What is the molarity of sodium hydroxide if 20.0 mL of the solution is neutralized by each of the following 1.00M solutions?A. 28.0 mL of HClB. 17.4 mL of H3PO4

The pH of 0.335 M trimethylammonium chloride, (CH3)3NHCI is approximately 5.676.

What is pH?

To find the pH of the solution, we need to first determine if (CH3)3NHCI acts as an acid or base. Since (CH3)3NHCI is a salt composed of a weak base, trimethylamine, and a strong acid, hydrochloric acid (HCI), it will undergo hydrolysis in water.

The hydrolysis reaction is given by:

(CH3)3NH+ (aq) + H2O (l) ⇌ (CH3)3N (aq) + H3O+ (aq)

The Kb expression for the equilibrium reaction is:

Kb = [ (CH3)3N ] [ H3O+ ] / [ (CH3)3NH+ ]

Since (CH3)3NH+ and HCl dissociate completely in water, the initial concentration of (CH3)3NH+ is equal to the concentration of (CH3)3NHCI, which is 0.335 M.

Using the Kb value given, we can solve for the concentration of H3O+:

Kb = 6.3 x [tex]10^{-5}[/tex] = [ (CH3)3N ] [ H3O+ ] / 0.335

[ H3O+ ] = Kb x (CH3)3NH+ / (CH3)3N

[ H3O+ ] = 6.3 x [tex]10^{-5}[/tex] x 0.335 / 1

[ H3O+ ] = 2.1095 x [tex]10^{-6}[/tex] M

Finally, we can calculate the pH using the expression:

pH = -log [H3O+]

pH = -log (2.1095 x [tex]10^{-6}[/tex])

pH = 5.676

Therefore, the pH of the solution is approximately 5.676.

To know more about pH, visit:

https://brainly.com/question/15289741

#SPJ1

Complete question is: The pH of 0.335 M trimethylammonium chloride, (CH3)3NHCI is approximately 5.676.

Answer:

4897 J

Explanation:

The heat transferred to the surroundings, q_surr, can be calculated using the equation:

q_surr = -q_rxn = -CmΔT

where C is the specific heat capacity of the mixture (assumed to be the same as water, 4.184 J/g°C), m is the mass of the mixture (which we can calculate using the density, assuming that the volumes are additive), and ΔT is the change in temperature (in Celsius).

First, let's calculate the mass of the mixture:

density of water = 1.00 g/cm^3

volume of mixture = volume of acid + volume of base = 106 mL + 157 mL = 263 mL = 0.263 L

mass of mixture = density of water x volume of mixture = 1.00 g/cm^3 x 0.263 L = 263 g

Next, let's calculate the change in temperature:

ΔT = final temperature - initial temperature = 27.29°C - 22.94°C = 4.35°C

Now we can calculate the heat transferred to the surroundings:

q_surr = -CmΔT

q_surr = -(4.184 J/g°C) x (263 g) x (4.35°C)

q_surr = -4897 J

Note that the negative sign indicates that heat is lost by the system to the surroundings. Therefore, the heat transferred to the surroundings, q_surr, is 4897 J.

Answer:

See below.

Explanation:

The atomic number of lead (Pb) is 82, which means it has 82 electrons. The electronic configuration of lead is

1s² 2s² 2p⁶ 3s² 3p⁶ 3d¹⁰ 4s² 4p⁶ 4d¹⁰ 5s² 5p⁶ 4f¹⁴ 5d¹⁰ 6s² 6p²

The orbital diagram for the valence electrons of lead (Pb) is

↑↓ ↑↓ ↑↓ ↑↓ ↑↓ ↑↓ ↑↓ ↑↓

s s p p p p d d

2 1 6 2 6 2 10 10

|||||||||

1 2 3 4 5 6 7 8

The notation ↑↓ represents a pair of electrons with opposite spins.

To determine if lead (Pb) is diamagnetic or paramagnetic, we need to look at whether there are any unpaired electrons. Based on the orbital diagram, we can see that all the electrons in the valence shell are paired, meaning that lead (Pb) is diamagnetic.

