Answer:
Any substance that contains only one kind of an atom is known as an element. Because atoms cannot be created or destroyed in a chemical reaction, elements such as phosphorus (P4) or sulfur (S8) cannot be broken down into simpler substances by these reactions.
Example: Water decomposes into a mixture of hydrogen and oxygen when an electric current is passed through the liquid. Hydrogen and oxygen, on the other hand, cannot be decomposed into simpler substances. They are therefore the elementary, or simplest, chemical substances - elements.
Each element is represented by a unique symbol. The notation for each element can be found on the periodic table of elements.
The elements can be divided into three categories that have characteristic properties: metals, nonmetals, and semimetals. Most elements are metals, which are found on the left and toward the bottom of the periodic table. A handful of nonmetals are clustered in the upper right corner of the periodic table. The semimetals can be found along the dividing line between the metals and the nonmetals.
Explanation:
How much heat must be transferred to 55 g of ice to change the ice's
temperature from -13°C to -5.0°C? (The specific heat capacity of ice is 2.11
J/g.°C)
Please help me
will give the brainliest!
Explanation:
a) The presence of sulfate ions in a solution can be confirmed by the reaction of barium chloride in an acidic medium.
The balanced chemical equation of the reaction is shown below:
[tex]BaCl_2(aq)+CuSO_4(aq)->CuCl_2(aq)+BaSO_4(s)[/tex]
Hence, the white precipitate is barium sulfate and its formation with the ionic equation is shown below:
[tex]Ba^2^+(aq)+SO_4^2^-(aq)->BaSO_4(aq)[/tex]
b) The presence of copper (II) ions can be confirmed by the following test:
Add potassium iodide solution to copper (II) solution.
Then a white ppt of cuprous iodide along with the liberation of iodine is observed and the entire solution attains brown color.
The chemical equation of the reaction is shown below:
[tex]2CuSO_4(aq)+4KI(aq)->Cu_2I_2(s)+I_2(s)+2K_2SO_4(aq)\\[/tex]
c)(i)Due to this reaction, the blue color of the solution becomes white.
Reddish-brown copper is deposited at the bottom of the container.
(ii)In this reaction, zinc is oxidized.
d) (i) Copper is produced at the cathode.
(ii)[tex]Cu^2^+(aq)+2e^-->Cu(s)[/tex]
(iii) The reaction that takes place at the cathode is reduction.
Reduction is gaining of electrons.
Which is another word for 10 meters in the metric system?
Answer:
Dekameter
Explanation:
How many moles of KOH are there in 27.5 mL of 0.250 M KOH?
Question 2 options:
4.31 × 10−3 mol KOH
6.88 × 10−3 mol KOH
7.24 × 10−3 mol KOH
8.13 × 10−3 mol KOH
9.21 × 10−3 mol KOH
Answer:
6.88 × 10^-3mol
Explanation:
Molarity = number of moles (n) ÷ volume (V)
According to this question, there in 27.5 mL of 0.250 M KOH, the number of moles of KOH can, therefore, be calculated as follows:
number of moles = molarity × volume
Volume of KOH = 27.5mL = 27.5/1000
= 0.0275L
n = 0.0275 × 0.250
n = 0.006875 mol
n = 6.88 × 10^-3mol
HELLO EVERYONE PLEASE I NEED HELP WITH
Please I REALLY NEED A HELP WITH THIS PLEASE HELP ME
THIS HARRY POTTER LITERARY ESSAY
OUTLINE
1. Love and Friendship is a central theme in Harry Potter and the Philosopher's Stone. Prove that this statement is true using 2(two) different characters from the novel as examples.
Introductory Statement/ Hook:
Statement of Intent: reason A and B :
thesis reason A and B:
BODY PARAGRAPH
#1 Point #1: Introduce REASON A here, but use general statement
#1: Provide quotations from the novel to support Reason A
Explanation #1:
Proof #2:
Explanation #2:
BODY PARAGRAPH
#2 Point #2: Introduce REASON B here, but use general statements
#1: Provide quotations from the novel to support ReasonB
Explanation #1:
Proof #2:
Explanation #2:
CONCLUSION
Restate/ Summarize Thesis:
Restate/ Summarize Points:
Answer:
Ron and Hermoine
Explanation:
They always fought over petty things, but at the end, they did end up together!
