The ionization constant of an acid is denoted by the symbol Kₐ. The smaller the value of Kₐ for an acid, the weaker will be the acid. Thus the correct option is D.
What is acid dissociation constant?The acid dissociation constant denotes the measure of the extent to which an acid dissociates in the solution. The strength of an acid is represented by the value Kₐ. The less an acid dissociates, smaller will be the value of Kₐ, the stronger the acid, higher will be the value of Kₐ.
The dissociation of HNO₂ is given as:
HNO₂ (aq) ⇄ H⁺ (aq) + NO₂⁻ (aq)
The dissociation constant of HNO₂ is given as:
Kₐ = [H⁺][NO₂⁻] / HNO₂
The value of Kₐ is constant at a particular temperature. We can use this fact to find out the pH of a weak acid at a particular temperature.
Thus the correct option is D.
To know more about acid dissociation constant, visit;
https://brainly.com/question/14498573
#SPJ7
How many atoms of hydrogen are there in 36 g of NH4?
Answer:
hope it helps you
Explanation:
please like and mark me brainlist
Plz Help I have One more time To retake and I can't fail it..
Answer:
D
Explanation:
A synthesis reaction is a reaction in which two or more reactants combine to form a given product.
If we look closely at option D, you will notice that sulphur and oxygen combined together to form sulphur dioxide. That is a typical example of chemical synthesis.
Hence;
S + O2 ----->SO2 is a synthesis reaction.
Combustion reactions typically involve all of the following except
a. The consumption of oxygen gas
b. The production of a Hydrocarbon
c. The production of water
d. The release of carbon dioxide
Answer:
b. The production of a HydrocarbonExplanation:
In Combustion reaction usually occurs when a hydrocarbon reacts with oxygen to produce carbon dioxide and water.
What is nascent hydrogen?
Answer:
[H]
Explanation:
This is nascent hydrogen it's a reactive form of hydrogen...
It reduces elements and compounds.
PLEASE HELPP!!!
PLEASE HELP!!!
Write the sentences in your copybook and draw a line through one of the words in
bold to complete each of these sentences about alkali metals correctly.
Alkali metals generally become more / less dense going down the group.
The melting and boiling points of alkali metals increase / decrease down the group.
The softness of alkali metals increases / decreases going down the group.
The speed with which alkali metals react with oxygen increases / decreases going
down the group.
Answer:
vahshahhsjajaiaoakkakakaaosos
what is the charge on ion X Li2X
In the compound Li2X, there are two lithium ions and one X^2- ion.
Ionic compounds are composed of an ion pair of opposite charge. Usually, the positive ion is a metal cation while the negative ion is a non metal anion. The two ions are held together by strong electrostatic interaction.
In the compound Li2X, there are two lithium ions and one X^2- ions. X^2 -is the non metal anion present.
Learn more: https://brainly.com/question/2673886
I need help with question 5
Answer:
B a spring being stretched
The carbon atom forms a part of all the major molecules found in living things. Which of the following doesnot contain carbon?
Hydrochloric acid or Hcl
hii pls help me!!
even if u know how to do one, it's okk
anything helps
Explanation:
a) HNO2(aq) = HNO3(aq) + H2O(l) +NO(g)
b) SoCl2 (l) + H2O (l) = So2(g) + 2HCl(aq)
c) CH4 (g) + 2O2(g) = Co2 (g) + 2H2O(g)
d) 3CuO(s) + 2NH3 (g) = 3Cu(s) + 3H2O (l) + N2(g)
Which statement includes all the steps in the change that is associated with the enthalpy of solution? solute separation and mixing reaction of reactants to form products. solute and solvent mixing and then separating solute separation, solvent separation, and then mixing
Answer: solute separation, solvent separation, and then mixing
Explanation:
The enthalpy change of solution simply means the amount of heat which can be released or absorbed when dissolving. The enthalpy of solution is usually expressed at constant temperature in kJ/mol.
The enthalpy of solution requires three main stages:
1. Solute separation: This is when the solute is broken down. In this case, all the intramolecular forces which holds the solute together is broken.
2. Solvent separation: This is when the solvent is broken down all the intramolecular forces which holds the solvent together is broken.
