A s'more requires 2 graham cracker squares, 1 marshmallow, and 3 chocolate pieces. If an entire chocolate bar contains 12 chocolate pieces, a marshmallow bag contains 40 marshmallows, and a graham cracker package contains 48 squares, how many s'mores can you make from 8 chocolate bars, one bag of marshmallows, and a package of graham crackers?
Explanation:
try 96 if that's not right let me know and I'll try to fix it
Answer:24
Explanation:
What is ethane?
A. A polymer
B. An alkyne
C. An alkane
D. An alkene
Answer:
D. An alkene
Explanation:
because Ethane is C2H4
Answer:
It's a alkANE. C.
Explanation:
The easiest way to memorize this is to look at the endings. Substances that end in -ANE are alkANEs. Substances that end in -ENE are alkENEs. Substances that end in -YNE are alkYNEs.
A substance which is made up of the same kind
of atom is known as?
Answer:
Element
Element : A pure substance composed of the same type of atom throughout. Compound : A substance made of two or more elements that are chemically combined in fixed amounts.
Explanation:
how is the Sun classified?
A as a giant star
B as a medium star
C as a white star as a neutron star
D as a white dwarf
Answer:
As a giant star.
Explanation:
A
Write chemical equations for the reactions that occur when solutions of the following substances are mixed:
a. HNO₂ (nitrous acid) and C₂H₇NO (aq) ethanolamine, a base.
b. H₃O+ and F-
a) HNO₂ + C₂H₇NO → N₂ + C₂H₆O + H₂O
b) H₃O⁺ + F⁻ → HF + H₂O
[tex]\large\color{lime}\boxed{\colorbox{black}{Answer : - }}[/tex]
a) HNO₂ + C₂H₇NO → N₂ + C₂H₆O + H₂O
b) H₃O⁺ + F⁻ → HF + H₂O
2. Calculate the wavelength of the emitted photon from hydrogen for the transition from ni = 3 to nf = 2. What part of the visible spectrum is this wavelength? Visible wavelengths are: Red 700 - 620 nm, Yellow 620 - 560 nm, Green 560 - 500 nm, Blue 500 - 440 nm, and Violet 440 - 400 nm.
Answer:
The correct answer is "654.54 nm".
Explanation:
According to the question,
⇒ [tex]\frac{1}{\lambda}= Rh(\frac{1}{n1^2} -\frac{1}{n2^2} )[/tex]
By substituting the values, we get
[tex]=1.1\times 10^7(\frac{1}{4} -\frac{1}{9} )[/tex]
[tex]=1.1\times 10^7(\frac{9-4}{36} )[/tex]
[tex]=1.1\times 10^7(\frac{5}{36} )[/tex]
[tex]=654.54\ nm[/tex]
Thus the above is the right solution.
Read the following statement:
Energy cannot be created or destroyed.
Does the statement describe a scientific law? (3 points)
a
No, because it universally applies to all objects
b
No, because it is not true in all circumstances
c
Yes, because it universally applies to all objects
d
Yes, because it is not true in all circumstances
Answer:
C. yes, because it is universally applies to all objects
Write balanced equations for the reaction of each of the following carboxylic acids with NaOH. Part A formic acid Express your answer as a chemical equation. A chemical reaction does not occur for this question. Request Answer Part B 3-chloropropanoic acid Express your answer as a chemical equation. nothing A chemical reaction does not occur for this question.
Answer:
Part A
HCOOH(aq) + NaOH(aq) → HCOONa(aq) + H2O(l)
Part B
ClCH2CH2CO2H(aq) + NaOH(aq) ------> ClCH2CH2CO2Na(aq) + H2O(l)
Explanation:
The reaction between an alkanoic acid and a base is a neutralization reaction. The reaction occurs as follows;
RCOOH + NaOH ----> RCOONa + H2O
We have to note the fact that the net ionic reaction still remains;
H^+(aq) + OH^-(aq) ---> H2O(l)
In both cases, the reaction can occur and they actually do occur as written.
