cross out 3 digits in the number 51489704 so that the number remaining is divisible by 45

Answers

Answer 1

Answer:

1,152

Step-by-step explanation:

So here, we shall be removing random numbers

For ease, since the number is divisible by 45: it is advisable to end the selected number with zero

So we have it that;

we are crossing the first 4, 9 and 7

So, we are left with;

51,840

dividing this by 45 will give 1,152


Related Questions

please help me with this problem

Answers

Answer:

Step-by-step explanation:

I'm not sure but i think your right

Find the equation of a line perpendicular to 8x - 2y = 4 and passes through the point (4, 3).

Answers

y = -2x-3

Lines that are perpendicular have slopes that are negative reciprocals of each other. Meaning, if a line has slope  , then a line perpendicular to this has slope . That means the slope of our perpendicular line is

The equation of the line that is perpendicular to 8x - 2y = 4 and passes through the point (4, 3) is y = (-1/4)x + 4.

To find the equation of a line that is perpendicular to the line 8x - 2y = 4 and passes through the point (4, 3), we can use the fact that the slopes of perpendicular lines are negative reciprocals of each other.

First, let's rewrite the given equation in slope-intercept form (y = mx + b), where m represents the slope:

8x - 2y = 4

-2y = -8x + 4

Divide both sides by -2:

y = 4x - 2

The slope of the given line is 4.

The slope of a line perpendicular to this line would be the negative reciprocal of 4, which is -1/4.

Now, we have the slope (-1/4) and a point (4, 3). We can use the point-slope form of a linear equation:

y - y₁ = m(x - x₁)

Substituting the values, we have:

y - 3 = (-1/4)(x - 4)

Expanding and simplifying, we get:

y - 3 = (-1/4)x + 1

Adding 3 to both sides, we have:

y = (-1/4)x + 4

To learn more about equation click on,

https://brainly.com/question/20712656

#SPJ2

Will Mark Brainlest Help Please !!!!!​

Answers

Answer:

a = - 2, b = 3

Step-by-step explanation:

B + C

= [tex]\left[\begin{array}{ccc}6&4\\2&6\\\end{array}\right][/tex] + [tex]\left[\begin{array}{ccc}1&-1\\2a&-6\\\end{array}\right][/tex] ( add corresponding elements )

= [tex]\left[\begin{array}{ccc}7&3\\2+2a&0\\\end{array}\right][/tex]

Then

[tex]\left[\begin{array}{ccc}5&b\\a&0\\\end{array}\right][/tex] = [tex]\left[\begin{array}{ccc}7&3\\2+2a&0\\\end{array}\right][/tex]

Equating corresponding elements gives

b = 3

a = 2 + 2a ( subtract 2a from both sides )

- a = 2 ( multiply both sides by - 1 )

a = - 2

A sports scientist has made the formula below that gives the energy in joules provided,
e
per
ml
,
a
consumed of a power drink.



e=a×0.2



Substitute in
660
for the amount consumed,
a
, in an energy shake and give the energy provided,
e
.

Answers

Gotta space it better but I think it’s .35

If C.P. = Rs. 480, S.P. =Rs.528 find profit and profit percent​

Answers

In this question first you should find profit amount by using formula and you should use profit amount in profit percentage formula then you should calculate it

HELP ME PLEASE I NEED HELP

Consider the end behavior of the function g(x) = 4|x − 2| − 3.

As x approaches negative infinity, f(x) approaches POSITIVE OR NEGATIVE infinity.


As x approaches positive infinity, f(x) approaches POSITIVE OR NEGATIVE infinity.

Answers

Answer:

Step-by-step explanation:

This is a narrower-than-normal absolute value graph, which is a v-shaped graph. It's pointy part, the vertex, lies at (2, -3) and it opens upwards without bounds along both the positive and negative x axes. Therefore, as x approaches negative infinity, f(x) or y (same thing) approaches positive infinity. As x approaches positive infinity, f(x) approaches positive infinity.

