Vinyl chloride (CH2=CHCl) is most likely the initial substance required to prepare the product after treatment with heated hydrochloric acid. A hydrochlorination procedure creates 1,2-dichloroethane as a byproduct by adding HCl across the vinyl chloride double bond.
Alkenes frequently undergo the hydrochlorination process, in which HCl is added across the double bond to produce a chloroalkane byproduct. In this instance, a vinyl chloride, which possesses a double bond between the carbon and chlorine atoms, is most likely the beginning substance. Warm HCl fractures the double bond, allowing the H and Cl atoms to add across the carbon atoms to create 1,2-dichloroethane as a byproduct. This response can be modelled as:
CH2 = CHCl + HCl ClCH2CH2Cl
All in all, this is a straightforward reaction that can be performed on a small scale in a lab or on a larger scale in industry to make 1,2-dichloroethane, which is utilised as a solvent and in the creation of vinyl chloride monomer.
learn more about hydrochloric acid here:
https://brainly.com/question/15231576
#SPJ4
The acceleration of a particle in an electric field depends on the charge-to-mass ratio of the particle.(a) compute e / m for a proton and find its acceleration in a uniform electric field of magnitude 100 n / c. (b) find the time it takes for a proton initially at rest in such a field to reach the speed of 0.01c
Answer:91
Explanation:because I am just very smart and this is the answer <3
If a substance is removed from a reaction in equilibrium, the equilibrium will shift toward
the side where the concentration was ________.
If a substance is removed from a reaction in equilibrium, the equilibrium will shift towards the side where the concentration was higher.
What is substance?A substance is a category of stuff with certain physical and chemical qualities as well as a set or definite composition. A substance might be an element or a compound. A substance made up of atoms with the same atomic number, or the same number of protons in their atomic nuclei, is referred to as an element.
This is known as the Le Chatelier's principle, which holds that a system in equilibrium would react to any stress by trying to counteract the stress and return to equilibrium. When a drug is removed from the reaction mixture, the system is put under stress due to the substance's lower concentration. The balance will change in a way that increases the production of the substance that was eliminated in order to counteract this drop.
To know more about substance, visit:
https://brainly.com/question/24372098
#SPJ1
Which of the following molecules would have the highest boiling point?
a) hexane
b) octane
c) 2-propylpentane
d) 2-methylhexane
The molecule which would have the highest boiling point is 2-methylhexane. Thus, the correct option will be D.
What is boiling point?The boiling point is the temperature at which the vapor pressure of a liquid is equal to the external pressure. The boiling point of a liquid is a measure of its vapor pressure. The higher the boiling point, the higher the vapor pressure of the liquid, and the more heat is required to vaporize it.
The boiling point of a substance is affected by the strength and types of intermolecular forces. The stronger the intermolecular forces, the higher the boiling point. 2-methylhexane has highest boiling point because it has the highest number of carbons and branches, which contribute to its strong intermolecular forces that lead to a higher boiling point.
Therefore, the correct option is D.
Learn more about Boiling point here:
https://brainly.com/question/25777663
#SPJ11
2. write the mechanism for the nitration of toluene showing explicitly why ortho and para products are favored over meta.
Nitration of toluene takes place in four steps which include formation of nitronium ion, formation of electrophile, deprotonation, and elimination of HNO₃.
What is the mechanism of nitration?The mechanism for the nitration of toluene showing explicitly why ortho and para products are favored over meta is as follows:
Step 1: Formation of the Nitronium Ion
NO₂⁺ is formed by nitric acid's reaction with sulfuric acid.
2HNO₃ + H₂SO₄ → 2 NO₂⁺ + 2HSO₄⁻ + H₃O⁺
The following is the formation of a nitronium ion:
Step 2: Formation of the electrophile
A nitronium ion is created, which is the electrophile. Because of the strong electron-releasing effect of the methyl group, the nitronium ion is drawn to the ring.
Due to the stability of the resulting carbocation, ortho and para products are favored over meta. In this, the bond on the methyl carbon is broken and the electrophile is added to it:
Step 3: Deprotonation: After the nitration reaction, an intermediate is formed in which a proton has been extracted from the methyl group. The formation of this intermediate indicates that the electrophile has been added to the ring's ortho or para positions.
Step 4: Elimination of HNO₃: An acid base reaction occurs to complete the nitration process, yielding nitrotoluene, HNO₃, and sulfuric acid. Here the intermediate is used to illustrate that the reaction has occurred with the ortho product. This reaction may also result in a para product in a similar manner.
Learn more about Nitration here:
https://brainly.com/question/26927899
#SPJ11
If 50 grams of water are saturated at 90°C with potassium nitrate and then cooled to 40°C, how much will precipitate?
Answer:
43.1gramms
Explanation:
change the temperatures to kelvin
90--363
40--313
50grams of water are saturated at 90 degree celcius.
then,
50___363
x_____313
then cross multiply
363x=15650
divide both sides by 363
x=43.1gramms
Electrons that inhabit different orbitals must have a different value for the:
a. principal quantum number
b. angular momentum quantum number
c. spin quantum number
d. none of the above
Answer:
D
Explanation:
I had this question before :)
What is the hybridization of the carbon that is attached to the oxygens in CH;COOH (acetic acid)? 4) Which molecule has the greatest dipole moment? A. CCl B. CH,Clz C. CFa D. BrzCClz CH,Fz
The carbon that is attached to the oxygens in CH₃COOH (acetic acid) is sp2 hybridized. This is because it is attached to three atoms (one oxygen and two hydrogens) and has a trigonal planar geometry.
