Answer:
S + 2CO = SO2 + 2C
First, look for the amount of substance of sulfur:
n(S) = m / M
n(S) = 14.8 g/32 g / mol = 0.4625 mol
n(CO) = m (CO) / M (CO)
M(CO) = 12 + 16 = 28 g/mol
n(CO) = 19.9 g/28 g/mol = 0.71 mol
S in excess, so for calculating we take CO:
n(SO2) = n(CO)/2 = 0.71 mol/2 = 0.355 mol
m(SO2) = M(SO2)*n(SO2)
M(SO2) = 32 + 16*2 = 64 g/mol
m(SO2) = 64 g/mol * 0.355 mol = 22.74 g
To what volume (in mL) would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN?
Answer:
To 318.18 mL would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN
Explanation:
Dilution is the reduction of the concentration of a chemical in a solution and consists simply of adding more solvent.
In a dilution the amount of solute does not vary. But as more solvent is added, the concentration of the solute decreases, as the volume (and weight) of the solution increases.
In a solution it is fulfilled:
Ci* Vi = Cf* Vf
where:
Ci: initial concentration Vi: initial volume Cf: final concentration Vf: final volumeIn this case:
Ci= 1.40 MVi= 20 mLCf= 0.088 MVf= ?Replacing:
1.40 M* 20 mL= 0.088 M* Vf
Solving:
[tex]Vf=\frac{1.40 M* 20 mL}{0.088 M}[/tex]
Vf= 318.18 mL
To 318.18 mL would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN
By how many times would you expect Al2(SO4)3 to depress the F.P of water compared to sucrose C12H22011 ?
Answer:
By how many times would you expect Al2(SO4)3 to depress the F.P of water compared to sucrose C12H22011 ?.
Explanation:
The freezing point of a pure solvent decreases further by adding a nonvolatile solute.
This is called depression in freezing point.
When an ionic solute is dissolved then the depression in the freezing point is proportional to the number of ions present in the solution.
In aluminum sulfate, there are five ions formed as shown below:
[tex]Al_2(SO_4)_3(aq)->2Al^3^+(aq)+3SO_4^2^-(aq)[/tex]
But sucrose is a covalent compound and it does not undergo dissociation.
Hence, aluminum sulfate decreases the freezing point of water by five times compared to sucrose.
Explanation:
Identify the possible quantitative analysis you can do using only the 28.02 g/mol as a unit factor. Select one or more:
Answer:
Calculate the moles of N2 molecules in 3.94 grams of nitrogen.
Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules.
Explanation:
Calculate the moles of N2 molecules in 4.73 liters of nitrogen gas. FALSE. You can't make this conversion using only the conversion factor with units of g/mol. To convert liters to moles are necessaries pressure, temperature and volume of the gas to use PV = nRT
Calculate the grams of N2 in 10.58 liters of nitrogen gas. FALSE. As explained, you need, P,V and T to find the moles of the gas. With the moles you can find the mass using the conversion factor of 28.02g/mol
Calculate the moles of N2 molecules in 3.94 grams of nitrogen. TRUE. You can find the moles of N2 as follows:
3.94g N2 * (1mol/28.02g) = 0.14 moles of N2 molecules
Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules. TRUE. The mass in 5.03x10²⁰ moles of nitrogen molecules is:
5.03x10²⁰ moles * (28.02g/mol) = 1.4x10²²g of nitrogen.
If 0.250 L of a 5.90 M HNO₃ solution is diluted to 2.00 L, what is the molarity of the new solution?
Answer:
0.74 M
Explanation:
From the question given above, the following data were obtained:
Molarity of stock solution (M₁) = 5.90 M
Volume of stock solution (V₁) = 0.250 L
Volume of diluted solution (V₂) = 2 L
Molarity of diluted solution (M₂) =?