Explain why you get a basic solution when you dissolve NaF in water.
Answer:
The fluoride ion is capable of reacting, to a small extent, with water, accepting a proton. The fluoride ion is acting as a weak Brønsted-Lowry base. The hydroxide ion that is produced as a result of the above reaction makes the solution slightly basic.
So
we get a basic solution when you dissolve NaF in water.
Na is a alkaline earth metal
Metallic compound dissolved in water acts as base
Also there is another reason
Na F is ioniC
Fluorine is known as having highest electron affinity in world
It can accept a line pair of OH-
So it's Bronsted Lowry base .
It can also acts as Arrhenius baseHence its basic
How many moles of Al are needed to react exactly with 10.00 moles of Fe2O3 according to the following
equation?
Fe2O3 + 2 Al → Al2O3 + 2Fe
A) 15.0 moles
1
B) 20.0 moles
C) 30.0 moles
D) 60.0 moles
E) 35.0 moles
Answer:
Answer is B) 20.0 moles
Explanation:
From the equation,
1 mole of Fe2O3 = 2 moles of Al
therefore 10.0 moles of Fe2O3 = 10×2
= 20.0 moles.
H2+O=???????????????????
Answer:
H₂O
Explanation:
Two molecules of Hydrogen and one molecules of Oxygen, when mixed, create H₂O, or water. There is no scientific name for H₂O due to it's common name. It is just refereed to as "water" or H₂O.
how many CH4 molecules are in 14.8 g of CH4
Answer:
[tex]\boxed {\boxed {\sf 5.56 \times 10^{23} \ molecules \ CH_4}}[/tex]
Explanation:
We are asked to find how many molecules of methane are in 14.8 grams of the substance.
1. Convert Grams to MolesFirst, we convert grams to moles. We use the molar mass, or the mass of 1 mole of a substance. These values are equivalent to the atomic masses found on the Periodic Table, however the units are grams per mole instead of atomic mass units.
We are given the compound methane, or CH₄. Look up the molar mass of the individual elements (carbon and hydrogen).
C: 12.011 g/mol H: 1.008 g/molCheck the formula for subscripts. Hydrogen (H) has a subscript of 4, so there are 4 moles of hydrogen in 1 mole of methane. We must multiply hydrogen's molar mass by 4, then add carbon's molar mass.
H₄: 1.008 * 4 = 4.032 g/mol CH₄: 12.011 + 4.032 = 16.043 g/molNow we use dimensional analysis to convert. To do this, we set up a ratio using the molar mass.
[tex]\frac {16.043 \ g \ CH_4 }{ 1 \ mol \ CH_4}[/tex]
Since we are converting 14.8 grams of methane to moles, we multiply by this value.
[tex]14.8 \ g \ CH_4 *\frac {16.043 \ g \ CH_4 }{ 1 \ mol \ CH_4}[/tex]
Flip the ratio so the units of grams of methane cancel.
[tex]14.8 \ g \ CH_4 *\frac{ 1 \ mol \ CH_4} {16.043 \ g \ CH_4 }[/tex]
[tex]14.8 *\frac{ 1 \ mol \ CH_4} {16.043}[/tex]
[tex]\frac {14.8}{16.043} \ mol \ CH_4= 0.9225207256 \ mol \ CH_4[/tex]
2. Moles to MoleculesNext, we convert moles to molecules. We use Avogadro's Number or 6.022 × 10²³. This is the number of particles (atoms, molecules, formula units, etc.) in 1 mole of a substance. In this problem, the particles are moles of methane. Set up another ratio using Avogadro's Number.
[tex]\frac { 6.022 \times \ 10^{23} \ molecules \ CH_4}{ 1 \ mol \ CH_4}[/tex]
Multiply by the number of moles we calculated.
[tex]0.9225207256\ mol \ CH_4 * \frac { 6.022 \times \ 10^{23} \ molecules \ CH_4}{ 1 \ mol \ CH_4}[/tex]
The units of moles of methane cancel.