The atom with the lowest first ionization energy is C (carbon). The order from highest to lowest is: e) Cl (chlorine) > d) P (phosphorus) > c) Ge (germanium) > b) C (carbon) > a) Ca (calcium).

The atom that would have the lowest first ionization energy is Ca (Calcium). The amount of energy that is required to remove the most loosely held electron from an isolated neutral gaseous atom to form a cation is called the first ionization energy. It is a measure of the stability of an atom. The ionization energy of an element is determined by the amount of energy required to remove an electron from its ground state. The ionization energy is a physical property of an element that varies across the periodic table. The element that has the lowest ionization energy is the most reactive and will most likely form cations.

Identify which of the following atoms would have the lowest first ionization energy. The given atoms are Ca, C, Ge, P, and Cl. Out of these atoms, Ca would have the lowest first ionization energy. The electronic configuration of Ca is 2, 8, 8, 2. Calcium belongs to group 2 and period 4 of the periodic table. It has 20 protons, 20 electrons, and 2 valence electrons. Because of its 2 valence electrons, it has a low ionization energy. The electronic configuration of Ca is most stable because of the presence of the 8 valence electrons in the outermost shell.

The electronic configurations of the other given atoms are:

C: 2, 4Ge: 2, 8, 18, 4P: 2, 8, 5Cl: 2, 8, 7

All of these elements have electrons that are either in the process of filling the valence shell or have already filled it. They have higher ionization energies because of this. Therefore, Ca would have the lowest first ionization energy.

For more such questions on ionization energy , Visit:

https://brainly.com/question/20658080

#SPJ11

a balanced equation for the redox reaction: 2 Ca(s) + O2(g) → 2 CaO(s)

A redox reaction is a type of chemical reaction that involves the transfer of electrons between species. One species undergoes oxidation (loses electrons) while another species undergoes reduction (gains electrons).

In the reaction between calcium metal and oxygen gas, the calcium metal is being oxidized (loses electrons) and the oxygen gas is being reduced (gains electrons). This can be seen in the balanced equation where the calcium atoms go from having an oxidation state of 0 to +2, while the oxygen atoms go from having an oxidation state of 0 to -2.

Learn more about redox reaction here:

https://brainly.com/question/13293425

#SPJ1

The major organic product of the condensation of ammonia or a primary amine with the carbonyl group of an aldehyde or ketone is an imine.

A functional group or organic substance with a carbon-nitrogen double bond (C=N) is known as an imine. A hydrogen atom or an organic group may be joined to the nitrogen atom. (R). The carbon atom is connected to two more single bonds. Imines are present in numerous processes and are frequently found in manufactured and naturally occurring chemicals.

The five core atoms for ketimines and aldimines, C2C=NX and C(H)C=NX, respectively, are coplanar. The sp2-hybridization of the mutually double-bonded nitrogen and carbon atoms yields planarity. For nonconjugated imines, the C=N distance is 1.29-1.31, whereas for conjugated imines, it is 1.35. The C-N distances in amines and nitriles, on the other hand, are 1.47 and 1.16, respectively. Slow rotation occurs around the C=N bond. E- and Z-isomers were detected using NMR spectroscopy of aldimines have been detected. Owing to steric effects, the E isomer is favored.

An imine is formed when a primary amine reacts with a carbonyl group (C=O) of an aldehyde or ketone to form a new C-N bond. This reaction is known as a condensation reaction, as it involves the loss of a small molecule (e.g. water) to form the product.

For more such questions on condensation reaction , Visit:

https://brainly.com/question/1361341

#SPJ11

The correct questions is :

What  is the major organic product of the condensation of ammonia or a primary amine with the carbonyl group of an aldehyde or ketone?

Answer:

First, we need to calculate the change in temperature:

ΔT = final temperature - initial temperature

ΔT = 85 °C - 35 °C

ΔT = 50 °C

Next, we can use the following formula to calculate the heat energy required:

Q = m·C·ΔT

where Q is the heat energy in calories, m is the mass of the sample in grams, C is the specific heat in cal/g °C, and ΔT is the change in temperature in °C.

Plugging in the given values, we get:

Q = 35.0 g · 0.108 cal/g °C · 50 °C

Q = 189.0 calories

Therefore, 189.0 calories are required to raise the temperature of the sample from 35 °C to 85 °C

The percent ionization of the nitrous acid in the 0.036 M aqueous solution is 2.1%.