The molecule with the greatest dipole moment is CH₂Cl₂(dichloromethane) because it has a tetrahedral geometry and the two C-Cl bonds are oriented in opposite directions, creating a net dipole moment. The other molecules (CCl₄, CF₄, and Br₂CCl₂) are all symmetric and have zero dipole moment.
A chemical concept known as hybridization describes the bonding and geometry of molecules. It entails combining atomic orbitals to create hybrid orbitals, which can more accurately capture the bonding in a molecule. The number of hybrid orbitals formed is equal to the number of atomic orbitals combined. Atomic orbitals with similar energy levels are merged to create the hybrid orbitals. An atom's geometry, bond angles, and polarity can all be impacted by hybridization, which can then have an impact on the molecule's reactivity and physical characteristics. Foreseeing the forms and characteristics of molecules as well as explaining their chemical behaviour requires an understanding of atom hybridization.
Learn more about hybridization here:
https://brainly.com/question/30010106
#SPJ4
What procedures can be performed on trials 2 and 3 so that the rate of dissolving is the same as trial 1? A student wants to determine how different factors affect the rate of dissolving solid in water: Trial Size of Particles Rate_of_Dissolving small 10 sec medium 20 sec large 30 sec 2 3 What procedures can be performed on trials 2 and 3 so that the rate of dissolving is the same as trial 1? A_ the student can increase the pressure B. the student can decrease the pressure C the student can decrease the temperature D. the student can increase the temperature'
The size of particles has an effect on the rate of dissolving, but temperature is also a significant factor that affects how quickly a solid will dissolve in water. Lowering the temperature slows down the movement.
What is the temperature ?Temperature is a measure of the average kinetic energy of the particles in a substance or system. In simpler terms, it is a measure of how hot or cold something is. The temperature of a substance or system is commonly measured in degrees Celsius (°C) or degrees Fahrenheit (°F), and it can be influenced by various factors such as heat transfer, pressure, and the presence of other substances. Temperature is an important physical property that affects many aspects of daily life, including weather patterns, cooking, and the functioning of electronic devices. It is also a critical factor in many scientific processes, such as chemical reactions, phase transitions, and the behavior of materials at the atomic and molecular level.
To know more about temperature visit:
https://brainly.com/question/11464844
#SPJ1
A gas mixture contains each of the following gases at the indicated partial pressures:
N2= 215 torr
O2= 102 torr
He= 117 torr
a) What is the total pressure of the mixture?
b) What mass of each gas is present in a 1.35 L sample of this mixture at 25.0 C ?
a) The total pressure of the mixture is 434 torr
b) The mass of each gas is, N₂ = 40.56 g, O₂ = 21.76 g, He = 3.20 g
a) The total pressure of the mixture is calculated by adding all the values of partial pressures of the N₂, O₂, and He
215 torrs of N₂ + 102 torr of O₂ + 117 torr of He
= 434 torr
Thus, the total pressure of the mixture is 434 torr
b) The mass of each gas in the 1.35 L sample of the mixture at 25.0 C can be calculated using the ideal gas law: PV = nRT.
The amount of each gas present is equal to the total moles of gas, n, in the sample.
n = (PV)/(RT)
where P is the partial pressure of the gas in the mixture,
V is the volume of the sample (1.35 L),
R is the ideal gas constant (0.08206 L atm mol⁻¹ K⁻¹), and
T is the temperature in Kelvin (298.15 K).
For N₂: n = (215 torr x 1.35 L)/(0.08206 L atm mol⁻¹ K⁻¹ x 298.15 K) = 1.45 moles
For O₂: n = (102 torr x 1.35 L)/(0.08206 L atm mol⁻¹ K⁻¹ x 298.15 K) = 0.68 moles
For He: n = (117 torr x 1.35 L)/(0.08206 L atm mol⁻¹ K⁻¹ x 298.15 K) = 0.80 moles
The mass of each gas is equal to the moles multiplied by the molar mass of the gas:
For N₂: 1.45 moles x 28.01 g/mol = 40.56 g
For O₂: 0.68 moles x 32.00 g/mol = 21.76 g
For He: 0.80 moles x 4.00 g/mol = 3.20 g
Thus, the mass of each gas is, N₂ = 40.56 g, O₂ = 21.76 g, He = 3.20 g.
Learn more about partial pressure here:
https://brainly.com/question/14119417
#SPJ11
Which one of the following salts, when 1 mole is dissolved in water, produces the solution with a pH closest to 7.00? A) NH4BR B) NaHSO4 C) NaF D) Ba O E) LiOH
When NaF is dissolved in water, it undergoes hydrolysis to form Na+ and F- ions. The resulting solution is slightly basic, with a pH slightly greater than 7. The correct answer is C) NaF.
What are salts?Salts are ionic compounds formed from the reaction between an acid and a base. They are composed of positively charged ions (cations) and negatively charged ions (anions). Salts are typically solid at room temperature and have high melting and boiling points.
When dissolved in water, salts can dissociate into their component ions, allowing them to conduct electricity. Some common examples of salts include table salt (NaCl), baking soda (NaHCO3), and Epsom salt (MgSO4).
