Answer:
The molar mass of N2O5 is 108 g/mol. 1296g of N2O5 has 1296 / 108 = 12 moles. 1 mole contains 6.022 x 10^23 molecules
A structural model of retinol is shown below. How many carbon atoms are in
retinol?
А. 14
В. 28
С. 20
D. 5
Answer:
The answer is 20
Explanation:
how to separate and purify the Flufenamic acid from the aqueous layer
Answer:
Explanation:
H
A certain liquid has a normal boiling point of and a boiling point elevation constant . A solution is prepared by dissolving some urea () in of . This solution boils at . Calculate the mass of that was dissolved. Round your answer to significant digits.
This question is incomplete, the complete question is;
A certain liquid X has a normal boiling point of 150.4 °C and a molar boiling point elevation constant kb is 0.60 °Ckgmol⁻¹.
A solution is prepared by dissolving some urea (NH22CO) in 750 g of X. This solution boils at 150.9 °C . Calculate the mass of urea that was dissolved. Round your answer to 3 significant digits.
Answer:
the mass of urea that was dissolved is 37.5 g
Explanation:
Given the data in the question;
normal boiling point of X; Tb⁰ = 150.4 °C
boiling point of solution Tb = 150.9 °C
Change in boiling point Δt = Tb - Tb⁰ = 150.9 °C - 150.4 °C = 0.5 °C
Kb = 0.6 °C.kg.mol⁻¹
V = 750 g
Now, we know that
Δt = Kb × molality
so
0.5 = 0.6 × molality
molality = 0.5 / 0.6
molality = 0.833
we know that molar mass of urea is 60 g/mol
so
molality = mass × 1000 / molar mass × volume( g )
we substitute
0.833 = ( mass × 1000 ) / ( 60 × 750 )
0.833 = ( mass × 1000 ) / 45000
0.833 × 45000 = mass × 1000
mass = ( 0.833 × 45000 ) / 1000
mass = 37485 / 1000
mass = 37.485 ≈ 37.5 g { 3 significance figure }
Therefore, the mass of urea that was dissolved is 37.5 g
PLEASE HELP!!
How does temperature, agitation, and particle size affect solubility?
Answer:
At higher temperatures, particles move faster and collide more, increasing solubility rates.
Agitation increases solubility rates as well, by bringing fresh solvent into contact with the undissolved solute
The smaller the particle size, the higher (faster) solubility rate. Vice versa, the bigger the particle size, the lower (slower) solubility rate.
Explanation:
Which one of the following reactions is NOT balanced?
2 CO + O2 + 2 CO2
2 SO2 + O2 +2 SO3
2 KNO3 + 10 K 5 K20 + N2
SF4 + 3 H2O → H2SO3 + 4HF
Answer:
co+ o2+ 2co2 is not balanced reaction
Linoleic acid is a polyunsaturated fatty acid found, in ester form, in many fats and oils. Its doubly allylic hydrogens are particularly susceptible to abstraction by radicals, a process that can lead to the oxidative degradation of the fat or oil.
a. True
b. Flase
Answer:
True.
Explanation:
The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.
Question 9
2 pts
How many milliliters of 1.0 M HCl needs to be diluted to make 200 mL of a 0.1 M solution?
O 0.2 mL
O 0.02 mL
O 20 mL
2 mL
2 nts
Answer: There are 20 milliliters of 1.0 M HCl is required to be diluted to make 200 mL of a 0.1 M solution.
Explanation:
Given: [tex]M_{1}[/tex] = 1.0 M, [tex]V_{1}[/tex] = ?
[tex]M_{2}[/tex] = 0.1 M, [tex]V_{2}[/tex] = 200 mL
Formula used is as follows.
[tex]M_{1}V_{1} = M_{2}V_{2}[/tex]
Substitute values into the above formula as follows.
[tex]M_{1}V_{1} = M_{2}V_{2}\\1.0 M \times V_{1} = 0.1 M \times 200 mL\\V_{1} = \frac{0.1 M \times 200 mL}{1.0 M}\\= 20 mL[/tex]
Thus, we can conclude that there are 20 milliliters of 1.0 M HCl is required to be diluted to make 200 mL of a 0.1 M solution.
