Typhoon signals rise due to what? wind speed or wind strength or both?​

Answer:

0.74 M

Explanation:

From the question given above, the following data were obtained:

Molarity of stock solution (M₁) = 5.90 M

Volume of stock solution (V₁) = 0.250 L

Volume of diluted solution (V₂) = 2 L

Molarity of diluted solution (M₂) =?

The molarity of the diluted solution can be obtained by using the dilution formula as illustrated below:

M₁V₁ = M₂V₂

5.90 × 0.250 = M₂ × 2

1.475 = M₂ × 2

Divide both side by 2

M₂ = 1.475 / 2

M₂ = 0.74 M

Thus, the molarity of the diluted solution is 0.74 M

Answer:

Indicate how the concentration of each species in the chemical equation will change to reestablish equilibrium after reactant or product is added.

[tex]2CO(g) + O2(g) <=> 2CO2[/tex]

Explanation:

When the reactants concentration increases, then the equilibrium will shift towards products and when the concentration of products increases, then equilibrium will shift towards reactants.

So, increases in concentration of carbon monoxide (CO) shifts the equilibrium to favor the formation of carbondioxide.

Similarly increase in concentration of oxygen also favor the formation of product carbon dioxide.

Increase in concentration of CO2 favors the formation of CO and O2.

Decrease in product concentration also favors the formation of product.

Decrease in reactant concentration favors the formation of reactants only.

Answer:

b. a H+ ion

Explanation:

The concept of conjugate acid-base pair is related to Bronsted-Lowry acid-base theory and according to this theory, acid is a proton acceptor.

In short,

conjugate base is formed when an acid donates a proton.

conjugate acid is formed when a base accepts a proton.

Answer:

1, 1, 2, 3

Explanation:

The numbers 1 and 8 both have 1 sig. fig.

The number 13 has 2 sig. figs.

The number 104 has 3 sig. figs.

Answer:

9.36 g

Explanation:

The equation of the reaction is;

C8H18(g) + 25/2 O2(g) ----> 8CO2(g) + 9H2O(g)

Number of moles of octane = 10.3g/ 114 g/mol = 0.09 moles

1 mole of octane yields 9 moles of water

0.09 moles of octane yields 0.09 × 9/1 = 0.81 moles of water

Number of moles of oxygen = 23g/32g/mol = 0.72 moles

12.5 moles of oxygen yields 9 moles of water

0.72 moles of oxygen yields 0.72 × 9/12.5 = 0.52 moles of water

Hence oxygen is the limiting reactant;

Maximum mass of water produced = 0.52 moles of water × 18 g/mol = 9.36 g

Answer:

The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.

The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.

Answer:

88.9%

Explanation:

Primero convertimos 5.97 g de glucosa a moles, usando su masa molar:

Después calculamos la cantidad máxima de moles de CO₂ que se hubieran podido producir:

Ahora calculamos los moles de CO₂ producidos, usando los datos de recolección dados y la ecuación PV=nRT:

Finalmente calculamos el rendimiento porcentual:

Answer:

e. HCOOH and NaCHOO

Explanation:

For a buffer solution, both an acid and its conjugate base are required.

With the information above in mind, we can discard options a) and c), as those combinations are not of an acid and its conjugate base.

Now it is a matter of comparing the pKa (found in literature tables) of the acids of the remaining three acids:

The acid with the pKa closest to the desired pH is HCOOH, so the correct answer is e. HCOOH and NaCHOO

Answer:

All of the above.

Explanation:

For a scientific hypothesis to be considered a hypothesis, it has to be testable. When conducting a lab experiment, it also allows the tester to predict what might occur during and after the experimentation. They are also explanatory. For example, theories are hypotheses that have been verified and can explain why something in nature takes place.

Answer:

True.

Explanation:

The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.

ummm is that chemistry?

