DNA is said to be the organism's genetic fingerprint. What does it mean? Give one application of this concept

Answers

Answer 1

Answer:

DNA is an organism's genetic fingerprint because it contains unique genetic information that determines its development, function, and reproduction. This unique DNA sequence can be used for identification purposes, such as establishing paternity or maternity, identifying suspects in criminal investigations, and identifying remains in forensic investigations. The field of forensic science uses DNA analysis to compare DNA profiles from crime scenes to those of potential suspects, resulting in the conviction of many criminals who would have otherwise gone unpunished.


Related Questions

How many atoms of lithium are in 18.7 g?

Answers

The  atoms of lithium that  are in 18.7 g is 16 × 10²³ atoms . This is taken out by mole concept .

What is mole concept ?

The mole is a unit of measurement similar to the pair, dozen, gross, and so on. It provides a precise count of the atoms or molecules in a bulk sample of matter. A mole is the amount of substance that contains the same number of discrete entities (atoms, molecules, ions, etc.)

if 7 grams of lithium contain 6 × 10²³ atoms

then 18.7 will contain 16 × 10²³ atoms

to know more about mole concept , visit ;

brainly.com/question/31123980

#SPJ1

1. Mass of the empty Dish 167.0 g
2. Mass of the dish plus kernel before heating 169.0 g
3. Mass of the kernels before heating 2.0 g
4. Mass of the dish plus popped corn 168.8 g
5. Mass of the popped corn 1.8 g
6. Mass of the water driven 0.2 g
7. Mass percent of water in the popcorn 10%

Given that a sample of unpopped popcorn weighed 58.2 grams and after popping the popped kernels weighed 51.1 grams, calculate the percent water in the unpopped popcorn.

Answers

The mass of water driven off during popping can be calculated by subtracting the mass of the popped corn and the dish from the mass of the dish and kernel before heating.

What is  heating ?

Heating is the process of increasing the temperature of a substance or object, typically using an external energy source such as heat, radiation, or electrical current. The heat energy is transferred to the object or substance, causing its particles to vibrate and move faster, which results in an increase in temperature. Heating is commonly used in a wide range of applications, including cooking, chemical reactions, industrial processes, and space heating.

What is  cooking?

Cooking is the process of preparing food by applying heat, typically using methods such as baking, roasting, grilling, frying, boiling, simmering, steaming, or microwaving. The aim of cooking is to make food more palatable and easier to digest, as well as to kill harmful bacteria and other microorganisms that may be present in raw food. Cooking can also enhance the nutritional value of some foods by making certain nutrients more bioavailable.

To know more  about heating visit :

https://brainly.com/question/1429452

#SPJ1

What is the amount of pi?

Answers

However, it is commonly approximated as 3.14159.

What is an irrational number ?

An irrational number is a number that cannot be expressed as a simple fraction or ratio of two integers. It is a non-repeating, non-terminating decimal. Examples of irrational numbers include pi (π), the square root of 2 (√2), and the golden ratio (∅).

What is a termination ?

In mathematics, a terminating decimal is a decimal number that has a finite number of digits after the decimal point, i.e., the decimal representation ends in a finite number of zeroes. For example, 0.75, 2.0, and 0.0625 are terminating decimals.

To know more about irrational visit :

https://brainly.com/question/15837135

#SPJ1

which the following optically active alcohol is treated with hbr, a racemic mixture of alkyl bromides is obtained

Answers

(S)-2-butanol will undergo an SN2 reaction with HBr to produce a racemic mixture of alkyl bromides. Here option B is the correct answer.

When optically active alcohol is treated with HBr, the reaction follows an SN1 or SN2 mechanism. In the case of SN1, a carbocation intermediate is formed, and in SN2, a backside attack by the nucleophile occurs. The stereochemistry of the product depends on the configuration of the intermediate and the direction of attack.

In the case of (S)-2-butanol, the hydroxyl group is attached to the second carbon atom, which makes it a primary alcohol. When treated with HBr, it undergoes an SN2 reaction, where the hydroxyl group is replaced by the bromine atom. The nucleophile attacks from the backside of the molecule, leading to an inversion of configuration.

This results in the formation of a racemic mixture of alkyl bromides, as both enantiomers have an equal chance of being attacked from either side. On the other hand, (R)-2-butanol, being the enantiomer of (S)-2-butanol, will also undergo the same reaction and produce the same racemic mixture of alkyl bromides.

In the case of (R)-1-phenyl ethanol and (S)-1-phenyl ethanol, they are secondary alcohols and can undergo either SN1 or SN2 reactions depending on the reaction conditions. However, the reaction mechanism will lead to the formation of a mixture of diastereomers, rather than a racemic mixture of enantiomers.