A 2,31M solution of trans-4-methyl-2-pentene (C6H12, 85mL) is combined with 7,5mL of 3,55M elemental bromine to form an addition product. With an expectation of 100% yield, more than 25mmols of elemental bromine would be consumed during this chemical process.
a. True
b. False
Answer:
The statement is false
Explanation:
Number of moles of alkene = 2.31 × 85/1000 = 0.196 moles
Number of moles of Br2 = 3.55 × 7.5/1000 = 0.0266 moles
Given that the reaction is 1:1
1 mole of alkene reacts with 1 mole of bromine
0.196 moles of alkene should react with 0.196 moles of bromine
Hence, to achieve 100%yield, 0.196 moles of bromine and not 25mmols of elemental bromine
100.0 mL of a 0.780 M solution of KBr is diluted to 500.0 mL. What is the new concentration of the solution?
Platinum is one of the most dense elements (d = 21.5 g/cm3). What is the volume of a 10.0 g sample of the metal?
Answer:
0.465
Explanation:
To find the volume of a substance, divide the mass by the density.
M/D = V
10.0 / 21.5 = 0.4651163
Then round to 3 significant figures: and the density is 0.465
What is the product of the following reaction? K OC(CH3)3
Answer:
See explanation and image attached
Explanation:
The reaction is an E2 reaction. It is a synchronous reaction.
The base KOC(CH3)3 abstracts a proton as the bromide ion leaves in a single step.
This yields the product as shown in the image attached.
Enough of a monoprotic acid is dissolved in water to produce a 1.211.21 M solution. The pH of the resulting solution is 2.882.88 . Calculate the Ka for the acid.
Answer:
1.44 × 10⁻⁶
Explanation:
Step 1: Given data
Concentration of the acid (Ca): 1.21 MpH of the solution: 2.88Step 2: Calculate the concentration of H⁺ ions
We will use the definition of pH.
pH = -log [H⁺]
[H⁺] = antilog -pH = antilog -2.88 = 1.32 × 10⁻³ M
Step 3: Calculate the acid dissociation constant of the acid (Ka)
For a weak monoprotic acid, we will use the following expression.
Ka = [H⁺]²/Ca
Ka = (1.32 × 10⁻³)²/1.21 = 1.44 × 10⁻⁶
CAN YOU PLEASE HELP ME
When Pt electrodes are used in the electrolysis of Kl(aq), a number of reactions are possible at the electrodes. Using a standard reduction potentials table predict which reaction is most likely to occur at the anode
anode is oxidation
so look at the reduction potential for Pt and Kl
the one with the smaller reduction potential will undergo oxidation
the one with the larger reduction potential will undergo reduction
you have to flip the equation that undergoes oxidation because the reduction table always gives reduction equations
Diethyl ether (C2H5 )2O vaporizes at room temperature. If the vapor exerts a pressure of 233 mm Hg in a flask at 25 °C, what is the density of the vapor?
Answer: The density of the given vapor is 0.939 g/L.
Explanation:
Given: Pressure = 233 mm Hg (1 mm Hg = 0.00131579 atm) = 0.31 atm
Temperature = [tex]25^{o}C[/tex] = (25 + 273) K = 298 K
According to the ideal gas equation,
[tex]PV = \frac{m}{M}RT[/tex]
where,
P = pressure
V = volume
m = mass
M = molar mass
R = gas constant = 0.0821 L atm/mol K
T = temperature
This formula can be re-written as follows.
[tex]PM = \frac{m}{V}RT[/tex] (where, [tex]Density = \frac{mass (m)}{Volume (V)}[/tex] )
Hence, formula used to calculate density of diethy ether (molar mass = 74.12 g/mol) vapor is as follows.
[tex]d = \frac{PM}{RT}[/tex]
Substitute values into the above formula as follows.
[tex]d = \frac{PM}{RT}\\= \frac{0.31 atm \times 74.12 g/mol}{0.0821 L atm/mol K \times 298 K}\\= \frac{22.9772}{24.4658}\\= 0.939 g/L[/tex]
Thus, we can conclude that the density of the given vapor is 0.939 g/L.
How many hydrogen atoms are in 3.90 mol of ammonium sulfide?
Answer:
First, the number of ammonium sulfide molecules should be calculated:
N = NA × n,
where NA - the Avogadro number, n - number of moles.
