I think i can help u with this
The balanced equation for the reaction between hydrochloric acid (HCl) and calcium carbonate (CaCO3) is:
2HCl + CaCO3 → CaCl2 + CO2 + H2O
To determine the limiting reagent, we need to calculate the number of moles of each reactant and compare them to their stoichiometric coefficients in the balanced equation. Let's start with hydrochloric acid:
Number of moles of HCl = 234 g / 36.46 g/mol = 6.41 mol
Now let's calculate the number of moles of calcium carbonate:
Number of moles of CaCO3 = 425 g / 100.09 g/mol = 4.25 mol
According to the balanced equation, the stoichiometric ratio of HCl to CaCO3 is 2:1. Therefore, we can see that calcium carbonate is the limiting reagent since we have fewer moles of CaCO3 than HCl, and we need twice as many moles of HCl to react completely with CaCO3.
To find the theoretical yield of CO2, we need to use the stoichiometry of the balanced equation. We see that the stoichiometric ratio of CaCO3 to CO2 is 1:1, so for every mole of CaCO3, we get one mole of CO2. Therefore, the theoretical yield of CO2 can be calculated as:
Theoretical yield of CO2 = 4.25 mol x 1 mol CO2/ 1 mol CaCO3 x 44.01 g/mol = 187.76 g
Now we can calculate the percent yield of CO2 by using the formula:
Percent yield = (actual yield / theoretical yield) x 100%
Substituting the given values, we get:
Percent yield = (82.5 g / 187.76 g) x 100% = 43.91%
Therefore, the percent yield of CO2 is approximately 43.91%.
what volume is occupied by 0.108 mol of helium gas at a pressure of 0.92 atm and a temperature of 313 k ? express your answer using two significant figures. view available hint(s)
The volume occupied by 0.108 mol of helium gas at a pressure of 0.92 atm and a temperature of 313 K is 2.3 L.
What is the volume of gas?The gas laws involve the relationship between the pressure, volume, and temperature of a gas. The ideal gas law can be used to determine the volume of gas that a certain amount of substance occupies at a particular pressure and temperature. The ideal gas law equation is:
PV = nRT
where, P is the pressure, V is the volume, n is the number of moles, R is the gas constant, and T is the temperature in Kelvin (K).
To determine the volume of helium gas that is occupying 0.108 moles at 0.92 atm and 313 K, we need to rearrange the ideal gas law equation to solve for V:
V = (nRT)/P
Substituting the values given, we have:
V = (0.108 mol)(0.08206 L atm/mol K)(313 K)/(0.92 atm)
V = 2.28 L
The volume of gas to two significant figures, the volume is 2.3 L.
Learn more about Volume of gas here:
https://brainly.com/question/15265703
#SPJ11
Determine the pH of each of the following solutions., 3.6×10−2 M HI,9.23×10−2 M HClO4, a solution that is 4.0×10−2 M in HClO4 and 4.8×10−2 M in HCl, a solution that is 1.01% HCl by mass (Assume a density of 1.01 g/mL for the solution.)
A 3.6102 M HI solution has a pH of 1.44. A 9.23102 M HClO4 solution has a pH of 0.036. The mass-based solution with 1.01% HCl has a pH of 2.09 in water.
The concentration of hydrogen ions (H+) in a solution determines the pH, which is a measurement of the solution's acidity or basicity. The pH values of various solutions are measured in the examples provided. Strong acids, HI and HClO4, are present in the first two solutions. Due to its lower pH, HI is a stronger acid than HClO4. The third solution, which comprises a combination of HClO4 and HCl and is weaker than the previous two because of its higher pH level, contains HCl. The pH of the final solution, which contains 1.01% HCl by mass, is 2.09, showing that it is a weak acid.
learn more about solution here:
https://brainly.com/question/30665317
#SPJ4
The phenomenon in which electrons that are closer to the nucleus slightly repel those that are farther out, is known as: select the correct answer below: - shielding - deflecting - building up - converging
The phenomenon in which electrons that are closer to the nucleus slightly repel those that are farther out is known as Shielding.
Electrons in an atom are negatively charged particles, and they are attracted to the positively charged nucleus. However, the outer electrons of an atom are also repelled by the inner electrons that are closer to the nucleus. This repulsion is due to the negative charges of the electrons, and it partially cancels out the attraction of the nucleus for the outer electrons.
Shielding is the phenomenon in which electrons that are closer to the nucleus slightly repel those that are farther out. This makes it possible for electrons in higher energy levels to be farther from the nucleus, so they are less strongly attracted and easier to remove.
Learn more about Shielding here: https://brainly.com/question/27985711
#SPJ11
calculation and give the answers to the correct number of significant figures.
Part A
1.72×10−3/7.9×1021.72×10−3/7.9×102
Express your answer to the correct number of significant figures.
Activate to select the appropriates template from the following choices. Operate up and down arrow for selection and press enter to choose the input value typeActivate to select the appropriates symbol from the following choices. Operate up and down arrow for selection and press enter to choose the input value type
nothing
SubmitRequest Answer
Part B
1.98×10−2+1×10−4−3.5×10−31.98×10−2+1×10−4−3.5×10−3
Express your answer to the correct number of significant figures.
Activate to select the appropriates template from the following choices. Operate up and down arrow for selection and press enter to choose the input value typeActivate to select the appropriates symbol from the following choices. Operate up and down arrow for selection and press enter to choose the input value type
nothing
SubmitRequest Answer
Part C
[(1.38×105)(0.000318)/0.080](115.2)[(1.38×105)(0.000318)/0.080](115.2)
Express your answer to the correct number of significant figures.
