting the given masses into moles.

Molar mass of C = 12 g/mol

Molar mass of H = 1 g/mol

Molar mass of O = 16 g/mol

Putting values in equation 1, we get:

[tex]\text{Moles of C}=\frac{58.8g}{12g/mol}=4.9 mol[/tex]

[tex]\text{Moles of H}=\frac{9.87g}{1g/mol}=9.87 mol[/tex]

[tex]\text{Moles of O}=\frac{31.33g}{16g/mol}=1.96mol[/tex]

Step 2: Calculating the mole ratio of the given elements.

Calculating the mole fraction of each element by dividing the calculated moles by the least calculated number of moles that is 1.96 moles

[tex]\text{Mole fraction of C}=\frac{4.9}{1.96}=2.5[/tex]

[tex]\text{Mole fraction of H}=\frac{9.87}{1.96}=5.03\approx 5[/tex]

[tex]\text{Mole fraction of O}=\frac{1.96}{1.96}=1[/tex]

Converting the mole fraction into whole numbers by multiplying them with 2.

[tex]\text{Mole fraction of C}=2.5\times 2=5[/tex]

[tex]\text{Mole fraction of H}=5\times 2=10[/tex]

[tex]\text{Mole fraction of O}=1\times 2=2[/tex]

Step 3: Taking the mole ratio as their subscripts.

The ratio of C : H : O = 5 : 10 : 2

Hence, the empirical formula of the compound becomes [tex]C_5H_{10}O_2[/tex]

The empirical formula of the substance is[tex]C_5H_{10}O_2[/tex].

Explanation:

Given:

A compound made up of 58.8% of carbon, 9.87% hydrogen, and oxygen.

To find:

The empirical formula of this substance.

Solution

The percentage of carbon in a given substance by mass = 58.8%

The percentage of hydrogen in a given substance by mass = 9.87%

The percentage of oxygen in a given substance by mass :

[tex]= 100\%-58.8\%- 9.87\%=31.33\%[/tex]

Consider 100 grams of a substance.

In 100 grams of substance:

The mass of carbon =58.8% of 100 g = 58.8 g

The mass of hydrogen = 9.87% of 100 g = 9.87 g

The mass of oxygen = 31.33% of 100 g= 31.33 g

The moles of carbon [tex]=\frac{58.8 g}{12.0107 g/mol}=4.90 mol[/tex]

The moles of hydrogen[tex]=\frac{9.87g}{1.00784g/mol}=9.79 mol[/tex]

The moles of oxygen[tex]=\frac{31.33g}{15.999g/mol}=1.96 mol[/tex]

let the empirical formula of the substance = [tex]C_xH_yO_z[/tex]

The value of subscript x:

[tex]=\frac{4.90 mol}{1.96 mol}=2.5[/tex]

The value of subscript y:

[tex]=\frac{9.79mol}{1.96 mol}=5[/tex]

The value of subscript z:

[tex]=\frac{1.96mol}{1.96 mol}=1[/tex]

The empirical formula of a substance :

[tex]C_{2.5}H_5O_1=C_{\frac{25}{10}}H_5O_1=C_{25}H_{50}O_{10}[/tex]

Reducing to the lowest whole numbers:

[tex]C_{25}H_{50}O_{10}=C_5H_{10}O_2[/tex]

The empirical formula of the substance is [tex]C_5H_{10}O_2[/tex].

Learn more about the empirical formula here:

brainly.com/question/1247523?referrer=searchResults

brainly.com/question/1363167?referrer=searchResults

Calculate the individual percent recoveries of benzoic acid, naphthalene and 3-nitroaniline if you were able to collect 9.75 g of benzoic acid, 6.41 g of naphthalene, and 7.71 g of 3-nitroaniline from a set of extractions. The starting mass of the mixture was 26.24 g. (0.6 pt)

Answers

Answer:

Benzoic acid= 37.16%

Naphthalene = 24.43%

3-Nitroaniline= 29.38%

Explanation:

Data given:

percentage recovery of benzonic acid = 9.75/26.24 * 100 = 37.16%

Percentage recovery of napthalene = 6.41/26.24 * 100 = 24.43%

Percentage recovery of 3-nitroaniline = 7.71/26.24 * 100 = 29.38%


The speed of light_____ meters per second

Answers

299,792,458 meters per second.