To learn more about alkyl bromides

https://brainly.com/question/29031148

#SPJ4

Complete question:

Which of the following optically active alcohols, when treated with HBr, results in a racemic mixture of alkyl bromides?

a) (R)-2-butanol

b) (S)-2-butanol

c) (R)-1-phenyl ethanol

d) (S)-1-phenyl ethanol

Given the equilibrium constants for the equilibria, 2NH4+(aq) + 2H2O(l) <-->2NH3(aq) + 2H3O+(aq); Kc = 3.24 x 10^-19 CH3COOH(aq) + H2O(l) <--> CH3COOH (aq) + H3O+(aq); Kc = 1.75 x 10^-5 determine Kc for the following equilibrium. CH3COOH(aq) + NH3(aq) --> CH3COOH (aq) + NH4+(aq)

Answers

Given the equilibrium constants for the equilibria, Kc for the following

equilibrium is 3.06 × 10⁴

What is equilibrium constant ?

A chemical reaction's equilibrium constant is the value of its reaction quotient at chemical equilibrium, a state attained by a dynamic chemical system after a sufficient amount of time has passed in which its composition has no measurable tendency to change further. The equilibrium constant is independent of the initial analytical concentrations of the reactant and product species in the mixture for a given set of reaction conditions. As a result, given the initial composition of a system, known equilibrium constant values can be used to determine the system's composition at equilibrium. Temperature, solvent, and ionic strength, for example, can all influence the value of the equilibrium constant.

to know more about equilibrium constant , visit ;

brainly.com/question/29129401

#SPJ1

What is the bond angle of carbonothioyl dibromide
Also what is the molecular shape

Answers

Answer:

Carbonothioyl dibromide, also known as CBr2S, has a bond angle of approximately 109.5 degrees, which is the typical tetrahedral bond angle for molecules with sp3 hybridization.

The molecular shape of CBr2S is also tetrahedral, with the two bromine atoms and the sulfur atom arranged at the corners of a tetrahedron, and the carbon atom at the center.

It is advantageous for a predator to prey exclusively on a single prey species

Answers

Answer: It is not necessarily advantageous for a predator to prey exclusively on a single prey species, as this can limit their options and make them vulnerable if the population of that prey species declines or becomes extinct. Predators that are more flexible and able to switch between different prey species may be better equipped to survive and thrive in changing environments.

However, there are some advantages to specializing in a single prey species. For example, a predator that is well adapted to hunting a particular prey species may be more efficient and successful at capturing and consuming that prey, which could provide a reliable source of energy. Additionally, if the predator and prey have co-evolved, the predator may have adaptations that specifically allow it to exploit the weaknesses or vulnerabilities of its prey, giving it an advantage over predators that are less specialized.

17 points The Art Forger Who Tricked the Nazis
Where did the trial take place? What was the defendant accused of?
What was strange about his defense?
How did Han van Meegeren manage to forge the works of art so well? What did he do to make them look authentic?
How could forensic testing have changed this case?
What ultimately happened to van Meegeren?
Money to Run, But No Skills to Hide
How did Schrenker try to fake his own death? How did he get caught?
Why is creating a new state ID harder to do these days?
Why is it so difficult to fake a passport? What is the easiest way for criminals to obtain a passport?
Why does Mr. Abagnale claim it is easy to get a fraudulent passport? What steps does someone have to take to make this happen?
Why was Mr. Abagnale arrested? What happened to him after his arrest?

Answers

Answer:

but I have a great day to be a good day for a new post it on your own life to be the

The titration of 45.0 ml of an unknown triprotic acid required 32.71 ml of 0.37 M KOH to
reach the endpoint. What is the molarity of the unknown acid?

Answers

The molarity of the unknown triprotic acid is 0.269M.

How to calculate molarity?

Molarity is the concentration of a substance in solution, expressed as the number moles of solute per litre of solution.

The molarity of the unknown acid can be calculated using the following formula:

CaVa = CbVb

Where;

Ca and Va = acid concentration and volume respectivelyCb and Vb = base concentration and volume respectively

According to this question, the titration of 45.0 ml of an unknown triprotic acid required 32.71 ml of 0.37 M KOH to reach the endpoint.

45 × Ca = 32.71 × 0.37

45Ca = 12.1027

Ca = 0.269M

Learn more about molarity at: https://brainly.com/question/8732513

#SPJ1

Which transition metal can form both a high and low spin complex? Zn2+, Cu2+, Mn3+, Ti2+

Answers

Answer: Manganese

Explanation:

With titanium, it only has two d electrons, so it can't form different high and low spin complexes. It doesn't matter because it will never fill the higher-energy orbitals. The total spin state turns out to be +1 (two unpaired d electrons, no matter what). Therefore, manganese will form both a high and low spin complex.