The answer is 2.19×10−2 with three significant figures. The correct number of significant figures is determined by the data with the least amount of significant figures, which in this case is 0.080.
What is figure?Figure is a term that is used to describe a shape, design, pattern, or form. It can also be used to refer to a diagram or an illustration. Figures are used to explain and illustrate concepts, facts, and phenomena in various fields of study, including mathematics, science, and the humanities. Figures are also used in art, design, and architecture to create visual compositions that have a certain aesthetic appeal. They can be used to represent ideas, concepts, and emotions.
Since 0.080 has three significant figures, the answer must also be rounded to three significant figures.
To learn more about figure
https://brainly.com/question/29827869
#SPJ1
The answer is 2.19×10⁻² with three significant figures. The correct number of significant figures is determined by the data with the least number of significant figures, which in this case is 0.080.
What is figure?Figure is a term that is used to describe a shape, design, pattern, or form. It can also be used to refer to a diagram or an illustration. Figures are used to explain and illustrate concepts, facts, and phenomena in various fields of study, including mathematics, science, and the humanities. Figures are also used in art, design, and architecture to create visual compositions that have a certain aesthetic appeal. They can be used to represent ideas, concepts, and emotions.
Since 0.080 has three significant figures, the answer must also be rounded to three significant figures.
To learn more about figure, visit:
brainly.com/question/29827869
#SPJ1
Question 15 (1 point) Give the net ionic equation for the reaction (if any) that occurs when aqueous solutions of Na2CO3 and HCl are mixed. O A) 2 H+ (aq) + CO32" (aq) + H2CO3(s) O B) 2 Na* (aq) + CO32" (aq) + 2 H+ (aq) + 2 CI"(aq) + H2CO3(s) + 2 NaCl(aq) O C) 2 H*(aq) + CO32-(aq) → H2O(l) + CO2(e) O D) 2 Na+(aq) + CO32"(aq) + 2 H+ (aq) + 2 CI-(aq) + H2CO3(s) + 2 Nat(aq) + 2 Cl(aq) 20 21
The net ionic equation for the reaction that occurs when aqueous solutions of Na₂CO₃ and HCl are mixed is:
2 H⁺(aq) + CO₃²⁻(aq) → H₂O(l) + CO₂(g). Thus, option C is correct.
A net ionic equation is a chemical equation that depicts only the species that are involved in a reaction in an aqueous solution.
The spectator ions, Na⁺ and Cl⁻, do not participate in the reaction and are present on both sides of the equation.
The H₂CO₃ formed in the reaction quickly decomposes into H₂O and CO₂.
Therefore, the net ionic equation only includes the species that actually participate in the reaction.
2 H+(aq) + CO32-(aq) → H2O(l) + CO2(g).
Learn more about ionic equations here:
https://brainly.com/question/28193640
#SPJ11
Chemistry Assertion and Reasoning
B) Assertion and Reasoning Direction: in the following questions, a statement followed by a statement of reason (R).
Mark the correct choice as:
(A) Both Assertion (a) And Reason (R) Are true and Reason (R) Is thd correct explanation of assertion (A)
(B) Both Assertion (A) And reason ( R) Are true but Reason (R) Is not correct explanation of assertion (A)
(C) Assertion (A) is true but reason ( R) is false
(D) Assertion (A) is false but reason (R) is true
Assertion: Calcium And Argon are isobars
Reason: Calcium And Argon Have Same Mass Numbers
Assertion: the number of valence electrons in oxygen atoms is 6
Reason: the valency of Oxygen atom is 6
Assertion: most of the Alpha Particles in Rutherfords experiment passed straight through gold foil
Reason: The Centre Of The Atom Is Positively Charged
Answer ASAP PLEASE!
1. Calcium and Argon are isobars , the correct answer is (A). 2. number of valence electrons in oxygen atoms is 6, the correct answer is (B) 3. most of the alpha particles deflected, the correct answer is (D).
Describe Protons?Protons are subatomic particles that are found in the nucleus of an atom. They have a positive electrical charge, which is equal and opposite to the negative charge of electrons, the other subatomic particle found in atoms. The number of protons in the nucleus of an atom determines what element the atom is.
The mass of a proton is approximately 1 atomic mass unit (amu), which is about 1.673 x 10⁻²⁷ kg. This is slightly less than the mass of a neutron, which is another subatomic particle found in the nucleus of an atom.
1. The correct answer is (A) Both Assertion (A) and Reason (R) are true, and Reason (R) is the correct explanation of Assertion (A).
The statement in Assertion is true that Calcium and Argon are isobars because they have the same mass number (40). Isobars are atoms of different elements that have the same mass number but different atomic numbers.
The statement in Reason is also true and provides the explanation for Assertion because the mass number of an atom is equal to the sum of the number of protons and neutrons in its nucleus. Calcium has 20 protons and 20 neutrons, giving it a mass number of 40. Argon has 18 protons and 22 neutrons, also giving it a mass number of 40. Therefore, they have the same number of nucleons and are isobars.
Therefore, option (A) is the correct answer.
2. The correct answer is (B) Both Assertion (A) and Reason (R) are true but Reason (R) is not the correct explanation of Assertion (A).