N (ammonium sulfide) = 6.022 × 1023 × 8.5 mol = 51.187 × 1023.
The moelcular formula of ammonium sulfide is (NH4)2S. It means that each molecule contains 8 hydrogen atoms.
As a result, 8.5 mol of (NH4)2S contain:
51.187 × 1023 × 8 = 41 × 1024 hydrogen atoms.
Answer: 41 × 1024 hydrogen atoms
Which of the following is true for balancing equations?
A. There must be an equal number of atoms of each element on both sides of the equation.
B. The number of products should be equal to the number of reactants
C. The properties of products should be the same as the properties of the reactants
D. There must be an equal number of compounds on both sides of the equation
Answer:
A.
Explanation:
An equation with the equal amount and proportion of atoms of each element on both sides of the reaction is commonly referred to as a balanced chemical equation.
The law of conservation of matter asserts that no observable and empirical change in the amount of matter occurs within a conventional chemical process. As a result, each element in the product would have the same equal amount or numbers of atoms as the reactants.
Assign oxidation state to each atom in each element ion or compound.
a. Ag
b. Ag+
c. CaF2
d. H2S
e.CO3
f. CrO4
g. Cl2
h. Fe
i. CuCl2
j. CH4
Answer:
a. [tex]Ag^0[/tex]
b. [tex]Ag^{+}[/tex]
c. [tex]Ca^{2+}F_2^-[/tex]
d. [tex]H_2^+S^{2-}[/tex]
e. [tex](C^{4+}O_3^{2-})^{-}[/tex]
f. [tex](Cr^{6+}O_4^{2-})^{2-}[/tex]
g. [tex]Cl_2^0[/tex]
h. [tex]Fe^0[/tex]
i. [tex]Cu^{2+}Cl_2^-[/tex]
j. [tex]C^{4-}H_4^+[/tex]
Explanation:
Hello there!
In this case, according to the concept of charge balance, which tell us that the overall charge is zero for any compound, except ions, it turns out possible to proceed as follows:
a. [tex]Ag^0[/tex]
b. [tex]Ag^{+}[/tex]
c. [tex]Ca^{2+}F_2^-[/tex]
d. [tex]H_2^+S^{2-}[/tex]
e. [tex](C^{4+}O_3^{2-})^{-}[/tex]
f. [tex](Cr^{6+}O_4^{2-})^{2-}[/tex]
g. [tex]Cl_2^0[/tex]
h. [tex]Fe^0[/tex]
i. [tex]Cu^{2+}Cl_2^-[/tex]
j. [tex]C^{4-}H_4^+[/tex]
Keep in mind lonely elements have 0 as their oxidation state.
Regards!
According to the kinetic-molecular theory, gas molecules have
ANSWER:
Part
A. Less energy than molecules of a solid.
B. strong interactions between molecules.
C. little distance between molecule
D. weak interactions between molecules.
Answer:
The choose ( D )
weak interactions between molecules.
Answer:
Explanation:
el a
1. Arrange the following groups in order of decreasing priority that would allow you to determine E/Z, or R/S. Provide a string of letters (e.g. abcd) as an answer with the highest priority listed first, lowest priority last:
a) -CH3 b) -CH2OH c) -CH2NH2 d) -CH2BR
2. Arrange the following groups in order of decreasing priority that would allow you to determine E/Z, or R/S. Provide a string of letters (e.g. abcd) as an answer with the highest priority listed first, lowest priority last:
a) -F b) -CH2OH c) -CHO d) -CH3
1) The order of decreasing priority would allow determining E/Z or R/S is "dbca".
2) The order of decreasing priority would allow determining E/Z or R/S is "acbd".
What is absolute configuration?Absolute configuration can be described as to the spatial arrangement of atoms within a chiral molecular entity. Absolute configuration in organic molecules, where carbon is bonded to four different substituents.
The absolute configuration has used a set of rules to describe the relative positions around the chiral center atom. The most common labeling method is the descriptors R or S where R and S refer to Rectus and Sinister.
The group with the highest atomic number will get the highest priority and the group with the lowest atomic number substituents will get the lowest priority. Therefore, the order of priority is -CH₂Br > -CH₂OH > -CH₂NH₂ > -CH₃.
Therefore, the order of priority for the second part is -F > -CHO > -CH₂OH > -CH₃.