The osmotic pressure (π) of a solution can be related to the molar concentration (M) of the solute and the temperature (T) of the solution by the following equation:

π = MRT

Where R is the gas constant.

We can use this equation to calculate the molar concentration of the nitrous acid solution:

M = π / RT

M = (0.93 atm) / (0.0821 L·atm/(mol·K) x 298 K)

M = 0.036 M

This is the molar concentration of the undissociated nitrous acid in the solution. To calculate the percent ionization of the acid, we need to know the concentration of the H+ and NO2- ions in the solution.

The balanced chemical equation for the dissociation of nitrous acid is:

HNO2(aq) ⇌ H+(aq) + NO2-(aq)

Let x be the extent of ionization of the nitrous acid. Then the concentration of H+ and NO2- ions can be expressed in terms of x as follows:

[H+] = x M

[NO2-] = x M

The concentration of the undissociated nitrous acid is (1-x)M.

The expression for the equilibrium constant (Ka) of the reaction can be written as:

Ka = [H+] [NO2-] / [HNO2]

Substituting the concentrations in terms of x, we get:

Ka = x^2M / (1-x)M

Simplifying the above equation, we get:

Ka = x^2 / (1-x)

The percent ionization of the acid is the fraction of the original HNO2 molecules that dissociate into H+ and NO2- ions. It can be calculated as follows:

% ionization = (concentration of H+ ions) / (initial concentration of HNO2) x 100

% ionization = (x M) / (M) x 100

% ionization = x x 100

Substituting the value of x from the above equation for Ka, we get:

Ka = x^2 / (1-x)

x = sqrt(Ka / (1+Ka))

We can calculate the value of Ka using the standard reference value of the acid dissociation constant (Ka) for nitrous acid at 25°C, which is 4.5 x 10^-4.

x = sqrt(4.5 x 10^-4 / (1+4.5 x 10^-4))

x = 0.021

% ionization = 0.021 x 100

% ionization = 2.1%

Therefore, the percent ionization of the nitrous acid in the 0.036 M aqueous solution is 2.1%.

Learn more about osmotic pressure here : brainly.com/question/25413362

#SPJ1

However, it is commonly approximated as 3.14159.

An irrational number is a number that cannot be expressed as a simple fraction or ratio of two integers. It is a non-repeating, non-terminating decimal. Examples of irrational numbers include pi (π), the square root of 2 (√2), and the golden ratio (∅).

In mathematics, a terminating decimal is a decimal number that has a finite number of digits after the decimal point, i.e., the decimal representation ends in a finite number of zeroes. For example, 0.75, 2.0, and 0.0625 are terminating decimals.

To know more about irrational visit :

https://brainly.com/question/15837135

#SPJ1

The major organic product of an SN2 substitution reaction is an alkene, which may be either in retention or inversion of configuration relative to the original substrate.

The reaction you are asking about is an SN2 substitution reaction, in which a nucleophile (Nu) displaces a leaving group (LG) from a molecule with an alkyl halide substrate. The major organic product of this reaction will be an alkene, which has the same carbon chain as the alkyl halide substrate. Depending on the relative configuration of the substrate, the alkene product may be the same as the original substrate (retention) or have its configuration inverted (inversion). If stereochemistry is relevant to the question, then it should be specified in the answer.

To learn more about SN2 substitution :

https://brainly.com/question/29849583

#SPJ11

At has a higher initial ionisation energy than Br, while Br has a bigger atomic radius. Se has a bigger atomic radius than Br, and Br has a higher initial ionisation energy than Se.

The most loosely bound electron is further from the nucleus and thus easier to remove in bigger atoms. Hence, the ionisation energy should decrease as size (atomic radius) increases.

This is because the outer electrons aren't bound as strongly because they are farther from the nucleus.

To know more about ionisation energy visit:-

brainly.com/question/27356170

#SPJ1

The maximum number of electrons that can occupy the 1s sub-shell is 2, the 3p sub-shell is 6, the 3d sub-shell is 10, and the 6g sub-shell is 32.