The statement in Assertion is true that the number of valence electrons in oxygen atoms is 6. Valence electrons are the electrons in the outermost shell of an atom that participate in chemical reactions.
The statement in Reason is also true, but it does not provide the correct explanation for Assertion. Valency refers to the combining capacity of an atom, and it is determined by the number of valence electrons. The valency of oxygen is 2, not 6. Oxygen has 6 valence electrons, but it forms two covalent bonds to complete its octet in most compounds, giving it a valency of 2.
Therefore, option (B) is the correct answer.
3. The correct answer is (D) Assertion (A) is false but reason (R) is true.
The statement in Assertion is false because most of the alpha particles in Rutherford's experiment were deflected at various angles, and only a few passed straight through the gold foil. This observation led Rutherford to propose the nuclear model of the atom.
The statement in Reason is true. The center of the atom, or nucleus, is positively charged because it contains protons, which have a positive charge. Electrons, which have a negative charge, orbit the nucleus in a cloud-like distribution.
Therefore, option (D) is the correct answer.
To know more about atom visit:
https://brainly.com/question/30282087
#SPJ1
A 0.598 g sample of a green metal carbonate, containing unknown metal M, was heated to give the metal oxide and 0.222 g of CO2 (g) according to the reaction below. MCO3(s) + MO(s) + CO2(g) What is the metal M? Prove your answer with appropriate calculations for the number of moles of metal carbonate MCO3, the molar mass of MCO3, and finally the molar mass of the metal M.
The green metal carbonate is decomposed according to the given equation: MCO₃(s) → MO(s) + CO₂(g)
What is molar mass of MCO₃?
The number of moles of CO₂(g) produced can be used to determine the number of moles of the green metal carbonate (MCO₃) that decomposed.0.222 g of CO₂ (g) represents 1 mol of CO₂ (g), since its molar mass is 44 g/mol.
Therefore,1 mol of MCO₃ will produce 1 mol of CO₂ (g) in the reaction. So, 0.222 g of CO₂ (g) corresponds to 1 mol of MCO₃.
Hence, the number of moles of MCO₃ is:
moles of MCO₃= mass/Molar
mass= 0.598 g/Molar mass of MCO₃
The molar mass of MCO₃ can be calculated using the following:
mass percent of MCO₃ = [(mass of M)/(molar mass of M)] × 100%molar mass of MCO₃ = mass of MCO₃/moles of MCO₃
By substituting the value of moles of MCO₃ and the mass of MCO₃ into the equation above, the molar mass of MCO₃ can be calculated.
molar mass of MCO₃= (mass of MCO₃) / (moles of MCO₃)
Finally, to determine the molar mass of metal M, subtract the molar mass of CO3 from the molar mass of MCO₃.
MCO₃ = 12.011 + 3(15.999) + M(55.845)
= 181.76 + 55.845MM
= 55.845 - 60.01MM
= -4.165
The molar mass of the metal M is 4.165 g/mol.
To summarize, the metal M is sodium (Na) and its molar mass is 4.165 g/mol.
To know more about molar mass:
brainly.com/question/23058220
#SPJ11
What is the purpose of the one balloon larger in size than the other balloons? o to represent unoccupied space in a molecule to represent any pair of electrons - bonding or lone pair to represent the space lone pairs occupy in a molecule Submit Request Answer
The balloon that is one size larger than the others serves to symbolise the area in a molecule inhabited by lone pairs of electrons, signifying unshared electron pairs in a particular region.
The Lewis structure is a chemical model that depicts how atoms and valence electrons are arranged in a molecule. The atoms are represented by symbols, and the valence electrons, which are the electrons at the highest energy level, are shown as dots or lines. In organic chemistry, the bigger balloon often designates a region of a molecule where electrons are not shared with any other atoms or groups. The structure and reactivity of the molecule are impacted by this region, which is referred to as a lone pair. The wider balloon makes it easier to see where these unshared electron pairs are located and how they affect the molecule's overall structure and behaviour.
learn more about lone pairs here:
https://brainly.com/question/30886923
#SPJ4
2. write the mechanism for the nitration of toluene showing explicitly why ortho and para products are favored over meta.
Nitration of toluene takes place in four steps which include formation of nitronium ion, formation of electrophile, deprotonation, and elimination of HNO₃.
What is the mechanism of nitration?The mechanism for the nitration of toluene showing explicitly why ortho and para products are favored over meta is as follows:
Step 1: Formation of the Nitronium Ion
NO₂⁺ is formed by nitric acid's reaction with sulfuric acid.
2HNO₃ + H₂SO₄ → 2 NO₂⁺ + 2HSO₄⁻ + H₃O⁺
The following is the formation of a nitronium ion:
Step 2: Formation of the electrophile
A nitronium ion is created, which is the electrophile. Because of the strong electron-releasing effect of the methyl group, the nitronium ion is drawn to the ring.
Due to the stability of the resulting carbocation, ortho and para products are favored over meta. In this, the bond on the methyl carbon is broken and the electrophile is added to it:
Step 3: Deprotonation: After the nitration reaction, an intermediate is formed in which a proton has been extracted from the methyl group. The formation of this intermediate indicates that the electrophile has been added to the ring's ortho or para positions.
Step 4: Elimination of HNO₃: An acid base reaction occurs to complete the nitration process, yielding nitrotoluene, HNO₃, and sulfuric acid. Here the intermediate is used to illustrate that the reaction has occurred with the ortho product. This reaction may also result in a para product in a similar manner.