Learn more about absolute configuration, here:
https://brainly.com/question/14365822
#SPJ5
The number 0.0007270 is larger than the number 5.7 × 10–3.
Answer:
Yes
Explanation:
=5.7×10-3
=5.7×7=39.9
=0.0007270 greater than 5.7× 10-3
OR
=5.7×10
=57-3
=54
So it is greater number
Which of the following is the correct way to balance the following chemical question:
2SnO2 + 4H2 -> 2Sn + 4H2O
SnO2 + 2H2 -> Sn + 2H2O
a. Both equation I and II are balanced, but equation I is the correct way to write the balanced equation.
b. Can you divide equation II by another factor and still have it be correct? Why or why not?
c. In a complete sentence, write down a method you could use to determine if an equation is written in the correct way.
Answer:
i have no answer for part A
part B
the one that has a 4 can be divided by 2 because reducing
part c
you can determine if an equation is written in the correct way by balancing the equation as if it had not been done already.
It takes to break a carbon-hydrogen single bond. Calculate the maximum wavelength of light for which a carbon-hydrogen single bond could be broken by
The question is incomplete, the complete question is;
It takes 412. KJ/mol to break a carbon-hydrogen single bond. Calculate the maximum wavelength of light for which a carbon-hydrogen single bond could be broken by absorbing a single photon. Round your answer to significant digits.
Answer:
289 nm
Explanation:
The energy of the photon = 412 × 10^3/6.02 × 10^23 = 6.84 × 10^-19 J
From;
E = hc/λ
h= Plank's constant
c= speed of light
λ = wavelength
λ = hc/E
λ = 6.6 × 10^-34 × 3 × 10^8/6.84 × 10^-19
λ = 2.89 × 10^-7 m
λ = 289 nm
Draw the Lewis structure for the polyatomic hydronium H3O cation. Be sure to include all resonance structures that
Answer:
Lewis structure of Hydronium ion is shown below :
Explanation:
Lewis structure : It is a representation of valence electrons on the atoms in a molecule
Here , Hydronium ion is given , which contains 1 atom of oxygen and 3 atoms of hydrogen .
Oxygen has a total of 6 valence electrons and hydrogen contains 1 valence electron .
Oxygen share its 3 valence electrons with 3 hydrogen atoms and left with 3 valence electrons. From these three valence electrons of oxygen atom two electrons will be shown as a pair of electrons on oxygen atom but a single electron can not be shown . So , to simplify this, one positive charge is shown overall .
Resonance structure will be same as the hybrid structure because all three atoms are same , that is hydrogen .
The shape of the sulfur dioxide molecule, where sulfur is the central atom is
bent.
linear.
trigonal planar.
tetrahedral.
Answer:
bent
Explanation:
The molecular formula of sulfur dioxide is written as SO₂
The molecular geometry of sulfur dioxide can be determined using the Lewis structure.
The Lewis structure shows the distribution of electrons around the atoms of a given compound such as sulfur dioxide (SO₂).
In this compound, sulfur is the central atom with 6 valence electrons.
The sulfur is bonded covalently with two oxygen atoms, each with 6 valence electrons. Oxygen contributes 2 lone pairs while sulfur which is the central atom contributes 1 lone pair of electrons in the bond.
The bond angle between the two oxygen atoms and the central sulfur atom is approximately 120⁰, as a result of the bent shape of the molecular structure.
Using any data you can find in the ALEKS Data resource, calculate the equilibrium constant k at 25.0 celsius for the following reaction.
6Cl2(g)+2Fe2O3(s)----->4FeCl3(s)+3O2
Round answer to 2 significant digits.