A gas is at 35.0°C and 4.50 L. What is the temperature of the gas if the volume is increased to 9.00 L?
A gas is at 35.0°C and 4.50 L. What is the temperature of the gas if the volume is increased to 9.00 L?
65.0°C
343°C
17.5°C
1.16°C
614°C

Answers

Answer:  343 Celsius

Explanation:

Gay lussac law

T2=T1V2/V1  Temp must be in Kelvin

T2= 308.15 X 9.00 / 4.50 =616.30 K - 273.15 to get back in celsius

=343.15 C

2. Assume
60.0 mL
of a
2.5M
potassium chromate solution is mixed with
40.0 mL
of a
3.2M
solution of iron (III) chloride. a) Will a reaction occur and if so, what reaction will occur? b) How much precipitate will be produced in grams? c) What is the concentration of each spectator ion in the final solution? What is the concentration of left-over ions in the solution? (Calculate the final concentration of each ion).
Previous qu

Answers

The displacement reaction will occur. The concentration of each spectator ion in the final solution is 3/2 moles of Fe2(CrO4)3 will be formed and Concentration of CrO4^2- will be  0.033 M

Step 1:

The balanced chemical equation for the reaction is given below:

K2CrO4 + FeCl3 -> Fe2(CrO4)3 + 2KCl

Hence, the reaction occurs between potassium chromate and iron (III) chloride.

Step 2:

We need to find out how much precipitate will be produced in grams.

Let's calculate the moles of reactants and then use mole ratio to find out the limiting reagent:

[tex]\[\text{Moles of potassium chromate} = \text{Molarity} \times \text{Volume} \div 1000\][Molarity of K2CrO4 = 2.5 M; Volume of K2CrO4 = 60.0 mL][/tex]

Moles of K2CrO4 = (2.5 x 60.0) / 1000 = 0.150 mol

[tex]\[\text{Moles of iron (III) chloride} = \text{Molarity} \times \text{Volume} \div 1000\][Molarity of FeCl3 = 3.2 M[/tex] = 3.2 M;

Volume of FeCl3 = 40.0 mL]Moles of FeCl3 = (3.2 x 40.0) / 1000 = 0.128 mol

As we see, K2CrO4 is the limiting reagent. So, FeCl3 is in excess.

Therefore, amount of Fe2(CrO4)3 precipitated is given by moles of K2CrO4 and mole ratio:

[tex]\[\text{Moles of Fe2(CrO4)3} = \text{Moles of K2CrO4} = 0.150 mol\][/tex]

Now, we will find the molecular weight of Fe2(CrO4)3 as 479.87 g/mol.

[tex]\[\text{Mass of Fe2(CrO4)3} = \text{Moles of Fe2(CrO4)3} \times \text{Molecular weight}\][/tex]

[tex]\[\text{Mass of Fe2(CrO4)3} = 0.150 \times 479.87 = 71.98\][/tex]

Therefore, the amount of precipitate produced is 71.98 g.c

We need to find out the concentration of each spectator ion in the final solution.

Firstly, we can write down the ionic equation for the reaction:

[tex]2 K+ + CrO4^2- + 3 Fe^3+ + 3 Cl^- - > 2 K+ + 3 Cl^- + Fe2(CrO4)3[/tex]

Now, we will check which ions remain in the final solution. We see that potassium and chloride ions are spectator ions. Hence, we don't need to calculate their concentration. The concentration of remaining ions can be calculated as follows:Fe3+ ions: In the given reaction, 3 moles of FeCl3 reacts with 2 moles of K2CrO4.

Hence, 3/2 moles of Fe2(CrO4)3 will be formed.

Therefore,

= [tex]\frac{3/2 \times 3.2 \times 40.0 \div 1000}{60.0 + 40.0}[/tex]

= 0.034 M\]CrO42- ions:

In the given reaction, 2 moles of K2CrO4 reacts with 3 moles of FeCl3.

Hence, 2/3 moles of Fe2(CrO4)3 will be formed.

Therefore,

Concentration{ of CrO4^2-}

= [tex]\frac{2/3 \times 2.5 \times 60.0 \div 1000}{60.0 + 40.0}[/tex]

= 0.033 M\]

For more such questions on displacement reaction , Visit:

https://brainly.com/question/20690229

#SPJ11

AsH3, HBr, KH, H2Se arrange in increasing order of acid strength

Answers

Answer:

Transcribed Image Text: Rank the following substances in order of increasing acid strength. (1 as least and 4 as most in acid strength) ✓ H₂Se ✓ HBr HI ✓ AsH3 Expert Solution

Explanation:

HOPE IT HELPS!!

is the energy of the surroundings increases for any chemical reactoin supported by the first law of thermodynamics

Answers

Yes, the increase in surrounding energy for any chemical reaction is supported by the first law of thermodynamics, which means that the total energy in the universe is constant.

Thermodynamics is the branch of science concerned with the study of heat changes in various chemical processes. There are four basic laws of thermodynamics named zeroth law, first law, second law, and third law which represents all changes in reaction.

The first law of thermodynamics states that "energy cannot be created or destroyed in a chemical reaction, but can be converted from one form to another", and if a system loses energy in the process, it can gain some through the environment.

It simply changes from one form to another, so the total energy of the universe is conserved.

For more information about first law of thermodynamics, visit :

https://brainly.com/question/30848251

#SPJ4

Complete question:

Is the energy of the surroundings increases for any chemical reaction supported by the first law of thermodynamics?