Learn more about Nitration here:
https://brainly.com/question/26927899
#SPJ11
draw the organic product that is expected to form when the following compound is treated with aqueous naoh.
The organic product that is expected to form when the following compound is treated with aqueous NaOH is RCOONa + H₂O .
The given compound is a carboxylic acid. When treated with aqueous NaOH, it will undergo a reaction known as neutralization to form the corresponding salt of the carboxylic acid.The reaction mechanism is as follows;The first step is the dissociation of NaOH into its ions
NaOH → Na⁺ + OH⁻
Secondly, there will be proton transfer between the carboxylic acid and the OH ion of NaOH as follows:
RCOOH + OH⁻ → RCOO⁻ + H₂O
With this, we can draw the organic product expected to form when the given compound is treated with aqueous NaOH as shown below: OR RCOONa + H₂O. The product formed is the salt of the given carboxylic acid.
More on organic products: https://brainly.com/question/17150018
#SPJ11
the atmospheric pressure on venus is about 90 atm or 90 times more than the pressure on earth. carbon dioxide makes up 96.5% of this atmosphere. what is the partial pressure of carbon dioxide on venus?
The partial pressure of carbon dioxide on Venus is approximately 86.85 atmospheres.
If the atmospheric pressure on Venus is approximately 90 times greater than the pressure on Earth, and carbon dioxide makes up 96.5% of the Venusian atmosphere, we can calculate the partial pressure of carbon dioxide on Venus.
Let's assume the pressure on Earth is 1 atmosphere (atm). Then, the atmospheric pressure on Venus would be 90 atm.
To find the partial pressure of carbon dioxide on Venus, we multiply the total atmospheric pressure by the fraction of carbon dioxide in the atmosphere:
Partial pressure of carbon dioxide on Venus = Total atmospheric pressure on Venus * Fraction of carbon dioxide in the atmosphere
Partial pressure of carbon dioxide on Venus = 90 atm * (96.5 / 100)
Partial pressure of carbon dioxide on Venus = 90 atm * 0.965
Partial pressure of carbon dioxide on Venus ≈ 86.85 atm
Therefore, the partial pressure of carbon dioxide on Venus is approximately 86.85 atmospheres.
Learn more about partial pressures, here:
https://brainly.com/question/30114830
#SPJ12
For E2 elimination reactions to occur, chair conformations of halocyclohexanes must have both the H and the X atoms in _____ positions
For E2 elimination reactions to occur, chair conformations of halocyclohexanes must have both the H and the X atoms in axial positions. The E2 elimination reaction is a type of elimination reaction that is dependent on the substrate and the strength of the base used. It is a bimolecular process that happens when two molecules, the substrate, and the base, collide with each other.
The E2 reaction is a one-step process in which the leaving group and the hydrogen ion are lost from the substrate at the same time, resulting in the formation of a pi bond. In a halocyclohexane molecule, there are two positions for the H and X atoms, axial and equatorial.
However, in order for the E2 reaction to occur, the H and X atoms must be in axial positions so that they are in the same plane as the leaving group. This ensures that the hydrogen ion and the leaving group can be lost from the substrate at the same time, resulting in the formation of a pi bond.
Know more about elimination reactions here:
https://brainly.com/question/29695970
#SPJ11
Which of the following molecules would have the highest boiling point?
a) hexane
b) octane
c) 2-propylpentane
d) 2-methylhexane
The molecule which would have the highest boiling point is 2-methylhexane. Thus, the correct option will be D.
What is boiling point?The boiling point is the temperature at which the vapor pressure of a liquid is equal to the external pressure. The boiling point of a liquid is a measure of its vapor pressure. The higher the boiling point, the higher the vapor pressure of the liquid, and the more heat is required to vaporize it.
The boiling point of a substance is affected by the strength and types of intermolecular forces. The stronger the intermolecular forces, the higher the boiling point. 2-methylhexane has highest boiling point because it has the highest number of carbons and branches, which contribute to its strong intermolecular forces that lead to a higher boiling point.
Therefore, the correct option is D.
Learn more about Boiling point here:
https://brainly.com/question/25777663
#SPJ11
What volume of air is present in human lungs if 0.19 mol are present at 312K and 1.3 atm?
A. 0.066
B. 2.9L
C. 5.5L
D.3.7L
Answer:
The answer is D - 3.7 L.
Under what conditions of temperature and pressure do real gases behave most like ideal gases?
1) high temperature and high pressure
2) high temperature and low pressure
3) low temperature and high pressure
4) low temperature and low pressure
Real gases behave most like ideal gases under conditions of high temperature and low pressure. Option 2 is correct.
This is because at high temperatures, the kinetic energy of gas molecules increases, causing them to move faster and collide more frequently, which reduces the intermolecular forces between the gas molecules. At low pressures, the gas molecules are farther apart and the intermolecular forces are weaker, allowing the gas molecules to move more freely and behave more like an ideal gas.
At high pressures and low temperatures, the gas molecules are closer together and the intermolecular forces are stronger, causing deviations from ideal gas behavior. Hence the correct option is 2.
To know more about ideal gas, here
brainly.com/question/28257995
#SPJ4
In an experiment of the photoelectric effect, an incident beam of visible light shined on a piece of metal and produced electrons with zero kinetic energy (Case 1)1. Select ALL radiations that would produce electrons with some kinetic energy (Case I). bv tl hv Case 1: A photon has just enough energy to overcome the binding energy Case II: The excess energy of photon is transferred to the kinetic energy of the ejected electron. Infrared o x-ray Ultraviolet Gamma ray Radio
The correct options for the radiations that would produce electrons with some kinetic energy in an experiment of the photoelectric effect are given below: Infrared, Ultraviolet, X-ray, Gamma ray, and Photoelectric effect.