For the 1s sub-shell, due to the Pauli Exclusion Principle, two electrons of opposite spin can exist in the same orbital. This means that there is a maximum of two electrons that can occupy the 1s sub-shell. For the 3p sub-shell, three orbitals exist with a maximum of two electrons each. Since two electrons of opposite spin can occupy each orbital, there is a maximum of six electrons that can occupy the 3p sub-shell. For the 3d sub-shell, five orbitals exist with a maximum of two electrons each. Since two electrons of opposite spin can occupy each orbital, there is a maximum of 10 electrons that can occupy the 3d sub-shell. Finally, for the 6g sub-shell, seven orbitals exist with a maximum of two electrons each. Since two electrons of opposite spin can occupy each orbital, there is a maximum of 32 electrons that can occupy the 6g sub-shell.

To learn more about Electrons ;

https://brainly.com/question/11316046

#SPJ11

(S)-2-butanol will undergo an SN2 reaction with HBr to produce a racemic mixture of alkyl bromides. Here option B is the correct answer.

When optically active alcohol is treated with HBr, the reaction follows an SN1 or SN2 mechanism. In the case of SN1, a carbocation intermediate is formed, and in SN2, a backside attack by the nucleophile occurs. The stereochemistry of the product depends on the configuration of the intermediate and the direction of attack.

In the case of (S)-2-butanol, the hydroxyl group is attached to the second carbon atom, which makes it a primary alcohol. When treated with HBr, it undergoes an SN2 reaction, where the hydroxyl group is replaced by the bromine atom. The nucleophile attacks from the backside of the molecule, leading to an inversion of configuration.

This results in the formation of a racemic mixture of alkyl bromides, as both enantiomers have an equal chance of being attacked from either side. On the other hand, (R)-2-butanol, being the enantiomer of (S)-2-butanol, will also undergo the same reaction and produce the same racemic mixture of alkyl bromides.

In the case of (R)-1-phenyl ethanol and (S)-1-phenyl ethanol, they are secondary alcohols and can undergo either SN1 or SN2 reactions depending on the reaction conditions. However, the reaction mechanism will lead to the formation of a mixture of diastereomers, rather than a racemic mixture of enantiomers.

To learn more about alkyl bromides

https://brainly.com/question/29031148

#SPJ4

Complete question:

Which of the following optically active alcohols, when treated with HBr, results in a racemic mixture of alkyl bromides?

a) (R)-2-butanol

b) (S)-2-butanol

c) (R)-1-phenyl ethanol

d) (S)-1-phenyl ethanol

The R f values for compounds A, B, and C on a silica gel TLC plate developed in hexanes would be determined by measuring the distance each compound traveled compared to the distance the solvent traveled.

a) There is a 4 cm gap between the origin and the solvent front. The Rf value for spot A is[tex]\frac{1.5}{4}= 0.375[/tex], because it travelled 1.5 cm. Due to the 3.5 cm movement of Spot B, its Rf is[tex]\frac{3.5}{4} = 0.875[/tex]. Spot C shifted 3 cm, making its Rf [tex]\frac{3}{4} = 0.75[/tex].

b)Due to its shorter travel distance than the other two compounds, compound A is the most polar. Recall that polar substances adhere to the adsorbent more readily, move less, and have a lower Rf value.

c)Hexanes is less polar than acetone as a solvent. Each of the three compounds would move more quickly if the same method were employed to elute them.The chemicals can be removed from the polar adsorbent more effectively with a more polar eluting solvent. Each compound would have a higher Rf value if acetone were used to elute the TLC plate as opposed to hexanes because each compound travels more quickly.

learn more about  Rf value Refer:brainly.com/question/17796724

#SPJ1

Answer:

when the solution of potassium hydroxide and zinc chloride are mixed,the double-displacement reaction occur ,resulting in precipitation and the reaction forms potassium chloride and zinc hydroxide .

A few statements may be true regarding a biochemical oxidation-reduction (redox) reaction. The statements are as follows: A redox reaction occurs when there is a transfer of electrons between molecules or atoms.