Answer:
Explanation:
From the given reaction:
[tex]6Cl_{2(g)}+2Fe_2O_{3(s)} \to 4FeCl_{3(s)}+3O_2[/tex]
From the Gibbs Free Energy table at standard conditions, the value of each compound is as follows:
[tex]G_f^0 \ of \ Cl_2 = 0 \ KJ/mol[/tex] [tex]G_f^0 \ of \ Fe_2O_3 = -742.24 \ KJ/mol[/tex]
[tex]G_f^0 \ of \ Fe_2Cl_3 = -334.05 \ KJ/mol[/tex] [tex]G_f^0 \ of \ O_2 = 0 \ KJ/mol[/tex]
Now, the standard Gibb's Free energy for the given reaction can be estimated as follows:
[tex]\mathtt{\Delta G^0 = (4 *G_f^0(FeCl_3) +3*G_f^0(O_2)) - (6*G_f^0 (Cl_2) +2*G_f^0(Fe_2O_3))}[/tex]
[tex]\mathtt{\Delta G^0 = (4 *(-334.05) +3*(0)) - (6(0) +2(-742.24))}[/tex]
[tex]\mathtt{\Delta G^0 = 148.28 \ kJ/mol}[/tex]
using the following formula:
[tex]\mathtt{\Delta G^0 =-RTIn K_{eq}}[/tex]
the equilibrium constant can be determined as:
[tex]\mathtt{ In K_{eq} =\dfrac{\Delta G^0 }{-RT}}[/tex]
[tex]\mathtt{ In K_{eq} =\dfrac{148.28*10^3 J/mol }{-(8.314 \ J/k mol )*298 \ K}}[/tex]
[tex]\mathtt{ In K_{eq} =-59.85}[/tex]
[tex]\mathtt{ K_{eq} =e^{-59.85}}[/tex]
[tex]\mathtt{ K_{eq} =1.0*10^{-26}}[/tex] to 2 significant figures.
Acetic acid and water react to form hydronium cation and acetate anion, like this:
HCH3CO2(aq) + H2O → H3O+(l)(aq) + CH3CO2^-(aq)
Imagine 226 mmol of CH3CO2- are added to a flask containing a mixture of HCH3CO2, H2O, H3O + and CH3CO2- at equilibrium.
Required:
What is the rate of the reverse reaction before any CH3CO2^- has t:een added to the flask?
Answer:
The rate of the reverse reaction before any addition of CH3CO2- is zero
Explanation:
When the reaction is in equilibrium:
HCH3CO2(aq) + H2O ⇄ H3O+(l)(aq) + CH3CO2^-(aq)
The reaction quotient, Q = Ka and no more products or reactants are produced because their concentrations are in the right proportion.
Now, as no reaction occurs,
The rate of the reverse reaction before any addition of CH3CO2- is zerog Arrange the following compounds in order of acidity (highest to lowest): H2O, H3O , HCl A. CH3COOH > HCl > H2O B. H2O > CH3COOH > HCl C. HCl > H2O > CH3COOH D. HCl > CH3COOH > H2O
Answer:
Arrange the following compounds in order of acidity (highest to lowest): H2O, CH3COOH , HCl
A. CH3COOH > HCl > H2O
B. H2O > CH3COOH > HCl
C. HCl > H2O > CH3COOH
D. HCl > CH3COOH > H2O
Explanation:
The given substances are acetic acid, hydrochloric acid, and water.
Since HCl is a strong acid and it undergoes complete ionization.
CH3COOH acetic acid is a weak acid and it undergoes partial dissociation in water.
Pure water is a neutral substance.
Hence, the order of acidity is shown below:
HCl > CH3COOH > H2O.
Among the given options, option D is the correct answer.
Which equation was used by Albert Einstein to explain the photoelectric effect? [E = energy, h= planck's constan, and v = frequency]
Answer:
E = hv
Explanation:
Energy = planck constant × frequency
If the volume of the gas is increased to 9.6 L , what will the pressure be?
A solution of hydrochloric acid had a hydrogen ion concentration of 1.0 mol/dm3
Water was added to hydrochloric acid until the ph increased by 1
What was the hydrogen ion concentration of the hydrochloric acid after had been added?
Answer:
pH = -log[H+]
Where [H+] = Hydrogen ion concentration
In this case,
[H+] = 1 × 10^(-2) = 10^(-2)
log{10^(-2)} = -2
-log{10^(-2)} = -(-2) = 2
pH = -log{10^(-2)} = 2
and hi.!!!
Answer:
0.1
Explanation:
Hydrogen ion concentration can be calculated using the formula [H+] = 10^-pH
pH can be concentrated using ph = -log[H+]
let's calculate the initial pH before anything was added: pH = -log(1) = 0
it increased by 1 so the final pH is 1.
Now we'll find the [H+] of a solution with a pH of 1:
concentration = 10^(-1) = 0.1