What is the photoelectric effect?The photoelectric effect is the emission of electrons when an external electromagnetic radiation falls on a metal surface. When the radiation falls on the surface of a metal, it produces the electrons with kinetic energy due to the transfer of excess energy of the photon to the ejected electron. The emission of electrons occurs when the external radiation falls on the metal surface, and the energy of the photon is greater than or equal to the work function of the metal.
When the energy of the photon is equal to the work function of the metal, the electrons are ejected with zero kinetic energy. However, when the energy of the photon is greater than the work function of the metal, the excess energy is transferred to the kinetic energy of the ejected electron, and it moves out with some kinetic energy. Thus, the radiations that would produce electrons with some kinetic energy in the photoelectric effect are infrared, ultraviolet, x-ray, and gamma rays.
Learn more about Photoelectric effect here:
https://brainly.com/question/9260704
#SPJ11
Choose the paramagnetic species from below.
Ar
O
Ti4+
All of the above are paramagnetic.
None of the above are paramagnetic.
The correct answer is option (c) Ti4+.
The species which are attracted to a magnetic field are known as paramagnetic species. If we talk about the given options, then we can see that there are only 3 species that are given. Out of these three, only Ti4+ is paramagnetic. How can we determine whether a species is paramagnetic or not? The species which contain unpaired electrons are paramagnetic in nature. If there are all paired electrons, then the species are diamagnetic. If we talk about Ti4+, then it contains 2 unpaired electrons, which makes it paramagnetic. This is the reason why the correct answer is Ti4+.In Ar, all the electrons are paired, which makes it diamagnetic. In O, there are 2 unpaired electrons, which makes it paramagnetic. How can we determine whether a species is paramagnetic or not? The species which contain unpaired electrons are paramagnetic in nature. If there are all paired electrons, then the species are diamagnetic.
Learn more about paramagnetic species at brainly.com/question/29990302
#SPJ11
Practice Problem 11.15b Propose an efficient synthesis for the following transformation. y The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. A B с Br2 HBr, ROOR cat. OsO4, NMO D HBr E H2, Pd F H2SO4, H2O, HgSO4 I 1) O3; 2) DMS H 1) xs NaNH2, 2) H20 1) R2BH; 2) H2O2, NaOH Practice Problem 11.18d Propose an efficient synthesis for the following transformation. The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. B с HBr, ROOR 1) O3; 2) DMS Br2, hv F D H2S04, H20, HgSO4 E H2, Lindlar's cat. HC=CNa I G HBr H NaOme 1) R2BH; 2) H2O2, NaOH Practice Problem 11.21a X Incorrect. Propose an efficient synthesis for the following transformation. The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. A B HBr, ROOR HC=CNa 1) R2BH; 2) H2O2, NaOH D HBr E CH3CH2Br H2S04, H2O, HgSO4 G NaOH н conc. H2SO4, heat I 1) LiAlH4; 2) H307 Practice Problem 11.21b Propose an efficient synthesis for the following transformation. :- The transformation above can be performed with some reagent or combination of the reag spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide j B с t-BuOK 1) O3; 2) DMS Br2, hv D H2SO4, H20, HgSO4 E H2, Lindlar's cat. F HC=CNa H HBr, ROOR HBr I 1) R2BH; 2) H202, NaOH Practice Problem 11.21c Propose an efficient synthesis for the following transformation. SOH The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. B с HBr, ROOR HC=CNa 1) R2BH; 2) H202, NaOH F D HBr E CH3CH2Br H2SO4, H20, HgSO4 I G NaOH H conc. H2S04, heat 1) 03; 2) H20 Propose an efficient synthesis for the following transformation. - li The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. А B HBr conc. H2S04, heat HC=CNa D HBY, ROOR E Hy, Lindlar's cat. 1) O3; 2) DMS G Brą, hv H dilute H2SO4 I H2, Pt Practice Problem 11.25a Propose an efficient synthesis for the following transformation: % Br The transformation above can be performed with some combination of the reagents listed below. Give the necessary reagents in the correct order for each transformation, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. А t-BuOK B OsO4, NMO c 1) O3; 2) DMS D H2, Pt E H2, Lindlar's cat F xs HBr I G 1) BH 3.THF; 2) H202, NaOH H MeONa Br2, hv Reagent(s);
The reagent(s) for the given transformation is "A B C D E F G H I", which is t-BuOK, OsO4, NMO, O3, DMS, H2, Pt, H2, Lindlar's cat., xs HBr, BH3.THF, H202, NaOH, MeONa, Br2, hv.
What is transformation?Transformation is the process of changing something into a different form or state. It can involve altering the physical characteristics, behaviors, attitudes, or perceptions of an entity. Transformation is a process that occurs in a variety of contexts including business, education, technology, and personal development.
A) t-BuOK - For the given transformation, the initial step is to add an alkoxide, here t-BuOK, to the starting material.
B) OsO4, NMO - After the addition of the alkoxide, the resulting intermediate has to be oxidized by OsO4 and NMO reagents.
C) 1) O3; 2) DMS - The intermediate then has to be ozonolyzed using ozone and dimethyl sulfide (DMS).
