Organic foods do not contain chemicals.

True
False

Answers

Answer 1
True because they are organically made without any things that include chemicals

Related Questions

What does X represent in the following reaction?
239 239
93NP → 94Pu + X
A) a neutron
C) an alpha particle
B) a proton
D) a beta particle

Answers

Answer:

D. beta particle

Explanation:

Pu has 94 protons which is only one more than Np (93), that means beta decay. Atomic mass stays the same in beta decay. Beta is very small particle so atomic mass stays at 239.

The given reaction is an example of beta decay where the atomic number of the nuclei increases by one unit and mass number remains unchanged. Therefore, the particle X is a beta particle or an electron.

What is beta decay?

Heavy unstable isotopes of atoms undergoes nuclear decay by the emission of charged particles such as alpha or beta particle. In alpha decay, the helium nuclei is emitted and in beta decay, electrons are emitted.

In alpha decay, the mass number of the nuclei decreases by 4 units and atomic number by 2 units. In beta decay, the mass number does not change but the atomic number increases by one unit.

Neptunium undergoes beta decay and forms the plutonium nuclei. Thus X is a beta particle. The reaction is written as follows:

[tex]\rm _{93} ^{239}Np \rightarrow _{94}^{239}Pu + _{-1}^{0}e[/tex]

To find more on beta decay, refer here:

https://brainly.com/question/25455333

#SPJ2

A number is three times the difference between twenty and the number. What is the number?

Answers

Answer:

the number is 7

Explanation:

"Three times" means multiply by 3

"Difference" means subtract

"Sum" means add

3(x - 7) = 23 - (3x + 2)

3x - 21 = 23 - 3x - 2

3x - 21 = 21 - 3x

6x = 42

x = 7

What are the effects of global warming?​

Answers

the effects are: temperature rises, water shortages, and increased fire threats

What is ethane?
A. A polymer
B. An alkyne
C. An alkane
D. An alkene ​

Answers

Answer:

D. An alkene ​

Explanation:

because Ethane is C2H4

Answer:

It's a alkANE. C.

Explanation:

The easiest way to memorize this is to look at the endings. Substances that end in -ANE are alkANEs. Substances that end in -ENE are alkENEs. Substances that end in -YNE are alkYNEs.

Write chemical equations for the reactions that occur when solutions of the following substances are mixed:

a. HNO₂ (nitrous acid) and C₂H₇NO (aq) ethanolamine, a base.
b. H₃O+ and F-

Answers

a) HNO₂ + C₂H₇NO → N₂ + C₂H₆O + H₂O

b) H₃O⁺ + F⁻ → HF + H₂O

[tex]\large\color{lime}\boxed{\colorbox{black}{Answer : - }}[/tex]

a) HNO₂ + C₂H₇NO → N₂ + C₂H₆O + H₂O

b) H₃O⁺ + F⁻ → HF + H₂O

2. Calculate the wavelength of the emitted photon from hydrogen for the transition from ni = 3 to nf = 2. What part of the visible spectrum is this wavelength? Visible wavelengths are: Red  700 - 620 nm, Yellow  620 - 560 nm, Green  560 - 500 nm, Blue 500 - 440 nm, and Violet  440 - 400 nm.

Answers

Answer:

The correct answer is "654.54 nm".

Explanation:

According to the question,

⇒ [tex]\frac{1}{\lambda}= Rh(\frac{1}{n1^2} -\frac{1}{n2^2} )[/tex]

By substituting the values, we get

       [tex]=1.1\times 10^7(\frac{1}{4} -\frac{1}{9} )[/tex]

       [tex]=1.1\times 10^7(\frac{9-4}{36} )[/tex]

       [tex]=1.1\times 10^7(\frac{5}{36} )[/tex]

       [tex]=654.54\ nm[/tex]

Thus the above is the right solution.

Explain why you get a basic solution when you dissolve NaF in water.

Answers

Answer:

The fluoride ion is capable of reacting, to a small extent, with water, accepting a proton. The fluoride ion is acting as a weak Brønsted-Lowry base. The hydroxide ion that is produced as a result of the above reaction makes the solution slightly basic.

