Product A sells 1.5 times more than Product B. Product B sells 70% less than Product C. Product C sold 34,000 units this month.
How many units of Product A were sold?
10,200
15,300 23,800 35,700 51,000

Answers

Answer 1

Answer:

15,300 units

Step-by-step explanation:

First, find how many units of Product B were sold:

34,000(0.3)

= 10,200

Find how many units of Product A were sold:

10,200(1.5)

= 15,300

So, 15,300 units of Product A were sold.

Answer 2

Product A  sold 15,300 units that is 1.5 times more than product B

Given :

Product A sells 1.5 times more than Product B. Product B sells 70% less than Product C.

Product C sold 34,000 units this month

Product C sold = 34000

Product B is 70% less than product C

So, product B is 100-70% =30% of product C

[tex]Product B=\frac{30}{100} \cdot 34000\\Product B \; sold = 10200[/tex]

Lets find out product A sold

Product A sold = 1.5 times more than product B

[tex]Product A= 1.5 \cdot product B\\Product A=1.5 \cdot 10200=15300[/tex]

15,300 units of product A were sold.

Learn more :  brainly.com/question/18958901


Related Questions

What is the simplified form of the following expression? Assume x > 0.
3
2x
16x
2x
4/24x²
2x
4/2443
16x4
124²

Answers

Answer:

fourth root of 24 x cubed/16x to the power four

Shawn has 4 times as many candies as Jason, who has a third as many candies as
lan. If Shawn has 64 candies, how many candies does Ian have?

Answers

Ian has 48 candies. hope that helps!
Ian has 4 candies...........

Starting with a fresh bar of soap, you weigh the bar each day after you take a shower. Then you find the regression line for predicting weight from number of days elapsed. The slope of this line will be:__________.

Answers

Answer:

The slope will be negative

Step-by-step explanation:

The slope of the regression line tells us about the relationship or behavior of the dependent and independent variables. In the scenario above, where the weight is being compared with the number of days elapsed. What is expected of the weight and quantity of a bar soap each time it is used for a shower is that it will decrease in weight. Therefore, as the number of days increases, and hence, number of showers rise, the weight of soap will decrease. Hence, we'll obtain a negative slope, one in which the increase in a variable leads to decrease in the other.

please help me with both questions

Answers

Answer:

(b) 829 seconds

(c) 13.8 minutes

Step-by-step explanation:

(b) 2.48×10⁸/2.99×10⁵ = 829 seconds

(c) 829/60 = 13.8 minutes

A car insurance company has determined that6% of all drivers were involved in a car accident last year. If14drivers are randomly selected, what is the probability of getting at most 3 who were involved in a car accidentlast year

Answers

Answer:

[tex]P(x \le 3) = 0.9920[/tex]

Step-by-step explanation:

Given

[tex]p = 6\%[/tex] --- proportion of drivers that had accident

[tex]n = 14[/tex] -- selected drivers

Required

[tex]P(x \le 3)[/tex]

The question is an illustration of binomial probability, and it is calculated using:

[tex]P(x ) = ^nC_x * p^x * (1 - p)^{n-x}[/tex]

So, we have:

[tex]P(x \le 3) = P(x = 0) +P(x = 1) +P(x = 2) +P(x = 3)[/tex]

[tex]P(x=0 ) = ^{14}C_0 * (6\%)^0 * (1 - 6\%)^{14-0} = 0.42052319017[/tex]

[tex]P(x=1 ) = ^{14}C_1 * (6\%)^1 * (1 - 6\%)^{14-1} = 0.37578668057[/tex]

[tex]P(x=2 ) = ^{14}C_2 * (6\%)^2 * (1 - 6\%)^{14-2} = 0.15591149513[/tex]

[tex]P(x=3 ) = ^{14}C_3 * (6\%)^3 * (1 - 6\%)^{14-3} = 0.03980719024[/tex]

So, we have:

[tex]P(x \le 3) = 0.42052319017+0.37578668057+0.15591149513+0.03980719024[/tex]

[tex]P(x \le 3) = 0.99202855611[/tex]

[tex]P(x \le 3) = 0.9920[/tex] -- approximated

HELP PLEASE!!!