When NaF is dissolved in water, it undergoes hydrolysis to form Na+ and F- ions. The F- ions react with water molecules to form HF and OH- ions. The resulting solution is slightly basic, with a pH slightly greater than 7.
Learn more about salts here https://brainly.com/question/13818836
#SPJ1
Tripling the concentration of a reactant increases the rate of a reaction nine times. With this knowledge, answer the following questions: (a) What is the order of the reaction with respect to that reactant?
(b) Increasing the concentration of a reactant by a factor of four increases the rate of a reaction four times. What is the order of the reaction with respect to that reactant?
Answer:
a) Tripling the concentration of a reactant increases the rate of a reaction nine times.the order of the reaction with respect to that reactant is 2
b)Increasing the concentration of a reactant by a factor of four increases the rate of a reaction four times.the order of the reaction with respect to that reactant is 1.
Explanation:
a) The order of the reaction with respect to that reactant is 2. The rate law of the reaction with the stoichiometric coefficients a, b, and c would be as follows:
rate = k[A]^x[B]^y[C]^z
Where k is the rate constant and x, y, and z are the orders of the reaction with respect to the corresponding reactants. When [A] is tripled, the rate increases nine times, indicating that the rate is proportional to [A]^2. Therefore, the order of the reaction with respect to [A] is 2.
b) The order of the reaction with respect to that reactant is 1. The rate law of the reaction with the stoichiometric coefficients a, b, and c would be as follows:
rate = k[A]^x[B]^y[C]^z
When [A] is quadrupled, the rate increases four times, indicating that the rate is proportional to [A]. Therefore, the order of the reaction with respect to [A] is 1.
To know more about concentration of a reactant refer here:https://brainly.com/question/4600091#
#SPJ11
Now let's try one without any help from the simulation. Write a balanced chemical equation for the combustion reaction of ethane gas (C2H6) and oxygen gas (O2), then answer the following questions:(o) How many moles of carbon dioxide are produced from the combustion of 6.20 moles of ethane gas? (You may assume you have an excess of oxygen gas)(p) How many moles of carbon dioxide are produced from the combustion of 3.92 moles of oxygen gas? (You may assume you have an excess of ethane gas)(q) How many moles of carbon dioxide are produced from the combustion of 6.20 moles of ethane gas with 3.92 moles of oxygen gas?(r) How much excess reactant remains after the reaction described in (q)?(s) How much excess reactant remains after the combustion of 6.10 moles of ethane gas with 5.69 moles of oxygen gas?
The reaction is given by:C2H6(g) + 3O2(g) → 2CO2(g) + 3H2O(g), o) From the balanced chemical equation, we can see that 1 mole of ethane gas reacts with 3 moles of oxygen gas to produce 2 moles of carbon dioxide gas. 3.92 moles of oxygen gas will react with (1/3) × 3.92 = 1.307 moles of ethane gas. This will produce 1.307 × 2 = 2.614 moles of carbon dioxide gas. q) 6.20 moles of ethane gas will react with 6.20 × 3 = 18.60 moles of oxygen gas. This will produce 6.20 × 2 = 12.40 moles of carbon dioxide gas.r) This means that all the oxygen gas will be consumed in the reaction. Therefore, there will be no excess oxygen gas remaining after the reaction. s) 4.203 moles of ethane gas will be in excess after the reaction.
The equation is now balanced as there are equal numbers of each type of atom on both sides of the equation. 6.20 moles of ethane gas will react with 6.20 × 3 = 18.60 moles of oxygen gas. This will produce 6.20 × 2 = 12.40 moles of carbon dioxide gas. From the balanced chemical equation, we can see that 3 moles of oxygen gas react with 1 mole of ethane gas to produce 2 moles of carbon dioxide gas. Therefore From the balanced chemical equation, we can see that 1 mole of ethane gas reacts with 3 moles of oxygen gas to produce 2 moles of carbon dioxide gas.
From the balanced chemical equation, we can see that 1 mole of ethane gas reacts with 3 moles of oxygen gas to produce 2 moles of carbon dioxide gas. Therefore, 5.69 moles of oxygen gas will react with (1/3) × 5.69 = 1.897 moles of ethane gas. This will produce 1.897 × 2 = 3.794 moles of carbon dioxide gas. This means that 6.10 − 1.897 = 4.203 moles of ethane gas will be in excess after the reaction.
To know more about carbon dioxide gas visit:-
https://brainly.com/question/30615378
#SPJ11
20pcm3 og a gas has a pressure of 510mmhg what will be the volume of the pressure is increased to 780mmhg, assuming there is no change in temperature
The volume of the gas will decrease from 20 cm³ to 13.08 cm³.
What is Boyle's law?Boyle's law is a gas law that states that the product of the pressure and volume of a gas is constant at constant temperature.
What is the significance of assuming no change in temperature in this problem?Assuming no change in temperature is significant because it allows us to apply Boyle's law to solve the problem. If the temperature were to change, we would need to use a different gas law, such as Charles's law or the combined gas law, to account for the change in temperature.
We can use Boyle's law to solve this problem, which states that the product of the pressure and volume of a gas is constant at constant temperature. Mathematically, we can express this as P₁V₁ = P₂V₂, where P₁ and V₁ are the initial pressure and volume, respectively, and P₂ and V₂ are the final pressure and volume, respectively.