So

we get a basic solution when you dissolve NaF in water.

Na is a alkaline earth metal

Metallic compound dissolved in water acts as base

Also there is another reason

Na F is ioniC

Fluorine is known as having highest electron affinity in world

It can accept a line pair of OH-

So it's Bronsted Lowry base .

It can also acts as Arrhenius base

Hence its basic

A substance which is made up of the same kind
of atom is known as?

Answers

Answer:

Element

Element : A pure substance composed of the same type of atom throughout. Compound : A substance made of two or more elements that are chemically combined in fixed amounts.

Explanation:

Determine the number of hydrogen atoms connected to each carbon atom: The bond-line structure of a compound has a SMILES string of CC1CCN(CC1N(C)C2=NC=NC3=C2C=CN3)C(=O)CC#N. All the carbon atoms of the compound are highlighted and labeled a through p.

Answers

Answer:

dsgsdfd

Explanation:

Critique this statement: Electrons can exist in any position
outside of the nucleus.

Answers

Answer:

However, there has to be 2 electrons on the first shell, and 8 on the others.

Explanation:

Hope this helps :)

A wavelength of 489.2 nm is observed in a hydrogen spectrum for a transition that ends in the nf level of the Balmer series. What was ni for the initial level of the electron

Answers

Answer:

[tex]n_1=4[/tex]

Explanation:

From the question we are told that:

Wavelength [tex]\lambda=489.2 nm =>4.86*10^{-7}[/tex]

nf level= Balmer series

nf level= 2

Generally the equation for Wavelength is mathematically given by

[tex]\frac{1}{\lambda}=R[\frac{1}{nf^2}-\frac{1}{n_1^2}][/tex]

Where

[tex]R=Rydberg Constant[/tex]

[tex]R=1.097*10^7[/tex]

Therefore

[tex]\frac{1}{4.86*10^{-7}}=1.097*10^7[\frac{1}{2^2}-\frac{1}{n_1^2}][/tex]

[tex]n_1=4.0021[/tex]

[tex]n_1=4[/tex]

how many CH4 molecules are in 14.8 g of CH4

Answers

1.8021•1024 molecules

Answer:

[tex]\boxed {\boxed {\sf 5.56 \times 10^{23} \ molecules \ CH_4}}[/tex]

Explanation:

We are asked to find how many molecules of methane are in 14.8 grams of the substance.

1. Convert Grams to Moles

First, we convert grams to moles. We use the molar mass, or the mass of 1 mole of a substance. These values are equivalent to the atomic masses found on the Periodic Table, however the units are grams per mole instead of atomic mass units.

We are given the compound methane, or CH₄. Look up the molar mass of the individual elements (carbon and hydrogen).

C: 12.011 g/mol H: 1.008 g/mol

Check the formula for subscripts. Hydrogen (H) has a subscript of 4, so there are 4 moles of hydrogen in 1 mole of methane. We must multiply hydrogen's molar mass by 4, then add carbon's molar mass.

H₄: 1.008 * 4 = 4.032 g/mol CH₄: 12.011 + 4.032 = 16.043 g/mol

Now we use dimensional analysis to convert. To do this, we set up a ratio using the molar mass.

[tex]\frac {16.043 \ g \ CH_4 }{ 1 \ mol \ CH_4}[/tex]

Since we are converting 14.8 grams of methane to moles, we multiply by this value.

[tex]14.8 \ g \ CH_4 *\frac {16.043 \ g \ CH_4 }{ 1 \ mol \ CH_4}[/tex]

Flip the ratio so the units of grams of methane cancel.

[tex]14.8 \ g \ CH_4 *\frac{ 1 \ mol \ CH_4} {16.043 \ g \ CH_4 }[/tex]

[tex]14.8 *\frac{ 1 \ mol \ CH_4} {16.043}[/tex]

[tex]\frac {14.8}{16.043} \ mol \ CH_4= 0.9225207256 \ mol \ CH_4[/tex]

2. Moles to Molecules

Next, we convert moles to molecules. We use Avogadro's Number or 6.022  × 10²³. This is the number of particles (atoms, molecules, formula units, etc.) in 1 mole of a substance. In this problem, the particles are moles of methane. Set up another ratio using Avogadro's Number.