D) H2, Pt - The ozonolysis will result in a mixture of aldehyde and ketone. The aldehyde has to be hydrogenated using H2 and Pt.
E) H2, Lindlar's cat. - The ketone has to be hydrogenated using H2 and Lindlar's catalyst.
F) xs HBr - The product of the hydrogenation has to be converted to a tertiary alcohol by an elimination reaction with HBr.
G) 1) BH3.THF; 2) H202, NaOH - The tertiary alcohol has to be oxidized to a tertiary ketone using BH3.THF, H202 and NaOH.
H) MeONa - The tertiary ketone has to be methylated using MeONa.
I) Br2, hv - The product of the methylation has to be brominated using Br2 and heat.
Therefore, the reagent(s) for the given transformation is "A B C D E F G H I", which is t-BuOK, OsO4, NMO, O3, DMS, H2, Pt, H2, Lindlar's cat., xs HBr, BH3.THF, H202, NaOH, MeONa, Br2, hv.
To learn more about transformation
https://brainly.com/question/382594
#SPJ1
(science) explain the difffrence between a food chain and a food web
Answer: A food chain shows what eats what. A food web is made up of all the food chains in the ecosystems.
Explanation: Hope that helps!
Answer:
Explanation:
A food chain outlines who eats whom.
A food web is all of the food chains in an ecosystem.
describe the effect of each of the following on the rate of the reaction of magnesium metal with a solution of hydrochloric acid: the molarity of the hydrochloric acid, the temperature of the solution, and the size of the pieces of magnesium.
The molarity will determine the concentration of the acid in the solution, thus increasing the rate of the reaction. The temperature will increase the kinetic energy of the particles. The size of the pieces of magnesium: a larger surface area of magnesium will increase the rate of reaction.
The molarity of the hydrochloric acid:The rate of reaction of magnesium metal with a solution of hydrochloric acid is increased when the molarity of the hydrochloric acid increases. This is because an increase in the molarity of the hydrochloric acid increases the concentration of hydrogen ions in the solution, which increases the frequency of successful collisions between magnesium atoms and hydrogen ions, hence increasing the rate of reaction.
The temperature of the solution:The rate of reaction of magnesium metal with a solution of hydrochloric acid is increased when the temperature of the solution increases. This is because an increase in temperature increases the kinetic energy of magnesium atoms and hydrogen ions, increasing the frequency of successful collisions between them, hence increasing the rate of reaction.
The size of the pieces of magnesium:The rate of reaction of magnesium metal with a solution of hydrochloric acid is increased when the size of the pieces of magnesium decreases. This is because a smaller size of magnesium increases the surface area of magnesium in contact with the solution, increasing the frequency of successful collisions between magnesium atoms and hydrogen ions, hence increasing the rate of reaction.
More on reaction rates: https://brainly.com/question/29767006
#SPJ11
Complete the sentence to explain why ethanol is soluble in water but propane is not Drag the terms on the left to the appropriate blanks on the right to complete the sentence. Reset Help Ethanol has a that can form but the hydrogen bonds polar –OH group ionic bonds nonpolar-CH, group with alkane propane does not covalent bonds water other ethanol molecules Submit Request Answer Part B Complete the sentences to explain winy 1-propanol is soluble in water but 1-hexanol is not. Drag the terms on the left to the appropriate blanks on the right to complete the sentences. Reset Help one to three longer shorter Alcohols with carbon atoms are completely soluble in water. In alcohols with carbon chains, the effect is diminished, making them slightly soluble to insoluble one to four the-CH, group the-OH group one to five Submit Request Answer
Answer:
In general terms, because (1) the carbon-oxygen and hydrogen-oxygen bonds in ethanol are much more polar than any of the bonds in propane; (2) the oxygen atom in ethanol can form hydrogen bonds with the hydrogen atoms in water, but there is not such possibility with propane; and (3) propane contains more carbon atoms per molecule than ethanol.
Explanation:
In general terms, because (1) the carbon-oxygen and hydrogen-oxygen bonds in ethanol are much more polar than any of the bonds in propane; (2) the oxygen atom in ethanol can form hydrogen bonds with the hydrogen atoms in water, but there is not such possibility with propane; and (3) propane contains more carbon atoms per molecule than ethanol.
) Predict the product for the following reaction. Assume you have an excess of potassium tert-butoxide. (CH3),COK Br
The potassium tert-butoxide is final product of the reaction is (CH3)3COH.
Why potassium tert-butoxide is (CH3)3COH?
The product for the given reaction is (CH3)3COH.
Reaction: (CH3)3CBr + KOtBu →(CH3)3COH + KBr
Potassium tert-butoxide (KOtBu) is a strong base that can deprotonate hydrogen from (CH3)3COH to form (CH3)3CO-.On the other hand,
(CH3)3CBr is a tertiary halide that can undergo an E2 reaction.
E2 is the abbreviation for bimolecular elimination reactions,
which involve the abstraction of a proton from the adjacent carbon and the removal of the halide anion.
The hydrogen that is abstracted by KOtBu can only come from the carbon that is adjacent to the bromine in (CH3)3CBr, according to Saytzeff's rule, because this is the carbon with the least number of hydrogens.
As a result, an alkene intermediate will be formed.
The KBr salt will be the by-product.
The alkene intermediate, however, is not present in the end product because it is a reactive molecule and quickly reacts with any available hydrogen.
The hydrogen is provided by the KOtBu base.