The electron donor becomes oxidized, and the electron acceptor is reduced, causing a transfer of energy. A redox reaction produces ATP, which is the primary energy currency of the cell. Oxidation and reduction are complementary reactions that occur simultaneously in the same reaction, resulting in the release of energy. Redox reactions are vital in metabolic pathways, and the electron carriers NAD+ and FAD+ are essential in these reactions. Oxygen is frequently used as a final electron acceptor in redox reactions. Redox reactions can also occur in non-cellular environments, such as photosynthesis, respiration, and combustion. The significance of redox reactions is enormous, and they play an essential role in sustaining life on earth. They help in generating energy, breaking down complex molecules, synthesizing molecules, and many other cellular processes.

To learn more about  Oxidation-reduction :

https://brainly.com/question/13892498

#SPJ11

Answer:

Explanation:

2-bromopropane is the major product because the reaction mechanism involves the formation of the most stable carbocation intermediate. When hydrogen bromide reacts with propene, the hydrogen atom from HBr adds to the carbon atom of the double bond that has fewer hydrogen atoms attached, resulting in the formation of a carbocation intermediate. The intermediate can either form 1-bromopropane or 2-bromopropane depending on the position of the carbocation. The 2-bromopropane is the major product because the secondary carbocation formed in this case is more stable than the primary carbocation formed in the case of 1-bromopropane.

To test for an alkene, bromine water can be used. When an alkene reacts with bromine water, the bromine molecule adds across the double bond, forming a colorless dibromoalkane product. The mechanism for the reaction between hex-1-ene and bromine involves the formation of a cyclic bromonium ion intermediate, followed by the attack of water on the intermediate, resulting in the formation of the dibromoalkane product.

a) Addition polymerization is a process in which unsaturated monomers are joined together to form a polymer. The process involves breaking the double bond of the monomer and joining the monomers together to form a long-chain polymer. The process requires a catalyst to initiate the reaction.

b) The repeating unit of the polymer formed from the addition polymerization of chloroethene monomers is -CH2-CHCl-. This polymer is called polyvinyl chloride (PVC), and it has a wide range of uses, including pipes, electrical cables, and vinyl flooring.

The  atoms of lithium that  are in 18.7 g is 16 × 10²³ atoms . This is taken out by mole concept .

The mole is a unit of measurement similar to the pair, dozen, gross, and so on. It provides a precise count of the atoms or molecules in a bulk sample of matter. A mole is the amount of substance that contains the same number of discrete entities (atoms, molecules, ions, etc.)

if 7 grams of lithium contain 6 × 10²³ atoms

then 18.7 will contain 16 × 10²³ atoms

to know more about mole concept , visit ;

brainly.com/question/31123980

#SPJ1

The empirical formula, CH2O9(menthol) is multiplied by 5 to get the molecular formula, C10H20O.The empirical and molecular formula for menthol are CH2O and C10H20O, respectively.

The molecular formula for menthol is C5H10O.

This can be determined by dividing the molar mass of the empirical formula (156.26 g/mol) by the molar mass of CO2 (44.01 g/mol). This gives a ratio of 3.55, which is equal to the ratio of C atoms in the empirical formula, C10H20O.

Therefore, the molecular formula is C5H10O.
Given:

Menthol is composed of C, H, and O0.1005g sample of menthol is combusted and produces0.2829g of CO2 0.1159g H2O

1. Find: Empirical and molecular formula for menthol.

Let's first calculate the number of moles of CO2 produced. The balanced equation for combustion of menthol is:

C10H20O(s) + 12O2(g) → 10CO2(g) + 10H2O(l)

From the above equation, we can see that for 10 moles of CO2 produced 1 mole of menthol is required.

2. By taking the number of moles of CO2 produced, we can calculate the number of moles of menthol burned.

Moles of CO2 = 0.2829g / 44.01g/mol= 0.00643 mol

C10H20O(s) + 12O2(g) → 10CO2(g) + 10H2O(l)

From the balanced equation,1 mole of C10H20O requires 10 moles of CO2

Moles of C10H20O burned = 10 * 0.00643= 0.0643 mol

Next, we can calculate the number of moles of H2O produced.