Answer:

is this chem

Explanation:

Answer:

the product and the reactant must be balanced

if u are required to give the mechanism if the reaction it must be written

Answer:2C4H10+2C12+12O2 4CO2+CC14+H20

Answer:

fgufyifyifyiyduhyufyiddjyfjyf86yif

Answer:

At higher temperatures, particles move faster and collide more, increasing solubility rates.

Agitation increases solubility rates as well, by bringing fresh solvent into contact with the undissolved solute

The smaller the particle size, the higher (faster) solubility rate. Vice versa, the bigger the particle size, the lower (slower) solubility rate.

Explanation:

Explanation:

Esterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.

Answer:

The Esterification ProcessEsterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.

The Esterification ProcessEsterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.Once the -OH has been removed, the hydrogen on the alcohol can be removed and that oxygen can be connected to the carbon. Because the oxygen was already connected to a carbon, it is now connected to a carbon on both sides, and an ester is formed.

The Esterification ProcessEsterification occurs when a carboxylic acid reacts with an alcohol. This reaction can only occur in the presence of an acid catalyst and heat. It takes a lot of energy to remove the -OH from the carboxylic acid, so a catalyst and heat are needed to produce the necessary energy.Once the -OH has been removed, the hydrogen on the alcohol can be removed and that oxygen can be connected to the carbon. Because the oxygen was already connected to a carbon, it is now connected to a carbon on both sides, and an ester is formed.The methyl acetate that was formed is an ester. In this image, the green circle represents what was the carboxylic acid (in this case acetic acid), and the red circle represents what was the alcohol (in this case methanol):

This reaction lost an -OH from the carboxylic acid and a hydrogen from the alcohol. These two also combine to form water. So any esterification reaction will also form water as a side product.

Answer:

Explanation:

/ means divided by

* means multiply

1. formula is

partial pressure = no of moles(gas 1)/ no of moles(total)

0.30 mol CO/0.60 mol CO2 + 0.30 mol CO + 0.10 mol H20 ->

.3/(.6+.3+.1) =

.3/1 =

.3 =

partial pressure of CO

2.

.3 * .8 atm = .24

khanacademy

quizlet

The partial pressure of the CO is 0.24 atm if the total pressure of the mixture was 0.80 atm.

Dalton's Law of partial pressure states that the total pressure exerted by non reacting gaseous mixture at a constant temperature and given volume is equal to the sum of partial pressure of all gases.

Dalton's Law of partial pressure using mole fraction of gas

Partial pressure of carbon monoxide (CO) = Mole fraction of carbon monoxide (CO) × Total pressure

Now, we have to find the first mole fraction of CO

Mole fraction of carbon monoxide (CO) = [tex]\frac{\text{moles of solute}}{\text{total moles of solute}}[/tex]

                                                                  = [tex]\frac{\text{moles of CO}}{\text{moles of CO}_2 + \text{moles of CO} + \text{moles of H}_{2}O}[/tex]

                                                                  = [tex]\frac{0.30}{0.60 + 0.30 + 0.10}[/tex]

                                                                  = [tex]\frac{0.30}{1}[/tex]

                                                                  = 0.3

Now, put the value in above equation, we get that

Partial pressure of carbon monoxide (CO)

= Mole fraction of carbon monoxide (CO) × Total pressure

= 0.3 × 0.8

= 0.24 atm

Thus, the partial pressure of the CO is 0.24 atm is the total pressure of the mixture was 0.80 atm.

Learn more about the Dalton's Law of partial Pressure here: https://brainly.com/question/14119417

#SPJ2

Answer:

2.07459

Explanation:

this is the correct answer.

Answer:

1.Precipitation

2.Transpiration

3.Condensation

4.Evaporation

5.Evaporation

3.Condensation

Explanation:

Rain pours from the sky occurs due to the process of precipitation, leaves of the plant dried due to the process of transpiration in which the water is evaporated from the body of plant, fluffy clouds form in the sky occurs in the process of condensation, bathing suit dries after swim is due to evaporation in which water is removed and goes into the atmosphere and water puddles disappear due to the process of evaporation. Evaporation is the removal of water from the any surface whereas transpiration is the removal of water from plant body parts.

