I need the help ASAP please

I Need The Help ASAP Please

Answers

Answer 1

Answer:

Option B

Answered by GAUTHMATH


Related Questions

Shawn has 4 times as many candies as Jason, who has a third as many candies as
lan. If Shawn has 64 candies, how many candies does Ian have?

Answers

Ian has 48 candies. hope that helps!
Ian has 4 candies...........

find the sum of all multiples of 9 between 0 and 200​

Answers

Answer:

I thick the answer is 2277

Michigan and Michigan State play each other this Saturday in football. Based on data from ESPN, Michigan averages 38.1 points per game with a SD of 8.4 and average 424 yards gained per game with a SD of 72. The correlation between points scored and yards gained is 0.68. Thus:

Average points = 38.1, SD= 8.4
Average yards gained = 424, SD= 72, r = 0.68

Required:
a. Find the slope of the regression equation for predicting number of points scored based on average yards gained per game). Report your answer to 4 decimal places.
b. If Michigan gains 500 yards in the game against Michigan State, what is Michigan's predicted points scored? Round to the nearest whole number.

Answers

Answer:

200000

by 10009

Step-by-step explanation:

nbebsbsbsbbsbsbsbsbBz

According to this diagram, what is tan 62°?
62°
17
18
280
90°
15
O A.
8
17
OB.끝
O c. 1
8
15
D.
15
8
O
E.
17
15
F.
15
17

Answers

Answer:

15/8

Step-by-step explanation:

tan(62)=P/B

tan(62)=15/8

look at the image below

Answers

Answer:

201.1 km²

Step-by-step explanation:

Surface area of a sphere= 4πr², where r = radius

so,

4πr²

= 4×π×4²

= 64π

= 201.1 km² (rounded to the nearest tenth)

Mike has 18 goldfish and 24 silver fish in his aquarium what is the ratio of silverfish to total fish in the aquarium aquarium

Answers

Answer:

4:7

Step-by-step explanation:

18+24=total number of fish=42

silver fish amount= 24

therefore, ratio is 24:42=12:21=4:7

18:42 simplified 3:7

please can anyone help me with this question what is the probability of the spinner landing on an even number.​

Answers

1/2 chance it will land on an even number


Explanation there is 4 even numbers and 4 odd numbers meaning it’s a 50/50 chance

A 90% confidence interval is (35 45). What is the margin of error?
A. 5
B.4.5
C.9
D.10

Answers

Answer:

option A 5

I hope it's correct

.....

Determine the critical values for the confidence interval for the population standard deviation from the given values. Round your answers to three decimal places.
n = 12 and c = 0.9.

Answers

Answer:

The answer is "[tex]\chi^2_{L} = 4.575 \ and\ \chi^2_{U}= 19.675[/tex]"

Step-by-step explanation:

[tex]n=12\\\\\ c= 0.9[/tex]

Calculating the level of significance [tex](\alpha) = 1 -c[/tex]

                                                                  [tex]=1-0.9\\\\=0.1[/tex]

Calculating the degrees of freedom:

[tex]df=n-1=12-1=11[/tex]

Calculating the critical value:

Applying the Chi-Square table, the critical values for the two-tailed test with a degree of freedom  (11) for the significance level of [tex]\alpha = 0.1[/tex]:

[tex]\chi^2_{L} = 4.575 \\\\\chi^2_{U}= 19.675[/tex]

How to make my answer for 0.70 a fraction

Answers

Answer:

0.70 = 7/10

Step-by-step explanation:

Answer:

70/100 or 7/10 (Simplified)

Step-by-step explanation:

0.70 is basically .70 of 1. You can wrote this as a fraction, 70/100. If you divide 70 by 100, it gives you .70.

If you want to simplify it, it becomes 7/10, and if you divide 7 by 10, it also gives you 0.70.

Depends if you want your fraction simplified or not.

have a great day.

Jack’s backpack weighs 15 pounds. Fernando’s backpack weighs less than Jack’s. Which graph shows how much Fernando’s backpack can weigh?

Answers

Answer:

A

Step-by-step explanation:

c and d out of the question

b has its circle filled in meaning it could be 15lbs, which it's not

A correct answer by default

Answer:b

Step-by-step explanation: it has a filled in diamond which mean it's that...

please helpppp i need it by tonight its very important

Answers

Answer:

m<1=145

m<2=35

m<3=35

Step-by-step explanation:

measure one is supplementary(the angles add to 180) to measure four.

so we do 180-35=145

measure 2 is congruent to measure four because they are corresponding angles

so measure 2=35

and measure 3 is also congruent to measure 4 because the are corresponding angles

so m<3=35

terms are there. Divide 51 into three parts in AP so that the largest exceeds the smallest by 10.​

Answers

The first three terms of the Arithmetic Progression are 12, 17 and 22.