Moles of H2O = 0.1159g / 18.015g/mol= 0.00643 mol

C10H20O(s) + 12O2(g) → 10CO2(g) + 10H2O(l)

From the balanced equation,1 mole of C10H20O requires 10 moles of H2O

Moles of C10H20O burned = 10 * 0.00643= 0.0643 mol

3. Now we can calculate the empirical formula of menthol. The empirical formula can be calculated as follows:

Empirical formula = CH2O (Divide all moles by smallest moles) The molecular weight of CH2O = 30 g/mol

The empirical formula mass of the compound is:

mass = (12.011 + 2*1.008 + 15.999) = 30.026

Empirical formula mass of CH2O is 30.026g/mol, and the given sample weighs 0.1005 g.
The number of empirical formula units in the sample is 0.1005 g / 30.026 g/mol = 0.003348Units.

Empirical formula = CH2OThe empirical formula weight of menthol is CH2O, which is equal to 30.026g/mol.

4. To find the molecular formula, we need to know the molecular weight of the menthol. We can calculate it as follows:

Molecular formula mass = Empirical formula mass x n

Where n = integer Molecular formula mass of menthol is 156 g/mol, and the empirical formula mass is 30.026 g/mol.

So, n = 156 g/mol ÷ 30.026 g/mol = 5.192

Thus the empirical formula, CH2O is multiplied by 5 to get the molecular formula, C10H20O.The empirical and molecular formula for menthol are CH2O and C10H20O, respectively.

For more such questions on empirical formula , Visit:

https://brainly.com/question/1603500

#SPJ11

The molarity of the unknown triprotic acid is 0.269M.

Molarity is the concentration of a substance in solution, expressed as the number moles of solute per litre of solution.

The molarity of the unknown acid can be calculated using the following formula:

CaVa = CbVb

Where;

According to this question, the titration of 45.0 ml of an unknown triprotic acid required 32.71 ml of 0.37 M KOH to reach the endpoint.

45 × Ca = 32.71 × 0.37

45Ca = 12.1027

Ca = 0.269M

Learn more about molarity at: https://brainly.com/question/8732513

#SPJ1

If we use the Gizmo to find the freezing, melting, and boiling points of water at 5,000 meters (16,404 feet) then,

Freezing point: 32 ºF (0ºC)

Melting point: 32 ºF (0ºC)

Boiling point: 203°F (95°C)

The freezing point is defined as the temperature at which a liquid becomes a solid. Increased pressure usually raises the freezing point with the melting point of the solid. The boiling point of a pure substance is defined as the temperature at which the substance transitions from a liquid to the gaseous phase. At the boiling point the vapor pressure of the liquid is equal to the applied pressure on the liquid. The melting point of a substance is defined as the temperature at which the substance changes from a solid to a liquid.

Melting occurs at a single temperature for the pure substances. The normal and average melting point and boiling point of water at 1 atmospheric pressure are 0°C and 100°C respectively. Decreasing the pressure under 1 atm. will lower the boiling point since the external pressure will be lower so it will become equal with the vapor pressure at a lower temperature.

To learn more about Freezing point

https://brainly.com/question/40140

#SPJ4

The claim was correct . All elements  have same number of particles in one mole and have different number of particles  in a mole based on atomic number .

In the International System of Units, the mole (symbol mol) is the unit of substance amount (SI). The amount of substance is a measurement of how many elementary entities of a given substance are present in an object or sample. An elementary entity can be an atom, a molecule, an ion, an ion pair, or a subatomic particle such as an electron, depending on the substance. For example, despite having different volumes and masses, 10 moles of water (a chemical compound) and 10 moles of mercury (a chemical element) contain equal amounts of substance, and the mercury contains exactly one atom for each molecule of water.

to know more about mole , visit ;

brainly.com/question/26416088

#SPJ1

The standard change in Gibbs energy at 25 degree Celsius is  490.6 °C. for given equilibrium partial pressure  .

The Gibbs energy is the thermodynamic potential that is minimized when a system reaches chemical equilibrium at constant pressure and temperature when not driven by an applied electrolytic voltage. Its derivative with respect to the reaction coordinate of the system then vanishes at the equilibrium point.

Using the formula

ΔG° =  - R × T ln K

WHERE R=  8.3144598 J⋅mol⁻¹⋅K⁻¹.