2- A 0.60 sample an unknown organic acid found in muscle cells is burned in air and found to contain 0.24 grams of carbon, 0.040 grams of hydrogen, with the rest being oxygen. If the molecular weight of the substance is 90 grams/n, what is the molecular formula

Answers

Answer:

C₃H₆O₃

Explanation:

To solve this question we need to find, as first, the moles of each atom in order to find empirical formula (Simplest whole-number ratio of atoms present in a molecule).

With the molar mass of the substance and the empirical formula we can find the molecular formula as follows:

Moles C -Molar mass:12.0g/mol-

0.24g * (1mol/12.0g) = 0.020 moles C

Moles H = Mass H because molar mass = 1g/mol:

0.040 moles H

Moles O -Molar mass: 16g/mol-

Mass O: 0.60g - 0.24g - 0.040g = 0.32g O

0.32g O * (1mol/16g) = 0.020 moles O

Ratio of atoms (Dividing in moles of C: Lower number of moles):

C = 0.020 moles C / 0.020 moles C = 1

H = 0.040 moles H / 0.020 moles C = 2

O = 0.020 moles O / 0.020 moles C = 1

Empirical formula:

CH₂O.

Molar mass CH2O:

12g/mol + 2*1g/mol + 16g/mol = 30g/mol

As molecular formula has a molar mass 3 times higher than empirical formula, the molecular formula is 3 times empirical formula:

C₃H₆O₃

The molecular formula of the organic acid would be C3H6O3

Molecular formula

Molecular formula = [empirical formula]n

Where n = molar mass/mass of empirical formula

Empirical formula

C = 0.24/12 = 0.02

H = 0.040/1 = 0.04

O = 0.6 - (0.24+0.04) = 0.32/16 = 0.02

Divide by the smallest

C = 1

H = 2

O = 1

Empirical formula = CH2O

Empirical formula mass = 12 + 2 + 16 = 30

n = 90/30 = 3

Molecular formula = [CH2O]3

                               = C3H6O3

More on molecular formula can be found here: https://brainly.com/question/1247523

If 0.250 L of a 5.90 M HNO₃ solution is diluted to 2.00 L, what is the molarity of the new solution?

Answers

Answer:

0.74 M

Explanation:

From the question given above, the following data were obtained:

Molarity of stock solution (M₁) = 5.90 M

Volume of stock solution (V₁) = 0.250 L

Volume of diluted solution (V₂) = 2 L

Molarity of diluted solution (M₂) =?

The molarity of the diluted solution can be obtained by using the dilution formula as illustrated below:

M₁V₁ = M₂V₂

5.90 × 0.250 = M₂ × 2

1.475 = M₂ × 2

Divide both side by 2

M₂ = 1.475 / 2

M₂ = 0.74 M

Thus, the molarity of the diluted solution is 0.74 M

the force of attraction between non polar molecules are what (a)electrovalent bond (b)covalent bond (c)Hydrogen bond (d)Van der waals forces​

Answers

Answer:

d. van der waals force

Explanation:

Van der Waals force :

the weakest intermolecular forceand consist of dipole-dipole force and dispersion force.

write any two things that should be remembered while writing chemical equation​

Answers

Answer:

the product and the reactant must be balanced

if u are required to give the mechanism if the reaction it must be written

Please please help help please

Answers

Acute toxin or D) 100% correct

Que es la actividad física y en qué mejora

Answers

La actividad física regular puede mejorar su fuerza muscular y aumentar su resistencia. El ejercicio proporciona oxígeno y nutrientes a sus tejidos y ayuda a que su sistema cardiovascular funcione de manera más eficiente. Y cuando la salud de su corazón y pulmones mejoran, tiene más energía para hacer frente a las tareas diarias. Encantado de ayudarle

Post-Lab Questions
1. A beverage company is having trouble with the production of the dye in their drinks. The color of their drink mix is supposed to be a pale green color, but they often get different results. For each unwanted result, choose the most plausible explanation to help the company improve the formula.
(1pts)
The color of the drink is too pale after adding the dye to the drink because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
The color of the dye is appearing as red, instead of green because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
The drink started out the correct color but it is getting darker over time, even though nothing has been added to the drink, because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
2. Beer's Law states that A=εbc, where A is the absorbance, ε is the molar absorptivity of the solute, b is the path length, and c is the concentration. Identify the experimental evidence from the activity that you have for the dependence of absorbance on each variable.
The evidence for the dependence of absorbance on the variable ε is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
The evidence for the dependence of absorbance on the variable b is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
The evidence for the dependence of absorbance on the variable c is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
3. Describe how you could use the Beer's Law simulation to experimentally determine the best wavelength at which to perform an experiment.
Measure the absorbance for solutions of multiple different solutes and find the minimum absorbance.
Measure the absorbance for solutions with different concentrations and find the slope of the trendline.
Measure the absorbance for the same solution at different wavelengths and find the maximum absorbance.
Measure the absorbance for the same solution in different cuvette sizes and find the y-intercept.