Which equation is a correctly written thermochemical equation?
OC3H8 (g) +502 (g) → 3CO2 (g) + 4H₂O (1), AH= -2,220 kJ/mol
OFe (s) + O2 (g) → Fe₂O3 (s), AH= -3,926 kJ
ONH₂Cl → NH₂ + + Cl
O2C8H18 + 250216CO2 + 18H₂O, AH=-5,471 kJ/mol

Answers

Answer:

The correctly written thermochemical equation is:

C3H8 (g) + 5O2 (g) → 3CO2 (g) + 4H2O (l), ΔH = -2,220 kJ/mol

This equation represents the combustion of propane (C3H8) in the presence of oxygen (O2) to produce carbon dioxide (CO2) and water (H2O), with a heat release of -2,220 kJ/mol. The state symbols (g) for gases and (l) for liquids indicate the physical state of each substance at standard conditions.

Explanation:

ABOVE

Predict the principal organic product of the following reaction. Specify stereochemistry where appropriate.

Answers

The major organic product of an SN2 substitution reaction is an alkene, which may be either in retention or inversion of configuration relative to the original substrate.

The reaction you are asking about is an SN2 substitution reaction, in which a nucleophile (Nu) displaces a leaving group (LG) from a molecule with an alkyl halide substrate. The major organic product of this reaction will be an alkene, which has the same carbon chain as the alkyl halide substrate. Depending on the relative configuration of the substrate, the alkene product may be the same as the original substrate (retention) or have its configuration inverted (inversion). If stereochemistry is relevant to the question, then it should be specified in the answer.

To learn more about SN2 substitution :

https://brainly.com/question/29849583

#SPJ11

According to the Bronsted-Lowry concept of acids and bases, which of the following statements about a base is NOT true? If a base is strong, then its conjugate acid will be relatively weaker. A base must contain a hydroxide group. A base will share one of its electron pairs to bind H+. A base reacts with an acid to form a salt.

Answers

According to the Bronsted-Lowry concept of acids and bases, the statement "If a base is strong, then its conjugate acid will be relatively weaker" is NOT true.

The Bronsted-Lowry concept defines an acid as a proton (H+) donor and a base as a proton acceptor. The strength of an acid or base is determined by the extent to which it is willing to donate or accept a proton. Therefore, when a strong acid donates a proton, the resulting conjugate base is also strong; likewise, when a strong base accepts a proton, the resulting conjugate acid is also strong.
Other characteristics of bases include the presence of a hydroxide group (OH-), and the ability to accept a proton (H+) to form a salt. However, the strength of a base does not necessarily depend on its presence or absence of a hydroxide group.
In conclusion, the Bronsted-Lowry concept of acids and bases states that the strength of a base does not determine the strength of its conjugate acid; therefore, the statement "If a base is strong, then its conjugate acid will be relatively weaker" is NOT true.

For more such questions on Bronsted-Lowry

https://brainly.com/question/24098522

#SPJ11

Write the electronic configuration and draw the orbital diagram for the element: lead (Z=82) State if it is diamagnetic/paramagnetic. Please decide the diamagnetic/paramagnetic property based on the orbital diagram only! (It is okay to use the noble gas in square brackets here)

Answers

Answer:

See below.

Explanation:

The atomic number of lead (Pb) is 82, which means it has 82 electrons. The electronic configuration of lead is

1s² 2s² 2p⁶ 3s² 3p⁶ 3d¹⁰ 4s² 4p⁶ 4d¹⁰ 5s² 5p⁶ 4f¹⁴ 5d¹⁰ 6s² 6p²

The orbital diagram for the valence electrons of lead (Pb) is

↑↓ ↑↓ ↑↓ ↑↓ ↑↓ ↑↓ ↑↓ ↑↓

s s p p p p d d

2 1 6 2 6 2 10 10

|||||||||

1 2 3 4 5 6 7 8

The notation ↑↓ represents a pair of electrons with opposite spins.

To determine if lead (Pb) is diamagnetic or paramagnetic, we need to look at whether there are any unpaired electrons. Based on the orbital diagram, we can see that all the electrons in the valence shell are paired, meaning that lead (Pb) is diamagnetic.

For Mn3+, write an equation that shows how the cation acts as an acid. express your answer as a chemical equation including phases.

Answers

Mn3+, an ion of manganese(III), can function as an acid by giving a proton (H+) to a base. Here's an illustration: Mn3+ (aq) + 3OH- (aq) Mn(OH)3 (s)

What colour are Mn2+ and MnO4?

There is no need to add an indicator because MnO4's vivid purple colour serves as one enough. In the conical flask, there is Fe2+. The Fe2+ solution is added, and the Fe2+ lowers the MnO4- to Mn2+. As Mn2+ is a colourless solution, the purple colour disappears.

What is the ion Mn2name? +'s

The divalent metal cation manganese(2+) contains manganese as the metal. It plays the part of a cofactor. It consists of a monoatomic dication, a manganese cation, and a divalent metal cation.

