pls help me!!!!
will give brainliest

Pls Help Me!!!!will Give Brainliest

Answers

Answer 1

Answer:

B. Is the answer of your question


Related Questions

the answer gzzydyyxggxggxxghyzyxycycgcycyc

Answers

Step-by-step explanation:

we start with the first and the third equations, as they have the same content structure.

we multiply the whole first equation by 2, so that the z terms become aligned, and then we add both equations :

-8x + 4z = 28

-2x - 4z = 22

--------------------

-10x + 0 = 50

x = -5

-2x - 4z = 22

-2×-5 - 4z = 22

10 - 4z = 22

-4z = 12

z = -3

y = x + z + 12

y = -5 - 3 + 12 = 4

h(x)=2x^(2)
evaluate for h(3/2)

Answers

Answer:

hope it helps you.........

It costs $8 for admission to the Park City Ice Arena. In addition, renting skates costs $1 per hour. Write an equation that shows how the total cost, y, depends on the length of the rental in hours, x.

Write an equation that shows how the total cost, y, depends on the length of the rental in hours, x. ​

Answers

Answer:

y=x+8

Step-by-step explanation:

The linear equation is given y=x+8

What are linear equations?

Linear equations help in representing the relationship between variables such as x, y, and z, and are expressed in exponents of one degree. In these linear equations, we use algebra, starting from the basics such as the addition and subtraction of algebraic expressions.

Given here: Cost of entry=$8 and hourly rate of $1

Let the total cost is y and let the length of the rental in hours be x

then we construct an equation with linear relationship as follows:

y=x+8

Hence, The linear equation is given y=x+8

Learn more about linear equations here:

https://brainly.com/question/29739212

#SPJ2

0.5 compared to 2/4 ??? PLEASE ANSWER . I really need help :(

Answers

Answer:

They are the same

Step-by-step explanation:

0.5 = 2/4

Half of 100 is 50

2/4 is half

Hannah was asked to make d the subject of the formula
d-7=4d+3/e
Finish her question.

Answers

Answer:

[tex]d = \frac{-1}{e} - \frac{7}{3}[/tex]

Step-by-step explanation:

In order to make d the subject of the formula, you need to isolate it.

- You started with d-7 = 4d + 3/e

- Move 4d to the left side by subtracting 4d from both sides to cancel it from the right so you have...

d - 7 = 4d + 3/e              This will leave you left with -3d - 7 = 3/e

-4d     -4d                          

- Then move over the -7 by adding 7 to both sides...

-3d - 7 = 3/e              This will leave you left with -3d = 3/e + 7

     +7          +7

- Finally to get d by itself divide both sides of the equation by -3 and you'll be left with...

[tex]d = \frac{3}{-3e} -\frac{7}{3}[/tex]

- You can cancel out the 3 in the -3/3e and make it -1/e so your final answer will be

[tex]d = \frac{-1}{e} - \frac{7}{3}[/tex]

Drag each tile to the correct box. Complete the sequence for deriving the quadratic formula using the quadratic equation in standard form, .

Answers

Answer:

see the picture

Step-by-step explanation:

By the below figure (6) is the initial equation

(1) next added (b/2a)^2 on both sides to make it whole square on left side which gives (4) in (4) both terms are added on the right side to make it (5)

then square root on both sides gives (2) and now taking b/2a to the right side gives the final quadratic formula (3)

We can obtain the quadratic formula from completing the square method as shown.

The quadratic formula is derived from the completing the square method as follows;

Given the quadratic equation;

[tex]ax^{2} + bx + c =0[/tex]

Dividing through by a we have;

[tex]x^{2} + \frac{b}{a} + \frac{c}{a} = 0[/tex]

Adding half of b to both sides of the equation, we have;

[tex](x + \frac{b}{a}) ^{2} = \frac{-c}{a} + \frac{b^2}{4a^2}[/tex]

Taking LCM of the right hand side;

[tex](x + \frac{b}{2a})^{2} = \frac{b^2 - 4ac}{4a^2}[/tex]

Making x the subject of the formula;

[tex]x = \frac{-b + \sqrt{b^2 - 4ac} }{2a}[/tex]

Learn more: https://brainly.com/question/14283892

please help me!!!! thank you.