Oak wilt is a fungal disease that infects oak trees. Scientists have discovered that a single tree in a small forest is infected with oak wilt. They determined that they can use this exponential model to predict the number of trees that will be infected after t years.
f(t)=e^0.4t


Question:

Rewrite the exponential model as a logarithmic model that calculates the # of years, g(x) for the number of infected trees to reach a value of x.

Answers

The logarithmic model is:

[tex]g(x) = \frac{\ln{x}}{0.4}[/tex]

-------------

We are given an exponential function, for the amount of infected trees f(x) after x years.To find the amount years needed for the number of infected trees to reach x, we find the inverse function, applying the natural logarithm.

-------------

The original function is:

[tex]y = f(x) = e^{0.4x}[/tex]

To find the inverse function, first, we exchange y and x, so:

[tex]e^{0.4y} = x[/tex]

Now, we have to isolate y, and we start applying the natural logarithm to both sides of the equality. So

[tex]\ln{e^{0.4y}} = \ln{x}[/tex]

[tex]0.4y = \ln{x}[/tex]

[tex]y = \frac{\ln{x}}{0.4}[/tex]

Thus, the logarithmic model is:

[tex]g(x) = \frac{\ln{x}}{0.4}[/tex]

A similar question is given at https://brainly.com/question/24290183

please helpppp i need it by tonight its very important

Answers

Answer:

m<1=145

m<2=35

m<3=35

Step-by-step explanation:

measure one is supplementary(the angles add to 180) to measure four.

so we do 180-35=145

measure 2 is congruent to measure four because they are corresponding angles

so measure 2=35

and measure 3 is also congruent to measure 4 because the are corresponding angles

so m<3=35

PLSS HELPPPP WILL GIVE BRAINLESSS A 22-foot ladder is resting against the side of a building. The bottom of the ladder is 3 feet from the building. Find the measure of the angle the ladder makes with the ground. Round your answer to the nearest tenth of a degree.

Answers

Answer:

The answer is 82.2  

Step-by-step explanation

hope this helps

Triangle ABL is an isosceles triangle in circle A with a radius of 11, PL = 16, and ∠PAL = 93°. Find the area of the circle enclosed by line PL and arc PL. Show all work and round your answer to two decimal places.

Answers

The area bounded by a chord and arc it intercepts is known as a segment of a circle segment of a circle

The area of the circle enclosed by line PL and arc PL is approximately 37.62 square units

The reason the above value is correct is as follows:

The given parameters in the question are;

The radius of the circle, r = 11

The length of the chord PL = 16

The measure of angle ∠PAL = 93°

Required:

The area of part of the circle enclosed by chord PL and arc PL

Solution:

The shaded area of the given circle is the minor segment of the circle enclosed by line PL and arc PL

The area of a segment of a circle is given by the following formula;

Area of segment = Area of the sector - Area of the triangle

Area of segment = Area of minor sector APL - Area of triangle APL

Area of minor sector APL:

Area of a sector = (θ/360)×π·r²

Where;

r = The radius of the circle

θ = The angle of the sector of the circle

Plugging in the the values of r and θ, we get;

Area of the minor sector APL = (93°/360°) × π × 11² 98.2 square units

Area of Triangle APL:

Area of a triangle = (1/2) × Base length × Height

Therefore;

The area of ΔAPL = (1/2) × 16 × 11 × cos(93°/2) ≈ 60.58 square units

Required shaded area enclosed by line PL and arc PL:

Therefore, the area of shaded segment enclosed by line PL and arc PL is found as follows;

Area of the required segment PL (98.2 - 60.58) square units = 37.62 square units

The area of the circle enclosed by line PL and arc PL ≈ 37.62 square units

Learn more about the finding the area of a segment can be found here:

https://brainly.com/question/22599425

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

The calculation of the area between line segment PL and circle arc PL is described below:

1) Calculation of the area of the circle arc.

2) Calculation of the area of the triangle.

3) Subtracting the area found in 2) from the area found in 1).

Step 1:

The area of a circle arc is determined by the following formula:

[tex]A_{ca} = \frac{\alpha\cdot \pi\cdot r^{2}}{360}[/tex] (1)

Where:

[tex]A_{ca}[/tex] - Area of the circle arc.