Answer:

#6  8.67x10²⁴ atoms

#7  

1. Atom

2. Formula unit

3. Molecule

4. Ion

Explanation:

#6 First we calculate how many carbon moles are there in 7.00 moles of C₂F₂, keeping in mind that there are 2 C moles per C₂F₂ mol:

As for carbon dioxide, there are 0.400 C moles in 0.400 moles of CO₂.

We calculate the total number of C moles:

Finally we calculate the number of atoms in 14.4 C moles, using Avogadro's number:

#7

Answer:

True

Explanation:

The valence orbitals of boron are 2s2 2p1. We have to recall that all the valence orbitals whether full or empty are involved in the formation of molecular orbitals.

The number of molecular orbitals formed is equal to the number of atomic orbitals that are combined.

Since there are two valence orbitals and there is only one p orbital among the valence orbitals, it is true that only one p orbital is needed to form molecular orbitals in boron.

Answer:

To transfer leftover solids to the filtration funnel and wash out crystals after recrystallization, ice cold methanol should be used (the mother liquor used for recrystallization).

Explanation:

Hope this helped

Answer:

Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol

Explanation:

According to IUPAC rules, the name of a compound is:

Prefix+root word+suffix

1) Select the longest carbon chain and it gives the root word.

2) The substituents give the prefix.

3) The functional group gives the secondary suffix and the type of carbon chain gives the primary suffix.

The structure of the given compounds are shown below:

molarity = moles of solute / volume of solution

moles of solute = molarity × volume of solution

moles of solute = 0.245 mol/L × 0.1500 L

moles of solute = 0.03675 mol

moles of solute = 0.0368 mol

-----------------------------------------------------------

Step 1: Calculate the molar mass of solute.

molar mass of solute = (40.08 g/mol × 1) + (35.45 g/mol × 2)

molar mass of solute = 110.98 g/mol

Step 2: Calculate the mass of solute.

mass of solute = moles of solute × molar mass of solute

mass of solute = 0.03675 mol × 110.98 g/mol

mass of solute = 4.08 g

Note: The volume of solution must be expressed in liters (L).

Answer:

[tex]\boxed {\sf \bold {0.0368 \ mol \ CaCl_2}}}}[/tex]

[tex]\boxed {\sf \bold {4.08 \ g \ CaCl_2}}}}}[/tex]

Explanation:

Molarity is a measure of concentration in moles per liter.

[tex]molarity= \frac {moles \ of \ solute}{liters \ of \ solution}[/tex]

In this solution, there are 150.0 milliliters of solution and the molarity is 0.245 M CaCl₂ or 0.245 mol CaCl₂ per liter.

First, convert the milliliters to liters. There are 1000 milliliters in 1 liter.

Now, substitute the known values (molarity and liters of solution) into the formula. The moles of solution are unknown, so we can use x.

[tex]0.245 \ mol \ CaCl_2 /L= \frac{ x}{0.150 \ L}[/tex]

We are solving for x, so we must isolate this variable. It is being divided by 0.150 L. The inverse of divisions is multiplication, so we multiply both sides by 0.150 L.

[tex]0.150 \ L *0.245 \ mol \ CaCl_2 /L= \frac{ x}{0.150 \ L} * 0.150 L[/tex]

[tex]0.150 \ L *0.245 \ mol \ CaCl_2 /L=x[/tex]

The units of liters cancel.

[tex]0.150 *0.245 \ mol \ CaCl_2 =x[/tex]

[tex]0.03675 \ mol \ CaCl_2[/tex]

The original measurements have 3 significant figures, so our answer must have the same.

We should round to the ten thousandths place. The 5 to the right of this place tells us to round the 7 up to an 8.