[tex]0.9225207256* \frac { 6.022 \times \ 10^{23} \ molecules \ CH_4}{ 1 }[/tex]
[tex]5.55541981 \times 10^{23} \ molecules \ CH_4[/tex]
3. RoundThe original measurement of grams (14.8) has 3 significant figures, so our answer must have the same. For the number we calculated, that is the hundredth place. The 5 in the thousandth place tells us to round the 5 in the hundredth place up to a 6.
[tex]5.56 \times 10^{23} \ molecules \ CH_4[/tex]
14.8 grams of methane is equal to approximately 5.56 × 10²³ molecules of methane.
Which is the electronic configuration for oxygen?
# of protons
# of neutrons
# of electrons
Atomic Number
Mass Number
18
17
35
17
37
6
8
6
6
15
Answer:
35
Explanation:
is the answer for your question
how hydrogen chloride gas is prepared on labrotary by conc sulpheric acid
Answer:
It is prepared small amounts of hydrogen cloride for uses in the lab.
It can be "generated in an HCl generator by dehydrating hydrochloric acid with either sulfuric acid or anhydrous calcium chloride."
A chunk of a metal alloy displaces 0.58 L of water and has a mass of 2.9 kg. What is the density of the alloy in g/cm3?
Answer:
5g/cm3
Explanation:
firstly convert the litres and kilograms to grams and centimeters.
1l is equivalent to 1000cm3
0.58×1000
580cm3
and 1kg is equivalent to 1000g
2.9×1000
2900
then find the density by using the formula
density=mass/volume
=2900g/580cm3
=5g/cm3
I hope this helps
Consider the reaction: A(aq) + 2B (aq) === C (aq). Initially 1.00 mol A and 1.80 mol B
were placed in a 5.00-liter container. The mole of B at equilibrium was determined to
be 1.00 mol. Calculate K value.
0.060
5.1
25
17
Ugh
Answer:
17
Explanation:
Step 1: Calculate the needed concentrations
[A]i = 1.00 mol/5.00 L = 0.200 M
[B]i = 1.80 mol/5.00 L = 0.360 M
[B]e = 1.00 mol/5.00 L = 0.200 M
Step 2: Make an ICE chart
A(aq) + 2 B(aq) ⇄ C(aq)
I 0.200 0.360 0
C -x -2x +x
E 0.200-x 0.360-2x x
Then,
[B]e = 0.360-2x = 0.200
x = 0.0800
The concentrations at equilibrium are:
[A]e = 0.200-0.0800 = 0.120 M
[B]e = 0.200 M
[C]e = 0.0800 M
Step 3: Calculate the concentration equilibrium constant (K)
K = [C] / [A] × [B]²
K = 0.0800 / 0.120 × 0.200² = 16.6 ≈ 17
What mass of water is formed in the reaction of 4.16g H with excess oxygen gas.
Answer:
Explanation:
Start with a balanced equation.
2H2 + O2 → 2H2O
Calculate mole H2 using the formula: n = m/M, where:
n = mole
m = mass (g)
M = molar mass (g/mol)
Calculate molar mass of H2.
M H2 = 2 × 1.008 g/mol = 2.016 g/mol
Calculate moles H2.
n H2 = 4.16 g H2/2.016 g/mol = 2.063 mol H2
Calculate moles H2O by multiplying moles H2 by the mole ratio between H2O and H2 from the balanced equation, so that moles H2 cancel.
2.063 mol H2 × (2 mol H2O/2 mol H2) = 2.063 mol H2O
The mass of water will be calculated by rearranging the n = m/M formula to isolate m;
m = n × M
Calculate the molar mass H2O.
M H2O = (2 × 1.008 g/mol) + (1 × 15.999 g/mol) = 18.015 g/mol
Calculate the mass H2O.
m = n × M = 2.063 mol H2O × 18.015 g/mol = 37.2 g H2O
4.16 g H2 with excess O2 will produce 37.2 g H2O.
Lewis Structures are used to describe the covalent bonding in molecules and ions. Draw a Lewis structure for NO3- and answer the following questions based on your drawing.
