If each geometric shape represents a different type of atom, and atoms that are touching have chemically bonded with each other, which best describes this model? * 1. An element 2. A compound 3. A homogeneous mixture of two compounds 4. A heterogeneous mixture of two compounds 5. A homogeneous mixture of four elements 6. A heterogeneous mixture of four elements

Answer: answer is C

Explanation:

Its product is heavier than each of its reactants is true about this ₇N¹⁴ + ₁H¹ →  ₈O¹⁵ reaction

A nuclear reaction is a reaction in which one or more than one nuclides are generate and it collides between two atomic nuclei or one atomic nucleus.

The reaction is  

₇N¹⁴ + ₁H¹ →  ₈O¹⁵

Now equating the mass number of both sides

14 + 1 = 15 + a

a = 0

Equating atomic number of both sides

7 + 1 = 8 + x

x = 0

Thus, we can say that its product is heavier than each of its reactants is true about this reaction

Hence, option C is correct answer.

Learn more about Nuclear reaction here: https://brainly.com/question/25387647
#SPJ2

Answer:

ethylpentanoate

Explanation:

Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.

The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;

CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)

The name of the compound formed is ethylpentanoate.

Answer:

Chlorine has strong inter molecular forces than iodine

Explanation:

Answer:

Chlorine has strong inter molecular forces than iodine

Explanation:

I2 is a solid while Cl2 is a gas because Iodine molecules are larger and therefore experience stronger intermolecular forces.

HOPE IT HELPS :)

PLEASE MARK IT THE BRAINLIEST!

Answer:

The answer is below

Explanation:

Resolution is the smallest unit of measurement that can be measured by a measuring instrument. Each point on the ruler is 0.1 cm and the difference between any two points, about 0.01 cm cam be measured. The minimum measurement (resolution) that can be measured by the ruler is 0.01 cm (two decimals), therefore it cannot measure up to three decimal places such as numbers like 2.755.

Answer:

The answer is "Option D".

Explanation:

The entire ionic equation for all the substances, which are ionic compounds but are available in an aquatic is represented in the form with ions in the full ionic equation.  

In the Net ionic equation, it doesn't have the particulate matter throughout the net ionic equations throughout the equations.  

In the Spectator ions, it doesn't participate in interactions mostly on reaction and the material hand. From both sides, the very same ions are present.  

The evenly balanced chemical formula is,

[tex]2KOH (aq)+ H_2SO_4(aq) \longrightarrow 2H_2O(l) + K_2SO_4[/tex]

It is the separate organic compound that full ion formula will match the choice D.

Answer:

101.87

Explanation:

that's the answer

Explanation:

ionic compounds have high melting points

Answer:

have a negative electrical charge of one (-1)

Explanatio

Electrons have an electrical charge of negative one. When you think electron, always think -1

Answer: burning paper

Explanation:

The paper burns in air to form smoke and ash. which makes it a chemical change.

Explanation:

SOLID

Sodium hydroxide exists in the solid phase at room temperature. You would find it in the lab as hemispherical white solid pellets. The phase of a substance depends on temperature and pressure. As you heat a solid, it will melt and change to the liquid phase.

Answer:

[tex]\large \boxed{\text{183 g}}[/tex]  

Explanation:

[tex]\begin{array}{rcl}\text{Density} & = & \dfrac{\text{Mass}}{\text{Volume}}\\\\\rho & = &\dfrac{m}{V}\\\\1.83 \text{ g$\cdot$ cm}^{-3} & = & \dfrac{m}{\text{100 cm}^{3}}\\\\m & = & \text{183 g}\\\end{array}\\\text{There are $\large \boxed{\textbf{183 g}}$ of sulfuric acid.}[/tex]

Answer:

There are 7 carbons in 2,3 dimethylpentane

Explanation:

Because 2,3-dimethlypentane is an organic compound of carbon and hydrogen with formula C7H16

Answer: B

Explanation: Apex

An electron configuration be used to predict relative atomic size because the larger the highest energy level number, the larger the atomic

radius.

The electron configuration of an element shows the arrangement of electrons in atoms of that element.

As more sublevels are added, repulsion between electrons occupying shells increases causing a greater shielding and consequent increase in the size of the atom.

Hence, the larger the highest energy level number, the larger the atomic

radius.

Learn more: https://brainly.com/question/238050

Answer:

B)−6,942 J /mol

Explanation:

At constant temperature and pressure, you cand define the change in Gibbs free energy, ΔG, as:

ΔG = ΔH - TΔS

Where ΔH is enthalpy, T absolute temperature and ΔS change in entropy.

Replacing (25°C = 273 + 25 = 298K; 25.45kJ/mol = 25450J/mol):

ΔG = ΔH - TΔS

ΔG = 25450J/mol - 298K×108.7J/molK

ΔG = -6942.6J/mol

Right solution is:

Molarity= No of moles of solute * 1000 / vol solution in ml

No of moles= Given mass / Molar mass

Given Mass of solute (H2O2)= 10g

Molar mass of H2O2=34gmol^-1

No of moles= 10/34= 0.294 moles

Volume of solution=50ml

Molarity =   0.294*1000 / 50

Molarity = 5.8M

Answer:

A. 35

B. 7

C. halogênios

Explanation:

Aqui, para responder a essa pergunta, precisaremos conhecer o elemento particular em questão.