(Answer for your question about love and friendship being a central theme in Harry Potter and the Philosopher's stone)
*ALSO, MY ANSWER MIGHT BE WRONG* so be sure to use a pencil just in case!
QUICK CHECK
Use the periodic table to select which type of bond is present and which of the listed properties is most
likely for each substance.
Substance
Type of bond
Likely property
A А
B
A
Cuzm
Ba
lonic
DO
covalent
02
С
D
metallic
Answer:
Coppell zinc,ironic bond
Explanation:
lt will give away two zinc atoms
Answer:
I will go with Sodium chlorine NaCl
I need help with question 5
Answer:
B a spring being stretched
The carbon atom forms a part of all the major molecules found in living things. Which of the following doesnot contain carbon?
Hydrochloric acid or Hcl
if excess nitrogen gas reacts with 600 cm³ of hydrogen gas at room conditions , calculate the maximum volume of ammonia produced from the reaction? the chemical question is N2 + 3H2 = 2NH3
Answer:
400 cm³ of ammonia, NH₃.
Explanation:
The balanced equation for the reaction is given below:
N₂ + 3H₂ —> 2NH₃
From the balanced equation above,
3 cm³ of H₂ reacted to produce 2 cm³ of NH₃.
Finally, we shall determine the maximum volume of ammonia, NH₃ produced from the reaction. This can be obtained as illustrated below:
From the balanced equation above,
3 cm³ of H₂ reacted to produce 2 cm³ of NH₃.
Therefore, 600 cm³ of H₂ will react to produce = (600 × 2)/3 = 400 cm³ of NH₃.
Thus, 400 cm³ of ammonia, NH₃ were obtained from the reaction.
Draw the following structures and name them :
I. CH3CH2(OH)
II.CH3CH2CH(CH3)C(Cl)2C(l)2CH(F)OH
III.CH3CH(CH3)CHO
IV.CH2=CH(OH)
V.CH3OCH2CH3
Answer:
hope this helps.answer is in the picture
Need help fast!!
What is the pH of a solution with a 1.50 x 10-9 M hydroxide ion concentration? (4
points)
1) 0.176
2) 5.18
3) 8.82
4) 9.20
Answer:
The answer is "5.18 ".
Explanation:
It's a question of chemistry. Therefore, the following solution is provided:
We will first determine the solution's pOH. The following can possible:
The concentration of Hydroxide ion [tex][OH^{-}] = 1.5\times 10^{-9}\ M[/tex]
[tex]pOH =?\\\\pOH = -\log [OH^{-}]\\\\pOH = -\log 1.5\times 10^{-9}\\\\pOH = 8.82\\\\[/tex]
Furthermore, the pH of the solution shall be established. It was provided as follows:
[tex]pOH = 8.82\\\\pH =?\\\\pH + pOH = 14\\\\pH + 8.82 = 14\\\\[/tex]
When collecting all the like terms:
[tex]pH = 14 -8.82\\\\pH = 5.18[/tex]
Therefore, the solution of pH is 5.18.
How many moles are in 32g of O2?
Answer:
1 mol of O2
Explanation:
n = m/ M
n = 32/ ( 2× 15.999)
n= 1 mol of O2
Why does nuclear fusion occur in stars but not on Earth?
A.
There are no elements on Earth that can undergo fusion.
B.
Too many free neutrons are present on Earth.
C.
Fusion reactions require a lot of heat and pressure.
D.
Elements capable of undergoing fusion can’t be enriched on Earth.
Answer:
C. Fusion reactions require a lot of heat and pressure
Explanation:
A Nuclear fusion doesn't occur naturally on Earth because it requires temperatures far higher than Earth temperatures. Nuclear fusion takes place only at extremely high temperatures. That's because a great deal of energy is needed to overcome the force of repulsion between the positively charged nuclei.
What is the reducing agent in the reaction Fe + AgNO3 → Fe(NO3)3 + Ag?
O A. Fe
B. AgNO3
C. Fe(NO3)3
D. Ag
Answer:
A.
Iron, Fe
explanation:
Iron reduces silver nitrate to silver.
Answer:
agno3
Explanation:
just took the quiz
find the atoms of 52u of helium
Here, we have been given the the amount of helium to be 52 amu.