Using this equation, we can solve for V₂:
P₁V₁ = P₂V₂
V₂ = (P₁V₁)/P₂
Substituting the given values, we get:
V₂ = (510 mmHg x 20 cm³) / 780 mmHg
V₂ = 13.08 cm³
Therefore, if the pressure is increased from 510 mmHg to 780 mmHg at constant temperature, the volume of the gas will decrease from 20 cm³ to 13.08 cm³.
Learn more about Boyle's law here:
https://brainly.com/question/30367133
#SPJ1
calculation and give the answers to the correct number of significant figures.
Part A
1.72×10−3/7.9×1021.72×10−3/7.9×102
Express your answer to the correct number of significant figures.
Activate to select the appropriates template from the following choices. Operate up and down arrow for selection and press enter to choose the input value typeActivate to select the appropriates symbol from the following choices. Operate up and down arrow for selection and press enter to choose the input value type
nothing
SubmitRequest Answer
Part B
1.98×10−2+1×10−4−3.5×10−31.98×10−2+1×10−4−3.5×10−3
Express your answer to the correct number of significant figures.
Activate to select the appropriates template from the following choices. Operate up and down arrow for selection and press enter to choose the input value typeActivate to select the appropriates symbol from the following choices. Operate up and down arrow for selection and press enter to choose the input value type
nothing
SubmitRequest Answer
Part C
[(1.38×105)(0.000318)/0.080](115.2)[(1.38×105)(0.000318)/0.080](115.2)
Express your answer to the correct number of significant figures.
The answer is 2.19×10−2 with three significant figures. The correct number of significant figures is determined by the data with the least amount of significant figures, which in this case is 0.080.
What is figure?Figure is a term that is used to describe a shape, design, pattern, or form. It can also be used to refer to a diagram or an illustration. Figures are used to explain and illustrate concepts, facts, and phenomena in various fields of study, including mathematics, science, and the humanities. Figures are also used in art, design, and architecture to create visual compositions that have a certain aesthetic appeal. They can be used to represent ideas, concepts, and emotions.
Since 0.080 has three significant figures, the answer must also be rounded to three significant figures.
To learn more about figure
https://brainly.com/question/29827869
#SPJ1
The answer is 2.19×10⁻² with three significant figures. The correct number of significant figures is determined by the data with the least number of significant figures, which in this case is 0.080.
What is figure?Figure is a term that is used to describe a shape, design, pattern, or form. It can also be used to refer to a diagram or an illustration. Figures are used to explain and illustrate concepts, facts, and phenomena in various fields of study, including mathematics, science, and the humanities. Figures are also used in art, design, and architecture to create visual compositions that have a certain aesthetic appeal. They can be used to represent ideas, concepts, and emotions.
Since 0.080 has three significant figures, the answer must also be rounded to three significant figures.
To learn more about figure, visit:
brainly.com/question/29827869
#SPJ1
Two protons are fired toward each other in a particle accelerator, with only the electrostatic force acting. Which of the following statements must be true about them as they move closer together? (There could be more than one correct choice.)
a. Their kinetic energy keeps increasing.
b. Their acceleration keeps decreasing.
c. Their kinetic energy keeps decreasing.
d. Their electric potential energy keeps decreasing.
e. Their electric potential energy keeps increasing.
When two protons are fired toward each other in a particle accelerator, with only the electrostatic force acting, then their kinetic energy keeps increasing, acceleration keeps decreasing, kinetic energy keeps decreasing, electric potential energy keeps decreasing.
How does the electrostatic force act?The electrostatic force is a force that arises between electrically charged objects. It is the force exerted on a charged particle by other charged particles or electromagnetic fields. It is a fundamental force in nature that has an infinite range and can be either attractive or repulsive. The strength of the electrostatic force is proportional to the inverse square of the distance between the charged particles. As two charged particles move closer together, the force between them increases. Therefore, as the two protons move closer together, their kinetic energy and electric potential energy will increase.
According to Coulomb's law, the electrostatic force is inversely proportional to the square of the distance between the two charges. Therefore, as the distance between the two protons decreases, the electrostatic force acting between them will increase. As a result, their acceleration will keep decreasing. At the same time, as the protons move closer together, their kinetic energy will keep increasing while their electric potential energy will keep decreasing.
Learn more about Electrostatic force here:
https://brainly.com/question/9774180
#SPJ11
If a solid piece of shiny sodium metal is exposed to chlorine gas, a large amount of heat is released and the white solid sodium chloride (table salt) forms. Based on this information, which of the following statements is TRUE? A) This process was exothermic_ B) This process represents a physical change: C) Mass is lost during this process_ D) This process was endothermic_
Option A is the correct statement for the process was exothermic that a large amount of heat is released when sodium metal is exposed to chlorine gas.
What happens when sodium is exposed to chlorine? Sodium metal reacts with chlorine gas to produce sodium chloride. When solid shiny sodium metal is exposed to chlorine gas, a large amount of heat is generated, and the white solid sodium chloride (table salt) is formed. So the process is an exothermic reaction.A chemical reaction in which heat is given out, such as the one between sodium and chlorine, is exothermic. When the products' energy is less than the reactants' energy, energy is given out from the system into the surroundings, resulting in an increase in temperature in the surroundings. Therefore, this process was an exothermic and the correct option is 'A'.Learn more about sodium chloride: https://brainly.com/question/28106660
#SPJ11
Under what conditions of temperature and pressure do real gases behave most like ideal gases?