As a result, the final product of the reaction is (CH3)3COH.
Learn more about potassium tert-butoxide
brainly.com/question/29484874
#SPJ11
a.) Determine whether potassium hydrogen tartrate (KHC4H4O6) is neutral, basic, or acidic. First, what is its Ka when it acts as an acid? The following are for the diprotic acid, H2C4H4O6: Ka1 = 1.0 x 10-3 and Ka2 = 4.6 x 10-5. b.) Second, what is its Kb when it acts as a base? c.) Finally, indicate whether the HC4H4O6- ion is neutral, basic, or acidic in solution.
a) potassium hydrogen tartrate (KHC4H4O6) is acidic. Ka is calculated for the acidic characteristics of the molecule. When a proton is donated by the molecule to water, it forms the ion HCO4-. b) Kb = [C4H4O6-2][OH-]/[HC4H4O6-], Kb = (1.0 × 10-11) × [C4H4O6-2][OH-]/[HC4H4O6-]. c) As the ion HC4H4O6- is an acidic ion, it will have acidic characteristics in solution. It is because the ion can donate protons and act as an acid.
Kb is calculated for the basic characteristics of the molecule. The balanced chemical equation for the reaction is as follows:HC4H4O6-(aq) + H2O(l) ⇌ C4H4O6-2(aq) + OH-(aq)The Kb is determined using the equation given below : Kb = [C4H4O6-2][OH-]/[HC4H4O6-]The Ka value is calculated as shown below: Kb = [C4H4O6-2][OH-]/[HC4H4O6-]Kb = (1.0 × 10-11) × [C4H4O6-2][OH-]/[HC4H4O6-]
The balanced chemical equation for the reaction is as follows: HC4H4O6(aq) + H2O(l) ⇌ HCO4-(aq) + H3O+(aq)The Ka is determined using the equation given below : Ka = [HCO4-][H3O+]/[HC4H4O6]Ka = (1.0 × 10-3) × [HCO4-][H3O+]/[HC4H4O6]. Therefore, the Ka value is not given.
Know more about potassium hydrogen tartrate here:
https://brainly.com/question/11127999
#SPJ11
in which case the reaction in the gas mixture will proceed nonspontaneously in the forward direction?
The reaction in the gas mixture will proceed non-spontaneously in the forward direction when the standard free energy change (∆G°) is positive or zero.
What is spontaneous reaction?In chemical reactions, the term spontaneity refers to whether the reaction proceeds on its own or requires an input of energy to occur. When ∆G° is negative, a reaction is said to be spontaneous in the forward direction, meaning it occurs naturally without any external input of energy. When ∆G° is positive or zero, on the other hand, the reaction proceeds nonspontaneously in the forward direction.
In other words, the reaction requires energy input to proceed. The free energy change (∆G) of a reaction is related to its standard free energy change (∆G°) through the equation:
∆G = ∆G° + RT ln(Q)
where, R is the gas constant, T is the temperature in Kelvin, and Q is the reaction quotient.
If Q = 1, the reaction is at equilibrium and ∆G = ∆G°. If Q < 1, the reaction proceeds spontaneously in the forward direction (∆G < 0), and if Q > 1, the reaction proceeds spontaneously in the reverse direction (∆G > 0).
Learn more about Spontaneous reaction here:
https://brainly.com/question/13790391
#SPJ11
Does electronegativity increase as atomic radius increases?
Actually, when atomic radius grows, electronegativity often decreases.
The capacity of an atom to draw electrons into a chemical connection is known as electronegativity. The separation between the nucleus and the farthest electrons grows with increasing atomic radius. As a result, the nucleus's attraction to the electrons is reduced, making it more challenging for the atom to draw electrons to itself. The electronegativity values of bigger atoms are therefore often lower than those of smaller ones. Despite this general tendency, there are certain outliers since electronegativity also depends on other elements including nuclear charge and electron configuration. For instance, the rising nuclear charge in halogens causes the electronegativity to rise as the atomic radius falls.
learn more about electronegativity here:
https://brainly.com/question/17762711
#SPJ4
choose the pair of words or phrases that best completes the sentence below. isoelectronic species have radii that vary with even though they have the same number of . select the correct answer below: the number of electrons; protons atomic number; electrons atomic number; neutrons the number of electrons; neutrons
The pair of words or phrases that best completes the sentence "Isoelectronic species have radii that vary with ___even though they have the same number of ___." is "atomic number; electrons."
Explanation:
Isoelectronic species refers to atoms, molecules or ions having the same number of electrons but a different number of protons. They have identical electron configurations but different nuclear charges. As a result, they may have different ionic radii.
The ionization energy and electron affinity of isoelectronic species are identical, but the size of the atoms varies with the nuclear charge or atomic number. Atomic radius depends on the number of electrons and the nuclear charge. This is because the nuclear charge exerts an attractive force on the electrons in the outer shell that holds them in place.
The greater the nuclear charge, the smaller the atom.The pair of words or phrases that best completes the sentence is "atomic number; electrons." The number of electrons in the outermost shell of an atom determines its size. As we progress from left to right on a period, the number of electrons in the outer shell stays the same, but the nuclear charge increases.
This results in a decrease in size from left to right .Arranging isoelectronic species in a table shows that the radius of an ion is inversely proportional to the nuclear charge or atomic number.