Thus,
Atomic mass of Helium is 4u = 2 protons + 2Neutrons = 1 atom. No. of atoms in 52u = $ \sf{\frac{52}{4}}$ = 13 atoms.$ \red{\leadsto}$ Hence, the number of atoms will be 13 atoms.
[tex] \\ [/tex]
what is the difference between double salt and complex salt
Answer:
The main different of double salt and complex salt is that a double salt is a combination of two salt compounds whereas a complex salt is a molecular structure that is composed of one or more complex ions.
How does the position of an object relate to the energy stored in a object?
Answer:
An object can store energy as the result of its position. For example, the heavy ball of a demolition machine is storing energy when it is held at an elevated position. This stored energy of position is referred to as potential energy. Similarly, a drawn bow is able to store energy as the result of its position
Answer:
you can see the attached file is scanned the same level of detail of the heart the heart and I am a little bit of an emergency you can see it on the heart the tree is the best of luck for tomorrow be in a few days and times are available in a while back and forth to be a good idea and latitude longitude of
1 mole of alkene CxH2x was fully burnt in oxygen. The products were analysed. 264g of Co2 and 108g of of H20 were produced. Use the information to balance the equation and work out the identity of CxH2x.
CxH2x+ O2--> CO2+H2O
PLEASE CAN SOMEONE EXPLAIN THIS TO ME!!!!!!!!!!!!
Answer:
C6H12
Explanation:
Step 1: Find the molar mass of carbon dioxide and water
MH2O = 2(1.008) + 16.00 = 1.802x10^1 g/mol
MCO2 = 12.01 + 2(16.00) = 4.401x10^1 g/mol
Step 2: Calculate the moles of the products
nH2O = 108g / 1.802x10^1 g/mol = 5.99 or about 6
nCO2 = 264g/ 4.401x10^1 g/mol = 5.99 or about 6
Step 3: Enter moles of carbon dioxide and water into the balanced equation
CxH2x + O2 = 6CO2 + 6H2O
Step 4: Balance
We see how there is six carbon dioxide on the right side which means there are six carbons in the equation.
This means x is equal to 6 in our equation.
If you plug the information into the equation you get:
C6H12 + O2 = 6 CO2 + 6 H2O
Now all that's left is to balance the oxygens
We see how there is 18 oxygens on the right side of the equation which means there must be 18 on the left side.
Because we have oxygen gas we divide 18 by 2 which means there are 9 O2's on the left side
Therefore, the balanced equation is C6H12 + 9O2 = 6 CO2 + 6 H2O
A pupil has drawn the electronic structure of fluorine and the diagram is shown below. However,
mistakes have been made. State three mistakes that have been made.
Fl atomic number: 9
Fl atomic mass: 10
(ps i have two of these but can’t figure out the last)
Answer:
The number of electrons in the orbit is wrong they have to be 9 and not 10since flourine is in group 7 the number of electrons in the outer most shell has to be 7 and not 2the first shell has 8 instead of 2 electronsI hope this helps
Plants in forests take up carbon dioxide from the atmosphere during photosynthesis. They transform the carbon dioxide into plant material. When plants die, their organic matter is often worked into the soil by decomposers. Some of this organic matter remains within the soil and forest floor, and some of it is taken up by other living things.
Based on this information, what role do forests play in the carbon cycle?
A.
Forests are carbon sinks because they store carbon.
B.
Forests are carbon sinks because they do not absorb carbon dioxide when plants die.
C.
Forests are carbon sources because they emit carbon.
D.
Forests are carbon sources because they can be burned to emit carbon dioxide.
Answer: B. forests are carbon sinks because they store carbon
Explanation:forests take up carbon from the atmosphere through photosynthesis and from organic matter through decomposition. so, forests are carbon sinks because they store carbon
which particle is an atom with only 10 neutrons in its nucleus ?
Answer:
fluorine
Explanation:
what is the charge on ion X Li2X
In the compound Li2X, there are two lithium ions and one X^2- ion.
Ionic compounds are composed of an ion pair of opposite charge. Usually, the positive ion is a metal cation while the negative ion is a non metal anion. The two ions are held together by strong electrostatic interaction.
In the compound Li2X, there are two lithium ions and one X^2- ions. X^2 -is the non metal anion present.
Learn more: https://brainly.com/question/2673886
Asap please help 15 points
Explanation:
P_H
and
li_n
hope it helps
b) The size of a star is a balance between
2 things. Explain this statement.