12. PLEASE HELP ME
Which of the following are the coordinates of the vertex of y= x2 - 10x + 2?

A. (–10, 2)

B. (2, –10)

C. (–5, 23)

D. (5, –23)

Answers

Answer:

I think b no. is the correct answer

Answer:

D. (5, –23)

Step-by-step explanation:

The vertex is in essence the turning point of the parabola y = x² − 10x + 2

the x coordinate of the turning point =  

                                                        =  

                                                        =  5

when x = 5, y = (5)² - 10(5) + 2

                     = -23

Thus coordinate or vertex is ( 5, -23)

5 right 23 down

Geometry, please answer question ASAP

Answers

Answer:

Triangle ACB =~ triangle DFE, by adding 6 units to each side of both triangles their relationship will not change. They are still similar.

Step-by-step explanation:

The answer isn't great in all honesty but it's been a long time since I took geometry and I don't 100% remember the proper way of stating it. Though I am 100% sure they stay similar.

Sorry couldn't be of more help but figured something was better then nothing

The total number of cupcakes soldduring 5 days was 2087. The number of cupcakes sold by the shop on Thursday was 3 times the cupcakes sold on Monday. How many cupcakes were sold on Thursday?

Answers

Answer:

1252

Step-by-step explanation:

We're assuming that the same amount of cupcakes were sold each day.

2087/5 = 417.4

417.4 x 3 = 1252.2

Since we can't sell fractions of a cupcake, 1252 were sold on Thursday.

can someone help me with this?

Answers

Answer:

The answer is 660

Step-by-step explanation:

30×2200÷100= 660

Answer:

660

Step-by-step explanation:

to know 30%

2200÷10×3=660

In an experiment, a student is to flip a quarter 10 times and record the number of times heads appears. A group of students performs the experiment 21 times, with these results.

6 4 5 6 5 6 4 6 2 4 3 4 5 7 5 8 7 5 3 5 5

Construct a dotplot with these data and then identify the dotplot you created.

Answers

Answer:

The average, mode, and median of the results are 5, meaning that half of the time the quarter will land on heads.

Step-by-step explanation:

The required dot plot shows the result of the experiment performed by flipping a quarter 21 times.


In an experiment, a student is to flip a quarter 10 times and record the number of times heads appears. A group of students performs the experiment 21 times, with these results. 6 4 5 6 5 6 4 6 2 4 3 4 5 7 5 8 7 5 3 5 5.


What is arithmetic?

In mathematics, it deals with numbers of operations according to the statements. There are four major arithmetic operators, addition, subtraction, multiplication, and division,

What is Statistic?

Statistics is the study of mathematics that deals with relations between comprehensive data.

Here,
The dot plot has been made, for the number of outcomes and their frequencies. The dot plot gives the info about the mean mode and median.

Thus, the required a dot plot showing the result of the experiment performed by flipping a quarter 21 times.

Learn more about arithmetic here:

brainly.com/question/14753192

#SPJ2

What is the slope of the line that contains the points (9,-4) and (1,-5)? O A. 8 O B. - O c. 1 1 O D. 8​

Answers

Answer:

1/8

Step-by-step explanation:

-5-(-4)/1-9

In right triangle ABC, AB = 3 and AC = 9. What is the measure of angle B to the nearest degree?

Answers

Answer:

90 degrees

Step-by-step explanation:

see image

make x A

y B

z C

AB=3 (given)

AC=9 (given)

measure of angel B or y, is 90

if

x= A

y= C

z= B

then the hypotenuse would be shorter than one of the legs

3<9

so B has to be the right angle (90 degrees)

What is the range of the given data set? OA) 30 OB) 32 OC) 37 OD) 40​

Answers

Answer:

Range = maximum number - minimum number

maximum number = 99minimum number = 62

Range = 99 - 62 = 37

Answer:

37

Step-by-step explanation:

The range is the difference between the highest number and the smallest number.