Answers

Answer:

1. not enough dye was added to the drink.

The wrong dye was added to the drink

the water in the drink is evaporating

2. Changing the compound changes the absorbance behavior.

3. Measure the absorbance for the same solution in different cuvette sizes and find the y-intercept.

Explanation:

When the beverage company adds dye to the drink, there should be standard quantity added to the drink so that the color of the drink remains constant. When too much dye is added to the drink, the color will get dark brown or black. When the color of drink get lighter than green this means dye is not added in required quantity.

In what kind of orbital do the lone-pair electrons on the nitrogen of dimethylacetamide reside, and is it in the same plane as the ch3 groups

Answers

Answer:

The lone pairs on nitrogen in dimethylacetamide reside in sp3 orbitals which are coplanar with the methyl groups

Explanation:

The compound dimethylacetamide consists of oxygen bearing two lone pairs of electrons and a nitrogen atom bearing a lone pair of electrons and has two methyl groups attached to the nitrogen atom.

The lone pair on the nitrogen atom is accommodated in an sp3 orbital of nitrogen as shown in the question. This sp3 orbital is coplanar with the two methyl groups.

Identify the possible quantitative analysis you can do using only the 28.02 g/mol as a unit factor. Select one or more:

Answers

Answer:

Calculate the moles of N2 molecules in 3.94 grams of nitrogen.

Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules.

Explanation:

Calculate the moles of N2 molecules in 4.73 liters of nitrogen gas. FALSE. You can't make this conversion using only the conversion factor with units of g/mol. To convert liters to moles are necessaries pressure, temperature and volume of the gas to use PV = nRT

Calculate the grams of N2 in 10.58 liters of nitrogen gas. FALSE. As explained, you need, P,V and T to find the moles of the gas. With the moles you can find the mass using the conversion factor of 28.02g/mol

Calculate the moles of N2 molecules in 3.94 grams of nitrogen. TRUE. You can find the moles of N2 as follows:

3.94g N2 * (1mol/28.02g) = 0.14 moles of N2 molecules

Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules. TRUE. The mass in 5.03x10²⁰ moles of nitrogen molecules is:

5.03x10²⁰ moles * (28.02g/mol) = 1.4x10²²g of nitrogen.

A student dropped a piece of silver metal into a solution of HCl(aq). He observed the formation of gas bubbles and collected the gas into another test tube. The student performed a splint test and observed that the splint produced a popping sound when he placed the splint into the test tube of the gas. What can be said about the results of this students experiment?

a. The student performed the splint test incorrectly. He should of observed the splint flare up when the splint was placed in the test tube.
b. The student completed the experiment correctly and there were no errors in the experiment.
c. The experiment was performed incorrectly. Silver doesn't react with HCl. Therefore, the student picked up the wrong metal when conducting the experiment.
d. The student performed the splint test incorrectly. He should of observed the flame being extinguished when the splint was placed in the test tube.

Answers

Answer:

The student completed the experiment correctly and there were no errors in the experiment.

Explanation:

When a pea size amount of Ag is dropped into a solution of HCl, the following reaction occurs;

Ag(s) + 2HCl(aq) ----> AgCl(aq) + H2(g)

The gas H2 burns with a pop sound. The gas obtained does not react to litmus. The products of the reaction are expected.

Hence, the experiment was properly conducted and the student completed the experiment correctly and there were no errors in the experiment.

Which of the following is the correct way to balance the following chemical question:
2SnO2 + 4H2 -> 2Sn + 4H2O
SnO2 + 2H2 -> Sn + 2H2O
a. Both equation I and II are balanced, but equation I is the correct way to write the balanced equation.
b. Can you divide equation II by another factor and still have it be correct? Why or why not?
c. In a complete sentence, write down a method you could use to determine if an equation is written in the correct way.

Answers

Answer:

i have no answer for part A

part B

the one that has a 4 can be divided by 2 because reducing

part c

you can determine if an equation is written in the correct way by balancing the equation as if it had not been done already.

Would 1 pound of peanut butter occupy more or less space than 1 pound of water?

Answers

It would occupy less space

help with the following would be greatly appreciated!

Answers

what is the question ?

once a recrystallization is completed and filtered, what solvent would be suitable for transferring the leftover solids to filtration funnel

Answers

Answer:

To transfer leftover solids to the filtration funnel and wash out crystals after recrystallization, ice cold methanol should be used (the mother liquor used for recrystallization).