[tex]\bold {0.0368 \ mol \ CaCl_2}[/tex]

We can convert mass to moles using the molar mass. These values are found on the Periodic Table. They are the same as the atomic masses, but the units are grams per mole (g/mol) instead of atomic mass units.

The solute is calcium chloride: CaCl₂. Look up the molar masses of the individual elements.

Notice that chlorine has a subscript of 2. We must multiply the molar mass by 2.

Add calcium's molar mass.

Use the molar mass as a ratio.

[tex]\frac {110.98 \ g\ CaCL_2}{ 1 \ mol \ CaCl_2}[/tex]

Multiply the moles of calcium chloride we calculated above.

[tex]0.0368 \ mol \ CaCl_2 *\frac {110.98 \ g\ CaCL_2}{ 1 \ mol \ CaCl_2}[/tex]

The units of moles of calcium chloride cancel.

[tex]0.0368 *\frac {110.98 \ g\ CaCL_2}{ 1 }[/tex]

[tex]4.084064 \ g\ CaCl_2[/tex]

Round to 3 significant figures again. For this number, it is the hundredths place. The 4 in the thousandths place tells us to leave the 8.

[tex]\bold {4.08 \ g \ CaCl_2}[/tex]

Answer:

molar heat of combustion = -5156 *10³ kJ/mol

Explanation:

A quantity of 1.435 g of naphthalene , was burned in a constant-volume bomb calorimeter. Consequently, the temperature of the water rose from 20.28oC to 25.95oC If the heat capacity of the bomb plus water was 10.17 kJ/°C, calculate the heat of combustion of naphthalene on a molar basis; that is, find the molar heat of combustion.

Step 1: Data given

Mass of naphthalene = 1.435 grams

Initial temperature of water = 20.28 °C

Final temperature of water = 25.95 °C

heat capacity of the bomb plus water was 10.17 kJ/°C

Molar mass naphtalene = 128.2 g/mol

Step 2:

Qcal = Ccal * ΔT

⇒with Qcal =the heat of combustion

⇒with Ccal = heat capacity of the bomb plus water = 10.17 kJ/°C

⇒with ΔT = the difference in temperature = T2 - T1 = 25.95 - 20.28 = 5.67°C

Qcal = 10.17 kJ/°C * 5.67 °C

Qcal = 57.7 kJ

Step 3: Calculate moles

Moles naphthalene = 1.435 grams / 128.2 g/mol

Moles naphthalene = 0.01119 moles

Step 4: Calculate the molar heat of combustion

molar heat of combustion = Qcal/ moles

molar heat of combustion = -57.7 kJ/ 0.01119 moles

molar heat of combustion = -5156 *10³ kJ/mol

Answer:

1.88 A

Explanation:

Let's consider the reduction of copper in an electrolytic cell.

Cu²⁺ + 2 e⁻ ⇒ Cu

We can calculate the charge used to deposit 12.3 g of Cu using the following relations.

The charge used is:

[tex]12.3 g \times \frac{1 molCu}{63.55gCu} \times \frac{2molElectron}{1molCu} \times \frac{96486C}{1molElectron} = 3.73 \times 10^{4} C[/tex]

We can convert 5.50 h to seconds using the conversion factor 1 h = 3600 s.

5.50 h × 3600 s/1 h = 1.98 × 10⁴ s

The current used is:

I = q/t = 3.73 × 10⁴ C/1.98 × 10⁴ s = 1.88 A

Answer:

Protein biochemistry is the study of proteins. Protein biochemistry is a scientific field dedicated to the study of proteins, complex chains of amino acids which make up the building blocks of all living organisms.

Explanation:

I hope that helped

Copy and Pasted!

Answer:

Listen to what guy said on top.

Explanation:

polypeptide structures consisting of one or more long chains of amino acids residue.....

or my answer

Answer:

Melting-point apparatus