Looking at the stem and leaf plot we can identify the largest and smallest number

Largest number: 99

Smallest number: 62

If range = largest number - smallest number then range = 99 - 62 = 37

Nghiệm của bất phương trình | 2x - 3| - 1 <0

Answers

Answer:

x = 1 và 2       x= 1 and 2

Step-by-step explanation:

Đầu tiên trừ đi 1 để được 2x-3 nhỏ hơn -1 sau đó bạn lập phương trình bằng 2x-3 = -1 và 2x-3 = 1 để nhận được kết quả cuối cùng là 1 và 2 do đó x = 1 và 2

First subtract 1 to get 2x-3 is less then -1 then you let the equation equal 2x-3=-1 and 2x-3=1 to get a final answer of 1 and 2 therefore x=1 and 2

find the ratio of Rs 20 and 900​

Answers

Answer:

1 : 45

Step-by-step explanation:

Given

Rs 20 and 900 ( divide both by 20 )

= 1 : 45

A wholesaler purchased an electric item for Rs 2,700 and sold to retailer at
10% profit. The retailer sold it at 20% profit to a consumer. How much did the
consumer pay for it.


PLZ PLZ HELP.......​

Answers

Step-by-step explanation:

10 % of 2700 = 270

so he had 2970 rupee

20% of 2970 = 594

so customer have to pay 2970 + 594 = 3564

ntroduction to Functions
Assignment Active
Creating a Function from a Mapping
The mapping shows a relationship between input and
output values.
Input
Output
Which ordered pair could be removed to make this
relation a function?
O (-5,0)
0 (-1, -3)
O (4, -2)
O (6,-1)

Answers

Answer:

To be a function, each input must only have one output. In this case, input 4 has two outputs, so (4 , -2) can be removed for it to be a function.

Let me know if you have any other questions!

The ordered pair (4,2) could be removed to make the given relation a function.

What is the relation?

A relation is a function if for every input (x-value) there is exactly one output (y-value).

If there are two or more ordered pairs with the same x-value but different y-values, then the relation is not a function. In this case, one of those ordered pairs would need to be removed in order to make it a function.

As per the question, the relation was given as {(-5,0), (2, -3), (-1, -3), (4, -2), (4, -2), (6,-1)}, the ordered pair (4,-2) would need to be removed because there are two outputs (-2 and 2) for the input of 4.

Thus, removing (4,2) would result in the function.

Learn more about the relations here:

https://brainly.com/question/29207494

#SPJ7

x = 3

x = 5

x = 0

x = 2

Answers

Answer:

x=2 is incorrect

Step-by-step explanation:

Y(2)=(3/4)*x^2=(3/4)*4=3

Which of the following is a parent function?
O A. f(x) = e*
O B. f(x) = 2.34
O x
C. f(x) = x4 +3
O D. f(x) = 2e2x

Answers

Answer:

[tex]f(x) = e^x[/tex]

Step-by-step explanation:

Given

Options (a) to (d)

Required

Which is a parent function

A parent function is such that has a single term without coefficients

From the list of given options

[tex]f(x) = e^x[/tex] suits the above definition

Other options (b) to (d) either have coefficients, or have multiple terms

(x-4)°=1
giải hộ em với ạ

Answers

Answer: 5

Step-by-step explanation:

⇒ (x - 4) = 1

⇒ x = 1 + 4

⇒ x = 5

Therefore value of x = 5

Answered by Gauthmath must click thanks and mark brainliest

TRIGONOMETRY
Could someone please help me with 5.2 please...it would really help alot:)​

Answers

sin(x+y) - sin(x-y) - 1 = cos(2x)

sin(90) - sin(x-y) - 1 = cos(2x)

1 - sin(x-(90-x)) - 1 = cos(2x)

-sin(2x-90) = cos(2x)

-1*(sin(2x)cos(90) - cos(2x)sin(90)) = cos(2x)

-1*(sin(2x)*0 - cos(2x)*1) = cos(2x)

-1*(0 - cos(2x)) = cos(2x)

-1*(-cos(2x)) = cos(2x)

cos(2x) = cos(2x)

This confirms the identity is true.

Notice that throughout this proof, I only changed the left hand side.

On the 5th line, I used the identity sin(A-B) = sin(A)cos(B)-cos(A)sin(B).