For an ARITHMETIC PROGRESSION, AP ;

First term = a

Second term = a + d

Third term = a + 2d

Where, d = common difference ;

If third term exceeds smallest by 10 ;

Third term - first term

a + 2d - a = 10

2d = 10

d = 10/2

d = 5

Sum of the three terms :

a + (a + d) + a + 2d = 51

3a + 3d = 51

d = 5

3a + 3(5) = 51

3a + 15 = 51

3a = 51 - 15

3a = 36

a = 12

The AP would be:

First term, a = 12

Second term, a + d = 12 + 5 = 17

Third term = a + 2(d) = 12 + 10 = 22

Therefore , the first three terms of the AP are :

12, 17 and 22

Learn more about ARITHMETIC PROGRESSION :

https://brainly.com/question/12006170

Simplify the following expression

Answers

Answer:

[tex]\frac{98p^{6}}{q}[/tex]

Step-by-step explanation:

Distribute the exponents

[tex](\frac{(7^{-2}p^{-6}q^{-8})}{2q^{-9}} )^{-1}[/tex]

[tex](\frac{q}{98p^{6}} )^{-1}[/tex]

Distribute the -1

[tex]\frac{98p^{6}}{q}[/tex]

A car insurance company has determined that6% of all drivers were involved in a car accident last year. If14drivers are randomly selected, what is the probability of getting at most 3 who were involved in a car accidentlast year

Answers

Answer:

[tex]P(x \le 3) = 0.9920[/tex]

Step-by-step explanation:

Given

[tex]p = 6\%[/tex] --- proportion of drivers that had accident

[tex]n = 14[/tex] -- selected drivers

Required

[tex]P(x \le 3)[/tex]

The question is an illustration of binomial probability, and it is calculated using:

[tex]P(x ) = ^nC_x * p^x * (1 - p)^{n-x}[/tex]

So, we have:

[tex]P(x \le 3) = P(x = 0) +P(x = 1) +P(x = 2) +P(x = 3)[/tex]

[tex]P(x=0 ) = ^{14}C_0 * (6\%)^0 * (1 - 6\%)^{14-0} = 0.42052319017[/tex]

[tex]P(x=1 ) = ^{14}C_1 * (6\%)^1 * (1 - 6\%)^{14-1} = 0.37578668057[/tex]

[tex]P(x=2 ) = ^{14}C_2 * (6\%)^2 * (1 - 6\%)^{14-2} = 0.15591149513[/tex]

[tex]P(x=3 ) = ^{14}C_3 * (6\%)^3 * (1 - 6\%)^{14-3} = 0.03980719024[/tex]

So, we have:

[tex]P(x \le 3) = 0.42052319017+0.37578668057+0.15591149513+0.03980719024[/tex]

[tex]P(x \le 3) = 0.99202855611[/tex]

[tex]P(x \le 3) = 0.9920[/tex] -- approximated

12/1,000 into decimal​

Answers

0.012 is the answer!

I hope this helps you out! :D

[tex]\\ \sf\longmapsto \dfrac{12}{1000}[/tex]

1000 has 3zeros hence decimal will go 3 points left

[tex]\\ \sf\longmapsto 0.012[/tex]

More:-

[tex]\\ \sf\longmapsto \dfrac{1}{10}=0.1[/tex]

[tex]\\ \sf\longmapsto \dfrac{1}{100}=0.01[/tex]

5 A machine puts tar on a road at the rate of 4 metres in 5 minutes.
a) How long does it take to cover 1 km of road
b) How many metres of road does it cover in 8 hours?​

Answers

Answer:

5 a) Total = 20.83 hrs = 20 hrs and 50 mins  (1250mins total)

5 b) Total = 96 meters. = 0.096km in 8 hrs.

Step-by-step explanation:

1km = 1000 meters

5 mins = 4 meters

1000/4 = 250 multiplier

250 x 5mins = 1250 minutes

1250/60 = 20hrs + 50 minutes

50 / 60 =  0.83 = 20.83hrs

b)  8 hrs = 8 x 60 = 480 minutes

480/5 = 24 multiplier of 4 meters

24 x 4 = 96 meters

Convert 0.450 to a proper fraction

Answers

Answer:

9/20

Step-by-step explanation:

450/1000

this is not the answer, because it is not simplified

so here we have to find common factor and simplifying

________________________________________________

450/1000 is simplified to 9/20, and it can no longer be simplified.

