Learning Task 1: Give the value and the place value of the underlined
digits. Write your answers in your notebook.
Value
Place
Value
1. Sixteen hundredths
2. Three hundred and nine ten
thousandths
3. Eleven and ten hundredths
4. Fifty-two and four hundred ninety-three
ten thousandths
5. Seven hundred and four ten
thousandths
E​

Answers

Answer 1

Answer:

Value place value

1. 0.016. hundredths

2. 0009. ten thousandths

3. 00011. ten thousandths

4. 0.00093. ten thousandths

5.0004. ten thousandths

Step-by-step explanation:


Related Questions

30 POINTS!!!!!!!!!!!!!!!!!!!! HELP PLZ
A scatter plot is shown below:

A graph shows numbers from 0 to 10 on the x axis at increments of 1 and the numbers 0 to 15 on the y axis at increments of 1. The ordered pairs 0, 14 and 1, 11 and 2, 9 and 3, 10 and 4, 7 and 5, 7 and 6, 5 and 7, 5 and 8, 3 and 9, 1 and 10, 0 are shown on the graph.

Which two ordered pairs can be joined to best draw the line of best fit for this scatter plot?

(4, 15) and (10, 7)
(1, 6) and (6, 0)
(0, 13) and (10, 11)
(0, 13) and (10, 0)

Answers

Answer:

kk

Step-by-step explanation:

(0, 13) and (10,11)

which expressions are equivalent to 3 (3P+3 - 3P-5) ? choose ALL that apply.

a. p - 2
b. p - 6
c. 3(1/3p-2)
d. 3(p-2)
e. 3(1/3p+3-5)
f. 3(1/3p-8)

Answers

Answer: The correct one is 3 (1/3p+3-5), p-6, 3(1/3p-2)

Step-by-step explanation: I just did it lol

In which direction must the graph of f(x) = |x| be shifted to produce the graph of g(x) = |x − 3|?

A.
left
B.
down
C.
up
D.
right

Answers

Answer:

In which direction must the graph of f(x) = |x| be shifted to produce the graph of g(x) = |x − 3|?

A. left

B. down

C. up

D. right

Right is the right answer.

Answer:

Down

Step-by-step explanation:

I took the test and got it right

Hello! :)
Please help me solve this + explain your answer :)

I will indeed give you Brainlst <3

Answers

The answer is decreasing and linear.Therefore B.Please mark me brainliest im 100% sure it’s the right answer.

HELP PLEASE
Determine the length of a chord whose central angle is 65° in a circle with a radius of 9 feet.
Question 5 options:


1)
4.84 feet


2)
9 feet


3)
9.67 feet


4)
8.16 feet

Answers

Answer:

3)

9.67 feet

Step-by-step explanation:

The length of the chord is approximately 8.16 feet. The correct option is 4.

What is the length of the chord of the circle?

A line segment connecting two points on a circle is referred to as a circle's chord in geometry. The circle's center is traversed by the longest segment that can be drawn between any two points on the circle.

To get the chord's length, we can utilize the formula for a circle's chord length. The equation is:

Length of chord = 2r sin(θ/2)

where r is the circle's radius, is its radian central angle, and sin is the sine function.

First, we need to convert the central angle from degrees to radians:

θ = 65° = (65/180)π = 1.14 radians

Now we can plug in the values:

Length of chord = 2(9 feet) sin(1.14/2) ≈ 8.16 feet

Therefore, the length of the chord is approximately 8.16 feet.

To know more about the chord of a circle follow

https://brainly.com/question/8937665

#SPJ2

Roberto wants to display 18 sports cards in an album. Some pages hold 2 cards and others hold 3 cards. How many different ways can Roberto display his figures?


Answers

Answer: The answer is 2.

HOPE IT HELPS!!


Which fraction is equal to 30%?
A.
30
100
B.
100
300
C.
100
30
D.
3.0
100

Answers

Answer:

A. 30/100

Step-by-step explanation:

All you have to do is divide the numerator by the denominator and then multiply that result with 100 like so:

(Numerator/Denominator)*100

When you enter 30/100 into the above formula, you get (30/100)*100 which calculates to:

30%

Good Luck!

