Sketch the graph of y = 2(x – 2)2 and identify the axis of symmetry

Answers

Answer 1

Answer:

x = 2

Step-by-step explanation:

The minimum point of the curve is (2, 0). Hence, axis of symmetry is x = 2


Related Questions

Choose the algebraic description that maps the image ABC onto A'B'C'.

Answers

(X,Y-4) this is the answer to the question since the y value of the translated image is moved down from the preimage

Mathematics I need help

Answers

(X-3)^2 +4. Is the answer

I need help please and thank you.

Answers

Answer:

option a.

[tex] + - \frac{13}{5} [/tex]

Step-by-step explanation:

[tex]25x^2\: - \:169 = 0 [/tex]

[tex]25x^2 = 169[/tex]

[tex] {x}^{2} = \frac{169}{25} [/tex]

[tex]x = + - \sqrt{ \frac{169}{25} } [/tex]

[tex]x = + - \frac{13}{5} [/tex]

Need help please I don’t get it

Answers

the e-function stuff can be confusing sometimes, but notices that g(x) / the blue line, is just somewhat lower, rest is the same.

how much lower? look at the y-intercepts

f(0)= "about 5"

g(0)= "about -3"

with this y-intercept only option c can work

For a data set of the pulse rates for a sample of adult​ females, the lowest pulse rate is 39 beats per​ minute, the mean of the listed pulse rates is x=76.0 beats per​ minute, and their standard deviation is s=13.8 beats per minute. a. What is the difference between the pulse rate of 39 beats per minute and the mean pulse rate of the​ females? b. How many standard deviations is that​ [the difference found in part​ (a)]? c. Convert the pulse rate of 39 beats per minutes to a z score. d. If we consider pulse rates that convert to z scores between −2 and 2 to be neither significantly low nor significantly​ high, is the pulse rate of 39 beats per minute​ significant

Answers

Answer:

a) The difference is of -37, that is, this pulse rate is 37 beats per minute below the mean.

b) 2.68 standard deviations below the mean.

c) Z = -2.68.

d) Z-score below -2, so a pulse rate of 39 beats per minute is significantly low.

Step-by-step explanation:

Normal Probability Distribution

Problems of normal distributions can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the z-score of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the p-value, we get the probability that the value of the measure is greater than X.

a. What is the difference between the pulse rate of 39 beats per minute and the mean pulse rate of the​ females?

Difference between 39 and 76, so 39 - 76 = -37.

The difference is of -37, that is, this pulse rate is 37 beats per minute below the mean.

b. How many standard deviations is that​ [the difference found in part​ (a)]

Standard deviation of 13.8, so:

-37/13.8 = -2.68

So 2.68 standard deviations below the mean.

c. Convert the pulse rate of 39 beats per minutes to a z score.

2.68 standard deviations below the mean, so Z = -2.68.

d. If we consider pulse rates that convert to z scores between −2 and 2 to be neither significantly low nor significantly​ high, is the pulse rate of 39 beats per minute​ significant?

Z-score below -2, so a pulse rate of 39 beats per minute is significantly low.

1 red marble 4 blue marbles 3 green marbles probability of drawing 2 blue marbles

Answers

Answer:

3/14

Step-by-step explanation:

Assuming you draw one after the other without replacement, you have a 1/2 chance of drawing blue the first time, and after one is taken out, you have 7 left. In order to draw 2 blues you would have to have a blue the first time, so there would be 3 blue left. Multiplying the 2 probabilities gets 1/2*3/7= 3/14. Double check that though.

A cylinder with radius 3 meters and height 7 meters has its radius tripled. How many times greater is the volume of the larger cylinder than the smaller cylinder?
How many times greater is the volume of the larger cylinder than the smaller cylinder?


Please help :)

Answers

Answer:

9x

Step-by-step explanation:

Quick maths, I dont really have an explaination pls give me brainliest ;-;.

Precision manufacturing: A process manufactures ball bearings with diameters that are normally distributed with mean 25.0 millimeters and standard deviation 0.07 millimeter. Round the answers to at least four decimal places. (a) Find the 60th percentile of the diameters. (b) Find the 67th percentile of the diameters. (c) A hole is to be designed so that 2% of the ball bearings will fit through it. The bearings that fit through the hole will be melted down and remade. What should the diameter of the hole be

Answers

Answer:

a) The 60th percentile of the diameters is of 25.0177 millimeters.

b) The 67th percentile of the diameters is of 25.0308 millimeters.

c) The diameter of the hole should be of 24.8562 millimeters.