1. For the central nitrogen atom:
The number of lone pairs = ________
The number of single bonds=_______
The number of double bonds= ______
2. The central nitrogen atom :
Answer:
The lewis structure for NO₃⁻ is shown in the attachment below
For the central nitrogen atom:
The number of lone pairs = 0
The number of single bonds = 2
The number of double bonds= 1
Explanation:
The lewis structure for NO₃⁻ is shown in the attachment below.
From the Lewis structure
For the central nitrogen atom:
The number of lone pairs = 0
The number of single bonds = 2
The number of double bonds= 1
What is the biggest cause of change in Earth's systems?
A. Heat
B. Motion
C. Friction
D. Plate tectonics
Answer:
heat
Explanation:
because it's the cause of change
Answer:
heat
Explanation:
because it is a natural factor that causes the change in Earth's system
Determine the number of hydrogen atoms connected to each carbon atom: The bond-line structure of a compound has a SMILES string of CC1CCN(CC1N(C)C2=NC=NC3=C2C=CN3)C(=O)CC#N. All the carbon atoms of the compound are highlighted and labeled a through p.
Answer:
dsgsdfd
Explanation:
What are the effects of global warming?
the effects are: temperature rises, water shortages, and increased fire threats
Sean plated an unknown metal onto his silver ring which initially weighed 1.4 g. He constructs an electrolytic cell using his ring as one of the electrodes. After running the cell, 0.022 moles of the unknown metal was plated onto his ring and the mass of the ring increased to 3.137 g. What is the atomic weight of the unknown metal in g/mol
Answer:
79 g/mol
Explanation:
Mass of unknown metal deposited = 3.137 g - 1.4 g = 1.737 g
Number of moles of metal deposited = 0.022 moles
Since;
Number of moles = reacting mass/molar mass
Molar mass = reacting mass/number of moles
Molar mass = 1.737 g/0.022 moles
Molar mass= 79 g/mol
Two common methods to generate an aldehyde is by oxidation of an alcohol and through ozonolysis.
a. True
b. False
Answer:
a. True.
Explanation:
Only primary and secondary alcohols can oxidise to give an aldehyde. But a weak oxidizing agent must be used to prevent formation of a carboxylic acid or ketone.
weak oxidizing agents: Chromyl chloride, silver/oxygen/500°C
take an example of ethanol:
[tex]{ \bf{CH _{3} CH_{2}OH \: \: \frac{Ag/O_{2} }{500 \degree C} > \: \:CH _{3} CHO}}[/tex]
[tex]{ \sf{CH _{3} CHO \: \: is \: ethanal}} [/tex]
By ozonolysis:
Here, reactants are Ozone gas, Carbon tetrachloride at a temperature (<20°C), ethanoic acid, zinc and water.
take an example of propanol:
if it undergoes ozonolysis, it gives ethanal and methanal.
Answer:
A. True
Explanation:
Only primary and secondary alcohols can oxidise to give an aldehyde. But a weak oxidizing agent must be used to prevent formation of a carboxylic acid or ketone.
weak oxidizing agents: Chromyl chloride, silver/oxygen/500°C
take an example of ethanol:
By ozonolysis:
Here, reactants are Ozone gas, Carbon tetrachloride at a temperature (<20°C), ethanoic acid, zinc and water.
take an example of propanol:
if it undergoes ozonolysis, it gives ethanal and methanal.
a. You have a stock solution of 14.8 M NH3. How many milliliters of this solution should you dilute to make 1000.0 mL of 0.250 M NH3?
b. If you take a 10.0 mL portion of the stock solution and dilute it to a total volume of 0.500 L, what will be the concentration of the final solution?
Answer:A) V = 16.892 ml
Explanation:
M1 * V1 = M2 * V2
14.8 M * V1 =0.250 M * 1000 ml
V1 = 16.892 ml
a. The volume of 16.89 milliliters of the stock solution of 14.8 M should be diluted to make 1000.0 mL of 0.250 M.
b. The concentration of the final solution is 0.296 M.