Read is solving the quadratic equation 0 equals X over two minus 2X -3 using the quadratic formula which shows the correct substitution of the values ABC into the quadratic formula quadratic formula X equals negative B+

Answers

Answer:

[tex]x = \frac{-(-2) \± \sqrt{(-2)^2 - 4*1*-3}}{2*1}[/tex]

Step-by-step explanation:

Given

[tex]0 = x^2 - 2x -3[/tex]

Required

The correct quadratic formula for the above

A quadratic equation is represented as:

[tex]ax^2 + bx + c = 0[/tex]

And the formula is:

[tex]x = \frac{-b \± \sqrt{b^2 - 4ac}}{2a}[/tex]

So, we have:

[tex]0 = x^2 - 2x -3[/tex]

Rewrite as:

[tex]x^2 - 2x - 3 = 0[/tex]

By comparison:

[tex]a= 1; b = -2; c = -3[/tex]

So, we have:

[tex]x = \frac{-b \± \sqrt{b^2 - 4ac}}{2a}[/tex]

[tex]x = \frac{-(-2) \± \sqrt{(-2)^2 - 4*1*-3}}{2*1}[/tex]

What is the length of CD

Answers

Answer:

Step-by-step explanation:

3(x-2)

Answer:

CD = 7

Step-by-step explanation:

CD and GI are of same lenghth so

3x - 6 = x + 8

transpose

3x - x = 8+6

2x = 14

x = 14/2

x = 7

Find the nth term of each of the sequences.
(a) 16, 19, 22, 25, 28, ...
(b) 1,3,9,27,81,...

Answers

Answer:

a) 16, 19, 22, 25, 28, 31, 34, 37, 40

b) 1, 3, 9, 27, 81, 243, 729, 2187

Explanation:

a) Add 3 on every number.

b) Multiply every number by 3.

A plumber gave an estimate for the renovation of a kitchen. Her hourly rate is $55 per hour and the parts for the renovation will cost $234.
If her total estimate is $509.00, how long does she expect the job to take?
hours

a.6 hours
b.7 hours
c.4 hours
d.5 hours

Answers

Answer:

12 houra

Step-by-step explanation:

404-80=27x

 

324=27x

x=324/27

x=12 hours.

The job is expected to take 5 hours, Option d.

What is unitary method?

The unitary method is a technique for solving a problem by first finding the value of a single unit, and then finding the necessary value by multiplying the single unit value.

According to the given problem,

Cost for parts = $234

Total estimate = $509.00

Amount left from total estimate after spending for parts = $( 509 - 234 )

                                                                                             = $275

Hourly rate for renovation = $55

Total hours = [tex]\frac{275}{55}[/tex] hours

                   = 5 hours.

Hence, we can conclude that she with $275, 5 hours of job can be afforded.

Learn more about unitary method here: https://brainly.com/question/19423643

#SPJ2

What is the area of the following circle?

Answers

Answer:

[tex]16\pi\:\mathrm{units^2}\text{ or }50.24\:\mathrm{ units^2}[/tex]

Step-by-step explanation:

The area of a circle with radius [tex]r[/tex] is given as [tex]A=r^2\pi[/tex].

In the question, we're given [tex]r=4[/tex] and asked to solve for [tex]A[/tex].

Substituting [tex]r=4[/tex] into [tex]A=r^2\pi[/tex], we get:

[tex]A=4^2\pi,\\A=\boxed{16\pi\:\mathrm{units^2}}[/tex]

If we use [tex]\pi=3.14[/tex] as mentioned in the question, we would have:

[tex]A=16\pi=16\cdot 3.14=\boxed{50.24\:\mathrm{units^2}}[/tex]

What is the explicit formula for this sequence?
-9, - 3, 3, 9, 15, ...

Answers

Answer:

-15+6d

Step-by-step explanation:

The common difference of the sequence is -3+9=6

The formula is an=a+(n-1)d, an=-9+(n-1)*6=-15+6d

Tim works as a server in a restaurant.
A
group
for $112.50. They leave Tim a tip of 20%.
Another group at Table 15 have a bill of
$142.75 and leave a 15% tip. Which table
of people at Table 22 have a bill
left Tim the greater tip

Answers

Answer:

The first group left a greater tip

Step-by-step explanation:

The first group left a tip of 20%. 20% of 112.5 is 22.5

The first group left a tip of 15%. 15% of 142.75 is 21.4125. Round to the nearest hundredth -> 21.41.