To know more about cation visit:-

https://brainly.com/question/28710898

#SPJ1

Calculate the buffer ratio (base/acid) required for a buffer of pH = 5.68 that is prepared by mixing sodium hydrogen oxalate and sodium oxalate. A table of pKa values can be found here. Report your answer to 2 significant figures in scientific notation. Calculate the pH (to two decimal places) of the buffer solution after the addition of 7.77 g of sodium hydrogen carbonate (NaHOCOO) to the buffer solution above. Assume 5% approximation is valid and that the volume of solution does not change.

Answers

122.5 grams of oxalic add dihydrate (MW = 126.07 g/mole) and disodium oxalate (MW = 133.99 g/mole) were required to prepare this buffer if the total oxalate concentration is 0.115 M.

Weak acids are defined as acids that don't completely dissociate in solution. It can be explained as any acid that is not a strong acid. The strength of a weak acid depends on how much it gets dissociates and the more it dissociates, the stronger the acid. The mass of the weak acid in a solution of a certain pH can be determined by calculating the original concentration of the acid after calculating the concentration of the hydrogen ions with the help of the pH value of the solution.

The Concentration of oxalate ion is  0.115 M.

pKa1 is 1.250.

pKa2 is 4.266.

pH is 5.193.

Molarity = (mass / molar mass) / 1 / volume in liter

The molar mass is 126.07g/mole.

Mass = Molarity × molar mass × Volume in liter

Mass=0.972 M × 126.07 g/mole × 1.00 L

        = 122.5 gram

To learn more about concentration

https://brainly.com/question/17206790

#SPJ4

The complete question is,

A buffer prepared by dissolving oxalic add dihydrate (H2C2O4⋅2H2O) and disodium oxalate (Na2C2O4) in 1.00 L of water has a pH of 5.193. How many grams of oxalic add dihydrate (MW = 126.07 g/mole) and disodium oxalate (MW = 133.99 g/mole) were required to prepare this buffer if the total oxalate concentration is 0.115 M? Oxalic acid has pKa values of 1.250 (pKa1) and 4.266 (pKa2).

The principle of polymers. polymers clearly plan an important role in the molecular economy of the cell. for each statement below, state why it is false and change it to a correct description.
a. polymers are assembled from monomers in an extracellular compartment and are transported into the cell when required.
b. polysaccharides are one of the three main macromolecular polymers in the cell. a polysaccharide molecule contains a number of different monomers, which gives rise to millions of polysaccharide sequences.

Answers

Polysaccharides are a type of carbohydrate polymer composed of repeating units of monosaccharides. They are not one of the three main types of macromolecular polymers in the cell.

The reason for false statement are as following :-

a. The statement is false because polymers are assembled from monomers within the cell, not in an extracellular compartment. Cells have the ability to synthesize a variety of polymers, including nucleic acids, proteins, and carbohydrates, to perform specific functions within the cell. The assembly of polymers from monomers is an energy-intensive process that requires enzymes and specific conditions, such as the appropriate temperature and pH level. Therefore, the synthesis of polymers typically occurs within the cell.

A correct description would be: Polymers are assembled from monomers within the cell, and the synthesis of polymers is an energy-intensive process that requires enzymes and specific conditions.

b. The statement is false because polysaccharides are not one of the three main macromolecular polymers in the cell. The three main types of macromolecular polymers in the cell are nucleic acids, proteins, and carbohydrates. Polysaccharides are a type of carbohydrate polymer, but they are not one of the three main types of macromolecular polymers. Polysaccharides are composed of repeating units of monosaccharides, which gives rise to a limited number of polysaccharide sequences.

A correct description would be: Polysaccharides are a type of carbohydrate polymer composed of repeating units of monosaccharides. They are not one of the three main types of macromolecular polymers in the cell.

To know more about polymers, visit:-

https://brainly.com/question/1602388

#SPJ1

What is the theoretical oxygen for 100 moles of propane undergoing the following combustion reaction? CsHs+502->3CO2+4 H20 O 350 moles O 21 moles O 500 moles O 400 moles

Answers

When 100 moles of propane undergo the given combustion reaction, 500 moles of oxygen will be required.

The combustion reaction of propane is given by:C₃H₈ + 5O₂ → 3CO₂ + 4H₂OFor every mole of propane, five moles of oxygen are required to complete the combustion reaction. Therefore, for 100 moles of propane, 500 moles of oxygen will be required.Theoretical oxygen for 100 moles of propane undergoing the combustion reaction is 500 moles of oxygen. Thus, the correct option is (C) 500 moles. The theoretical oxygen required is different from the actual oxygen required, which may vary due to incomplete combustion or other factors that affect the reaction.

For more such questions on combustion reaction

https://brainly.com/question/13251946

#SPJ11

Which statement below correctly describes their relative atomic radii and first ionization energy when comparing Se and Br? The atomic radius for Se is larger than Br, and the first ionization energy for Se is greater than Br. The atomic radius for Br is larger than Se, and the first ionization energy for Bris greater than Se. The atomic radius for Se is larger than Br, and the first ionization energy for Br is greater than Se. The atomic radius for Br is larger than Se, and the first ionization energy for Se is greater than Br.