What is the dilution law?The concentration or the volume of the concentrated or dilute solution can be calculated by using the equation:
M₁V₁ = M₂V₂
where M₁ and V₁ are the concentration and volume of the concentrated solution respectively and M₂ and V₂ are the concentration and volume of the dilute solution.
A stock solution is a solution that has a high concentration and that will be diluted to a low concentration by the addition of water in it.
Given, a stock solution of concentration, M₁ = 14.8 M
The concentration of the diluted solution, M₂ = 0.250 M
The volume of diluted solution, V₂ = 1000ml
Substitute the value of the molarity and volume in equation (1):
(14.8)× (V₁) = (1000) × (0.250)
V₁ = 16.89 ml
Similarly, for part (b): M₁ = 14.8 M, V₁ = 10 ml and V₂ = 0.5L = 500 ml
(14.8)× (10) = (500) × (M₂)
M₂ = 0.296 M
Learn more about dilution law, here:
https://brainly.com/question/15718488
#SPJ5
Critique this statement: Electrons can exist in any position
outside of the nucleus.
Answer:
However, there has to be 2 electrons on the first shell, and 8 on the others.
Explanation:
Hope this helps :)
A number is three times the difference between twenty and the number. What is the number?
Answer:
the number is 7
Explanation:
"Three times" means multiply by 3
"Difference" means subtract
"Sum" means add
3(x - 7) = 23 - (3x + 2)
3x - 21 = 23 - 3x - 2
3x - 21 = 21 - 3x
6x = 42
x = 7
What does X represent in the following reaction?
239 239
93NP → 94Pu + X
A) a neutron
C) an alpha particle
B) a proton
D) a beta particle
Answer:
D. beta particle
Explanation:
Pu has 94 protons which is only one more than Np (93), that means beta decay. Atomic mass stays the same in beta decay. Beta is very small particle so atomic mass stays at 239.
The given reaction is an example of beta decay where the atomic number of the nuclei increases by one unit and mass number remains unchanged. Therefore, the particle X is a beta particle or an electron.
What is beta decay?Heavy unstable isotopes of atoms undergoes nuclear decay by the emission of charged particles such as alpha or beta particle. In alpha decay, the helium nuclei is emitted and in beta decay, electrons are emitted.
In alpha decay, the mass number of the nuclei decreases by 4 units and atomic number by 2 units. In beta decay, the mass number does not change but the atomic number increases by one unit.
Neptunium undergoes beta decay and forms the plutonium nuclei. Thus X is a beta particle. The reaction is written as follows:
[tex]\rm _{93} ^{239}Np \rightarrow _{94}^{239}Pu + _{-1}^{0}e[/tex]
To find more on beta decay, refer here:
https://brainly.com/question/25455333
#SPJ2
A wavelength of 489.2 nm is observed in a hydrogen spectrum for a transition that ends in the nf level of the Balmer series. What was ni for the initial level of the electron
Answer:
[tex]n_1=4[/tex]
Explanation:
From the question we are told that:
Wavelength [tex]\lambda=489.2 nm =>4.86*10^{-7}[/tex]
nf level= Balmer series
nf level= 2
Generally the equation for Wavelength is mathematically given by
[tex]\frac{1}{\lambda}=R[\frac{1}{nf^2}-\frac{1}{n_1^2}][/tex]
Where
[tex]R=Rydberg Constant[/tex]
[tex]R=1.097*10^7[/tex]
Therefore
[tex]\frac{1}{4.86*10^{-7}}=1.097*10^7[\frac{1}{2^2}-\frac{1}{n_1^2}][/tex]
[tex]n_1=4.0021[/tex]
[tex]n_1=4[/tex]
Choose the most correct answer: The endothermic (∆H > 0) reaction:
a) Cannot occur at all temperature.
b) Can occur with the positive ∆S at high temperature.
c) Can occur with the negative ∆S at low temperature.
d) Cannot occur with the positive ∆S at high temperature.
Answer:
B
Explanation:
In order to create spontaneity, an endothermic process has to occur along with positive entropy and high temperature
