Answer:
This is called a hypothesis, which can be identified by the if... then... format.
So, the correct option is B. Form a hypothesis.
Let me know if this helps!
Answer:
C
Explanation:
I need help with question 5
Answer:
B a spring being stretched
How many atoms of hydrogen are there in 36 g of NH4?
Answer:
hope it helps you
Explanation:
please like and mark me brainlist
QUICK CHECK
Use the periodic table to select which type of bond is present and which of the listed properties is most
likely for each substance.
Substance
Type of bond
Likely property
A А
B
A
Cuzm
Ba
lonic
DO
covalent
02
С
D
metallic
Answer:
Coppell zinc,ironic bond
Explanation:
lt will give away two zinc atoms
Answer:
I will go with Sodium chlorine NaCl
what is the organic molecule
Answer:
kinetic energy is the molecules
Explanation:
A molecule of the kind normally found in living systems. Organic molecules are usually composed of carbon atoms in rings or long chains, to which are attached other atoms of such elements as hydrogen, oxygen, and nitrogen.
What must scientists look for in their experiment or their data to make sure it is accurate?
Answer:
Scientists must look in their experiment/data to check for accuracy because they don't want to make any mistakes, and most importantly have to make sure they have the right information to proceed.
Explanation:
^
Combustion reactions typically involve all of the following except
a. The consumption of oxygen gas
b. The production of a Hydrocarbon
c. The production of water
d. The release of carbon dioxide
Answer:
b. The production of a HydrocarbonExplanation:
In Combustion reaction usually occurs when a hydrocarbon reacts with oxygen to produce carbon dioxide and water.
PLEASE HELPP!!!
PLEASE HELP!!!
Write the sentences in your copybook and draw a line through one of the words in
bold to complete each of these sentences about alkali metals correctly.
Alkali metals generally become more / less dense going down the group.
The melting and boiling points of alkali metals increase / decrease down the group.
The softness of alkali metals increases / decreases going down the group.
The speed with which alkali metals react with oxygen increases / decreases going
down the group.
Answer:
vahshahhsjajaiaoakkakakaaosos
Plants in forests take up carbon dioxide from the atmosphere during photosynthesis. They transform the carbon dioxide into plant material. When plants die, their organic matter is often worked into the soil by decomposers. Some of this organic matter remains within the soil and forest floor, and some of it is taken up by other living things.
Based on this information, what role do forests play in the carbon cycle?
A.
Forests are carbon sinks because they store carbon.
B.
Forests are carbon sinks because they do not absorb carbon dioxide when plants die.
C.
Forests are carbon sources because they emit carbon.
D.
Forests are carbon sources because they can be burned to emit carbon dioxide.
Answer: B. forests are carbon sinks because they store carbon
Explanation:forests take up carbon from the atmosphere through photosynthesis and from organic matter through decomposition. so, forests are carbon sinks because they store carbon
A mixture of reactants and products for the reaction shown below is at equilibrium in a 5.0 L container what would most likely happen to the equilibrium if the volume of the container will reduced to 3.0 L?
Since the volume decreased, it means that the pressure is going to rise. Thus, the equilibrium of the reaction will shift in the direction that has the least amount of moles.
The statement, that describes the equilibrium "will change in the direction with the minimum moles."
What is an equilibrium?A condition of equilibrium has become one of balance. Chemical equilibrium is the state in which both the reactants and products are present in concentrations that have no further tendency to change with time, resulting in no observable change in the system's properties.
When volume decreases, the equilibrium shifts to favor the direction that produces fewer moles of gas. When the volume is raised, the equilibrium shifts in favor of the direction that produces the most moles of gas. Because the container's volume will be lowered from 5.0 L to 3.0 L, the pressure will rise. As a result, the equilibrium of the reaction will shift in the direction with the fewest moles. When the volume is reduced, the pressure rises. This demonstrates that a gas's pressure is inversely proportional to its volume.
Hence the correct answer is equilibrium will change in the direction with the minimum moles.
Learn more about equilibrium here
https://brainly.com/question/13463225
#SPJ2
If you hit the surface of Iron with a photon of energy and find that the ejected electron has a wavelength of .75 nm, what is the wavelength of the incoming photon in nanometers?