Use the drop-down menu to create true statements,
If the graph of an inverse passes the
, you know that the inverse is
a function,
The composition of a function and its inverse is
always
DONE
DOWE
The range values of an inverse are the
values of the original function,
The graph of an inverse is the reflection of the
graph of the function over the line
DONE
DOWE

Answers

Answer:

A) Vertical test

B) y=x

C) x

D) domain

If the graph of an inverse passes the Vertical Line Test, you know that the inverse is a function.

What is Inverse Function?

Inverse functions are functions which can be reversed in to another function.

Then the function is said to be the inverse of the second function.

The test which is used to know whether an inverse is a function or not is Vertical line Test.

So, if the graph of an inverse passes the Vertical Line Test, you know that the inverse is a function.

Composition of a function and it's inverse is always x.

Let y = f(x) be a function. Then x = f⁻¹ (y)

(f⁻¹of)(x) = f⁻¹ (f(x)) = f⁻¹ (y) = x

The graph of an inverse is the reflection of the graph of the function over the line y = x.

The range values of the inverse function are the domain values of the original function.

Hence the blank terms are found.

Learn more about Inverse of Functions here :

https://brainly.com/question/30350743

#SPJ7

Give the degree of the polynomial. -5-5x2wy4-y4x2-4w3

Answers

9514 1404 393

Answer:

  7

Step-by-step explanation:

The degree of each term is the sum of the degrees of the variables in it.

Term, Degrees

-5, 0

-5x^2wy^4, x:2, w:1, y:4 -- term degree = 2+1+4 = 7

-y^4x^2, y:4, x:2 -- term degree = 4+2 = 6

-4w^3, w:3 -- term degree = 3

The highest of these is 7, so the degree of this polynomial is 7.

Can someone help me solve this problem ?

Answers

Answer:

B

Step-by-step explanation:

Since x= 3/4

To take the fraction on left hand side, inverse 4/3

Take π as denominator

Then cube root the entire equation on the left hand side.

Answer:

Step-by-step explanation:

What is the volume of the cone

Answers

Answer:

The volume of this cone would be approximately equal to 2787.64 [tex]yd.^2[/tex].

Step-by-step explanation:

The formula used to calculate the volume of a cone is [tex]\pi r^2*\frac{h}{3}[/tex] where [tex]r[/tex] represents the radius of the circle at the base of the cone, and [tex]h[/tex] represents the vertical height of the cone. In this case, [tex]r[/tex] equals the diameter of the base divided by two, which is [tex]\frac{22}{2}[/tex] or 11 yards; and [tex]h[/tex] is equivalent to 22 yards. Insert these values into the formula and you'll get that the volume of this cone is equal to [tex]11^2*\pi*\frac{22}{3} = 121\pi * \frac{22}{3}[/tex] ≈ 2787.64 [tex]yd.^2[/tex], so that is the correct answer.

prove that 2^n+1>(n+2).sin(n)​

Answers

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

Triangle ABL is an isosceles triangle in circle A with a radius of 11, PL = 16, and ∠PAL = 93°. Find the area of the circle enclosed by line PL and arc PL. Show all work and round your answer to two decimal places.

Answers

The area bounded by a chord and arc it intercepts is known as a segment of a circle segment of a circle

The area of the circle enclosed by line PL and arc PL is approximately 37.62 square units

The reason the above value is correct is as follows:

The given parameters in the question are;

The radius of the circle, r = 11

The length of the chord PL = 16

The measure of angle ∠PAL = 93°

Required:

The area of part of the circle enclosed by chord PL and arc PL

Solution:

The shaded area of the given circle is the minor segment of the circle enclosed by line PL and arc PL

The area of a segment of a circle is given by the following formula;

Area of segment = Area of the sector - Area of the triangle

Area of segment = Area of minor sector APL - Area of triangle APL

Area of minor sector APL:

Area of a sector = (θ/360)×π·r²

Where;

r = The radius of the circle

θ = The angle of the sector of the circle

Plugging in the the values of r and θ, we get;

Area of the minor sector APL = (93°/360°) × π × 11² 98.2 square units

Area of Triangle APL:

Area of a triangle = (1/2) × Base length × Height

Therefore;

The area of ΔAPL = (1/2) × 16 × 11 × cos(93°/2) ≈ 60.58 square units

Required shaded area enclosed by line PL and arc PL:

Therefore, the area of shaded segment enclosed by line PL and arc PL is found as follows;

Area of the required segment PL (98.2 - 60.58) square units = 37.62 square units

The area of the circle enclosed by line PL and arc PL ≈ 37.62 square units

Learn more about the finding the area of a segment can be found here:

https://brainly.com/question/22599425

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

The calculation of the area between line segment PL and circle arc PL is described below:

1) Calculation of the area of the circle arc.