[tex]\frac { 6.022 \times \ 10^{23} \ molecules \ CH_4}{ 1 \ mol \ CH_4}[/tex]

Multiply by the number of moles we calculated.

[tex]0.9225207256\ mol \ CH_4 * \frac { 6.022 \times \ 10^{23} \ molecules \ CH_4}{ 1 \ mol \ CH_4}[/tex]

The units of moles of methane cancel.

[tex]0.9225207256* \frac { 6.022 \times \ 10^{23} \ molecules \ CH_4}{ 1 }[/tex]

[tex]5.55541981 \times 10^{23} \ molecules \ CH_4[/tex]

3. Round

The original measurement of grams (14.8) has 3 significant figures, so our answer must have the same. For the number we calculated, that is the hundredth place. The 5 in the thousandth place tells us to round the 5 in the hundredth place up to a 6.

[tex]5.56 \times 10^{23} \ molecules \ CH_4[/tex]

14.8 grams of methane is equal to approximately 5.56 × 10²³ molecules of methane.

A chunk of a metal alloy displaces 0.58 L of water and has a mass of 2.9 kg. What is the density of the alloy in g/cm3?

Answers

Answer:

5g/cm3

Explanation:

firstly convert the litres and kilograms to grams and centimeters.

1l is equivalent to 1000cm3

0.58×1000

580cm3

and 1kg is equivalent to 1000g

2.9×1000

2900

then find the density by using the formula

density=mass/volume

=2900g/580cm3

=5g/cm3

I hope this helps

# of protons
# of neutrons
# of electrons
Atomic Number
Mass Number
18
17
35
17
37
6
8
6
6
15

Answers

Answer:

35

Explanation:

is the answer for your question

Choose the most correct answer: The endothermic (∆H > 0) reaction:
a) Cannot occur at all temperature.
b) Can occur with the positive ∆S at high temperature.
c) Can occur with the negative ∆S at low temperature.
d) Cannot occur with the positive ∆S at high temperature.

Answers

Answer:

B

Explanation:

In order to create spontaneity, an endothermic process has to occur along with positive entropy and high temperature

Two common methods to generate an aldehyde is by oxidation of an alcohol and through ozonolysis.

a. True
b. False

Answers

Answer:

a. True.

Explanation:

Only primary and secondary alcohols can oxidise to give an aldehyde. But a weak oxidizing agent must be used to prevent formation of a carboxylic acid or ketone.

weak oxidizing agents: Chromyl chloride, silver/oxygen/500°C

take an example of ethanol:

[tex]{ \bf{CH _{3} CH_{2}OH \: \: \frac{Ag/O_{2} }{500 \degree C} > \: \:CH _{3} CHO}}[/tex]

[tex]{ \sf{CH _{3} CHO \: \: is \: ethanal}} [/tex]

By ozonolysis:

Here, reactants are Ozone gas, Carbon tetrachloride at a temperature (<20°C), ethanoic acid, zinc and water.

take an example of propanol:

if it undergoes ozonolysis, it gives ethanal and methanal.

Answer:

A. True

Explanation:

Only primary and secondary alcohols can oxidise to give an aldehyde. But a weak oxidizing agent must be used to prevent formation of a carboxylic acid or ketone.

weak oxidizing agents: Chromyl chloride, silver/oxygen/500°C

take an example of ethanol:

By ozonolysis:

Here, reactants are Ozone gas, Carbon tetrachloride at a temperature (<20°C), ethanoic acid, zinc and water.

take an example of propanol:

if it undergoes ozonolysis, it gives ethanal and methanal.

How many moles of Al are needed to react exactly with 10.00 moles of Fe2O3 according to the following
equation?
Fe2O3 + 2 Al → Al2O3 + 2Fe
A) 15.0 moles
1
B) 20.0 moles
C) 30.0 moles
D) 60.0 moles
E) 35.0 moles

Answers

Answer:

Answer is B) 20.0 moles

Explanation:

From the equation,

1 mole of Fe2O3 = 2 moles of Al

therefore 10.0 moles of Fe2O3 = 10×2

= 20.0 moles.