Answer:
Luminosity is the amount of light that a star radiates. The size of the star and its surface temperature determine its luminosity. Apparent magnitude of a star is its perceived brightness, factoring in size and distance, while absolute magnitude is its true brightness irrespective of its distance from earth
Explanation:
hii pls help me!!
even if u know how to do one, it's okk
anything helps
Explanation:
a) HNO2(aq) = HNO3(aq) + H2O(l) +NO(g)
b) SoCl2 (l) + H2O (l) = So2(g) + 2HCl(aq)
c) CH4 (g) + 2O2(g) = Co2 (g) + 2H2O(g)
d) 3CuO(s) + 2NH3 (g) = 3Cu(s) + 3H2O (l) + N2(g)
What is the reducing agent in the reaction Fe + AgNO3 → Fe(NO3)3 + Ag?
O A. Fe
O B. AgNO3
C. Fe(NO3)3
O D. Ag
Answer:
A
Explanation:
Fe up to Fe+3
In the given reaction, Fe is a reducing agent. Therefore, option (A) is correct.
What is a reducing agent?A substance in a redox reaction that donates its electrons to another substance and gets oxidized to a higher valency is called a reducing agent.
A reducing agent can be explained as one of the reactants of a redox reaction that can reduce the other reactant of the chemical reaction by donating its electrons.
If the reducing agent will not provide its electrons to other substances in a chemical reaction, then the reduction cannot take place. The given chemical reaction is:
Fe + AgNO₃ → Fe(NO₃)₃ + Ag
In the above reaction, the Fe is in the zero oxidation state and changes into Fe³⁺ in Fe(NO₃)₃ after the chemical reaction So Fe losses its electron and gets oxidized. Therefore, Fe is a reducing agent in this reaction.
Learn more about reducing agent, here:
brainly.com/question/2890416
#SPJ2
What has an atomic number of 1
Answer:
Hydrogen
Explanation:
plz solve the question and send the answer
I will give u branist, follow u ,rate u 5 star and also give u like ,plz help me
Answer:
64g of [tex]\bold{CH_{3}OH}\dashrightarrow[/tex]44.8L
vapour density of [tex]CH_{3}3OH=\frac{mass}{volume}[/tex] of [tex]\bold{CH_{3}OH}[/tex]
=64/44.8=10/7=1.43 g/l
Vapour density of [tex]\bold{CH_{3}OH}[/tex]=1.43g/l
64g of [tex]\bold{CH_{3}OH => 44.8L }[/tex]
vapour density of [tex]\small{\sf{CH_{3}3OH=\frac{mass}{volume} of } \bold{CH_{3}OH}}[/tex]
=64/44.8=10/7=1.43 g/l
Vapour density of [tex]\bold{CH_{3}OH = 1.43 g/L}[/tex]
William adds two values , following the rules for using significant figures in computations. He should write the sum of these two number by using
Answer:
when it comes to adding or subtracting numbers, his final answer should have the same number of decimal places as the least precise value.
For example if you add 2 numbers; 10.443 + 3.5 , 10.443 has 3 decimal places and 3.5 has only one decimal place.
Therefore 3.5 is the less precise value.
So when adding these 2 values the final answer should have only one decimal place.
after adding we get 13.943 but it can have upto one decimal place. then the second decimal place is less than 5 so the answer should be rounded off to 13.9.
the answer is the same number of decimal places as the least precise value
Explanation:
I think this is the answer I'm not sure
Answer: the same number of decimal places as the least precise value
Explanation:
Which statement includes all the steps in the change that is associated with the enthalpy of solution? solute separation and mixing reaction of reactants to form products. solute and solvent mixing and then separating solute separation, solvent separation, and then mixing
Answer: solute separation, solvent separation, and then mixing
Explanation:
The enthalpy change of solution simply means the amount of heat which can be released or absorbed when dissolving. The enthalpy of solution is usually expressed at constant temperature in kJ/mol.
The enthalpy of solution requires three main stages:
1. Solute separation: This is when the solute is broken down. In this case, all the intramolecular forces which holds the solute together is broken.
2. Solvent separation: This is when the solvent is broken down all the intramolecular forces which holds the solvent together is broken.
3. Mixing- In this case, the solute and the solvent is mixed for a solution.