2) Calculation of the area of the triangle.

3) Subtracting the area found in 2) from the area found in 1).

Step 1:

The area of a circle arc is determined by the following formula:

[tex]A_{ca} = \frac{\alpha\cdot \pi\cdot r^{2}}{360}[/tex] (1)

Where:

[tex]A_{ca}[/tex] - Area of the circle arc.

[tex]\alpha[/tex] - Arc angle, in sexagesimal degrees.

[tex]r[/tex] - Radius.

If we know that [tex]\alpha = 93^{\circ}[/tex] and [tex]r = 11[/tex], then the area of the circle arc is:

[tex]A_{ca} = \frac{93\cdot \pi\cdot 11^{2}}{360}[/tex]

[tex]A_{ca} \approx 98.201[/tex]

Step 2:

The area of the triangle is determined by Heron's formula:

[tex]A_{t} = \sqrt{s\cdot (s-l)\cdot (s-r)^{2}}[/tex] (2)

[tex]s = \frac{l + 2\cdot r}{2}[/tex]

Where:

[tex]A_{t}[/tex] - Area of the triangle.

[tex]r[/tex] - Radius.

[tex]l[/tex] - Length of the line segment PL.

If we know that [tex]l = 16[/tex] and [tex]r = 11[/tex], then the area of the triangle is:

[tex]s = \frac{16+2\cdot (11)}{2}[/tex]

[tex]s = 19[/tex]

[tex]A_{t} = \sqrt{19\cdot (19-16)\cdot (19-11)^{2}}[/tex]

[tex]A_{t} \approx 60.399[/tex]

Step 3:

And the area between the line segment PL and the circle arc PL is:

[tex]A_{s} = A_{ca}-A_{t}[/tex]

[tex]A_{s} = 98.201 - 60.399[/tex]

[tex]A_{s} = 37.802[/tex]

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

From a club of 24 people, in how many ways can a group of four members be selected to attend a conference?

Answers

Answer:

255,024

Step-by-step explanation:

24 x 23 x 22 x 21

24 options for the first member

23 options for the second member

22 options for the third member

21 options for the last member

Banking fees have received much attention during the recent economic recession as bankslook for ways to recover from the crisis. A sample of 31 customers paid an average fee of $11.53 permonth on their checking accounts. Assume the population standard deviation is $1.50. Calculatethe margin of error for a 90% confidence interval for the mean banking fee.

Answers

Answer:

The margin of error for a 90% confidence interval for the mean banking fee is of $0.44.

Step-by-step explanation:

We have that to find our [tex]\alpha[/tex] level, that is the subtraction of 1 by the confidence interval divided by 2. So:

[tex]\alpha = \frac{1 - 0.9}{2} = 0.05[/tex]

Now, we have to find z in the Z-table as such z has a p-value of [tex]1 - \alpha[/tex].

That is z with a pvalue of [tex]1 - 0.05 = 0.95[/tex], so Z = 1.645.

Now, find the margin of error M as such

[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]

In which [tex]\sigma[/tex] is the standard deviation of the population and n is the size of the sample.

Sample of 31:

This means that [tex]n = 31[/tex]

Assume the population standard deviation is $1.50.

This means that [tex]\sigma = 1.5[/tex]

Calculate the margin of error for a 90% confidence interval for the mean banking fee.

[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]

[tex]M = 1.645\frac{1.5}{\sqrt{31}}[/tex]

[tex]M = 0.44[/tex]

The margin of error for a 90% confidence interval for the mean banking fee is of $0.44.

13. 30 of the 100 iPads in an inventory are known to be cracked. What
is the probability you randomly select one that is not cracked?

Answers

Answer:

7/10 or 0.7

Step-by-step explanation:

a probability is always the ratio of possible cases over all cases.