To know more about Isoelectronic species refer here: https://brainly.com/question/30874804#
#SPJ11
Reduction involves the ____ of electron(s), and reactions for which the standard cell potential is ____ are spontaneous under standard conditions.
A. loss; negative
B. loss; positive
C. gain; negative
D. gain; positive
E. none of the above
Reduction involves the gain of electrons, and reactions for which the standard cell potential is negative are spontaneous under standard conditions.
Reduction- In a chemical reaction, the process of gaining one or more electrons is known as reduction. It is the opposite of oxidation, which is the loss of electrons in a reaction.
Reduction is the method of reducing the oxidation state of a substance. The reduction of carbon dioxide to glucose during photosynthesis is an example of a biological reduction. The reduction of iron oxides into elemental iron during the blast furnace process is an example of an industrial reduction.
To learn more about "reduction", visit: https://brainly.com/question/21851295
#SPJ11
Suppose that an ethene molecule gains an additional electron to give the 2 C H-4 ion. Will the bond order of the carbon–carbon bond increase or decrease? Explain.
When an ethene molecule receives an extra electron to form the 2 C H-4 ion, the bond order of the carbon–carbon bond will decrease.
What is bond order?
Bond order is a formal way to quantify the number of covalent bonds that exist between two atoms in chemistry. Bond order is defined as the difference in the number of electron pairs in bonding and antibonding molecular orbitals, as stated by Linus Pauling in his introduction.
Ethene is a hydrocarbon that has two carbon atoms joined by a double bond. In ethene, the carbon-carbon bond order is 2. A bond order is the number of chemical bonds connecting a pair of atoms. Double bonds have a bond order of 2, whereas single bonds have a bond order of 1. Bond order has a significant impact on the stability and strength of the bond.
As a result, a change in bond order can have a significant impact on a molecule's physical and chemical properties.The bond order in the 2 C H-4 ion is calculated using the molecular formula: 2 C + H + 1 e-. Carbon has six electrons in its outermost shell, while hydrogen has one.
To achieve stability, carbon requires four more electrons, and hydrogen requires one more electron. The electron received is utilized to form a new carbon-hydrogen bond. As a result, there will be three single carbon-carbon bonds, and the bond order will decrease from two to 1.5. The bond strength between the two carbon atoms is also reduced. Therefore, the carbon-carbon bond will decrease in bond order when an ethene molecule gains an extra electron to form the 2 C H-4 ion.
Learn more about bond order on:
https://brainly.com/question/9713842
#SPJ11
If a solid piece of shiny sodium metal is exposed to chlorine gas, a large amount of heat is released and the white solid sodium chloride (table salt) forms. Based on this information, which of the following statements is TRUE? A) This process was exothermic_ B) This process represents a physical change: C) Mass is lost during this process_ D) This process was endothermic_
Option A is the correct statement for the process was exothermic that a large amount of heat is released when sodium metal is exposed to chlorine gas.
What happens when sodium is exposed to chlorine? Sodium metal reacts with chlorine gas to produce sodium chloride. When solid shiny sodium metal is exposed to chlorine gas, a large amount of heat is generated, and the white solid sodium chloride (table salt) is formed. So the process is an exothermic reaction.A chemical reaction in which heat is given out, such as the one between sodium and chlorine, is exothermic. When the products' energy is less than the reactants' energy, energy is given out from the system into the surroundings, resulting in an increase in temperature in the surroundings. Therefore, this process was an exothermic and the correct option is 'A'.Learn more about sodium chloride: https://brainly.com/question/28106660
#SPJ11
When 2.55g of an unknown weak acid (HA) with a molar mass of 85.0 g/mol is dissolved in 250.0 g of water, the freezing point of the resulting solution is -0.258 Degrees Celsius.
Calculate Ka for the unknown weak acid.
The Ka for the unknown weak acid (HA) with a molar mass of 85.0 g/mol will be about 9.26 × 10⁻¹⁴.
What is the freeing point of unknown acid solution?The formula for calculating the freezing point depression of a solution is:
ΔTf = Kf × m × i
where, ΔTf is the change in freezing point, Kf is the freezing point depression constant, m is the molality of the solute, and i is the van't Hoff factor.
To calculate the molar mass of the unknown weak acid, we need to convert grams to moles:
2.55 g ÷ 85.0 g/mol = 0.03 molHA
We can then calculate the molality of the solution by dividing the moles of solute by the mass of the solvent in kilograms:
0.03 mol ÷ 0.250 kg = 0.12 mol/kg
ΔTf can be calculated by subtracting the freezing point of the pure solvent (water) from the freezing point of the solution:
0.258°C - 0°C = -0.258°C
The freezing point depression constant (Kf) for water is 1.86 °C/m. We can use this value, along with the molality of the solution, to solve for the dissociation constant (Kb) for the unknown weak acid:
ΔTf = Kf × m × i
0.258°C = 1.86 °C/m × 0.12 mol/kg × i
i = 1.08
Ka can be calculated using the relationship between Ka and Kb for an acid:
Kb = Kw / Ka
Kw is the ion product constant for water, which is 1.00 × 10⁻¹⁴ at 25°C. We can use this value, along with the value we just calculated for Kb, to solve for Ka:
Kb = Kw / Ka
1.08 = 1.00 × 10⁻¹⁴ / Ka
Ka = 9.26 × 10⁻¹⁴
So, the Ka for the unknown weak acid is 9.26 × 10⁻¹⁴.
Learn more about Freezing point depression here:
https://brainly.com/question/12844810
#SPJ11