Therefore, the first group left a greater tip

I hope this helps!

pls ❤ and give brainliest pls

Unit Rates
Assignment Active
Completing a Rate Table
Miles
Hours
Margie can walk 3.5 miles in 1 hour.
Find the values of a, b, c, and that complete the table
showing this relationship
3.5
a=
7
v
a
5
3
d=
14
e
5

Answers

Answer:

its c

Step-by-step explanation:

i did it on ed

Answer:

Heres the answer!

Step-by-step explanation:

Other Questions
Can someone help me with this math homework please! Number of RepresentativesState196019701980Colorado456New York413934Pennsylvania272523Texas232427What was one result of the changes shown in the table?O A. A rise in wages throughout the nation's industrial areasO B. Decreased federal spending on antipoverty programsC. A decline in support for agricultural subsidiesD. Increased political power for Republicans in a chemical equation, where do the products appear The total resistance of a parallel circuit is 25 ohms. If the total current is 100mA, how much current is through a 220 ohm resistor that makes up part of the parallel circuit? Normal diploid somatic cells of the mosquito Culex pipiens contain six chromosomes. The G1 nucleus of a mosquito cell contains 3.0 x 10^-12 grams of DNA. How much nuclear DNA would be expected in metaphase I of meiosis?a. 6.0 x 10^-12 g.b. 1.5 x 10^-12 g.c. 12 x 10^-12 g.d. 3.0 x 10^-12 g.e. 0.75 x 10^-12 g. Verda used a sensor to measure the speed of a moving car at different times. At each time, the sensor measured the speed of the car in both miles per hour and kilometers per hour. The table below shows her results Write a Lewis structure that obeys the octet rule for each molecule or ion. Include resonance structures if necessary and assign formal charges to each atom. Ava graphs the function h(x) = x2 + 4. Victor graphs the function g(x) = (x + 4)2. Which statements are true regarding the two graphs? Select three options.Avas graph is a vertical translation of f(x) = x2.Victors graph is a vertical translation of f(x) = x2.Avas graph moved 4 units from f(x) = x2 in a positive direction.Victors graph moved 4 units from f(x) = x2 in a positive direction.Avas graph has a y-intercept of 4. HELP ASAP!!!!!!!!! Ill give 100 points!!!Describe wordy Guthrie's radio audience in California, their living conditions, and why they liked him Two electrons are passing 20.0 mm apart. What is the electric repulsive force that they exert on each other Who won the war? Why were they successful? Help! please don't just steal my pointss Why does Machiavelli mention Pisa at the end of the passage?to acknowledge that liberty will always triumph in the endto demonstrate that Pisa was patient in waiting to rebelto prove that cities that are not destroyed will eventually rebelto show that Florence successfully held Pisa for a hundred years What are the nouns and verbs for the sentence. There was no reason to be nervous, because it had all been worked out. In the adjoining parallelogram ABCD, A is joined to any point E on BC. AE and DC produced meet at E Prove that. area of BEF = area of CDE HELP ME I HAVE ONLY TODAY LEF TFOR SCHOOL PLS!!!!!Suppose yogurt is on sale for $0.85 a piece, and you have a coupon for $0.99 off your total purchase. Write a function rule for the cost oh N yogurts. How much would 15 yogurts cost?A: C(n) = $0.99n - $0.85; $14.00B: C(n) = $0.85n - $0.99; $11.76C: C(n) = $0.85n; $12.75D: C(n) = $0.99n; $14.85 why mathematics is the very important in a small business? is mathematics is helpful to you? explain Why is Washington DC not represented in congress? When body temperature increases, thermoreceptors are stimulated and send nerve signals to the CNS. The CNS sends motor signals to sweat glands, which attempt to reduce body temperature. This is an example of a __________ reflex.a. organ.b. stretch.c. withdrawal.d. visceral. 25/24 as a decimal rounded to nearest hundredth