Step-by-step explanation:

Normal Probability Distribution

Problems of normal distributions can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the z-score of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the p-value, we get the probability that the value of the measure is greater than X.

Normally distributed with mean 25.0 millimeters and standard deviation 0.07 millimeter.

This means that [tex]\mu = 25, \sigma = 0.07[/tex]

(a) Find the 60th percentile of the diameters.

This is X when Z has a p-value of 0.6, so X when Z = 0.253.

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]0.253 = \frac{X - 25}{0.07}[/tex]

[tex]X - 25 = 0.253*0.07[/tex]

[tex]X = 25.0177[/tex]

The 60th percentile of the diameters is of 25.0177 millimeters.

(b) Find the 67th percentile of the diameters.

This is X when Z has a p-value of 0.67, so X when Z = 0.44.

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]0.44 = \frac{X - 25}{0.07}[/tex]

[tex]X - 25 = 0.44*0.07[/tex]

[tex]X = 25.0308[/tex]

The 67th percentile of the diameters is of 25.0308 millimeters.

(c) A hole is to be designed so that 2% of the ball bearings will fit through it. The bearings that fit through the hole will be melted down and remade. What should the diameter of the hole be.

This is the 2nd percentile, which is X when Z has a p-value of 0.08, so X when Z = -2.054.

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]-2.054 = \frac{X - 25}{0.07}[/tex]

[tex]X - 25 = -2.054*0.07[/tex]

[tex]X = 24.8562[/tex]

The diameter of the hole should be of 24.8562 millimeters.

Find the range of the data.
Scores: 81, 79, 80, 88, 72, 96, 86, 73, 79, 88

Answers

Answer:

24

Step-by-step explanation:

To find the range, you must subtract the lowest value from the highest value in the data set. If you organize the set from least to greatest, 72 is the lowest, and 96 is the highest.

So, 96 - 72 = 24, which is the range.

Z varies directly as Square x and inversely as y. If z = 187 when x = 64 and y = 6, find z if and 9. (Round off your answer to the nearest hundredth.)

Answers

Answer:

Z = 50

Step-by-step explanation:

Given the following data;

Z = 187

x = 64

y = 6

Translating the word problem into an algebraic expression, we have;

Z = k√x/y

First of all, we would find the constant of proportionality, k;

187 = k√64/6

187 * 6 = k√64

1122 = 8k

k = 1122/8

k = 140.25

To find z, when x and y = 9

Z = 140.25√9/9

Z = (140.25 * 3)/9

Z = 420.75/9

Z = 46.75 ≈ 50

Note: The values in the latter part of the question isn't explicitly stated, so I assumed a value of 9 for both x and y.

For the problem I tried dividing but my answers were not correct. How can I solve this problem then? Can someone help me out here please?

Answers

Answer:

8

Step-by-step explanation:

5 = 40

1 = x

Then we multiply by the rule of crisscrossing

5 x X = 40 x 1

5x = 40 then divide both by 5

X = 8

Suppose the age that children learn to walk is normally distributed with mean 12 months and standard deviation 2.5 month. 34 randomly selected people were asked what age they learned to walk. Round all answers to 4 decimal places where possible.

Answers

Answer:

Step-by-step explanation:

a.) it's just mean, variance

so here it's just 12,6.25

b.) For the x bar thing just divide the variance by the number of people (mean stay the same)

the variance is then (2.5²/34)= .1838

which makes it (12,.1838)

c.) here we don't use x bar (and so it's normal (12,2.5²))

p(11.6) = (11.6-12)/(2.5)= -.16 = .4364

p(12.4)= (12.4-12)/2.5 = .16= .5636

.5636-.4364= .1272

d.) here we use x bar because it's asking for an average so it's normal (12, .1838)

same deal

p(11.6)=(11.6-12)/√.1838= -.93295= .1762

p(12.4)= (12.4-12)/√.1838= .93295= .8238

.8238-.1762= .6476

d.) no because they're probably IID

f.) It's average so here we use x bar

q1 is just the 25th percentile

the 25th percentile is -.6745

-.6745=(x-12)/(√.1838)= 11.711

q3 is the 75th percentile

.6745=(x-12)/√.1838

x=12.289

The interquartile range is just the difference between the two

12.289-11.711= .5784

I need help with this math problem not sure what to do?​

Answers

Answer:

B. 14

Step-by-step explanation:

It's asking for function f + function g. Then it wants you to use 2 as the x value. So you have:

(f+g)(x) = 2x^2 + 3x + x - 2

(f+g)(x) = 2x^2 + 4x -2

Then using 2 as x:

(f+g)(2) = 2(2^2) + 4* 2 -2

(f+g)(2) = 8 + 8 - 2

(f+g)(2) = 14

Hope that helps, and let me know if I did any of that wrong.

U have to work out the value of a by the way

Answers

Answer:

Step-by-step explanation:

180-90=2b+b

90=3b

90/3=b

30=b

2b=2*30

   =60

180-90=a+a

90=2a

a=90/2

a=45

the answer is 45 degrees

hope it helps!!let me know if it does

Answer:

a= 15°

Step-by-step explanation:

> use the fact that the sum of angles in a triangle is 180°

> based on the picture in the small right triangle we have b° +2b° +90° =180°

b +2b +90 =180° , combine like terms

3b +90 = 180, subtract 90 from both sides of the equation

3b = 90, divide by 3 both sides of the equation

b = 30°

> angle b has a ray that continues as a line so it makes an 180° angle and we have the acute triangle so we can write that

a + a+ (180-b) =180, substitute b

2a + 180-30 =180, subtract 180 from both sides, and add 30 to both sides

2a=30, divide by 2 both sides

a= 15°

prove the identity sin3x=3sinx-4sin³x

Answers

Hi

we know that sin(A+B)=Sin(A)Cos(B)-Cos(A) Sin (B)

cos(2x)=1-2sin²(x)

sin(2x)=2sin(x)cos(x)

Exp:- Sin(3x)=Sin(x+2x)

Sin(x)cos(2x)+cos(x)sin(2x)

sin(x){1-2sin²(x)}+2cos²(x)sin(x)

sin(x)-2sin³(x)+2sin(x){1-sin²(x)}

sin(x)-2sin³(x)+2sin(x)-2sin³(x)

3sin(x)-4sin³(x)

Hope it helps....

Help asap! Lia can rent a van for either $90 per day with unlimited mileage or $50 per day with 250 free miles and an extra 25¢ for each mile over 250. For what number of miles traveled in one day would the unlimited mileage plan save Lia money? (Show work)

Answers

Answer:

The unlimited mileage plan would save money for Lia from 410 miles onwards.

Step-by-step explanation:

Since Lia can rent a van for either $ 90 per day with unlimited mileage or $ 50 per day with 250 free miles and an extra 25 ¢ for each mile over 250, to determine for what number of miles traveled in one day would the unlimited mileage plan save Lia money, the following calculation must be performed:

90.25 - 50 = 40.25

40.25 / 0.25 = 161

161 + 250 = 411

Therefore, the unlimited mileage plan would save money for Lia from 410 miles onwards.

Find the length of CE

Answers

Answer:

C. 37.8 units

Step-by-step explanation:

ED = 17/ cos(38°) = 17 / 0.7880 = 21.6 units

DF = 17× tan (38°) = 17× 0.7813 = 13.3 units

CD = 10/13.3 × 21.6 = 16.2 units

so, the length of CE = 21.6+16.2 = 37.8 units

Solve the inequality 5x + 3 2 >48

Answers

Answer:

[tex]{ \tt{5x + 3 \geqslant 48}} \\ { \tt{5x \geqslant 45}} \\ { \tt{x \geqslant 9}}[/tex]

Answer:

x[tex]\geq[/tex]9

Step-by-step explanation:

5x+3[tex]\geq \\[/tex]48  /-3

5x[tex]\geq[/tex]45   //5

x[tex]\geq[/tex]9

8. Solve the system using elimination.
3x - 4y = 9
- 3x + 2y = 9

Answers

Answer:

3x−4y=9 −3x+2y=9

Add these equations to eliminate x: −2y=18

Then solve−2y=18

for y: −2y=18 −2y −2 = 18 −2 (Divide both sides by -2)

y=−9

Now that we've found y let's plug it back in to solve for x.