[tex]\alpha[/tex] - Arc angle, in sexagesimal degrees.

[tex]r[/tex] - Radius.

If we know that [tex]\alpha = 93^{\circ}[/tex] and [tex]r = 11[/tex], then the area of the circle arc is:

[tex]A_{ca} = \frac{93\cdot \pi\cdot 11^{2}}{360}[/tex]

[tex]A_{ca} \approx 98.201[/tex]

Step 2:

The area of the triangle is determined by Heron's formula:

[tex]A_{t} = \sqrt{s\cdot (s-l)\cdot (s-r)^{2}}[/tex] (2)

[tex]s = \frac{l + 2\cdot r}{2}[/tex]

Where:

[tex]A_{t}[/tex] - Area of the triangle.

[tex]r[/tex] - Radius.

[tex]l[/tex] - Length of the line segment PL.

If we know that [tex]l = 16[/tex] and [tex]r = 11[/tex], then the area of the triangle is:

[tex]s = \frac{16+2\cdot (11)}{2}[/tex]

[tex]s = 19[/tex]

[tex]A_{t} = \sqrt{19\cdot (19-16)\cdot (19-11)^{2}}[/tex]

[tex]A_{t} \approx 60.399[/tex]

Step 3:

And the area between the line segment PL and the circle arc PL is:

[tex]A_{s} = A_{ca}-A_{t}[/tex]

[tex]A_{s} = 98.201 - 60.399[/tex]

[tex]A_{s} = 37.802[/tex]

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

Give example to verify if the given statement is true or false
1) if two numbers are co-primes , at least one of them should be prime number.

Answers

Answer:

no

Step-by-step explanation:

if two numbers are co-prime that is not necessary that one of them must be a prime number

The polygons in each pair are similar. Find the missing side length.

Answers

Let missing side be x

If both polygons are similar

[tex]\\ \sf\longmapsto \dfrac{3}{4}=\dfrac{18}{x}[/tex]

[tex]\\ \sf\longmapsto 3x=4(18)[/tex]

[tex]\\ \sf\longmapsto 3x=72[/tex]

[tex]\\ \sf\longmapsto x=\dfrac{72}{3}[/tex]

[tex]\\ \sf\longmapsto x=24[/tex]

Round 5,821 to the nearest thousands place:

Answers

Answer:

6000 hope this helps

if the question is 5,422 then the round figure is 5000

but the question is 5,821 its above 5500 will be 6000

A popular beach erodes 4 inches per year on average.

An eroding beach.
A. How many years will it take for the coastline to erode one foot?

Answers

Answer:

3 years

Step-by-step explanation:

4 inches per year on average

1 foot = 12 inches

12 divided by 4 equals 3

therefore it is 3 years

Helpp me plzzz im being timed

Answers

Above question
Slope = change in y / change in x
(2 different random point on the line)
Let’s point out 2 points: (0,3) and (6,0)
So slope = (3 - 0) / (0 - 6) = 3/(-6) = -1/2

Y-intercept is when x = 0, the line cross the y-axis at y = ?
So y = 3
Below question is farmiliar:
Slope = (30-50) / (0-6) = -20/(-6) = 10/3
Y-intercept = 30

17 x 35=56 over 76 hope it helps s

write your answer as an integer or as a decimal rounded to the nearest tenth​

Answers

Answer:

FH ≈ 6.0

Step-by-step explanation:

Using the sine ratio in the right triangle

sin49° = [tex]\frac{opposite}{hypotenuse}[/tex] = [tex]\frac{FH}{FG}[/tex] = [tex]\frac{FH}{8}[/tex] ( multiply both sides by 8 )

8 × sin49° = FH , then

FH ≈ 6.0 ( to the nearest tenth )

Answer:

6

Step-by-step explanation:

sin = opposite/hypotenuse

opposite = sin * hypotenuse

sin (49) = 0,75471

opposite = 0,75471 * 8 = 6,037677 = 6

After how many years, to the nearest whole year, will an investment of $100,000 compounded quarterly at 4% be worth
$213,022?
Provide your answer below:

Answers

9514 1404 393

Answer:

  19 years

Step-by-step explanation:

The compound interest formula tells you the future value of principal P invested at annual rate r compounded n times per year for t years is ...