..... 4s ^ 2 3d ^ 10 4p ^ 5 significa que está a cinco elétrons da configuração eletrônica do último elemento na primeira camada dos metais pesados.

O último elemento da 1ª série do elemento de transição é o zinco, portanto, como está a apenas 5 elementos de distância, o átomo de que estamos falando é o átomo de Bromo de Bromo.

A. O zinco tem um número atômico 30 e como o bromo está a 5 elementos de distância, seu número atômico é 35

B. Uma vez que pertence ao grupo halogênio, tem 7 elétrons de valência como o resto da família

C. Pertence à família dos halogênios

Answer:

Reduce high-pressure gas in the scuba cylinder to ambient (surrounding) pressure.

Explanation:

The primary function of a scuba regulator would be to reduce high-pressure gas in the scuba cylinder to ambient pressure.

A scuba regulator is a structure found attached to the scuba cylinder usually carried by scuba divers. The structure regulates the pressure of the breathing gas in the cylinder to a safe level before the gas becomes available for the breathing process of divers.

Usually, the gas in a scuba cylinder is at a high level. Hence, what the regulator does is to bring it down to a level that would be safe for the breathing of the diver.

Heya!

Sulfur dioxide - ( SO2 )

Answer:

Effects:

Hope this helps!

Have a nice day!:)

Answer:

Those aspects which are something a village needs are specified beneath.

Explanation:

Answer: 1. Sodium Benzoate

Explanation: An anti-oxidant is a substance that can help prevent or stop the damage done by free radicals. Examples include; Sulphur Dioxide, Sulphite Salts, Citric Acid, e.t.c

Sodium benzoate is a pure preservative.

Answer:

Iron and aluminum are both examples of metals that are used commonly in everyday life.

Answer:

ZnC4H10

Explanation:

The empirical formula of a compound refers to the formula that gives the simplest whole number ratio of each atoms of the elements in the compound.

The empirical formula is calculated thus:

The given percentages in the question represent the mass in grams of each element in the compound.

Zinc= 53%, C= 38.9%, H= 8.1% which represents 53g, 38.9g and 8.1g of each element respectively.

Molar Mass of Zn= 65.4 g/mol

Molar Mass of C= 12 g/mol

Molar Mass of H= 1 g/mol

Step 1: Divide the mass of each element by the molar mass given to convert to moles:

Zn= 53/65.4 = 0.81moles

C= 38.9/12 = 3.24moles

H= 8.1/1 = 8.1moles

Step 2: Divide each mole value by the smallest number of moles calculated, which is 0.81moles:

Zn= 0.81/0.81 = 1

C= 3.24/0.81 = 4

H= 8.1/0.81= 10

This is the mole ratio represented in the subscript of each element in the empirical formula:

That is, Zn (1) C (4) H (10)

Empirical formula= ZnC4H10

Explanation:

Which is a pure substance?

1. soda

2. gasoline

3. salt water

4. carbon dioxide

carbon dioxide

Bromine, a liquid at room temperature, has a boiling point of 58°C and a melting point of -7.2°C. Bromine can be classified as a

1. compound.

2. impure substance.

3. mixture.

4. pure substance.

pure substance.

Answer:

the answer is

Explanation:

Sugar and water make a homogeneous mixture (the same proportions of its components throughout any given sample).

Answer:

Ni(ClO₄)₂(aq) ⇒ Ni²⁺(aq) + 2 ClO₄⁻(aq)

8 mol ClO₄⁻

Explanation:

Let's consider the dissolution equation for nickel(II) perchlorate dissolving in water.

Ni(ClO₄)₂(aq) ⇒ Ni²⁺(aq) + 2 ClO₄⁻(aq)

The molar ratio of Ni(ClO₄)₂ to ClO₄⁻ is 1:2. If 4 moles of Ni(ClO₄)₂ are dissolved, the moles of ClO₄⁻ formed are:

4 mol Ni(ClO₄)₂ × (2 mol ClO₄⁻/ 1 mol Ni(ClO₄)₂) = 8 mol ClO₄⁻

Answer:

None of the three salts are soluble.

Explanation:

According to the solubility rule, the carbonates and sulphates of group two elements are insoluble in water.

All three substances mentioned possess very low solubility in water and can be said to be slightly soluble in water. If we compare them with other ionic substances that dissolve readily in water, we can rightly say that they are insoluble in water.

Hence all three substances are insoluble in water.

Answer:

Because they cannot be separated into more then one type of substance.

Explanation:

Answer:

Elements are made of only one kind of atom. The particles can be a single atom or a molecule made of only one kind of atom. There is no physical change that can separate elements into more than one kind of substance. This makes an element a pure substance.An element is made up of only one type of atom. An element cannot be broken down into a simpler form.