Answers

At has a higher initial ionisation energy than Br, while Br has a bigger atomic radius. Se has a bigger atomic radius than Br, and Br has a higher initial ionisation energy than Se.

How do atomic radii and ionisation energy relate to one another (i.e., what happens to ionisation energy as atomic radii grow)?

The most loosely bound electron is further from the nucleus and thus easier to remove in bigger atoms. Hence, the ionisation energy should decrease as size (atomic radius) increases.

Why does ionisation energy rise across a period while decreasing down a group?

This is because the outer electrons aren't bound as strongly because they are farther from the nucleus.

To know more about ionisation energy visit:-

brainly.com/question/27356170

#SPJ1

To a beaker weighing 263.2 g, you add 87.10 g of water and 0.549 g of sugar. Determine the combined
mass of the beaker, water and sugar (in grams).

Answers

Answer: 350.849 g

Explanation:

The question is asking the masses of water, sugar, and the beaker to be added together. So, it can be understood that we need to add all of the masses up as follows to get the combined mass:

263.2 g + 87.10 g + 0.549 g = 350.849 g

From this, we can determine that the combined mass of the beaker, water, and sugar (in grams) is 350.849 g.

Chemistry Help Please! It's worth a lot of points
1.Write the equilibrium expression for the following reactions
a. H2SO4(aq) + H2O(L) ⇆ HSO4-(aq) + H3O+(aq)
b. 4NH3(g) + 5O2(g) ⇆ 4NO(g) + 6H2O(g)
c. NH4Cl(s) ⇆ NH3(g) + HCl(g)
d. N2O4(g) ⇆ 2NO2(g)

2. The following reaction has a K value of 0.050. What does that mean about the concentrations of the reactants as compared to the products? Be specific in your answer.
N2(g) + 3H2(g) ⇆ 2NH3(g)

3. The following reaction has a K value of 6.8 x 103. What does that mean about the concentrations of the reactants as compared to the products? Be specific in your answer.
2SO3(g) ⇆ 2SO2(g) + O2(g)

4. When dissolving substances in water, the degree of solubility of a substance is often represented as the solubility product constant (Ksp). The solubility product constant is the same thing as the equilibrium constant for the dissolving reaction. Two substances that dissociate in water are shown below alone with the Ksp.
NaCl(s) ⇆ Na+(aq) + Cl-(aq) Ksp = 36
BaSO4(s) ⇆ Ba2+(aq) + SO42-(aq) Ksp = 1.1 x 10-16

5. Identify and label the Brønsted-Lowry acid, its conjugate base, the Brønsted-Lowry base, and its conjugate acid in each of the following equations:
a. HNO3 + H2O ⟶ H3O+ + NO3−
b. CN− + H2O ⟶ HCN + OH−
c. H2SO4 + Cl− ⟶ HCl + HSO4−
d. HSO4− + OH− ⟶ SO42− + H2O
e. O2− + H2O ⟶2OH−

6. What is the conjugate acid of each of the following? What is the conjugate base of each of the following?
a. OH-
b. H2O
c. HCO3-
d. NH3
e. HSO4-

7. The following acids are shown with their equilibrium constants (also known as the acid dissociation constant). Rank these acids from strongest to weakest. Explain your ranking.
HCN(aq) + H2O(L) ⇆ H3O+(aq) + CN-(aq) K = 6.2 x 10-10

HC2H3O2(aq) + H2O(L) ⇆ H3O+(aq) + C2H3O-(aq) K = 1.75 x 10-5

H2CO3(aq) + H2O(L) ⇆ H3O+(aq) + HCO3-(aq) K = 4.5 x 10-7

HIO4(aq) + H2O(L) ⇆ H3O+(aq) + IO4-(aq) K = 2.3 x 10-2

8. Calculate the pH and the pOH of each of the following solutions.
a. 0.200 M HCl
b. 0.0143 M NaOH
c. 3.0 M HNO3
d. 0.0031 M Ca(OH)2

9. Wine has a pH of 3.6. What are the hydronium and hydroxide ion concentrations?

10. The hydroxide ion concentration in household ammonia is 3.2 x 10-3 M. What is the concentration of hydronium ions?

Answers

Answer:

1. Equilibrium expressions:

a. K = [HSO4-][H3O+]/[H2SO4][H2O]

b. K = [NO]^4[H2O]^6/[NH3]^4[O2]^5

c. K = [NH3][HCl]/[NH4Cl]

d. K = [NO2]^2/[N2O4]

2. Since K = 0.050, the concentrations of the reactants (N2 and H2) are larger than the concentrations of the products (NH3).

3. Since K = 6.8 x 10^3, the concentrations of the products (SO2 and O2) are larger than the concentrations of the reactant (SO3).