Answer:
The wavelength of the incoming photon is 172.8 nm
Explanation:
The wavelength of the incoming photon can be calculated with the photoelectric equation:
[tex] KE = h\frac{c}{\lambda_{p}} - \phi [/tex] (1)
Where:
KE: is the kinetic energy of the electron
h: is Planck's constant = 6.62x10⁻³⁴ J.s
c: is the speed of light = 3.00x10⁸ m/s
[tex]\lambda_{p}[/tex]: is the wavelength of the photon =?
Φ: is the work function of the surface (Iron) = 4.5 eV
The kinetic energy of the electron is given by:
[tex] KE = \frac{p^{2}}{2m} = \frac{(\frac{h}{\lambda_{e}})^{2}}{2m} [/tex] (2)
Where:
p: is the linear momentum = h/λ
m: is the electron's mass = 9.1x10⁻³¹ kg
[tex]\lambda_{e}[/tex]: is the wavelength of the electron = 0.75 nm = 0.75x10⁻⁹ m
Hence, the wavelength of the photon is:
[tex] \frac{(\frac{h}{\lambda_{e}})^{2}}{2m} = h\frac{c}{\lambda_{p}} - \phi [/tex]
[tex]\lambda_{p} = \frac{hc}{\frac{h^{2}}{2m\lambda_{e}^{2}} + \phi} = \frac{6.62 \cdot 10^{-34} J.s*3.00\cdot 10^{8} m/s}{\frac{(6.62 \cdot 10^{-34} J.s)^{2}}{2*9.1 \cdot 10^{-31} kg*(0.75 \cdot 10^{-9} m)^{2}} + 4.5 eV*\frac{1.602 \cdot 10^{-19} J}{1 eV}} = 1.728 \cdot 10^{-7} m = 172.8 nm[/tex]
Therefore, the wavelength of the incoming photon is 172.8 nm.
I hope it helps you!
2.0 kilograms of lithium hydroxide can “scrub”, or remove, how many liters of carbon dioxide at standard conditions?
Answer:
0.94 L
Explanation:
The equation of the reaction is;
2LiOH + CO2 -----> Li2CO3 + H2O
Number of moles LiOH = 2.0/23.95 g/mol = 0.084 moles
2 moles of LiOH scrubs 22.4 L of CO2
0.084 moles of LiOH scrubs 0.084 moles × 22.4/2
= 0.94 L
The carbon atom forms a part of all the major molecules found in living things. Which of the following doesnot contain carbon?
Hydrochloric acid or Hcl
A pupil has drawn the electronic structure of fluorine and the diagram is shown below. However,
mistakes have been made. State three mistakes that have been made.
Fl atomic number: 9
Fl atomic mass: 10
(ps i have two of these but can’t figure out the last)
Answer:
The number of electrons in the orbit is wrong they have to be 9 and not 10since flourine is in group 7 the number of electrons in the outer most shell has to be 7 and not 2the first shell has 8 instead of 2 electronsI hope this helps
When it’s summer in the northern hemisphere what Season is it in the Southern Hemisphere
Answer:
Winter
Explanation:
I dont know but whatev
Answer:
Winter
Explanation:
The seasonal cycle in the polar and temperate zones of one hemisphere is opposite to that of the other. Therefore, When it is summer in the Northern Hemisphere, it is winter in the Southern, and vice versa.
hope it helps :)
Calculate the molar mass of the following compound: Ca3P2
Answer:
The molar mass of the compound given is 182.182 g/mol.
Explanation:
To calculate the molar mass of the compound, we must multiply the number of moles of each element by the the individual molar mass of each element and add them together.
Let's start with Calcium. The molar mass of Calcium is 40.078. In this compound, we have three moles of Calcium, so we should multiply this number by 3.
40.078 g/mol * 3 mol = 120.234 g
Now, let's do the same for Phosphorus.
30.974 g/mol * 2 g/mol = 61.948 g
To find the molar mass of the entire compound, we should add these two values together.
120.234 g + 61.948 g = 182.182 g
Therefore, the correct answer is 182.182 g/mol.
Hope this helps!
what is the charge on ion X Li2X
In the compound Li2X, there are two lithium ions and one X^2- ion.
Ionic compounds are composed of an ion pair of opposite charge. Usually, the positive ion is a metal cation while the negative ion is a non metal anion. The two ions are held together by strong electrostatic interaction.
In the compound Li2X, there are two lithium ions and one X^2- ions. X^2 -is the non metal anion present.