The molarity of the diluted solution can be obtained by using the dilution formula as illustrated below:
M₁V₁ = M₂V₂
5.90 × 0.250 = M₂ × 2
1.475 = M₂ × 2
Divide both side by 2
M₂ = 1.475 / 2
M₂ = 0.74 M
Thus, the molarity of the diluted solution is 0.74 M
True or false: Boron contains 2s22p1 valence electrons, so only one p orbital is needed to form molecular orbitals.
Answer:
True
Explanation:
The valence orbitals of boron are 2s2 2p1. We have to recall that all the valence orbitals whether full or empty are involved in the formation of molecular orbitals.
The number of molecular orbitals formed is equal to the number of atomic orbitals that are combined.
Since there are two valence orbitals and there is only one p orbital among the valence orbitals, it is true that only one p orbital is needed to form molecular orbitals in boron.
Rank each of the following gases in order of increasing urms assuming equivalent amounts and all gases are at the same temperature and pressure where 1 has the lowest urms and 4 has the highest urms.
a. Gas 1 : H2S
b. Gas: He
c. Gas 3: NF3
d. Gas 4: H2O
The Urms refers to the root mean square speed of the gas. The order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.
What is the Urms?The Urms refers to the root mean square speed of the gas. This is ultimately dependent on the relative molecular mass of the gases when they are maintained at the same temperature.
Now, let us look at the order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.
Learnmore about Urms: https://brainly.com/question/365923
what is the machine used to check melting point called?
Answer:
Melting-point apparatus
Que es la actividad física y en qué mejora
the force of attraction between non polar molecules are what
Answer:
dispersion force
Explanation:
What molecule is this
Answer:
That is a " ball and stick " model which represents carbon compounds.
Explanation:
This is the answer. Hope it helps you find what you're looking for.
Linoleic acid is a polyunsaturated fatty acid found, in ester form, in many fats and oils. Its doubly allylic hydrogens are particularly susceptible to abstraction by radicals, a process that can lead to the oxidative degradation of the fat or oil.
a. True
b. Flase
Answer:
True.
Explanation:
The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.
>
Which statement describes an electron?
EEEE
It has a positive charge and is located in the nucleus.
O It has a positive charge and is located in orbitals around the nucleus.
It has a negative charge and is located in the nucleus.
O It has a negative charge and is located in orbitals around the nucleus.
Answer:
It has a negative charge and is located in orbitals around the nucleus
Explanation:
The statement describes an electron is " It has a negative charge and is located in orbitals around the nucleus."
What is electron?The electron would be a subatomic particle with a negatively one elementary charge electric charge.
What is nucleus?Protons, that have a positive charge, as well as neutrons, which have no electrical charge, make up the nucleus. Quarks were subatomic particles that make up protons but also neutrons.
Electrons were present surrounding the atom's nucleus, in contrast to protons as well as neutrons, that are contained within the nucleus at its core. Negative electrons were drawn to the positive nucleus since the electric charges of opposite polarity attract one another.
To know more about electrons and nucleus.
https://brainly.com/question/23366064
#SPJ3
find out the equivalent weight of Ca(OH)2
Answer:
The equivalent weight of calcium hydroxide is 1/2 he mass of a mol of calcium hydroxide. 1 mol Ca(OH)2 = 74 grams Ca(OH)2 ; 1 equivalent Ca(OH)2 = 37 grams Ca(OH)2......
Explanation:
HOPE IT HELPS YOU
Liquid octane will react with gaseous oxygen to produce gaseous carbon dioxide and gaseous water . Suppose 10.3 g of octane is mixed with 23. g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to significant digits.
Answer:
9.36 g
Explanation:
The equation of the reaction is;
C8H18(g) + 25/2 O2(g) ----> 8CO2(g) + 9H2O(g)
Number of moles of octane = 10.3g/ 114 g/mol = 0.09 moles
1 mole of octane yields 9 moles of water
0.09 moles of octane yields 0.09 × 9/1 = 0.81 moles of water
Number of moles of oxygen = 23g/32g/mol = 0.72 moles
12.5 moles of oxygen yields 9 moles of water
0.72 moles of oxygen yields 0.72 × 9/12.5 = 0.52 moles of water
Hence oxygen is the limiting reactant;
Maximum mass of water produced = 0.52 moles of water × 18 g/mol = 9.36 g
Identify the options below that are results of adding a catalyst to a chemical system.