Lewis Structures are used to describe the covalent bonding in molecules and ions. Draw a Lewis structure for NO3- and answer the following questions based on your drawing.

1. For the central nitrogen atom:

The number of lone pairs = ________
The number of single bonds=_______
The number of double bonds= ______

2. The central nitrogen atom :

Answers

Answer:

The lewis structure for NO₃⁻ is shown in the attachment below

For the central nitrogen atom:

The number of lone pairs = 0

The number of single bonds = 2  

The number of double bonds= 1

Explanation:

The lewis structure for NO₃⁻ is shown in the attachment below.

From the Lewis structure

For the central nitrogen atom:

The number of lone pairs = 0

The number of single bonds = 2  

The number of double bonds= 1

What is the biggest cause of change in Earth's systems?
A. Heat
B. Motion
C. Friction
D. Plate tectonics

Answers

Answer:

heat

Explanation:

because it's the cause of change

Answer:

heat

Explanation:

because it is a natural factor that causes the change in Earth's system

Write balanced equations for the reaction of each of the following carboxylic acids with NaOH. Part A formic acid Express your answer as a chemical equation. A chemical reaction does not occur for this question. Request Answer Part B 3-chloropropanoic acid Express your answer as a chemical equation. nothing A chemical reaction does not occur for this question.

Answers

Answer:

Part A

HCOOH(aq) + NaOH(aq) → HCOONa(aq) + H2O(l)

Part B

ClCH2CH2CO2H(aq) + NaOH(aq) ------> ClCH2CH2CO2Na(aq) + H2O(l)

Explanation:

The reaction between an alkanoic acid and a base is a neutralization reaction. The reaction occurs as follows;

RCOOH + NaOH ----> RCOONa + H2O

We have to note the fact that the net ionic reaction still remains;

H^+(aq) + OH^-(aq) ---> H2O(l)

In both cases, the reaction can occur and they actually do occur as written.

A s'more requires 2 graham cracker squares, 1 marshmallow, and 3 chocolate pieces. If an entire chocolate bar contains 12 chocolate pieces, a marshmallow bag contains 40 marshmallows, and a graham cracker package contains 48 squares, how many s'mores can you make from 8 chocolate bars, one bag of marshmallows, and a package of graham crackers?

Answers

Explanation:

try 96 if that's not right let me know and I'll try to fix it

Answer:24

Explanation:

Sean plated an unknown metal onto his silver ring which initially weighed 1.4 g. He constructs an electrolytic cell using his ring as one of the electrodes. After running the cell, 0.022 moles of the unknown metal was plated onto his ring and the mass of the ring increased to 3.137 g. What is the atomic weight of the unknown metal in g/mol

Answers

Answer:

79 g/mol

Explanation:

Mass of unknown metal deposited = 3.137 g - 1.4 g = 1.737 g

Number of moles of metal deposited = 0.022 moles

Since;

Number of moles = reacting mass/molar mass

Molar mass = reacting mass/number of moles

Molar mass = 1.737 g/0.022 moles

Molar mass= 79 g/mol

Which is the electronic configuration for oxygen?

Answers

the answer is [He] 2s² 2p⁴

What mass of water is formed in the reaction of 4.16g H with excess oxygen gas.

Answers

Answer:

Explanation:

Start with a balanced equation.

2H2 + O2 → 2H2O

Calculate mole H2 using the formula: n = m/M, where:

n = mole

m = mass (g)

M = molar mass (g/mol)

Calculate molar mass of H2.

M H2 = 2 × 1.008 g/mol = 2.016 g/mol

Calculate moles H2.

n H2 = 4.16 g H2/2.016 g/mol = 2.063 mol H2

Calculate moles H2O by multiplying moles H2 by the mole ratio between H2O and H2 from the balanced equation, so that moles H2 cancel.

2.063 mol H2 × (2 mol H2O/2 mol H2) = 2.063 mol H2O

The mass of water will be calculated by rearranging the n = m/M formula to isolate m;

m = n × M

Calculate the molar mass H2O.