4. The Ksp expression for each of the reactions is:

a. Ksp = [Na+][Cl-]

b. Ksp = [Ba2+][SO42-]

5. Brønsted-Lowry acids and bases:

a. Acid: HNO3; Conjugate base: NO3-; Base: H2O; Conjugate acid: H3O+

b. Acid: HCN; Conjugate base: CN-; Base: H2O; Conjugate acid: HCN

c. Acid: H2SO4; Conjugate base: HSO4-; Base: Cl-; Conjugate acid: HCl

d. Acid: NH3; Conjugate base: NH2-; Base: H2O; Conjugate acid: NH4+

e. Acid: H2O; Conjugate base: OH-; Base: O2-; Conjugate acid: OH-

6. Conjugate acids and bases:

a. Acid: H2O; Conjugate base: OH-

b. Acid: H3O+; Conjugate base: H2O

c. Acid: H2CO3; Conjugate base: HCO3-

d. Acid: NH4+; Conjugate base: NH3

e. Acid: HSO4-; Conjugate base: SO42-

7. The strongest acid is HIO4 (highest K value), followed by HCN, HC2H3O2, and H2CO3 (lowest K value). The K values represent the degree to which the acids dissociate in solution. HIO4 is a strong acid, meaning it dissociates almost completely in solution, while H2CO3 is a weak acid, meaning it only dissociates partially.

8. pH and pOH calculations:

a. pH = -log[H3O+] = -log(0.200) = 0.699; pOH = -log[OH-] = -log(1.0 x 10^-14/0.200) = 12.301

b. pOH = -log[OH-] = -log(0.0143) = 1.844; pH = 14.000 - pOH = 12.156

c. pH = -log[H3O+] = -log(3.0) = 0.522; pOH = 13.478

d. pOH = -log[OH-] = -log(0.0062) = 2.206; pH = 14.000 - pOH = 11.794

9. Hydronium and hydroxide ion concentrations:

pH = 3.6; hydronium ion concentration = 10^-pH = 3.98 x 10^-4 M; hydro

(Please could you kindly mark my answer as brainliest you could also follow me so that you could easily reach out to me for any other questions)

Given that 4 NH3 + 5 O2 → 4 NO + 6 H2O, if 3.00 mol NH3 were made to react with excess of oxygen gas, the amount of H2O formed would be

Answers

Answer:

x mol H2O = 4.50 mol H2O

Step-by-step explanation:

From the balanced equation, we can see that for every 4 moles of NH3 that react, 6 moles of H2O are formed. Therefore, we can use a proportion to find the amount of H2O that would be formed if 3.00 mol of NH3 reacted:

4 mol NH3 : 6 mol H2O = 3.00 mol NH3 : x mol H2O

Solving for x, we get:

x mol H2O = (6 mol H2O / 4 mol NH3) * 3.00 mol NH3
x mol H2O = 4.50 mol H2O

Therefore, if 3.00 mol of NH3 were made to react with excess oxygen gas, 4.50 mol of H2O would be formed.

There are 7.68 × 1025 atoms of phosphorous in how many moles of diphosphorous pentoxide?

Answers

Answer:

7.68 x 1025 atoms of phosphorous correspond to 1.06 mole of diphosphorous pentoxide. This can also be written as 1.06 mol of P2O5.

A 0.036 M aqueous nitrous acid (HNO2) solution has an osmotic pressure of 0.93 atm at 25°C. Calculate the percent ionization of the acid.

Answers

The percent ionization of the nitrous acid in the 0.036 M aqueous solution is 2.1%.

How to calculate the percent ionization of the acid ?

The osmotic pressure (π) of a solution can be related to the molar concentration (M) of the solute and the temperature (T) of the solution by the following equation:

π = MRT

Where R is the gas constant.

We can use this equation to calculate the molar concentration of the nitrous acid solution:

M = π / RT

M = (0.93 atm) / (0.0821 L·atm/(mol·K) x 298 K)

M = 0.036 M

This is the molar concentration of the undissociated nitrous acid in the solution. To calculate the percent ionization of the acid, we need to know the concentration of the H+ and NO2- ions in the solution.

The balanced chemical equation for the dissociation of nitrous acid is:

HNO2(aq) ⇌ H+(aq) + NO2-(aq)

Let x be the extent of ionization of the nitrous acid. Then the concentration of H+ and NO2- ions can be expressed in terms of x as follows:

[H+] = x M

[NO2-] = x M

The concentration of the undissociated nitrous acid is (1-x)M.

The expression for the equilibrium constant (Ka) of the reaction can be written as:

Ka = [H+] [NO2-] / [HNO2]

Substituting the concentrations in terms of x, we get:

Ka = x^2M / (1-x)M

Simplifying the above equation, we get:

Ka = x^2 / (1-x)

The percent ionization of the acid is the fraction of the original HNO2 molecules that dissociate into H+ and NO2- ions. It can be calculated as follows:

% ionization = (concentration of H+ ions) / (initial concentration of HNO2) x 100

% ionization = (x M) / (M) x 100

% ionization = x x 100

Substituting the value of x from the above equation for Ka, we get:

Ka = x^2 / (1-x)

x = sqrt(Ka / (1+Ka))

We can calculate the value of Ka using the standard reference value of the acid dissociation constant (Ka) for nitrous acid at 25°C, which is 4.5 x 10^-4.

x = sqrt(4.5 x 10^-4 / (1+4.5 x 10^-4))

x = 0.021

% ionization = 0.021 x 100

% ionization = 2.1%

Therefore, the percent ionization of the nitrous acid in the 0.036 M aqueous solution is 2.1%.