Explanation:

Hope this helped

(S)-CH3CH(N3)CH2CH2CH3 can be synthesized by an SN2 reaction. Draw the structures of the alkyl chloride and nucleophile that will give this compound in highest yield.

Answers

Answer:

See explanation and image attached

Explanation:

Let us recall that the reaction in question is expected to happen by SN2 mechanism. This is because, the reaction occurs at secondary carbon atom and the attacking nucleophile (N3^-) is a good nucleophile.

The reaction occurs via a backside attack of the N3^- ion on (R)-2-chloropentane. This backside attack leads to inversion of configuration at the reaction centre to yield (S)-CH3CH(N3)CH2CH2CH3.

The images of the alkyl halide and nucleophile are shown in the image attached to this answer.

which straight-chain alkane would you predict to be the most viscous? all are liquids exhbiting the general bonding pattern ch3-(ch2)n-ch3

Answers

The question is incomplete, the complete question his;

Which straight chain alkane below would you predict to be the most viscous? Why? All are liquids exhibiting the general bonding pattern CH3-(CH2)n-CH3

C9H20

C10H22

C5H12

C6H14

C12H26

Answer:

C12H26

Explanation:

Generally, the viscosity of a liquid increases with increase in molecular mass of the substance.

Liquids of high molecular mass do not flow easily. This means that they posses high viscosity.

Thus, since C12H26 has the highest molecular mass among the options given in the question, C12H26 exhibits the greatest viscosity.

PLEASE HELP!!

How does temperature, agitation, and particle size affect solubility?

Answers

Answer:

At higher temperatures, particles move faster and collide more, increasing solubility rates.

Agitation increases solubility rates as well, by bringing fresh solvent into contact with the undissolved solute

The smaller the particle size, the higher (faster) solubility rate. Vice versa, the bigger the particle size, the lower (slower) solubility rate.

Explanation:

Other Questions
please help me on this asap what are the characteristics of effective communication Give two reasons why humans need a balanced ecosystem. Responses of the Mast cells to the allergen include/s a. All of the answers are correct b. Degranulation c. Secretion of lipid mediators d. Secretion of cytokines apakah kesan perkembangan perkhidmatan kesihatan kepada penduduk tanah melayu A regular polygon has each interior angle is 156, what is the number of sides of the polygon? A. 14 C. 16 B. 15 D. 17 Which of the following best describes the advancements of the New Stone Age?a. using toolsc. using seeds to grow crops,b. gathering foodd. using fire to cook foodPlease select the best answer from the choices provided If you grew up with a family pet, then you have surely noticed that they often seem to hear things that you dont hear. Now that youve read this section, you probably have some insight as to why this may be. How would you explain this to a friend who never had the opportunity to take a class like this? 7. Calculate the Perimeter AND Area of triangleABCB24 m40 m14 m20 m37 m In this cover letter text, what most needs to be revised?Dear Sir,I am writing to express my interest in your engineeringdepartment. The girl at your office told me that you hadseveral openings for strong, hardworking individuals atyour remote office in northwestern North Dakota.A. RedundancyB. Informal toneC. Casual styleD. Gender bias Why would parents allow their children to work dangerous jobs in 1900 Find the perimeter of JKL. Round your answer to the nearest tenth if necessary Need help on this, this is on edge btw.Which revolution(s) established long-lasting democratic traditions?A. the American RevolutionB. the American and Glorious revolutionsC. the Glorious and French revolutionsD. the Glorious Revolution Click to read the passage from Macbeth, by William Shakespeare. Thenanswer the question.In the passage, which characteristic of Macbeth's has the greatest effect onthe development of the scene?A. His titleB. His marriageC. His povertyD. His friends what is the comparison of pretty Provide details about Meiosis. 03:55:44 All of the following statements about Mexican immigrants in Texas are true EXCEPT: a. Their customs were heavily influenced by Spanish traditions. b. Very few Mexican immigrants worked as migrant farm laborers. c. After World War II, many began moving from rural to urban areas. d. By the 1920s, they began learning English and participating in the political system. what is balance of trade and balance of payment? a. Change the following into indirect speech. She said, "While I was having dinner, the phone rang. My friend said, "Where are they staying?" c. Jamila said, "I travel a lot in my job." . Fourth and fifth graders planted trees alongside the road. The distance between two trees is 5 meters how many trees did they plant if the distance between the first and last trees is 200 meters?