  A = P(1 +r/n)^(nt)

Solving for t, we get ...

  t = log(A/P)/(n·log(1 +r/n))

Using the given values, we find t to be ...

  t = log(2.13022)/(4·log(1 +0.04/4)) ≈ 19.000

The investment will be worth $213,022 after 19 years.

You measure 49 turtles' weights, and find they have a mean weight of 80 ounces. Assume the population standard deviation is 6.1 ounces. Based on this, construct a 99% confidence interval for the true population mean turtle weight. Round your answers to 2 decimal places.

Answers

Answer:

The 99% confidence interval for the true population mean turtle weight is between 77.76 and 82.24 ounces.

Step-by-step explanation:

We have to find our [tex]\alpha[/tex] level, that is the subtraction of 1 by the confidence interval divided by 2. So:

[tex]\alpha = \frac{1 - 0.99}{2} = 0.005[/tex]

Now, we have to find z in the Z-table as such z has a p-value of [tex]1 - \alpha[/tex].

That is z with a p-value of [tex]1 - 0.005 = 0.995[/tex], so Z = 2.575.

Now, find the margin of error M as such

[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]

In which [tex]\sigma[/tex] is the standard deviation of the population and n is the size of the sample.

[tex]M = 2.575\frac{6.1}{\sqrt{49}} = 2.24[/tex]

The lower end of the interval is the sample mean subtracted by M. So it is 80 - 2.24 = 77.76 ounces.

The upper end of the interval is the sample mean added to M. So it is 80 + 2.24 = 82.24 ounces.

The 99% confidence interval for the true population mean turtle weight is between 77.76 and 82.24 ounces.

five brothers of 4, 9, 11, 13 and 16 years respectively, receive an inheritance of 1,500,000, the will stipulated that that amount must be shared by the heirs so that, placed the shares in a bank, they would result in equal capitalized amounts, when each one reached 21, could raise his share. Knowing that the bank charges an interest rate of 9% per year, what is the amount of each share?

Answers

9514 1404 393

Answer:

Youngest to oldest:

160,406.86246,805.83293,230.01348,386.58451,170.72

Step-by-step explanation:

At 9% interest per year, the present value of 1 at age 20 is ...

  p(a) = 1.09^(a-20)

Adding the present values for the different ages, we get a total of about 2.35528984846. Dividing the inheritance by that amount gives the multiplier for each of the present value numbers. The result is the list of shares shown above. At age 20, each brother will inherit about 636,864.29.

__

Additional comment

This is the sort of question that suggests the use of a graphing calculator or spreadsheet for doing the tedious number crunching.

(We assume the bank pays 9% per year, rather than charges 9% per year.)

look at the image below

Answers

Answer:

201.1 km²

Step-by-step explanation:

Surface area of a sphere= 4πr², where r = radius

so,

4πr²

= 4×π×4²

= 64π

= 201.1 km² (rounded to the nearest tenth)

kabura bought a piece of cloth 3 metres long. The material shrunk by 1% after washing. What was the new length of the cloth​

Answers

Answer:

2.97m

Step-by-step explanation:

1% of 3m =1/100×3=0.03

0.03m of cloth was shrunk,

So, New lenght : 3-0.03=2.97m

Factors and rewrite the expression 25x-15​

Answers

Answer:

5(5x-3)

Step-by-step explanation:

The common factor in this expression is 5 so divide 5 to all the values

25/5=5

-15/5= -3

Put these values into parenthesis and leave the 5 on the left side and out of the parenthesis

5(5x-3)

Answer:

5(5x - 3)

Step-by-step explanation:

The greatest common factor here is 5. Divide each term by 5 and simplify.

25x/5 = 5x

15/5 = 3

Therefore, the answer is 5(5x - 3).

Police estimate that 25% of drivers drive without their seat belts. If they stop 6 drivers at random, find theprobability that more than 4 are wearing their seat belts.

Answers

Answer:

%17.80

Step-by-step explanation:

17.8% is the probability that more than 4 are wearing their seat belts.

What is Probability?

It is a branch of mathematics that deals with the occurrence of a random event.

Given that Police estimate that 25% of drivers drive without their seat belts.