3. Mixing- In this case, the solute and the solvent is mixed for a solution.
Plants in forests take up carbon dioxide from the atmosphere during photosynthesis. They transform the carbon dioxide into plant material. When plants die, their organic matter is often worked into the soil by decomposers. Some of this organic matter remains within the soil and forest floor, and some of it is taken up by other living things.
Based on this information, what role do forests play in the carbon cycle?
A.
Forests are carbon sinks because they store carbon.
B.
Forests are carbon sinks because they do not absorb carbon dioxide when plants die.
C.
Forests are carbon sources because they emit carbon.
D.
Forests are carbon sources because they can be burned to emit carbon dioxide.
Answer: B. forests are carbon sinks because they store carbon
Explanation:forests take up carbon from the atmosphere through photosynthesis and from organic matter through decomposition. so, forests are carbon sinks because they store carbon
How many moles of KOH are there in 27.5 mL of 0.250 M KOH?
Question 2 options:
4.31 × 10−3 mol KOH
6.88 × 10−3 mol KOH
7.24 × 10−3 mol KOH
8.13 × 10−3 mol KOH
9.21 × 10−3 mol KOH
Answer:
6.88 × 10^-3mol
Explanation:
Molarity = number of moles (n) ÷ volume (V)
According to this question, there in 27.5 mL of 0.250 M KOH, the number of moles of KOH can, therefore, be calculated as follows:
number of moles = molarity × volume
Volume of KOH = 27.5mL = 27.5/1000
= 0.0275L
n = 0.0275 × 0.250
n = 0.006875 mol
n = 6.88 × 10^-3mol
b) The size of a star is a balance between
2 things. Explain this statement.
Answer:
Luminosity is the amount of light that a star radiates. The size of the star and its surface temperature determine its luminosity. Apparent magnitude of a star is its perceived brightness, factoring in size and distance, while absolute magnitude is its true brightness irrespective of its distance from earth
Explanation:
Please help me
will give the brainliest!
Explanation:
a) The presence of sulfate ions in a solution can be confirmed by the reaction of barium chloride in an acidic medium.
The balanced chemical equation of the reaction is shown below:
[tex]BaCl_2(aq)+CuSO_4(aq)->CuCl_2(aq)+BaSO_4(s)[/tex]
Hence, the white precipitate is barium sulfate and its formation with the ionic equation is shown below:
[tex]Ba^2^+(aq)+SO_4^2^-(aq)->BaSO_4(aq)[/tex]
b) The presence of copper (II) ions can be confirmed by the following test:
Add potassium iodide solution to copper (II) solution.
Then a white ppt of cuprous iodide along with the liberation of iodine is observed and the entire solution attains brown color.
The chemical equation of the reaction is shown below:
[tex]2CuSO_4(aq)+4KI(aq)->Cu_2I_2(s)+I_2(s)+2K_2SO_4(aq)\\[/tex]
c)(i)Due to this reaction, the blue color of the solution becomes white.
Reddish-brown copper is deposited at the bottom of the container.
(ii)In this reaction, zinc is oxidized.
d) (i) Copper is produced at the cathode.
(ii)[tex]Cu^2^+(aq)+2e^-->Cu(s)[/tex]
(iii) The reaction that takes place at the cathode is reduction.
Reduction is gaining of electrons.
How does the position of an object relate to the energy stored in a object?
Answer:
An object can store energy as the result of its position. For example, the heavy ball of a demolition machine is storing energy when it is held at an elevated position. This stored energy of position is referred to as potential energy. Similarly, a drawn bow is able to store energy as the result of its position
Answer:
you can see the attached file is scanned the same level of detail of the heart the heart and I am a little bit of an emergency you can see it on the heart the tree is the best of luck for tomorrow be in a few days and times are available in a while back and forth to be a good idea and latitude longitude of
plz solve the question and send the answer
I will give u branist, follow u ,rate u 5 star and also give u like ,plz help me
Answer:
64g of [tex]\bold{CH_{3}OH}\dashrightarrow[/tex]44.8L
vapour density of [tex]CH_{3}3OH=\frac{mass}{volume}[/tex] of [tex]\bold{CH_{3}OH}[/tex]
=64/44.8=10/7=1.43 g/l
Vapour density of [tex]\bold{CH_{3}OH}[/tex]=1.43g/l
64g of [tex]\bold{CH_{3}OH => 44.8L }[/tex]
vapour density of [tex]\small{\sf{CH_{3}3OH=\frac{mass}{volume} of } \bold{CH_{3}OH}}[/tex]
=64/44.8=10/7=1.43 g/l
Vapour density of [tex]\bold{CH_{3}OH = 1.43 g/L}[/tex]
How many moles are in 32g of O2?