Answers

Solution:

[tex] {2}^{4x} = {8}^{3x - 10} \\ = > {2}^{4x} = {2}^{3(3x - 10)} \\ = > {2}^{4x} = {2}^{9x - 30} \\ cancel \: \: \: out \: \: \: 2 \: \: \: from \: \: \: both \: \: \: sides \\ = > 4x = 9x - 30 \\ = > 9x - 4x = 30 \\ = > 5x = 30 \\ = > x = \frac{30}{5} \\ = > x = 6[/tex]

Answer:

x = 6

Hope it helps.

Do comment if you have any query.

Directions: Directions: Identify x1, x2, y1, and y2. Solve for the of the line passing through the given points. Identify if the slope is positive, negative, zero, or undefined.

1.​(2,1) and (5,3)
2.​(-2,1) and (1, -3)
3.​(4,1) and (5,1)
4.​(7,-1) and (7,5)
5.​(-2,1) and (3,6)​

Answers

Step-by-step explanation:

Number 1

m = (y2 - y1)/(x2 - x1)

m = (3 - 1)/(5 - 2)

m = 2/3 POSITIVE

Number 2

m = (y2 - y1)/(x2 - x1)

m = (-3 - 1)/(1 + 2)

m = -4/3 NEGATIVE

Number 3

m = (y2 - y1)/(x2 - x1)

m = (1 - 1)/(5 - 4)

m = 0/1

m = 0 ZERO

Number 4

m = (y2 - y1)/(x2 - x1)

m = (5 - 1)/(7 - 7)

m = 4/0

m = UNDEFINED

Number 5

m = (y2 - y1)/(x2 - x1)

m = (6 - 1)/(3 + 2)

m = 5/5

m = 1 POSITIVE

Help me please I really need it

Answers

Answer:

B. 2^9.

Step-by-step explanation:

2^6 * 2^3

= 2^(6+3)

= 2^9.

Find next two terms. -162, -54, -18, ?, ?

Answers

Answer:

-6, -2

Step-by-step explanation:

-2 ×3 = -6

-6 ×3 = -18

-18 x3 = -54

-54 x3 = -162

Triangles 1 and 2 are both isosceles. They each have a 30 degree angle. Explain why these triangles do not have to be similar to each other?

Answers

Answer:

One triangle could have one angle at 30 degrees and the other two angles at 75 degrees, while the other triangle could have two angles that are 30 degrees and one angle that is 120 degrees, therefore making them not similar.

students expect to sell between 275 and 300 hot dogs at a baseball tournament. How many packages of 12 hot dog and 8 buns should the students buy if they want every bun to have a matching hot dog

Answers

Step-by-step explanation:

find the best fitting common multiple between 12 and 8.

let's start with the basic

8×12 = 96

96 fits 3 times into 300 with a remainder of 12.

so, 96 × 3 = 288

that means 288/12 = 24 packages of hot dogs and 288/8 = 36 packages of buns to create exactly 288 hot dogs.

any packages more or less would make the number of available buns and hot dogs "uneven".

which expession represents the product of 3 and 7

Answers

3 × 7

i took the test

Mike is going to have to wait for 5
more minutes in order for the factory to
be at lunch so he can put Boo back.
What percentage of time out of an hour
does he have to wait

Answers

Answer:

12%

Step-by-step explanation:

if you divide 5 from 1 hour which is 60 min you get 12 and convert that to percent and you get 12%

Solve the radical equation, if possible. (30 points)

Would prefer work shown as it would help, thank you.