1) high temperature and high pressure
2) high temperature and low pressure
3) low temperature and high pressure
4) low temperature and low pressure
Real gases behave most like ideal gases under conditions of high temperature and low pressure. Option 2 is correct.
This is because at high temperatures, the kinetic energy of gas molecules increases, causing them to move faster and collide more frequently, which reduces the intermolecular forces between the gas molecules. At low pressures, the gas molecules are farther apart and the intermolecular forces are weaker, allowing the gas molecules to move more freely and behave more like an ideal gas.
At high pressures and low temperatures, the gas molecules are closer together and the intermolecular forces are stronger, causing deviations from ideal gas behavior. Hence the correct option is 2.
To know more about ideal gas, here
brainly.com/question/28257995
#SPJ4
Assume that the mass of the Cu electrode changes by "x" grams in a certain period of time. Write a mathematical expression for the change in mass of the Zn electrode during the same time.
Given information:
Cu^2+ +Zn ---> Cu+Zn^2+ (net-ionic equation for the reaction in the cell)
Ecell is 1. 10 V
Please tell me if there is any other information you need to solve the problem
The change in mass of the Zn electrode is, y = (x * molar mass of Zn) / molar mass of Cu.
The reaction in the cell involves the transfer of electrons from zinc (Zn) to copper (Cu). The net ionic equation for the reaction is:
Cu²⁺ + Zn --> Cu + Zn²⁺
During the reaction, the mass of the Cu electrode decreases due to the loss of Cu^2+ ions, while the mass of the Zn electrode increases due to the gain of Zn^2+ ions. The change in mass of the Zn electrode can be related to the change in mass of the Cu electrode using the stoichiometry of the reaction.
From the net ionic equation, we can see that for every Zn atom oxidized (loses electrons), one Cu^2+ ion is reduced (gains electrons). Therefore, the moles of Cu lost must be equal to the moles of Zn gained. We can use the molar mass of Cu and Zn to relate the change in mass of the Cu electrode (x grams) to the change in mass of the Zn electrode (y grams) as follows,
moles of Cu lost = moles of Zn gained
(x grams of Cu) / (molar mass of Cu) = (y grams of Zn) / (molar mass of Zn)
Solving for y, the change in mass of the Zn electrode is:
y = (x * molar mass of Zn) / molar mass of Cu
To know more about electrode, here
brainly.com/question/17060277
#SPJ4
The ability of an atom during bond formation to attract electrons from its bonding partner
-The higher it is, the stronger the atom's electron attracting ability
-Nonmetals are higher (gain electrons while metals lose them)
-Electronegativities increase from left to right across periodic table rows and decrease as you move down a column
-Fluorine is the most electronegative element, Francium is the least
The ability of an atom during bond formation to attract electrons from its bonding partner is called electronegativity. The higher the electronegativity of an atom, the stronger its electron-attracting ability.
Let's understand this in detail:
Electronegativity is the power of an atom or molecule to attract electrons to itself in a covalent bond. An atom's electronegativity is influenced by its atomic number, the number of protons in the atom's nucleus.
The electronegativity of an atom is higher when its valence shell is nearly empty or nearly full.
Electronegativity increases from left to right across a period because of the increasing effective nuclear charge, which is the force of attraction between the positively charged atomic nucleus and the negatively charged electrons.
Electronegativity decreases down a group due to the increasing distance between the valence electrons and the positively charged nucleus.
Francium has the lowest electronegativity, while fluorine has the highest electronegativity.
Learn more about electronegativity: What is electronegativity and how can it be used in determining the polarity of nonpolar? https://brainly.com/question/18258838
#SPJ11
calculate the total percent recovery. show calculation with units and correct significant digits. why do we expect that the percent recovery will be less than 100 % for this experiment?
The percent recovery is the ratio of the actual amount of the desired substance to the original amount present. The total percent recovery can be calculated by using the formula given below.
The units and the correct significant digits should be used in the calculation. We expect that the percent recovery will be less than 100 % for this experiment because of the loss of product due to impurities or mistakes in the experimental procedure. For example, if the product is left on the filter paper while washing, then the actual yield will be less than the theoretical yield.
Calculate the total percent recovery. show calculation with units and correct significant digits. The percent recovery formula is:
Percent recovery = Actual yield ÷ Theoretical yield × 100%
Given, Actual yield = 70 theoretical yield = 80
percentage recovery = Actual yield ÷ Theoretical yield × 100 %
Percentage recovery = 70 ÷ 80 × 100 %
Percentage recovery = 0.875 × 100 %
Percentage recovery = 87.5 %
Therefore, the total percent recovery is 87.5 % with the correct significant digits. Why do we expect that the percent recovery will be less than 100 % for this experiment? We expect that the percent recovery will be less than 100 % for this experiment because of the loss of product due to impurities or mistakes in the experimental procedure.
Learn more about percent recovery at brainly.com/question/14972210
#SPJ4
Reduction involves the ____ of electron(s), and reactions for which the standard cell potential is ____ are spontaneous under standard conditions.
A. loss; negative
B. loss; positive
C. gain; negative
D. gain; positive
E. none of the above
Reduction involves the gain of electrons, and reactions for which the standard cell potential is negative are spontaneous under standard conditions.
Reduction- In a chemical reaction, the process of gaining one or more electrons is known as reduction. It is the opposite of oxidation, which is the loss of electrons in a reaction.