If they stop 6 drivers at random we need to find the probability that more than 4 are wearing their seat belts.

For each driver stopped, there are only two possible outcomes. Either they are wearing their seatbelts, or they are not.

he drivers are chosen at random, which mean that the probability of a driver wearing their seatbelts is independent from other drivers.

Police estimate that​ 25% of drivers drive without their seat belts.

This means that 75% wear their seatbelts, so P=0.75

If they stop 6 drivers at​ random, find the probability that all of them are wearing their seat belts.

[tex]P(X=x)=C_{n,x} p^{x} (1-p)^{n-x}[/tex]

[tex]P(X=6)=C_{6,6} 0.75^{6} (1-0.75)^{0} =0.1780[/tex]

Hence, 17.8% is the probability that more than 4 are wearing their seat belts.

To learn more on probability click:

https://brainly.com/question/11234923

#SPJ5

prove that 2^n+1>(n+2).sin(n)​

Answers

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

Jack’s backpack weighs 15 pounds. Fernando’s backpack weighs less than Jack’s. Which graph shows how much Fernando’s backpack can weigh?

Answers

Answer:

A

Step-by-step explanation:

c and d out of the question

b has its circle filled in meaning it could be 15lbs, which it's not

A correct answer by default

Answer:b

Step-by-step explanation: it has a filled in diamond which mean it's that...

The segments shown below could form a triangle.
A
C
7
9
12
B
А
a
A. True
B. False

Answers

Answer:

TRUE

Step-by-step explanation:

I SEEN SOME ONE ELSE WIT 5 STARS SAY SO(:

The given segment can form triangle. Therefore, the given statement is true.

What is triangle?

A polygon has three edges as well as three vertices is called a triangle. It's one of the fundamental geometric shapes. In Euclidean geometry, each and every three points that are not collinear produce a distinct triangle and a distinct plane. In other words, every triangle was contained in a plane, and there is only single plane that encompasses that triangle.

All triangles are enclosed in a single plane if all of geometry is the Euclidean plane, however this is no longer true in higher-dimensional Euclidean spaces. Unless when otherwise specified, this article discusses triangles within Euclidean geometry, namely the Euclidean plane. The given segment can form triangle.

Therefore, the given statement is true.

To know more about triangle, here:

https://brainly.com/question/14712269

#SPJ7

Convert 0.450 to a proper fraction

Answers

Answer:

9/20

Step-by-step explanation:

450/1000

this is not the answer, because it is not simplified

so here we have to find common factor and simplifying

________________________________________________

450/1000 is simplified to 9/20, and it can no longer be simplified.

The​ half-life of a radioactive substance is 20 years. If you start with some amount of this​ substance, what fraction will remain in 180 years?

Answers

Answer:

1/512

Step-by-step explanation:

Let staring fraction = x

Half-life = 20 years ; this is the time taken for an element to decrease to half of its original size

Hence,

After 20 years - - - > x/2

After 40 years - - - - > x/2 ÷ 2 = x/2 * 1/2 = x /4

After 60 years - - - - > x/4 ÷ 2 = x/4 * 1/2 = x/8

After 80 years - - - - -> x/8 ÷ 2 = x/8 * 1/2 = x / 16

After 100 years - - - > x/16 * 1/2 = x/32

After 120 years - - - - > x/32 * 1/2 = x/64

After 140 years - - - - -> x / 64 * 1/2 = x / 128

After 160 years - - - - - > x / 128 * 1/2 = x/256

After 180 years - - - - > x/256 * 1/2 = x / 512

Hence, the fraction after 180 years = 1/512

factorize : ( p- q ) cube​

Answers

Answer:

[tex]( {p - q}^{3} ) \\ = {p}^{2} - 3 {p}^{2} q + 3p {q}^{2} - {q}^{3} [/tex]

Hope my answer helped u :)

Please help explanation if possible

Answers

Answer:

18.84 feet.  let me know if you have ay other questions.

Step-by-step explanation:

The way to find the formula for circumference is kinda complicated so it is best to ust memorize the formula, which is 2πr.  or 2 times pi times the radius.  

Your problem gives you the formula, but instead of 2 and r in it you have d, which is the diameter.