Answers

Answer:

4.25

Step-by-step explanation:

Shown in photo

2.) Of a classroom filled with 20 students, 2 will be selected to stay after school and correct
homework for extra credit. How many combinations are possible?
A.) 190
B.) 210
C.) 63
D.) 40

Answers

Answer:

190

Step-by-step explanation:

20C2 = (20*19)/(1*2) = 190

Which statement best describes the effect of replacing the function f(x) = 2^x + 2 with the
function g(x) = 2^x + 5?

A: The graph shifts 7 units down.
B: The graph shifts 5 units down.
C: The graph shifts 2 units up.
D: The graph shifts 3 units up.

Answers

Answer:

d: The graph shifts 3 units up

Step-by-step explanation:

The answer is A: the graph shifts 7 units down.

Given the following exponential function, identify whether the change represents growth or decay, and determine the percentage rate of increase or decrease.

please help i dont know if its a growth or decay factor or what percentage its going up by

Answers

Answer:

Check my notes

Step-by-step explanation:

I made note of this last year

What is the equation of variation if p varies jointly as q and r, and the constant of variation is 4?
a. p = 4qr
b. q = 4pr
c. 4 = pqr
d. r = 4pq​

Answers

Answer:

a

Step-by-step explanation:

Given p varies jointly as q and r then the equation relating them is

p = kqr ← k is the constant of variation

Given k = 4 , then

p = 4qr ← equation of variation

poor word choice i need explanation

Answers

Answer:

Huh?

Whats the question?

An act or judgment that is misguided or wrong. bad choice. error.

add (3x^4+3)+(-8x^4)

Answers

Answer:

-5x^4 + 3

Step-by-step explanation:

Answer:

[tex]-5x^{4}[/tex]+3

Step-by-step explanation:

Add like terms: 3x^4 and -8x^4. Add them to get -5x^4. The 3 is left alone and added to the sum.

[tex]-5x^{4}[/tex]+3

Rewrite the following in ascending order.
(a) -3/8, 5/-12, -7/16, -13/18, 11/-24​

Answers

Answer:

-13/8 , -11/24, -7/16, -5/12 , -3/8

Step-by-step explanation:

Given numbers are -3/8 , 5/-12, -7/16, -13/18 , 11/-24

The can be written as -3/8, -5/12, -7/16, -13/18, -11/24

The denominators = 8,12,16,18,24

LCM of the denominators = 144

-3/8 = (-3/8)×(18/18) = -54/144

-5/12 = (-5/12)×(12/12) =-60/144

-7/16 = (-7/16)×(9/9) = -63/144

-13/18 = (-13/18)×(8/8) = -104/144

-11/24 = (-11/24)×(6/6) = -66/144

Ascending order of the numbers

= -104/144 , -66/144, -63/144, -60/144, -54/144

-13/8 , -11/24, -7/16, -5/12 , -3/8

A cube has a lateral area of 676 square feet. What is the side length of the cube? 4. 3 feet 6. 5 feet 10. 6 feet 13 feet.

Answers

Answer:

13 feet

Step-by-step explanation:

Answer:

Step-by-step explanation:

Area of one face = 676 / 6

= 112.67

So the slide length = sqrt 112.67 = 10.6 feet.

Which image does not show a pair of triangles that can be proven similar point
by Angle-Angle?

Answers

Answer:

a

Step-by-step explanation:

please the answer and how i should write it

Answers

Answer:

86,400,000 bacteria

Step-by-step explanation:

2^5=32, 3^3=27, 10^5=100,000

32*27*100,000

Answer:

There are 86400000 bacteria in the Petri dish.

Step-by-step explanation:

Write in standard form:

[tex]2^{5}[/tex] = 2 x 2 x 2 x 2 x 2 = 32

[tex]3^{3}[/tex] = 3 x 3 x 3 = 27

[tex]10^{5}[/tex] = 10 x 10 x 10 x 10 x 10 = 100000

32 x 27 x 100000

= 86400000

hope this helps and is right!! p.s. i really need brainliest :)

Maureen is a lawyer who used to charge her clients $460 per hour. Maureen recently reconsidered her rates and ultimately decided to charge $414 per hour. What was the percent of decrease in the billing rate?