"all cases" here is 100.

possible cases are all iPads not cracked in the inventory = 70 (because 30 are cracked, that leaves 100-30=70 not cracked).

so, the probability to select a non-cracked unit is

70/100 or simplified 7/10 (or 0.7)

Can someone do #4 and #5

Answers

Answer:

First, find two points on the graph:

(x₁, y₁) = (0, 2)(x₂, y₂) = (2, 8)

Slope = [tex]\frac{y_{2}-y_{1} }{x_{2}-x_{1}} = \frac{8-2}{2-0} =\frac{6}{2}=3[/tex]

16 + (-3) = 16 - 3 = 13

Find the value of x and the value of y.
A. x = 4, y = 8
B.x=7, y=422
C. X= 4/3, y= 7.2
D. x= 73, y=412

Answers

Answer:

x = 7 and

y = 4[tex]\sqrt{2}[/tex]

Step-by-step explanation:

as you can see from the image we need to draw a line and when we do so we get a special right triangle with angle measures 90-45-45 and side lengths represented by a-a-a[tex]\sqrt{2}[/tex]

since the line we drew is parallel to the rectangle's length it's = 4 and so the number represented with a is also = 4

from there on we see x = 7 and y = 4[tex]\sqrt{2}[/tex]

Answer:

I can confirm, it is B! x=7 and y=4sqrt2

Step-by-step explanation:

edge

The segments shown below could form a triangle.
A
C
7
9
12
B
А
a
A. True
B. False

Answers

Answer:

TRUE

Step-by-step explanation:

I SEEN SOME ONE ELSE WIT 5 STARS SAY SO(:

The given segment can form triangle. Therefore, the given statement is true.

What is triangle?

A polygon has three edges as well as three vertices is called a triangle. It's one of the fundamental geometric shapes. In Euclidean geometry, each and every three points that are not collinear produce a distinct triangle and a distinct plane. In other words, every triangle was contained in a plane, and there is only single plane that encompasses that triangle.

All triangles are enclosed in a single plane if all of geometry is the Euclidean plane, however this is no longer true in higher-dimensional Euclidean spaces. Unless when otherwise specified, this article discusses triangles within Euclidean geometry, namely the Euclidean plane. The given segment can form triangle.

Therefore, the given statement is true.

To know more about triangle, here:

https://brainly.com/question/14712269

#SPJ7

Other Questions
Lizzie Bright and Buckminister Boy part 2Based on this excerpt, the reader is able to conclude that Turner feels_____ About his friendship with Lizzie. The 4 answer it givesX=-3X=-1X=1X=3 George came to this country a year ago (Ask about a year) The biotic potential of a population I need help thank you so much ! How water utility company caters for their interests and what may happen if their expectations are not met. A school in Delhi has its own flag, which is rectangular and divided into 4 rows and 6 columns. The word SCHOOL' is inscribed in the first row, FLAG' in the fourth row, and a purple coloured rhombus is in the middle How did "the loyalAmerican peoplesee theReconstruction Act? Which of the following is a disadvantage of a sole proprietorship?Question 1 options:A: The owner has unlimited liability for the debts of the business.B: Proprietors are their own bosses and can work their own hours.C: It's the least expensive type of business organization to create.D: The owner gets to decide what to do with all of the profits made. PLEASE DO THIS ASAP! MUST SHOW WORK!NO LINKS You are considering purchasing stock in Canyon Echo. You feel the company will increase its dividend at 3.9 percent indefinitely. The company just paid a dividend of $3.62 and you feel that the required return on the stock is 11.7 percent. What is the price per share of the company's stock ILL GIVE BRAINLEST!!! An ice cream shop sold a combined total of 429 ice cream cones in the flavors ofchocolate or vanilla. They sold 105 more chocolate cones than vanilla. How many vanillaice cream cones did they sell? How would you best categorize this description? write note on table graphs and pictogram from available data What is an equation of the line that passes through the points (4,-2) and (8,-7)? HELP ILL GIVE BRAINLIEST Part 1: Which compound does C represent?Part 2: Name a process that could release this compound into the air.Part 3: Explain how the elements that form it are conserved during the carbon cycle. Use complete sentences to explain your answer.Justify how this compound was created from a recycling of carbon in the carbon cycle. Use complete sentences to explain your answer. which of the following would most likely be an entry in a sentence outline A. Education as a toolB. Education can change a persons lifeC. Education beyond high school versus education beyond collegeD. Education as a pathway Classify each of the four compounds as a conjugated, isolated, or cumulated diene. Compound A: Two alkenes are joined by a sigma bond. Compound A is a: cumulated diene conjugated diene isolated diene Compound B: Two alkenes are joined by a C H 2 group. Compound B is : isolated diene conjugated diene cumulated diene Compound C: Two alkenes are joined by C H 2 C H 2. Compound C is a: conjugated diene isolated diene cumulated diene Compound D: A cyclohexene has a double bond between carbons 1 and 2. Carbon 3 is an s p 2 carbon that is bonded to another s p 2 carbon with an alkyl substituent. Compound D is a: isolated diene conjugated diene cumulated diene all plants carry on photosynthesis true or false Let Z be the standard normal random variable. Use a probability calculator to answer the following questions: What is the probability Z will be within one standard deviation of average?