The reaction rates are increased.
The reaction quotient is unaffected.
The reaction quotient decreases.
The equilibrium constant is unaffected.
Answer:
The correct options are a, b and d
Explanation:
A catalyst is a substance that increases the rate of a chemical reaction by reducing the activation energy. Le Catelier's principle explains how a substance or an "action" can affect a reaction in equilibrium.
The principle states that when a change is made to the conditions of a reacting system at equilibrium, the position of the equilibrium moves to counteract the change made. These changes are change in temperature, pressure, volume and/or concentration. These changes will either cause the equilibrium to shift forward or backward.
However, the presence of a catalyst DOES NOT affect a chemical equilibrium/equilibrium constant nor does it affect the reaction quotient because the same amount of reactants and products are available just as in uncatalyzed reaction except that the reaction proceeds faster (which does not affect equilibrium).
The rate of reaction is given as the time required by the reactant to convert into the product. The addition of catalyst increases the rate of reaction, while the reaction quotient and the equilibrium remain unaffected.
What is a catalyst?A catalyst is a chemical or compound that adds to the reaction and lowers the activation energy by providing an alternative path to the reaction.
The catalyst takes part in the reaction but did not consume in the chemical reaction.
The equilibrium and the reaction quotient are dependent on the conversion of the reactant to the product. The catalyst is not used in the reaction and thus did not affect the reaction quotient or the equilibrium.
Hence, options A, B, and D are correct for the use of catalysts in the chemical reaction.
Learn more about catalysts, here:
https://brainly.com/question/17052831
Draw the Lewis structure for the polyatomic hydronium H3O cation. Be sure to include all resonance structures that
Answer:
Lewis structure of Hydronium ion is shown below :
Explanation:
Lewis structure : It is a representation of valence electrons on the atoms in a molecule
Here , Hydronium ion is given , which contains 1 atom of oxygen and 3 atoms of hydrogen .
Oxygen has a total of 6 valence electrons and hydrogen contains 1 valence electron .
Oxygen share its 3 valence electrons with 3 hydrogen atoms and left with 3 valence electrons. From these three valence electrons of oxygen atom two electrons will be shown as a pair of electrons on oxygen atom but a single electron can not be shown . So , to simplify this, one positive charge is shown overall .
Resonance structure will be same as the hybrid structure because all three atoms are same , that is hydrogen .
The metal tantalum becomes superconducting at temperatures below 4.483 K. Calculate the temperature at which tantalum becomes superconducting in degrees Celsius.
Answer:
The correct answer is "-268.667°C".
Explanation:
Given:
Temperature,
= 4.483 K (below)
Now,
The formula of temperature conversion will be:
⇒ [tex]T(^{\circ} C)=T(K)-273.15[/tex]
By putting the values, we get
⇒ [tex]=4.483-273.15[/tex]
⇒ [tex]=-268.667^{\circ} C[/tex]
Thus the above is the correct answer.
g Calculate the number of grams of aluminum that is produced in 1.00 h by the electrolysis of molten AlCl3 if the electrical current is 10.0A.
Answer:
3.36 grams Al°(s)
Explanation:
Given AlCl₃(s), determine the mass (grams) of Al°(s) produced from electrolysis of Aluminum Chloride at 10.0 amps for 1.00 hour.
AlCl₃(s) + 378.3°F (=192.4°C) => Al⁺³(l) + 3Cl⁻(l)
formula wt. Al° = 27g/mol
Faraday Constant (F°) = 96,500 amp·sec
? grams Al°(s) = 10.0amps x (1 mole e⁻/96,500amp-sec) x (1 mole Al°(s)/3 mole e⁻) x (27g Al°(s)/1 mole Al°(s)) x 3,600 sec = 3.36 grams Al°(s)
The 3.36 grams of aluminum are produced in 1 hour by the electrolysis of molten AlCl₃ when 10A current is passed.