Reduction is the method of reducing the oxidation state of a substance. The reduction of carbon dioxide to glucose during photosynthesis is an example of a biological reduction. The reduction of iron oxides into elemental iron during the blast furnace process is an example of an industrial reduction.
To learn more about "reduction", visit: https://brainly.com/question/21851295
#SPJ11
a.) Determine whether potassium hydrogen tartrate (KHC4H4O6) is neutral, basic, or acidic. First, what is its Ka when it acts as an acid? The following are for the diprotic acid, H2C4H4O6: Ka1 = 1.0 x 10-3 and Ka2 = 4.6 x 10-5. b.) Second, what is its Kb when it acts as a base? c.) Finally, indicate whether the HC4H4O6- ion is neutral, basic, or acidic in solution.
a) potassium hydrogen tartrate (KHC4H4O6) is acidic. Ka is calculated for the acidic characteristics of the molecule. When a proton is donated by the molecule to water, it forms the ion HCO4-. b) Kb = [C4H4O6-2][OH-]/[HC4H4O6-], Kb = (1.0 × 10-11) × [C4H4O6-2][OH-]/[HC4H4O6-]. c) As the ion HC4H4O6- is an acidic ion, it will have acidic characteristics in solution. It is because the ion can donate protons and act as an acid.
Kb is calculated for the basic characteristics of the molecule. The balanced chemical equation for the reaction is as follows:HC4H4O6-(aq) + H2O(l) ⇌ C4H4O6-2(aq) + OH-(aq)The Kb is determined using the equation given below : Kb = [C4H4O6-2][OH-]/[HC4H4O6-]The Ka value is calculated as shown below: Kb = [C4H4O6-2][OH-]/[HC4H4O6-]Kb = (1.0 × 10-11) × [C4H4O6-2][OH-]/[HC4H4O6-]
The balanced chemical equation for the reaction is as follows: HC4H4O6(aq) + H2O(l) ⇌ HCO4-(aq) + H3O+(aq)The Ka is determined using the equation given below : Ka = [HCO4-][H3O+]/[HC4H4O6]Ka = (1.0 × 10-3) × [HCO4-][H3O+]/[HC4H4O6]. Therefore, the Ka value is not given.
Know more about potassium hydrogen tartrate here:
https://brainly.com/question/11127999
#SPJ11
57.0 ml of 0.90 m solution of hcl was diluted by water. the ph of this diluted solution is 0.90. how much water was added to the original solution insert your answer rounded to 3 significant figure.
57.0 ml of 0.90 m solution of Hcl was diluted by water. the pH of this diluted solution is 0.90. 50.5 mL water was added to the original solution .
There are a few steps to solve this.
Here they are: First, calculate the initial concentration of HCl in the solution.
Molarity = moles of solute / volume of solution in liters.
The volume of the solution is 57.0 mL, which is 0.0570 L.
The molarity is 0.90 M. So,0.90 M = moles of HCl / 0.0570 L
Now we can solve for moles of HCl:
moles of HCl = 0.90 M x 0.0570 L = 0.0513 mol
Next, we need to use the pH to find the concentration of H+ ions.
pH = -log[H+]0.90 = -log[H+]
Solving for [H+],
we get:[H+] = 7.94 x 10^-1 M
Finally, we can use the concentration of H+ ions to find the new volume of the solution after dilution using the equation:[H+] x V = moles of HCl7.94 x 10^-1 M x V = 0.0513 mol
Solving for V,
we get: V = 6.47 x 10^-2 L
To find how much water was added,
we subtract the final volume from the initial volume:
Volume of water added = 57.0 mL - 6.47 mL = 50.5 mL (rounded to 3 significant figures)
Therefore, 50.5 mL of water was added to the original solution.
For more such questions on pH , Visit:
https://brainly.com/question/172153
#SPJ11
Practice Problem 11.15b Propose an efficient synthesis for the following transformation. y The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. A B с Br2 HBr, ROOR cat. OsO4, NMO D HBr E H2, Pd F H2SO4, H2O, HgSO4 I 1) O3; 2) DMS H 1) xs NaNH2, 2) H20 1) R2BH; 2) H2O2, NaOH Practice Problem 11.18d Propose an efficient synthesis for the following transformation. The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. B с HBr, ROOR 1) O3; 2) DMS Br2, hv F D H2S04, H20, HgSO4 E H2, Lindlar's cat. HC=CNa I G HBr H NaOme 1) R2BH; 2) H2O2, NaOH Practice Problem 11.21a X Incorrect. Propose an efficient synthesis for the following transformation. The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. A B HBr, ROOR HC=CNa 1) R2BH; 2) H2O2, NaOH D HBr E CH3CH2Br H2S04, H2O, HgSO4 G NaOH н conc. H2SO4, heat I 1) LiAlH4; 2) H307 Practice Problem 11.21b Propose an efficient synthesis for the following transformation. :- The transformation above can be performed with some reagent or combination of the reag spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide j B с t-BuOK 1) O3; 2) DMS Br2, hv D H2SO4, H20, HgSO4 E H2, Lindlar's cat. F HC=CNa H HBr, ROOR HBr I 1) R2BH; 2) H202, NaOH Practice Problem 11.21c Propose an efficient synthesis for the following transformation. SOH The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. B с HBr, ROOR HC=CNa 1) R2BH; 2) H202, NaOH F D HBr E CH3CH2Br H2SO4, H20, HgSO4 I G NaOH H conc. H2S04, heat 1) 03; 2) H20 Propose an efficient synthesis for the following transformation. - li The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. А B HBr conc. H2S04, heat HC=CNa D HBY, ROOR E Hy, Lindlar's cat. 1) O3; 2) DMS G Brą, hv H dilute H2SO4 I H2, Pt Practice Problem 11.25a Propose an efficient synthesis for the following transformation: % Br The transformation above can be performed with some combination of the reagents listed below. Give the necessary reagents in the correct order for each transformation, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. А t-BuOK B OsO4, NMO c 1) O3; 2) DMS D H2, Pt E H2, Lindlar's cat F xs HBr I G 1) BH 3.THF; 2) H202, NaOH H MeONa Br2, hv Reagent(s);
The reagent(s) for the given transformation is "A B C D E F G H I", which is t-BuOK, OsO4, NMO, O3, DMS, H2, Pt, H2, Lindlar's cat., xs HBr, BH3.THF, H202, NaOH, MeONa, Br2, hv.