Answer:

1. 30/100

Step-by-step explanation:

Convert fraction (ratio) 30 / 100 Answer: 30%

what is the y-intercept of the following equation ​

Answers

this is the y intercept! glad I can help :)

breakout edu keyla winter wonderland question


i CAN'T DO THIS I've tried so many times how do you do it

Answers

Answer:

due i feel you i suck at those and my teacher counts THEM AS A GRADE AAA GRADEE!!!!

Consider all four-digit numbers that can be made from the digits 0-9 (assume that numbers cannot start with 0). What is the probability of choosing a random number from this group that is less than or equal to 5000

Answers

Answer: 0.44

Step-by-step explanation:

First, let's count the total number of four-digit numbers.

Let's think it as four empty slots:

_ _ _ _

In each slot, we can put a single digit.

In the first slot, we have 9 options {1, 2, 3, 4, 5, 6, 7, 8, 9}

The zero is not an option here, because if there was a 0, this would be a 3 digit number, then the 0 can not be in the first slot.

For the second slot we have 10 options {0, 1, 2, 3, 4, 5, 6, 7, 8, 9}

for the third slot we have 10 options {0, 1, 2, 3, 4, 5, 6, 7, 8, 9}

for the fourth slot we have 10 options {0, 1, 2, 3, 4, 5, 6, 7, 8, 9}

The total number of combinations is equal to the product between the numbers of options for each slot, this means that we have:

Combinations = 9*10*10*10 = 9000

So there are 9000 different 4 digit numbers.

Now we want to find the probability of selecting a number at random that is equal or smaller than 5000.

Let's see the number of 4-digit numbers that are equal or smaller than 5000.

The smallest 4-digit number is 1000.

Then the number of numbers between 1000 and 5000 is:

5000 - 1000 = 4000

This means that there are 4000 4-digit numbers that are equal or smaller than 5000.

Now, the probability of selecting one of them at random is equal to the quotient between the number of 4-digit numbers that meet the condition (4000) and the total number of 4-digits (9000)

Then te probability is:

P = 4000/9000 = 4/9 = 0.44

T

Ed spent 25% of his savings on lunch, which cost $5.25. How much did he have in savings before lunch?

Answers

Step-by-step explanation:

I think 21 dollars is the answer

Andrea earns $32.25 a day. After 9 days , about how much will she have earned?

ESTIMATE

Answers

270? not completely sure.

which expression is equivalent to 15+8x+3+2x​

Answers

Answer:

10x + 18

Step-by-step explanation:

First, we need to add like terms. Like terms are terms that are alike. For instance 8x and 2x are like terms. 15 and 3 are also like terms.

So, we have to add 8x plus 2x and 15 plus 3. That’s comes out to 10x plus 18.

Therefore, this expression is equivalent to 10x + 18.

3.2 - 5.1n - 3n + 5= n +8.2 can someone tell me what goes in the blank

Answers

The answer for (n) is 0

What is 6% of 15? Use a fraction to solve

Answers

Answer:

0.9

Step-by-step explanation:

can't really Explain, its simple mathamatics 6% of 15 = 0.9

The museum of natural history has an auditorium that can seat 200 people. A class of 45 students is seated in the auditorium for a lecture. What decimal represents the portion of the seats in the auditorium that are empty? Please help FAST!

Answers

Answer:

.225

Step-by-step explanation:

45/200

pls help a.s.a.p!!!!!

Answers

Answer:

The correct answers are A and E

Step-by-step explanation:

How many solutions exist for the given equation?
x+12) = 4x-1
EEEE
O zero
O one
two
O infinitely many

Answers

Answer:

One answer exists for this equation.

Solve for x.
-1+4x5= 3

Answers

Answer:

[tex]x = 0.2 \: or \: \frac{1}{5} [/tex]

Step-by-step explanation:

[tex] - 1 + 4x.5 = 3[/tex]

[tex] = > 20x - 1 = 3[/tex]

[tex] = > 20x = 3 + 1 = 4[/tex]

[tex] = > x = \frac{4}{20} = \frac{1}{5} = 0.2[/tex]

You have 7 cups of raisins. A recipe calls for 2/3
cup of raisins per serving. How many full servings can you make?