What is electrolysis?Electrolysis is a process that uses an electrical current to break chemical compounds. The electric current is passed through the substance to bring the chemical change by gain or loss of electrons.
The electrolysis of the aluminum chloride in the molten state is represented as:
AlCl₃ → Al³⁺ + 3Cl⁻
At cathode: Al³⁺ + 3e⁻ → Al (s)
Given, the current. I = 10 A and t = 1 hr = 3600 s
We know that the current is calculated from the equation: I = q/t
q = I× t
q = (10A) × (3600s)
q = 36 × 10³ C
We know, 96500 C of the charge has electrons = 1 mol
36 × 10³ C of the charge has electrons = 0.373 mol
3 moles of electrons required to produce aluminum = 1 mol
0.373 mol of electrons will produce aluminum = 0.373/3 = 0.124 mol
We know that, the mass of one mole of Al = 27g
The mass of 0.124 mol of Al = 27 × 0.124 = 3.36 g
Therefore, the aluminum produced in 1 hour by the electrolysis of molten AlCl₃ is equal to 3.36 grams.
Learn more about electrolysis, here:
https://brainly.com/question/12054569
#SPJ5
Given the following list of densities, which materials would float in a molten vat of lead provided that they do not themselves melt? Densities (g/mL): lead = 11.4, glass = 2.6, gold = 19.3, charcoal = 0.57, platinum = 21.4.
a. gold and platinum
b. glass and charcoal
c. gold, platinum, glass and coal
d. gold and charcoal
e. None of these
Answer:
b. glass and charcoal
Explanation:
Step 1: Given data
Density of Pb: 11.4 g/mLDensity of Glass: 2.6 g/mLDensity of Au: 19.3 g/mLDensity of charcoal: 0.57 g/mLDensity of platinum: 21.4 g/mLStep 2: Determine which material will float in molten lead
Density is an intrinsic property of matter. Less dense materials float in more dense materials. The materials whose density is lower than that of lead and will therefore float on it are glass and charcoal.
PLEASE HELP!!
How does temperature, agitation, and particle size affect solubility?
Answer:
At higher temperatures, particles move faster and collide more, increasing solubility rates.
Agitation increases solubility rates as well, by bringing fresh solvent into contact with the undissolved solute
The smaller the particle size, the higher (faster) solubility rate. Vice versa, the bigger the particle size, the lower (slower) solubility rate.
Explanation:
Which one of the following molecule is planer?
a. NF3 c. PH3
b. BH3 d. NCl3
Answer:
option a
hope helps you
have a great day
the force of attraction between non polar molecules are what (a)electrovalent bond (b)covalent bond (c)Hydrogen bond (d)Van der waals forces
Answer:
d. van der waals force
Explanation:
Van der Waals force :
the weakest intermolecular forceand consist of dipole-dipole force and dispersion force.
Pls pls help me me pls
Answer:
Danger
Explanation:
What are the uses of Sulphuric acid?
Answer:
The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.
The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.
Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol
Answer:
Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol
Explanation:
According to IUPAC rules, the name of a compound is:
Prefix+root word+suffix
1) Select the longest carbon chain and it gives the root word.
2) The substituents give the prefix.
3) The functional group gives the secondary suffix and the type of carbon chain gives the primary suffix.
The structure of the given compounds are shown below:
If I have 25g of Sodium, how much Sodium Chloride will I theoretically create?
O 50g NaCl
0 58.3g NaCl
O 63.7g Naci
0 35.4g NaCl
Answer:
64 g
Explanation:
Step 1: Write the balanced equation
2 Na + Cl₂ ⇒ 2 NaCl
Step 2: Calculate the moles corresponding to 25 g of Na
The molar mass of Na is 22.98 g/mol.