Write down an original equation: 3x−4y=9

Substitute−9for y in 3x−4y=9: 3x−(4)(−9)=9

3x+36=9(Simplify both sides of the equation)

3x+36+−36=9+−36(Add -36 to both sides)

3x=−27 3x 3 = −27 3 (Divide both sides by 3) x=−9

Answer: x=−9 and y=−9

Hope This Helps!!!

What is the effect of X on Y?

Answers

Answer:

GMM,pooled OLC,even cross country OLC are most variables not difficult panel data analysis

f(X) = 10x^3 find inverse

Answers

1000 is you answer
Or
10x10x10
Or
10/3

Answer: [tex]y=\sqrt[3]{\frac{x}{10} }[/tex]

Step-by-step explanation:

[tex]f(x)=10x^{3}\\y=10x^{3}[/tex]

switch the x and y:

[tex]x=10y^{3}[/tex]

Now solve for y:

[tex]x=10y^{3} \\\frac{x}{10} =y^{3} \\\sqrt[3]{\frac{x}{10} } =y\\[/tex]

Therefore, the inverse of that function is: [tex]y=\sqrt[3]{\frac{x}{10} }[/tex]

What is the probability of drawing 1 red marble out of a bag containing 4 red marbles, 3 green marbles, 2 blue marbles, and 1 purple marble?

Answers

Answer:

2/5

Step-by-step explanation:

There are a total of 4+3+2+1=10 marbles in the bag. Since there is an equal chance of drawing any marble from the bag, the chances of drawing a red marble is equal to the number of red marbles divided by the total number of marbles.

What we're given:

4 red marbles10 total marbles

Therefore, the probability of drawing a red marble is:

[tex]\frac{4}{10}=\boxed{\frac{2}{5}}[/tex]

Answer: Most probably

Step-by-step explanation:

what is the perimeter of a triangle?

Answers

Answer:

P = side a + side b + side c

Step-by-step explanation:

The perimeter of any polygon is all sides added together.

Answer:

3 X sides please mark me brainlist

7 women can bake 100 cookies in 14 days. How many would it take for 4 women to bake 240 cookies?

Answers

Answer:

it would take 30 and a half days to make 240 cookies



Let f(x) = 2x + 8, g(x) = x² + 2x – 8, and h(x)
Perform the indicated operation. (Simplify as far as possible.)
(g - f)(2) =

Answers

the answer is (g-f)(2)

what is the value of -3^2+(4+7)(2)?​

Answers

Answer:

[tex] { - 3}^{2} + (4 + 7)(2) \\ = - 9 + 22 \\ = 13[/tex]


Solve the expression using the correct order of operations.
0.75x3.2+ (9.1)2-((-2.3)-(-0.9))2

Answers

Answer:

[tex]0.75 * 3.2+ (9.1)^2-((-2.3)-(-0.9))^2 = 83.25[/tex]

Step-by-step explanation:

Given

[tex]0.75 * 3.2+ (9.1)^2-((-2.3)-(-0.9))^2[/tex]

Required

Solve

Start with the bracket

[tex]0.75 * 3.2+ (9.1)^2-((-2.3)-(-0.9))^2 = 0.75 * 3.2+ (9.1)^2-(-1.4)^2[/tex]

Evaluate all exponents

[tex]0.75 * 3.2+ (9.1)^2-((-2.3)-(-0.9))^2 = 0.75 * 3.2+ 82.81-1.96[/tex]

Evaluate all products

[tex]0.75 * 3.2+ (9.1)^2-((-2.3)-(-0.9))^2 = 2.4+ 82.81-1.96[/tex]

[tex]0.75 * 3.2+ (9.1)^2-((-2.3)-(-0.9))^2 = 83.25[/tex]

What is the depth of water in a tank with 300,000 gallons of water at 70F when the pressure gauge at the bottom of the tank reads 23 psig?​

Answers

Answer:

53.08 ft

Step-by-step explanation:

The pressure at the bottom of the tank, P = ρgh where ρ = density of water = 1000 kg/m³, g = acceleration due to gravity = 9.8 m/s² and h = depth of water in tank.