Learn more about osmotic pressure here : brainly.com/question/25413362

#SPJ1

A student sets up a titration with a * 1 point buret filled with 0.5 M NaOH. In the flask below they place the phenolphthalein indicator and 6.2 mL of the unknown acid. The solution in the beaker turns pink after exactly 24.8 mL of NaOH have been added. Find the exact concentration of the unknown acid.

Answers

Nie was ich dich so gerne mal an dich sind auch nicht so gut ich habe es schon gemacht aber das ist ja nicht mehr das 47j ist aber hvd und

what happens when zinc chloride reacts with potassium hydroxide and what formed?​

Answers

Answer:

when the solution of potassium hydroxide and zinc chloride are mixed,the double-displacement reaction occur ,resulting in precipitation and the reaction forms potassium chloride and zinc hydroxide .

Other Questions
a piston cylinder containing air has an area of 0.011 m2 and a piston with a mass of 20.4 kg. if the atmospheric pressure is measured to be 102.3 kpa, what is the gauge pressure of the air inside the piston cylinder? the absolute pressure? *Which statement would originate from an individual who has adopted a strongly positive view on the merits of narrow socialization?a. I think adolescents should conform to our culture's norms.b. Morality is a stage-related theory of development.c. I think adolescents should be individuals.d. Cultures set a range of opportunities for development which slideshow tool is used to automatically apply changes to all of the slides in a presentation? ____ will work extreme hours and expect their subordinates to do the same.a) The Naturalb) The Politicianc) The Micromanagerd) The Workaholic A shopkeeper pays a total of $570 to buy 300 identical items. The shopkeeper sells 200 of these items. The selling price of each of these items is such that the shopkeeper makes a profit of 20% on what he paid for each item.The shopkeeper then reduces this selling price by 25% and he sells the remaining 100 items at this reduced price.Calculate the total profit made by the shopkeeper in selling all 300 items. A nurse is teaching a client who has chronic kidney disease and is to begin hemodialysis. Which of the following information should the nurse include in the teaching?A. Hemodialysis restores kidney function.B. Hemodialysis replaces hormonal function of the renal system.C. Hemodialysis allows an unrestricted diet.D. Hemodialysis returns a balance to blood electrolytes. Expand and simplify (3x - 1)(9x + 3x + 1) Some metalloids are liquids at room temperature.TRUEFALSE fifty points Hypothesis: Predict how the addition of subatomic particles will affect the structure and properties of an atom. (Example: I predict that adding more neutrons will affect . . .)Was your hypothesis correct? Why or why not? Website: https://phet.colorado.edu/sims/html/build-an-atom/latest/build-an-atom_en.html Open the Phet build-an-atom simulator. The banking industry almost exclusively uses _____ for check processing. a. OCR b. MICR c. magnetic stripesd. QR codes. which of the following is not true regarding contratistas? group of answer choices they were mexican or mexican american labor contractors who served as intermediaries between mexican laborers and their employers (who were typically anglo american) some contratistas felt genuine concern for immigrants some contratistas exploited immigrants they were always born in the u.s. With all the things you learned today, write an essay on why you need not buy or buy a product even though its a very famous one In THE BRIEF WONDROUS LIFE OF OSCAR WAO What does Yuniors chapter 5 on Abelard illustrate about the nature of storytelling and the writing of history? List all prime numbers in the 2023 February calendar Absorption costing treats fixed manufacturing overhead as a ______ cost.a. promotionb. profitc. priced. product Which element of a personal narrative would be bestfor Spencer to include next? how is the natural system helpful to the world and others? will we see a dna band in alu pcr-assay even if both chromosomes are negative for alu? Identify and name congruent triangles put the following steps in order for making a protein that will be exported from a eukaryotic cell, beginning with the first step at the top of the list. instructions choice 1 of 5. the vesicle delivers the protein to the golgi apparatus, where the protein folds and is packaged in a vesicle for export from the cell. toggle button the vesicle delivers the protein to the golgi apparatus, where the protein folds and is packaged in a vesicle for export from the cell. choice 2 of 5. the mrna binds to a ribosome of the rough er and produces a protein, which exits the er in a vesicle. toggle button the mrna binds to a ribosome of the rough er and produces a protein, which exits the er in a vesicle. choice 3 of 5. in the nucleus, genes in the dna that encode the membrane protein are copied into a messenger rna (mrna). toggle button in the nucleus, genes in the dna that encode the membrane protein are copied into a messenger rna (mrna). choice 4 of 5. the vesicle fuses with the cell membrane and releases the protein to the extracellular environment. toggle button the vesicle fuses with the cell membrane and releases the protein to the extracellular environment. choice 5 of 5. the mrna exits the nucleus through nuclear pores of the nuclear envelope. toggle button the mrna exits the nucleus through nuclear pores of the nuclear envelope.