Answer:
1 mol of O2
Explanation:
n = m/ M
n = 32/ ( 2× 15.999)
n= 1 mol of O2
what is the difference between double salt and complex salt
Answer:
The main different of double salt and complex salt is that a double salt is a combination of two salt compounds whereas a complex salt is a molecular structure that is composed of one or more complex ions.
A pupil has drawn the electronic structure of fluorine and the diagram is shown below. However,
mistakes have been made. State three mistakes that have been made.
Fl atomic number: 9
Fl atomic mass: 10
(ps i have two of these but can’t figure out the last)
Answer:
The number of electrons in the orbit is wrong they have to be 9 and not 10since flourine is in group 7 the number of electrons in the outer most shell has to be 7 and not 2the first shell has 8 instead of 2 electronsI hope this helps
Why does nuclear fusion occur in stars but not on Earth?
A.
There are no elements on Earth that can undergo fusion.
B.
Too many free neutrons are present on Earth.
C.
Fusion reactions require a lot of heat and pressure.
D.
Elements capable of undergoing fusion can’t be enriched on Earth.
Answer:
C. Fusion reactions require a lot of heat and pressure
Explanation:
A Nuclear fusion doesn't occur naturally on Earth because it requires temperatures far higher than Earth temperatures. Nuclear fusion takes place only at extremely high temperatures. That's because a great deal of energy is needed to overcome the force of repulsion between the positively charged nuclei.
if excess nitrogen gas reacts with 600 cm³ of hydrogen gas at room conditions , calculate the maximum volume of ammonia produced from the reaction? the chemical question is N2 + 3H2 = 2NH3
Answer:
400 cm³ of ammonia, NH₃.
Explanation:
The balanced equation for the reaction is given below:
N₂ + 3H₂ —> 2NH₃
From the balanced equation above,
3 cm³ of H₂ reacted to produce 2 cm³ of NH₃.
Finally, we shall determine the maximum volume of ammonia, NH₃ produced from the reaction. This can be obtained as illustrated below:
From the balanced equation above,
3 cm³ of H₂ reacted to produce 2 cm³ of NH₃.
Therefore, 600 cm³ of H₂ will react to produce = (600 × 2)/3 = 400 cm³ of NH₃.
Thus, 400 cm³ of ammonia, NH₃ were obtained from the reaction.
HELLO EVERYONE PLEASE I NEED HELP WITH
Please I REALLY NEED A HELP WITH THIS PLEASE HELP ME
THIS HARRY POTTER LITERARY ESSAY
OUTLINE
1. Love and Friendship is a central theme in Harry Potter and the Philosopher's Stone. Prove that this statement is true using 2(two) different characters from the novel as examples.
Introductory Statement/ Hook:
Statement of Intent: reason A and B :
thesis reason A and B:
BODY PARAGRAPH
#1 Point #1: Introduce REASON A here, but use general statement
#1: Provide quotations from the novel to support Reason A
Explanation #1:
Proof #2:
Explanation #2:
BODY PARAGRAPH
#2 Point #2: Introduce REASON B here, but use general statements
#1: Provide quotations from the novel to support ReasonB
Explanation #1:
Proof #2:
Explanation #2:
CONCLUSION
Restate/ Summarize Thesis:
Restate/ Summarize Points:
Answer:
Ron and Hermoine
Explanation:
They always fought over petty things, but at the end, they did end up together!
(Answer for your question about love and friendship being a central theme in Harry Potter and the Philosopher's stone)
*ALSO, MY ANSWER MIGHT BE WRONG* so be sure to use a pencil just in case!