Since the pressure at the bottom of the tank, P = ρgh, making h subject of the formula, we have

h = P/ρg

Since P = 23 psig = 23 × 1 psig = 23 × 6894.76 Pa = 158579.48 Pa

Substituting the values of the other variables into h, we have

h = P/ρg

h = 158579.48 Pa/(1000 kg/m³ × 9.8 m/s²)

h = 158579.48 Pa/(9800 kg/m²s²)

h = 16.18 m

h = 16.18 × 1 m

h = 16.18 × 3.28 ft

h = 53.08 ft

: Find absolute minimum and maximum values of (, ) = 2
2 +
4 + 4
On the close triangular region R bounded by the lines = −2, = 0, = 2

Answers

f(x , y) = x + y - xy, D is the closed triangular region with vertices (0, 0), (0 , 2) , and (4 , 0)

Which of these is an example of technology?
an idea for a story
the first wheel ever built
an engineer

Answers

Answer:

the first wheel ever built

Answer:

The first wheel ever built

Step-by-step explanation

(*) Sorry for my late answer but I hope this helps others that are looking for this.

100% in the test :)

Other Questions
If you start with 4.5 moles of aluminum and 6.5 moles of copper chloride to make aluminum chloride and copper, what is the limiting reagent?2Al + 3CuCl -> 2AlCl3 + 3Cu Setsuko wants to start a business of her own. She does not have enough savings, so she approaches her bank to obtain short-term funds for operations. The bank agrees to lend her $10,000 as she has requested. In this scenario, the type of funding obtained by Setsuko can be regarded as a could someone explain how to figure this out (marking brainliest to the most helpful answer) I will report fakes. express 572 in simplest radical form. Occurs in mitochondria.Select one:a. Both Photosynthesis and Cellular Respirationb. Neither Photosynthesis nor Cellular Respirationc. Photosynthesisd. Cellular Respiration Simplify (3 1/2+7)divided by (4 1/3-3) Telitha notices that a coworker always undercharges her friends when they make purchases at the shop. Telitha is worried that if she reports this coworker, everyone will think she's a snitch. This is an example of __________. Two trains are 500 miles apart when they first start moving towards each other. If in two hours the distance between them is 300 miles and one train goes 20 miles faster than another, find the speed of the faster train. (Note: there are two possible solutions. Could you please find both?) Question 8 of 10A biologist measures the allele frequencies of pea plants in a very controlledenvironment. The plants can either have a dominant tall allele (7) or arecessive short allele (t). Which of the following would be a reason that thispopulation is not at Hardy-Weinberg equilibrium?O A. There are no mutations in the alleles for height.B. Tall plants are more likely to survive.O c. All of the pea plants reproduce exactly once.O D. The pea flowers are pollinated at random. A company rents a building with a total of 60,000 square feet, which are evenly divided between two floors. The company allocates the rent for space on the first floor at twice the rate of space on the second floor. The total monthly rent for the building is $36,000. How much of the monthly rental expense should be allocated to a department that occupies 12,000 square feet on the second floor A Single Orbital With Two Lobes At 90In A Single Plane And A Node In The Center Would Likely Be Found Where?a.4sb.4pc.4dd. it would not be found in any of thesee.4f Can someone help me pleasee The mason will build a wall that uses 36 bricks in each row. The wall will be 140 rows high. Each brick weighs 4 pounds. What is the total weight of all the bricks? Every high school senior takes the SAT at a school in St. Louis. The high school guidance director at this school collects data on each graduating seniors GPA and their corresponding SAT test score. The guidance director is conducting a _________ in this experimental design.A. sample surveyB. censusC. sample pollD. random sample The agreement of the trial balance totals is an indication that all transactions have been properly recorded in the books of accounts. Do you agree with this statement? what does it mean by "How many countries are there in the united states?" b) Describe two measures each to conserve natural vegetation and wildlife, Class 8 - Geography - Unit 1 betwen 90to100 words What is the value of x in the equation3x - y = 30, when y = 15? The 11 th one please! Somebody help me:( There are a few / a little tomatoes in the garden.RSITY2. There isn't any / some pasta on the table. 3. Would like some / much salad with your steak?4. I usually steam some / any rice to eat with grilled5. Have you got any / not much cooking oil?