Answers

Answer:

10%

Step-by-step explanation:

460 - 414 is 46

Divide 46 by 460 to get 0.1

0.1 is equal to 10%

One year after you buy a tree, it is 10 feet tall. Each year after you buy the tree, it grows 2 feet. Write a linear model that represents the growth of the tree. How long does it take for the tree to reach its maximum height of 28 feet?

Answers

It takes 9 years for it to fully grow if you start from the first year.

PLEASE HELP ASAP GIVING BRAINLIEST

Answers

Answer:

brainliest mo munako

Step-by-step explanation:

bago answer pede maliwaag ba

HELP PLEASE!!!!
WILL GIVE BRAINLIEST
ANY LINKS OR WRONG ANSWERS WILL BE REPORTED!!!!

Answers

Answer:

1/5 × 950

(2nd option)

Step-by-step explanation:

[tex]20\% = \frac{20}{100} = \frac{1}{5} [/tex]

So 20% of 950 = 1/5 × 950

Examine this set of ordered pairs. (2,5) (8,9) (11,6) (18,2) (7,9) Is the set of ordered pairs a function? Choose the answer that's entirely correct.

(A) The set of ordered pairs is a function, because each input has exactly one output.


(B) The set of ordered pairs is not a function, because the output 9 has two different input values.


(C)The set of ordered pairs is a function, because each output has exactly one input.

(D) The set of ordered pairs is not a function, because the number 2 is both an input and an output.

Answers

A, each input is paired with exactly one output, meaning each x value is paired with exactly one y value

Answer: A

Step-by-step explanation:

as long as the x-coordinates are all different numbers then it is a function.

Other Questions
Em uma avaliao que vale at 5 pontos, Joo tirou 4,2 pontos. Quanto Joo teria tirado caso a prova valesse 10 pontos? How does the line Black snake! Black snake! contribute to the structure of the poem "The Black Snake"? it takes Cynthia 12 hours to proof a chapter of Hawkes Learning Systems' Intermediate Algebra book and it takes Phillip 3 hours. How long would it take them working together? (Round your answer to two decimal places.) (6X1)+(5X1/10) I need help on this .................... ayuda The algebraic form of an with no solution is?1. a = a2. x = a3. a = bWhich one is the answer? May somebody help me with this question? It is in the picture. PLS HELP !!! ill mark you for 1st right answer In at least 150 words, describe the reasons why Berryman's "Homage to Mistress Bradstreet" would have caused him to be banished from early American settlements discrib acidic oxide that can be Thermal Decomposetio of carbonat I need help with this No links plis you can help me ACCURATE ANSWER=BRAINLIST The first four terms of a sequence are shown.7, 25, 43, 61, ...Which of the following expressions can be used to find the nth term of the sequence?Question 3 options:7+18n18+7n18+7(n1)7+18(n1) What jobs did Erie people have Would you rather receive $10,000 a day for 31 days or a penny that doubles in value every day for 31 days? How much money would you have at the end of 31 days if you chose the $10,000 per day?How much money would you have at the end of 31 days if you chose to double the penny every day?How much would you have at the end of 15 days if you chose to double the penny every day?Someone pls help me which is the better buy?$8.60 for a 10 pack of batteries $9.84 for a 12 pack of batteries Which of the following wereexecuted for being communist?A. Alger Hiss and hissecretaryC. Julius & EthelRosenbergsB. all of the HollywoodTenD. three of the Hollywood ten What powers does the U.S. Constitution give the Congress, regarding responding to a crisis?' Which of the following represents a single replacement reaction?Select one:a.AB + C --> AC + Bb.A + B --> ABc.AB + CD --> AC + BDd.A - B --> AB 1. Calculate the density of an object that is has a mass of 24 grams and a volume of 6 cm cubed