What is transformation?Transformation is the process of changing something into a different form or state. It can involve altering the physical characteristics, behaviors, attitudes, or perceptions of an entity. Transformation is a process that occurs in a variety of contexts including business, education, technology, and personal development.
A) t-BuOK - For the given transformation, the initial step is to add an alkoxide, here t-BuOK, to the starting material.
B) OsO4, NMO - After the addition of the alkoxide, the resulting intermediate has to be oxidized by OsO4 and NMO reagents.
C) 1) O3; 2) DMS - The intermediate then has to be ozonolyzed using ozone and dimethyl sulfide (DMS).
D) H2, Pt - The ozonolysis will result in a mixture of aldehyde and ketone. The aldehyde has to be hydrogenated using H2 and Pt.
E) H2, Lindlar's cat. - The ketone has to be hydrogenated using H2 and Lindlar's catalyst.
F) xs HBr - The product of the hydrogenation has to be converted to a tertiary alcohol by an elimination reaction with HBr.
G) 1) BH3.THF; 2) H202, NaOH - The tertiary alcohol has to be oxidized to a tertiary ketone using BH3.THF, H202 and NaOH.
H) MeONa - The tertiary ketone has to be methylated using MeONa.
I) Br2, hv - The product of the methylation has to be brominated using Br2 and heat.
Therefore, the reagent(s) for the given transformation is "A B C D E F G H I", which is t-BuOK, OsO4, NMO, O3, DMS, H2, Pt, H2, Lindlar's cat., xs HBr, BH3.THF, H202, NaOH, MeONa, Br2, hv.
To learn more about transformation
https://brainly.com/question/382594
#SPJ1
The idea of __________ asserts that some evolutionary changes may not even involve intermediate forms.
punctuated equilibrium
The idea of punctuated equilibrium asserts that some evolutionary changes may not even involve intermediate forms.
What is punctuated equilibrium?The idea of punctuated equilibrium is a theory in evolutionary biology that proposes that most evolutionary changes occur relatively rapidly, with long periods of stability punctuated by rare instances of rapid evolutionary change.
The theory was first introduced by Niles Eldredge and Stephen Jay Gould in 1972 as a challenge to the traditional Darwinian theory of gradualism, which posits that evolution proceeds slowly and steadily over long periods of time.
According to punctuated equilibrium, some evolutionary changes may not even involve intermediate forms.
There are several examples of punctuated equilibrium in the fossil record, including the Cambrian explosion, which saw the sudden appearance of most major animal phyla in a relatively short period of time, and the rapid diversification of mammals following the extinction of the dinosaurs at the end of the Cretaceous period.
Learn more about Punctuated equilibrium here:
brainly.com/question/4430933
#SPJ11
what volume is occupied by 0.108 mol of helium gas at a pressure of 0.92 atm and a temperature of 313 k ? express your answer using two significant figures. view available hint(s)
The volume occupied by 0.108 mol of helium gas at a pressure of 0.92 atm and a temperature of 313 K is 2.3 L.
What is the volume of gas?The gas laws involve the relationship between the pressure, volume, and temperature of a gas. The ideal gas law can be used to determine the volume of gas that a certain amount of substance occupies at a particular pressure and temperature. The ideal gas law equation is:
PV = nRT
where, P is the pressure, V is the volume, n is the number of moles, R is the gas constant, and T is the temperature in Kelvin (K).
To determine the volume of helium gas that is occupying 0.108 moles at 0.92 atm and 313 K, we need to rearrange the ideal gas law equation to solve for V:
V = (nRT)/P
Substituting the values given, we have:
V = (0.108 mol)(0.08206 L atm/mol K)(313 K)/(0.92 atm)
V = 2.28 L
The volume of gas to two significant figures, the volume is 2.3 L.
Learn more about Volume of gas here:
https://brainly.com/question/15265703
#SPJ11
When 2.55g of an unknown weak acid (HA) with a molar mass of 85.0 g/mol is dissolved in 250.0 g of water, the freezing point of the resulting solution is -0.258 Degrees Celsius.
Calculate Ka for the unknown weak acid.
The Ka for the unknown weak acid (HA) with a molar mass of 85.0 g/mol will be about 9.26 × 10⁻¹⁴.
What is the freeing point of unknown acid solution?The formula for calculating the freezing point depression of a solution is:
ΔTf = Kf × m × i
where, ΔTf is the change in freezing point, Kf is the freezing point depression constant, m is the molality of the solute, and i is the van't Hoff factor.