The diameter of the circle is 2 times the radius, so that's why it is replaced.

the radius is the distance from the center fo the circle to one edge, and the diameter is the distance through the circle passing through its center.  so it's the center to one end plus the center to another end.  or r+r which is also 2r.

So d = 2r, so in this problem d =6 feet.

So now the formula πd = 3.14*6 feet = 18.84 feet

Venn diagrams: unions, intersections, and complements

Attached is the photo reference

Answers

Answer:

a) 0

b) 2,3,4,5,6,7

c)3,4,6,7

Step-by-step explanation:

Other Questions
Need help asap will rate 5 stars!!!! what do you mean by lack of transparency Define Data communication 7. Three people were _____ in the accident.A. damaged B. injured C. spoilt D. broken Good evening everyone Help me i n my hw ,The wall of cinema hall are covered with sound absorbing materials. Why?Answer it ASAP.Good day Chameleons catch insects with their tongues, which they can rapidly extend to great lengths. In a typical strike, the chameleon's tongue accelerates at a remarkable 220 m/s^2 for 20 msms, then travels at constant speed for another 30 ms. Required:During this total time of 50 ms, 1/20 of a second, how far does the tongue reach? What are the major economic activities in Sierra Leone Swifty Corporation manufactures a product with a unit variable cost of $100 and a unit sales price of $176. Fixed manufacturing costs were $480000 when 10000 units were produced and sold. The company has a one-time opportunity to sell an additional 1000 units at $145 each in a foreign market which would not affect its present sales. If the company has sufficient capacity to produce the additional units, acceptance of the special order would affect net income as follows:Income would increase by $45000.Income would increase by $3000.Income would increase by $145000.Income would decrease by $3000.Coronado Industries is using the target cost approach on a new product. Information gathered so far reveals:Expected annual sales 350000 unitsDesired profit per unit $0.35Target cost $168000What is the target selling price per unit?a. $0.48b. $0.35c. $0.70d. $0.83 for what value of x does 4^x=(1/8)^x+5? PLEASE HELP ME!!!! I am stuck. The frequency of tasters and nontasters of PTC varies among populations. (Answer ALL questions) - In population A, 94 percent of people are tasters (an autosomal dominant trait) and 6 percent are nontasters. - In population B, tasters are 75 percent and nontasters 25 percent. - In population C, tasters are 91 percent and nontasters are 9 percent.1. Calculate the frequency of the dominant (T) allele for PTC tasting in population A.2. Calculate the frequency of the recessive (t) allele for nontasting in population A.3. Calculate the frequency of the dominant (T) allele for PTC tasting in population B.4. Calculate the frequency of the recessive (t) allele for nontasting in population B.5. Calculate the frequency of the dominant (T) allele for PTC tasting in population C.6. Calculate the frequency of the recessive (t) allele for nontasting in population C.7. Assuming that Hardy-Weinberg conditions apply, determine the TT frequency in population A.8. Assuming that Hardy-Weinberg conditions apply, determine the Tt frequency in population A.9. Assuming that Hardy-Weinberg conditions apply, determine the tt frequency in population A.10. Assuming that Hardy-Weinberg conditions apply, determine the TT frequency in population B.11. Assuming that Hardy-Weinberg conditions apply, determine the Tt frequency in population B.12. Assuming that Hardy-Weinberg conditions apply, determine the tt frequency in population B.13. Assuming that Hardy-Weinberg conditions apply, determine the TT frequency in population C.14. Assuming that Hardy-Weinberg conditions apply, determine the Tt frequency in population C.15. Assuming that Hardy-Weinberg conditions apply, determine the tt frequency in population C. I need help with this please!! What is the balanced form of the following equation?Br2 + S2O32- + H2O Br1- + SO42- + H+ Please Answer This!!! I NEEEDDD TOOO KNOWWWWW ANSWER!!! what event most directly led to secession and the forming of the confederacy? 3. Create and write a real-world situation that could be represented by the equation below:5x + 15 = 45 3x (x - 2) = x^2 - 4 = X2010060Please help me What are the best extracaricular activites to get selected in a top university ?(By the way im indian ) Surface Area of conesInstructions: Find the surface area of each figure. Round your answers to the nearest tenth, if necessary. What actions may an employer take against a dishonest worker?