QUICK CHECK
Use the periodic table to select which type of bond is present and which of the listed properties is most
likely for each substance.
Substance
Type of bond
Likely property
A А
B
A
Cuzm
Ba
lonic
DO
covalent
02
С
D
metallic
Answer:
Coppell zinc,ironic bond
Explanation:
lt will give away two zinc atoms
Answer:
I will go with Sodium chlorine NaCl
Which is another word for 10 meters in the metric system?
Answer:
Dekameter
Explanation:
How much heat must be transferred to 55 g of ice to change the ice's
temperature from -13°C to -5.0°C? (The specific heat capacity of ice is 2.11
J/g.°C)
which particle is an atom with only 10 neutrons in its nucleus ?
Answer:
fluorine
Explanation:
Draw the following structures and name them :
I. CH3CH2(OH)
II.CH3CH2CH(CH3)C(Cl)2C(l)2CH(F)OH
III.CH3CH(CH3)CHO
IV.CH2=CH(OH)
V.CH3OCH2CH3
Answer:
hope this helps.answer is in the picture
If you hit the surface of Iron with a photon of energy and find that the ejected electron has a wavelength of .75 nm, what is the wavelength of the incoming photon in nanometers?
Answer:
The wavelength of the incoming photon is 172.8 nm
Explanation:
The wavelength of the incoming photon can be calculated with the photoelectric equation:
[tex] KE = h\frac{c}{\lambda_{p}} - \phi [/tex] (1)
Where:
KE: is the kinetic energy of the electron
h: is Planck's constant = 6.62x10⁻³⁴ J.s
c: is the speed of light = 3.00x10⁸ m/s
[tex]\lambda_{p}[/tex]: is the wavelength of the photon =?
Φ: is the work function of the surface (Iron) = 4.5 eV
The kinetic energy of the electron is given by:
[tex] KE = \frac{p^{2}}{2m} = \frac{(\frac{h}{\lambda_{e}})^{2}}{2m} [/tex] (2)
Where:
p: is the linear momentum = h/λ
m: is the electron's mass = 9.1x10⁻³¹ kg
[tex]\lambda_{e}[/tex]: is the wavelength of the electron = 0.75 nm = 0.75x10⁻⁹ m
Hence, the wavelength of the photon is:
[tex] \frac{(\frac{h}{\lambda_{e}})^{2}}{2m} = h\frac{c}{\lambda_{p}} - \phi [/tex]
[tex]\lambda_{p} = \frac{hc}{\frac{h^{2}}{2m\lambda_{e}^{2}} + \phi} = \frac{6.62 \cdot 10^{-34} J.s*3.00\cdot 10^{8} m/s}{\frac{(6.62 \cdot 10^{-34} J.s)^{2}}{2*9.1 \cdot 10^{-31} kg*(0.75 \cdot 10^{-9} m)^{2}} + 4.5 eV*\frac{1.602 \cdot 10^{-19} J}{1 eV}} = 1.728 \cdot 10^{-7} m = 172.8 nm[/tex]
Therefore, the wavelength of the incoming photon is 172.8 nm.
I hope it helps you!
Question 8 of 10
Which of the following is made of matter?
A. Light
B. Energy
C. The sun
D. Heat
Answer: i Choose the sun
because it has mass
Explanation: matter is anything that has mass and occupies space / Volume
and the sun has mass though it is not a solid one, and is made up of matter
HOPE THIS HELPSS!!!!
Analyse the temperature versus time graph of water, given below.
Which part of graph represent only liquid state and gaseous state and why?
Answer:
Phase C - Liquid State
Phase E - Gaseous State
Explanation:
Usually, in phases of water, we have the following;
When temperature is less than zero, it is said to be in its solid phase as ice.
When temperature is between 0 to 100, we can say it is in the liquid phase as water.
When temperature is above 100°C, It is said to be in the gaseous phase as vapour.
From the diagram;
Phase C is the only liquid state because it falls between temperature of 0°C and 100°
Also, only phase E is in the gaseous phase because the temperature is above 100°C.