To calculate the molar mass of the unknown weak acid, we need to convert grams to moles:
2.55 g ÷ 85.0 g/mol = 0.03 molHA
We can then calculate the molality of the solution by dividing the moles of solute by the mass of the solvent in kilograms:
0.03 mol ÷ 0.250 kg = 0.12 mol/kg
ΔTf can be calculated by subtracting the freezing point of the pure solvent (water) from the freezing point of the solution:
0.258°C - 0°C = -0.258°C
The freezing point depression constant (Kf) for water is 1.86 °C/m. We can use this value, along with the molality of the solution, to solve for the dissociation constant (Kb) for the unknown weak acid:
ΔTf = Kf × m × i
0.258°C = 1.86 °C/m × 0.12 mol/kg × i
i = 1.08
Ka can be calculated using the relationship between Ka and Kb for an acid:
Kb = Kw / Ka
Kw is the ion product constant for water, which is 1.00 × 10⁻¹⁴ at 25°C. We can use this value, along with the value we just calculated for Kb, to solve for Ka:
Kb = Kw / Ka
1.08 = 1.00 × 10⁻¹⁴ / Ka
Ka = 9.26 × 10⁻¹⁴
So, the Ka for the unknown weak acid is 9.26 × 10⁻¹⁴.
Learn more about Freezing point depression here:
https://brainly.com/question/12844810
#SPJ11
vinegar is a solution of acetic acid, hc2h3o2, dissolved in water. a 5.54-g sample of vinegar was neutralized by 30.10 ml of 0.100 m naoh. what is the percent by weight of acetic acid in the vinegar?
The percent by weight of acetic acid in the vinegar is 3.27% for the given 5.54-g sample of vinegar was neutralized by 30.10 ml of 0.100 m NaOH.
What is the percent of weight of acetic acid?Vinegar is a solution of acetic acid, HC₂H₃O₂, dissolved in water. A 5.54-g sample of vinegar was neutralized by 30.10 mL of 0.100 M NaOH. Find the percentage of acetic acid by weight in vinegar. As per the question, vinegar is a solution of acetic acid, HC₂H₃O₂, dissolved in water.
A 5.54-g sample of vinegar was neutralized by 30.10 mL of 0.100 M NaOH.
Since NaOH and HC₂H₃O₂ reacts in a 1:1 molar ratio, moles of NaOH used = moles of HC₂H₃O₂ in vinegar
So,0.100 mol/L solution of NaOH = 0.100 mol/L solution of HC₂H₃O₂ in vinegar (as they react in 1:1 ratio).
Also, Volume of NaOH = 30.10 mL = 30.10/1000 = 0.0301L
Thus, Amount of HC₂H₃O₂ in vinegar = 0.100 mol/L × 0.0301 L = 0.00301 mol.
Molar mass of HC₂H₃O₂ = 60.05 g/mol.
Weight of HC₂H₃O₂ in 5.54 g vinegar = 0.00301 mol × 60.05 g/mol = 0.18086 g.
Percentage by weight of acetic acid in the vinegar = 0.18086 / 5.54 × 100 = 3.27%.
Read more about moles here:
https://brainly.com/question/15356425
#SPJ11
what is BEFORE and AFTER when you put the baking soda in vinegar?
When you mix baking soda and vinegar, a chemical reaction occurs that produces carbon dioxide gas, water, and a type of salt called sodium acetate.
What happens at the mixing of baking soda in vinegar?Before: Before mixing baking soda and vinegar, they are both in their separate states. Baking soda is a white powder, and vinegar is a clear liquid.
During: When you mix the baking soda and vinegar, the baking soda (sodium bicarbonate) reacts with the vinegar (acetic acid) to produce carbon dioxide gas (CO2), water (H2O), and sodium acetate (NaC2H3O2).
After: After the chemical reaction has taken place, you will see bubbles of carbon dioxide gas being released. The solution will also become cloudy as the sodium acetate precipitates out. The resulting mixture may feel warmer due to the exothermic nature of the reaction (meaning it releases heat).
Learn more about baking soda in vinegar:https://brainly.com/question/2427021
#SPJ1
Can any help with this chemistry question?? I have an exam tomorrow
Answer:
Explanation:
To calculate the standard enthalpy of formation for TICL(I), we need to use the given thermochemical equations and Hess's law. The equation for the formation of TICL(I) is:
C(s) + TiO₂ (s) + 2Cl(g) → TICL(I) + CO(g)
Using the given equations for the formation of CO(g) and TiO2(s), we can manipulate them to get the necessary reactants for the formation of TICL(I):
Ti(s) + O₂(g) → TiO₂(s) (reverse the equation)
C(s) + 1/2O₂(g) → CO(g) (multiply by 2)
Adding these two equations, we get:
Ti(s) + 2C(s) + O₂(g) → TiO₂(s) + 2CO(g)
This equation is the reverse of the equation given for the formation of TICL(I), so we need to flip its sign to get the correct value for the enthalpy change:
TICL(I) → C(s) + TiO₂ (s) + 2Cl(g) + CO(g)
ΔH° = -(-394 kJ/mol + 286 kJ/mol + 0 + (-221 kJ/mol))
ΔH° = -(-329 kJ/mol)
ΔH° = +329 kJ/mol
Therefore, the correct value for the standard enthalpy of formation for TICL(I) is +329 kJ/mol, which is option D.