Learn more: https://brainly.com/question/2673886
How much heat must be transferred to 55 g of ice to change the ice's
temperature from -13°C to -5.0°C? (The specific heat capacity of ice is 2.11
J/g.°C)
Please help me
will give the brainliest!
Explanation:
a) The presence of sulfate ions in a solution can be confirmed by the reaction of barium chloride in an acidic medium.
The balanced chemical equation of the reaction is shown below:
[tex]BaCl_2(aq)+CuSO_4(aq)->CuCl_2(aq)+BaSO_4(s)[/tex]
Hence, the white precipitate is barium sulfate and its formation with the ionic equation is shown below:
[tex]Ba^2^+(aq)+SO_4^2^-(aq)->BaSO_4(aq)[/tex]
b) The presence of copper (II) ions can be confirmed by the following test:
Add potassium iodide solution to copper (II) solution.
Then a white ppt of cuprous iodide along with the liberation of iodine is observed and the entire solution attains brown color.
The chemical equation of the reaction is shown below:
[tex]2CuSO_4(aq)+4KI(aq)->Cu_2I_2(s)+I_2(s)+2K_2SO_4(aq)\\[/tex]
c)(i)Due to this reaction, the blue color of the solution becomes white.
Reddish-brown copper is deposited at the bottom of the container.
(ii)In this reaction, zinc is oxidized.
d) (i) Copper is produced at the cathode.
(ii)[tex]Cu^2^+(aq)+2e^-->Cu(s)[/tex]
(iii) The reaction that takes place at the cathode is reduction.
Reduction is gaining of electrons.
If 3.5 kJ of energy are added to a 28.2 g sample of iron at 20 degrees C, what is the final temperature of the iron in kelvins?
295.8k
that is the procedure above
The volume of a gas at 6.0 atm is 2.5 L. What is the volume of the gas at 75 atm at
the same temperature? (5 points)
1) 1.0 L
0 2 2) 1.5 L
3) 2.0 L
O 4) 3.0L
The volume of a gas at 6.0 atm is 2.5 L. What is the volume of the gas at 7.5 atm at
the same temperature? (5 points)
1) 1.0 L
2) 1.5 L
3) 2.0 L
4) 3.0L
Answer:
2.0 L
Option C) 2.0L is the correct answer.
Hence, at the same temperature, as the pressure is increased to the given value, the volume of the gas decreases to 2.0L.
Boyle's law
Boyle's law states that "the volume V of a given quantity of gas is inversely proportional to its pressure P as long as temperature remains constant.
Boyle's law is expressed as;
P₁V₁ = P₂V₂
Given the data in the question;
Initial Volume V₁ = 2.5LInitial pressure P₁ = 6.0atmFinal pressure P₂ = 7.5atmFinal volume V₂ = ?To determine the final volume of the gas, we substitute our given values into the expression above.
P₁V₁ = P₂V₂
V₂ = P₁V₁ / P₂
V₂ = ( 6.0atm × 2.5L ) / 7.5atm
V₂ = 15Latm / 7.5atm
V₂ = 2.0L
Option C) 2.0L is the correct answer.
Hence, at the same temperature, as the pressure is increased to the given value, the volume of the gas decreases to 2.0L.
Learn more about Boyle's law here: brainly.com/question/1437490
HELLO EVERYONE PLEASE I NEED HELP WITH
Please I REALLY NEED A HELP WITH THIS PLEASE HELP ME
THIS HARRY POTTER LITERARY ESSAY
OUTLINE
1. Love and Friendship is a central theme in Harry Potter and the Philosopher's Stone. Prove that this statement is true using 2(two) different characters from the novel as examples.
Introductory Statement/ Hook:
Statement of Intent: reason A and B :
thesis reason A and B:
BODY PARAGRAPH
#1 Point #1: Introduce REASON A here, but use general statement
#1: Provide quotations from the novel to support Reason A
Explanation #1:
Proof #2:
Explanation #2:
BODY PARAGRAPH
#2 Point #2: Introduce REASON B here, but use general statements
#1: Provide quotations from the novel to support ReasonB
Explanation #1:
Proof #2:
Explanation #2:
CONCLUSION
Restate/ Summarize Thesis:
Restate/ Summarize Points:
Answer:
Ron and Hermoine
Explanation:
They always fought over petty things, but at the end, they did end up together!