M H2O = (2 × 1.008 g/mol) + (1 × 15.999 g/mol) = 18.015 g/mol

Calculate the mass H2O.

m = n × M = 2.063 mol H2O × 18.015 g/mol = 37.2 g H2O

4.16 g H2 with excess O2 will produce 37.2 g H2O.

Consider the reaction: A(aq) + 2B (aq) === C (aq). Initially 1.00 mol A and 1.80 mol B
were placed in a 5.00-liter container. The mole of B at equilibrium was determined to
be 1.00 mol. Calculate K value.
0.060
5.1
25
17
Ugh

Answers

Answer:

17

Explanation:

Step 1: Calculate the needed concentrations

[A]i = 1.00 mol/5.00 L = 0.200 M

[B]i = 1.80 mol/5.00 L = 0.360 M

[B]e = 1.00 mol/5.00 L = 0.200 M

Step 2: Make an ICE chart

        A(aq) + 2 B(aq) ⇄ C(aq)

I       0.200    0.360        0

C        -x           -2x         +x

E     0.200-x  0.360-2x   x

Then,

[B]e = 0.360-2x = 0.200

x = 0.0800

The concentrations at equilibrium are:

[A]e = 0.200-0.0800 = 0.120 M

[B]e = 0.200 M

[C]e = 0.0800 M

Step 3: Calculate the concentration equilibrium constant (K)

K = [C] / [A] × [B]²

K = 0.0800 / 0.120 × 0.200² = 16.6 ≈ 17

how is the Sun classified?
A as a giant star
B as a medium star
C as a white star as a neutron star
D as a white dwarf​

Answers

Answer:

As a giant star.

Explanation:

A

how hydrogen chloride gas is prepared on labrotary by conc sulpheric acid

Answers

Answer:

It is prepared small amounts of hydrogen cloride for uses in the lab.

It can be  "generated in an HCl generator by dehydrating hydrochloric acid with either sulfuric acid or anhydrous calcium chloride."

Read the following statement:

Energy cannot be created or destroyed.

Does the statement describe a scientific law? (3 points)

a
No, because it universally applies to all objects

b
No, because it is not true in all circumstances

c
Yes, because it universally applies to all objects

d
Yes, because it is not true in all circumstances

Answers

Answer:

C. yes, because it is universally applies to all objects

H2+O=???????????????????

Answers

Answer:

H₂O

Explanation:

Two molecules of Hydrogen and one molecules of Oxygen, when mixed, create H₂O, or water. There is no scientific name for H₂O due to it's common name. It is just refereed to as "water" or H₂O.

a. You have a stock solution of 14.8 M NH3. How many milliliters of this solution should you dilute to make 1000.0 mL of 0.250 M NH3?
b. If you take a 10.0 mL portion of the stock solution and dilute it to a total volume of 0.500 L, what will be the concentration of the final solution?

Answers

Answer:A) V = 16.892 ml

Explanation:

M1 * V1 = M2 * V2

14.8 M * V1 =0.250 M * 1000 ml

V1 = 16.892 ml

a. The volume of 16.89 milliliters of the stock solution of 14.8 M  should be diluted to make 1000.0 mL of 0.250 M.

b. The concentration of the final solution is 0.296 M.

What is the dilution law?

The concentration or the volume of the concentrated or dilute solution can be calculated by using the equation:

M₁V₁ = M₂V₂

where M₁ and V₁ are the concentration and volume of the concentrated solution respectively and M₂ and V₂ are the concentration and volume of the dilute solution.

A stock solution is a solution that has a high concentration and that will be diluted to a low concentration by the addition of water in it.