Answers

Answer:

10 servings

Step-by-step explanation

7 cups is equal to 21/3 cups. Since 21 isnt divisible by 2, you have to round down to the nearest divisible number, which would be 20. 20/2 is 10, so 10 is the answer.

prove that cos130°+cos110°+cos10°=0​

Answers

Answer:

Use the formula cosC+cosD:2cos(C+D/2)cos(C-D/2) Use this in the question: 2cos(10+110/2)cos(10-110/2)+cos130=0 2cos60°cos(-50°)+cos130°=0 2×1/2.cos50+cos130=0 cos50+cos130=0 2cos(50+130/2)cos(50-130/2)=0 2cos90.cos40=0 2×0.cos40=0 0=0 H.P

Step-by-step explanation:

I hope this will help you!

A store pays $13 for a bicycle helmet and marks up the price by 40% what is the amount of the mark-up?

Answers

Answer:

Step-by-step explanation:

the amount of mark up is

13*(40/100)=5.20

Nada is making square coasters with sides of 3 inches. On each coaster is a circular design. What is the radius of the largest circle that fits on one of the coasters?

Answers

Answer:

1.5

Step-by-step explanation:

diameter is half the length of the circle so if it is 1.5 the full length will be 3 inches which is the full length of the coaster

Can y’all plz help me

Answers

Answer:

D. 10

Step-by-step explanation:

Assuming that <COA is a right angle, we can say that the two given angles are complementary

complementary angles are angles that add up to 90 degrees

this means we can create this equation: 3x + 46 + 14 = 90

so subtract 46 and 14 from 90: 3x = 30

divide both sides by 3: x = 10

Answer:

I think that it is letter D

Step-by-step explanation:

sorry if im wrong. but i hope this helps! :)

Graph 16x−4y=2.Please answer I will make you the brainlist and rate you 5 stars if good.And report if bad.

Answers

Answer:

First one is the graph second one is the equation

Step-by-step explanation:

Hope this helps :)

Answer:

Step-by-step explanation:

as graphed

Find the value of x in the triangle shown below 9 12

Answers

show a picture of the triangle

Which is the percent for 1.67

Answers

The percent is 167% have a good day

Answer:

167%

i thank that is the anserr.

Step-by-step explanation:

A ladder 5 m long, leaning against a vertical wall makes
an angle of 65° with the ground. How far up the wall is
the top of the ladder?

Answers

The height of the top of the ladder from the ground is 4.53 m

Step-by-step explanation:

Given:

length of ladder =5 m

Angle formed = 65°

Let h be the Height of the top of the ladder from the ground

Required:

Height of the top of the ladder from the ground

Equation:

SOH-CAH-TOA

Since the hypotenuse side is given and what we are to solve is the opposite side, use SOH

[tex]sinθ\:=\: \frac{opposite}{hypotenuse}[/tex]

[tex]sin(65°)\:=\: \frac{opposite}{5\: m}[/tex]

[tex]opposite\:=\:(5 \:m )\:sin(65°)[/tex]

[tex]opposite\:=\:4.53 \:m[/tex]

Final Answer:The height of the top of the ladder from the ground is 4.53 m

Please refer to the photo for the illustration

What’s is 9 divided by 3/10

Answers

Answer:

30

Step-by-step explanation:

9/(3/10)=9*(10/3)=30

Write a linear model for the amount of boxes, b, as a function of the number of hours since they opened, h. Use your model to predict the number of boxes in stock at the end of an 8 hour shift.

Answers

Question:

A company produces boxes of DVDs at a rate of 52 boxes per hour they begin to produce boxes when they first opened for the day and after 3 hours have 400 boxes in stock.

- How many boxes were in stock when they opened?

- Write a linear model for the amount of boxes, b, as a function of the number of hours since they opened, h.