(Answer for your question about love and friendship being a central theme in Harry Potter and the Philosopher's stone)
*ALSO, MY ANSWER MIGHT BE WRONG* so be sure to use a pencil just in case!
hii pls help me!!
even if u know how to do one, it's okk
anything helps
Explanation:
a) HNO2(aq) = HNO3(aq) + H2O(l) +NO(g)
b) SoCl2 (l) + H2O (l) = So2(g) + 2HCl(aq)
c) CH4 (g) + 2O2(g) = Co2 (g) + 2H2O(g)
d) 3CuO(s) + 2NH3 (g) = 3Cu(s) + 3H2O (l) + N2(g)
what is a measureing tape used for
Answer:
It is used to measure size or distance.
Answer:
it is used to measure long heights and distances and lengths,it is yellow and goes round
Explanation:
if excess nitrogen gas reacts with 600 cm³ of hydrogen gas at room conditions , calculate the maximum volume of ammonia produced from the reaction? the chemical question is N2 + 3H2 = 2NH3
Answer:
400 cm³ of ammonia, NH₃.
Explanation:
The balanced equation for the reaction is given below:
N₂ + 3H₂ —> 2NH₃
From the balanced equation above,
3 cm³ of H₂ reacted to produce 2 cm³ of NH₃.
Finally, we shall determine the maximum volume of ammonia, NH₃ produced from the reaction. This can be obtained as illustrated below:
From the balanced equation above,
3 cm³ of H₂ reacted to produce 2 cm³ of NH₃.
Therefore, 600 cm³ of H₂ will react to produce = (600 × 2)/3 = 400 cm³ of NH₃.
Thus, 400 cm³ of ammonia, NH₃ were obtained from the reaction.
How many moles of KOH are there in 27.5 mL of 0.250 M KOH?
Question 2 options:
4.31 × 10−3 mol KOH
6.88 × 10−3 mol KOH
7.24 × 10−3 mol KOH
8.13 × 10−3 mol KOH
9.21 × 10−3 mol KOH
Answer:
6.88 × 10^-3mol
Explanation:
Molarity = number of moles (n) ÷ volume (V)
According to this question, there in 27.5 mL of 0.250 M KOH, the number of moles of KOH can, therefore, be calculated as follows:
number of moles = molarity × volume
Volume of KOH = 27.5mL = 27.5/1000
= 0.0275L
n = 0.0275 × 0.250
n = 0.006875 mol
n = 6.88 × 10^-3mol
What is nascent hydrogen?
Answer:
[H]
Explanation:
This is nascent hydrogen it's a reactive form of hydrogen...
It reduces elements and compounds.
Which is another word for 10 meters in the metric system?
Answer:
Dekameter
Explanation:
plz solve the question and send the answer
I will give u branist, follow u ,rate u 5 star and also give u like ,plz help me
Answer:
64g of [tex]\bold{CH_{3}OH}\dashrightarrow[/tex]44.8L
vapour density of [tex]CH_{3}3OH=\frac{mass}{volume}[/tex] of [tex]\bold{CH_{3}OH}[/tex]
=64/44.8=10/7=1.43 g/l
Vapour density of [tex]\bold{CH_{3}OH}[/tex]=1.43g/l
64g of [tex]\bold{CH_{3}OH => 44.8L }[/tex]
vapour density of [tex]\small{\sf{CH_{3}3OH=\frac{mass}{volume} of } \bold{CH_{3}OH}}[/tex]
=64/44.8=10/7=1.43 g/l
Vapour density of [tex]\bold{CH_{3}OH = 1.43 g/L}[/tex]
Draw the following structures and name them :
I. CH3CH2(OH)
II.CH3CH2CH(CH3)C(Cl)2C(l)2CH(F)OH
III.CH3CH(CH3)CHO
IV.CH2=CH(OH)
V.CH3OCH2CH3
Answer:
hope this helps.answer is in the picture
Element X and Y are two different elements that are placed in the same group in the Periodic Table of Elements. Which of the following statements is correct about their atoms?
A Atoms of element X and Y have same number of electrons
B Atoms of element X and Y have different number of protons
C Number of neutrons for atom X and Y changes during formation of an ion
D Nucleon number for atom X and Y is the total number of protons and electrons
Answer:
A Atoms of element X and Y have same number of electrons