Given, a stock solution of concentration, M₁ = 14.8 M

The concentration of the diluted solution, M₂ = 0.250 M

The volume of diluted solution, V₂  = 1000ml

Substitute the value of the molarity and volume in equation (1):

(14.8)× (V₁) = (1000) × (0.250)

V₁ = 16.89 ml

Similarly, for part (b): M₁ = 14.8 M, V₁ = 10 ml and V₂  = 0.5L = 500 ml

(14.8)× (10) = (500) × (M₂)

M₂ = 0.296 M

Learn more about dilution law, here:

https://brainly.com/question/15718488

#SPJ5

Other Questions
PLISSSSSS HELP!!!!!!!!!!!!! i will give brainliest..... SafeRide, Inc. produces air bag systems that it sells to North American automobile manufacturers. Although the company has a capacity of 300,000 units per year, it is currently producing at an annual rate of 180,000 units. SafeRide, Inc. has received an order from a German manufacturer to purchase 60,000 units at $9.00 each. Budgeted costs for 180,000 and 240,000 units are as follows: 180,000 Units 240,000 UnitsManufacturing costs Direct materials $450,000 $600,000Direct labor 315,000 420,000Factory overhead 1,215,000 1,260,000Total 1,980,000 2,280,000Selling and administrative 765,000 780,000Total $2,745,000 $3,060,000Costs per unit Manufacturing $11.00 $9.50Selling and administrative 4.25 3.25Total $15.25 $12.75Sales to North American manufacturers are priced at $20 per unit, but the sales manager believes the company should aggressively seek the German business even if it results in a loss of $3.75 per unit. She believes obtaining this order would open up several new markets for the company's product. The general manager commented that the company cannot tighten its belt to absorb the $225,000 loss ($3.75 60,000) it would incur if the order is accepted.(a) Determine the finanicial implications of accepting the order.(b) How would your analysis differ if the company were operating at capacity? Determine the advantage or disadvantage of accepting the order under full-capacity circumstances. 1. When a solution of an acid contains larger amount of acid, it is said to be Find the appropriate answer for each word problem.a. A group of twelve art students are visiting a local art museum for a field trip. The total cost of admission for the students is $125. What is the cost of admission for each student?b. The school van can carry twelve passengers at a time. What is the least number of trips the van must make in order to bring 125 passengers to the same location?c. Charlotte and her mother baked 125 cookies to give as Christmas gifts to their neighbors. If they plan to give a dozen cookies to each neighbor, how many neighbors will receive a gift?d. Nicholas and Elaine are planning to serve cheesecake for dessert at their wedding and have purchased twelve cheesecakes. If the cheesecakes are divided evenly among the 125 wedding guests, how much cheesecake will each guest receive?I WILL GIVE BRAINLIEST IF CORRECT A survey asks a random sample of 1500 adults in Ohio if they support an increase in the state sales tax from 5% to 6%, with the additional revenue going to education. Let ^ p denote the proportion in the sample who say they support the increase. Suppose that 47% of all adults in Ohio support the increase. The standard deviation of the sampling distribution is What geographical feature contributed to why North Africa developed so differently from southern Africa? which statements are true about the target function? Check all that apply.tan(PAB) = y/xtan(APB) = x/ytan(PAB) = sin(PAB)/cos(PAB)tan(PAB) = cos(PAB)/sin(PAB)tan(PAB) = PB/AB 11. Where did the concept of Colorism originate in the black community?| Abraham set the table for a picnic using round plates. Each plate has a diameter of 8 inches. What is the area of each plate? Can someone help me with this an my other work please? The triangles are similar by?? 2c(u-6)+(u-6) complete the expression Which ordered pair is a solution of 2x+4y=6x-y I need help Im rubbish at maths and I really dont know Find the area of the shape below.11 cm14 cm9 cm20 cm Where would the normal force exerted on the rover when it rests on the surface of the planet be greater Jason has been working on losing weight. He has increased his physical activity and has been changing his diet. He finds that he really enjoys the taste of fresh fruit and vegetables, and a farmers'market near him sells locally grown produce at affordable prices. However, commercials for fast-food restaurants continue to tempt him, and sometimes he cheats on his diet.Which factors are most likely to help Jason stick to a healthy-eating plan? Select three options.food costtaste budsfood availabilityadvertisementsdietary guidelines g A mass of 2.0 kg traveling at 3.0 m/s along a smooth, horizontal plane hits a relaxed spring. The mass is slowed to zero velocity when the spring has been compressed by 0.15 m. What is the spring constant of the spring SOMEONE HELP ME QUICK!!! The reallocation of congressional seats among the states every ten years, following the census, is known as