- Use your model to predict the number of boxes in stock at the end of an 8 hour shift.

Answer:

1. [tex]Initial = 244[/tex]

2. [tex]b = 244 + 52h[/tex]

3. 660 boxes

Step-by-step explanation:

Given

[tex]Rate = 52\ per\ hour[/tex]

[tex]Total\ boxes\ in\ 3\ hours = 400[/tex]

Solving (a): Initial Number of boxes

First, we calculate the number of boxes made in 3 hours

[tex]Boxes = Rate * Hours[/tex]

[tex]Boxes = 52 * 3[/tex]

[tex]Boxes = 156[/tex]

If they had 400 boxes at the 3rd hour.

Then, the number of boxes when they opened is:

[tex]Initial = 400 - 156[/tex]

[tex]Initial = 244[/tex]

Solving (b): Linear function

[tex]b = boxes[/tex]

[tex]h = hours[/tex]

Since, we have the rate and the initial number of boxes.

The linear function is:

[tex]Boxes = Initial + Rate * Hours[/tex]

i.e.

[tex]b = 244 + 52 * h[/tex]

[tex]b = 244 + 52h[/tex]

Solving (c): Boxes at the end of the 8th hour

We have:

[tex]b = 244 + 52h[/tex]

In this case:

[tex]h = 8[/tex]

Substitute 8 for h

[tex]b = 244 + 52 * 8[/tex]

[tex]b = 244 + 416[/tex]

[tex]b = 660[/tex]

Hence, there are 660 boxes at the end of the 8th hour

Other Questions
Simplify so it's in slope-intercept form (y=mx+b)y - 125 = 55(x - 2) PLZ HELP ME!!!!!!!!!!!!!! maya joins two peices of wood together one peice is 36 inches long the total lenght of both peices is 62 how long is the other peice of woodhelp ;-;... Randall owns and operates a successful landscaping company. His net profit income in 2019 was $209,000. What is the amount of SE tax he must pay A home-improvement store sold blinds for $35. A customer signed up for a free membership card and received a 7% discount off the price. Sales tax of 7% was applied after the discount. What was the final price of the blinds? A car travels 72 miles on 6 gallons of gas. At that rate, how much gas will it need to travel 204 miles? Name the features caused by wave erosion and label them in the order that they wouldoccur. Write a short description of each feature.Hint. There are 6 features. Solve for x: 24x + 12 = 16 what is the molecular formula of benzoyl peroxide (c7h5o2) of the molecular mass is 0.242 kg/mol?(show work please) Which class has a ratio of girls to total students of 7:10? A. class with 3 boys and 7 girls B. class with 7 boys and 3 girls C. class with 7 boys and 10 girls D. class with 10 boys and 7 girls the main idea of the fish I didn't catch the seven wonders of the world are? What is the name of this artwork? The artist name is oussama diab but I dont know what this painting name is!! Explain similar figures including explaining how to find the scale factor when given two similar figures and side lengths. Which sentences describe how Sara revised and edited her research report about the ERA? (Select all correct answers.)She added more and stronger transitions between sentences.She added evidence that she had initially left out.She re-organized all of her paragraphs.She replaced informal language with academic discourse.What do the topic sentences in a report show you?the style and tone of the reportthe purpose of the reportthe reports intended audiencethe overall structure of the reportWhich phrases do describe features of academic discourse? (Select all correct answers.)short, simple sentenceslonger, more complex sentencesa formal toneadvanced vocabulary Pls I need answers at least one answer of any of the questions Which of the following best describes the cell below?CapsuleCell wallPlasma membraneCytoplasm,RibosomesPlasmidPBacterial HagellumNucleoid circular DNA)OAprokaryotic cellOBplant cellOC.protist cellODeukaryotic cell 1. What Does DNA stand for? The cost of a mobile phone processor is directly proportional to its speed. A 2GHz mobile costs 500.Let x be the speed of a processor in GHzLet y be the cost in pounds.Find a formula linking the variables. The _______________ rate describes the rate at which the atmosphere gets colder as the air gets thinner at higher altitudes.