25 g × 1 mol/22.98 g = 1.1 mol
Step 3: Calculate the moles of NaCl formed from 1.1 moles of Na
The molar ratio of Na to NaCl is 2:2. The moles of NaCl formed are 2/2 × 1.1 mol = 1.1 mol.
Step 4: Calculate the mass corresponding to 1.1 moles of NaCl
The molar mass of NaCl is 58.44 g/mol.
1.1 mol × 58.44 g/mol = 64 g
Di- n- pentyl ether can be converted to 1- bromopentane by treatment with HBr through essentially a(n) ________ mechanism.
Answer:
SN1 mechanism
Explanation:
The mechanism of this reaction is shown in the image attached.
The Di- n- pentyl ether is first protonated. The CH3(CH2)4OH is now a good leaving group as shown.
The attack of the bromide ion on the cation formed completes the mechanism to yield 1- bromopentane as shown in the mechanism.
You are asked to prepare a buffer solution with a pH of 3.50. The following solutions, all 0.100 M, are available to you: HCOOH, CH3COOH, H3PO4 , NaCHOO, NaCH3COO, and NaH2PO4. What would be the best combination to make the required buffer solution? Select one:
a. NaH2PO4 and NaCHOO
b. H3PO4 and NaH2PO4
c. NaH2PO4 and HCOOH
d. CH3COOH and NaCH3COO e. HCOOH and NaCHOO
can someone helo me with this
Answer:
e. HCOOH and NaCHOO
Explanation:
For a buffer solution, both an acid and its conjugate base are required.
With the information above in mind, we can discard options a) and c), as those combinations are not of an acid and its conjugate base.
Now it is a matter of comparing the pKa (found in literature tables) of the acids of the remaining three acids:
H₃PO₄ pKa = 2.12CH₃COOH pKa = 2.8HCOOH pKa = 3.74The acid with the pKa closest to the desired pH is HCOOH, so the correct answer is e. HCOOH and NaCHOO
write any two things that should be remembered while writing chemical equation
Answer:
the product and the reactant must be balanced
if u are required to give the mechanism if the reaction it must be written
If a hydrogen atom and a helium atom have the same kinetic energy:________
a. the wavelength of the hydrogen atom will be about 4 times longer than the wavelength of the helium atom.
b. the wavelength of the hydrogen atom will be about 2 times longer than the wavelength of the helium.
c. the wavelength of the hydrogen atom will be roughly equal to the wavelength of the helium atom.
d. the wavelength of the helium atom will be about 2 times longer than the wavelength of the hydrogen atom.
e. the wavelength of the helium atom will be about 4 times longer than the wavelength of the hydrogen atom.
Answer: If a hydrogen atom and a helium atom have the same kinetic energy then the wavelength of the hydrogen atom will be roughly equal to the wavelength of the helium atom.
Explanation:
The relation between energy and wavelength is as follows.
[tex]E = \frac{hc}{\lambda}\\[/tex]
This means that energy is inversely proportional to wavelength.
As it is given that energy of a hydrogen atom and a helium atom is same.
Let us assume that [tex]E_{hydrogen} = E_{helium} = E'[/tex]. Hence, relation between their wavelengths will be calculated as follows.
[tex]E_{hydrogen} = \frac{hc}{\lambda_{hydrogen}}[/tex] ... (1)
[tex]E_{helium} = \frac{hc}{\lambda_{helium}}[/tex] ... (2)
Equating the equations (1) and (2) as follows.
[tex]E_{hydrogen} = E_{helium} = E'\\\frac{hc}{\lambda_{hydrogen}} = \frac{hc}{\lambda_{helium}} = E'\\\lambda_{helium} = \lambda_{hydrogen} = E'[/tex]
Thus, we can conclude that if a hydrogen atom and a helium atom have the same kinetic energy then the wavelength of the hydrogen atom will be roughly equal to the wavelength of the helium atom.