T = 298 K

K = 0.82

SOLVING ,

The standard change in Gibbs energy at 25 degree Celsius is  490.6 °C.

To know more about Gibbs energy , visit ;

brainly.com/question/20358734

#SPJ1

Answer: Manganese

Explanation:

With titanium, it only has two d electrons, so it can't form different high and low spin complexes. It doesn't matter because it will never fill the higher-energy orbitals. The total spin state turns out to be +1 (two unpaired d electrons, no matter what). Therefore, manganese will form both a high and low spin complex.

Answer:

1. Equilibrium expressions:

a. K = [HSO4-][H3O+]/[H2SO4][H2O]

b. K = [NO]^4[H2O]^6/[NH3]^4[O2]^5

c. K = [NH3][HCl]/[NH4Cl]

d. K = [NO2]^2/[N2O4]

2. Since K = 0.050, the concentrations of the reactants (N2 and H2) are larger than the concentrations of the products (NH3).

3. Since K = 6.8 x 10^3, the concentrations of the products (SO2 and O2) are larger than the concentrations of the reactant (SO3).

4. The Ksp expression for each of the reactions is:

a. Ksp = [Na+][Cl-]

b. Ksp = [Ba2+][SO42-]

5. Brønsted-Lowry acids and bases:

a. Acid: HNO3; Conjugate base: NO3-; Base: H2O; Conjugate acid: H3O+

b. Acid: HCN; Conjugate base: CN-; Base: H2O; Conjugate acid: HCN

c. Acid: H2SO4; Conjugate base: HSO4-; Base: Cl-; Conjugate acid: HCl

d. Acid: NH3; Conjugate base: NH2-; Base: H2O; Conjugate acid: NH4+

e. Acid: H2O; Conjugate base: OH-; Base: O2-; Conjugate acid: OH-

6. Conjugate acids and bases:

a. Acid: H2O; Conjugate base: OH-

b. Acid: H3O+; Conjugate base: H2O

c. Acid: H2CO3; Conjugate base: HCO3-

d. Acid: NH4+; Conjugate base: NH3

e. Acid: HSO4-; Conjugate base: SO42-

7. The strongest acid is HIO4 (highest K value), followed by HCN, HC2H3O2, and H2CO3 (lowest K value). The K values represent the degree to which the acids dissociate in solution. HIO4 is a strong acid, meaning it dissociates almost completely in solution, while H2CO3 is a weak acid, meaning it only dissociates partially.

8. pH and pOH calculations:

a. pH = -log[H3O+] = -log(0.200) = 0.699; pOH = -log[OH-] = -log(1.0 x 10^-14/0.200) = 12.301

b. pOH = -log[OH-] = -log(0.0143) = 1.844; pH = 14.000 - pOH = 12.156

c. pH = -log[H3O+] = -log(3.0) = 0.522; pOH = 13.478

d. pOH = -log[OH-] = -log(0.0062) = 2.206; pH = 14.000 - pOH = 11.794

9. Hydronium and hydroxide ion concentrations:

pH = 3.6; hydronium ion concentration = 10^-pH = 3.98 x 10^-4 M; hydro

(Please could you kindly mark my answer as brainliest you could also follow me so that you could easily reach out to me for any other questions)

Its atomic radius increases form top to bottom inside a group, then decreases from left and right across a period. As a result, francium is indeed the largest element while helium is the smallest.

Atomic radii inside the periodic table decrease across a row form left to right and increase across a column from top to bottom. Due to these two patterns, the periodic table's lower left and upper right corners, respectively, contain the largest and smallest atoms.

The atomic radius grows form top to bottom inside a group and decreases form left to right during a period, as seen in the images below. As a result, francium is indeed the largest element while helium is the smallest.

To know more about francium visit:
https://brainly.com/question/28617076

#SPJ1

a. The atom with the smaller atomic size is: Nitrogen

a. The atom with the smaller atomic size is: Arsenic.

Atomic size, also known as atomic radius, is the distance between the nucleus of an atom and its outermost electrons. It is typically measured in picometers (pm) or angstroms (Å). The atomic size of an element can be calculated by finding the distance between the nucleus and the outermost electron shell of an atom of that element. This distance can be determined using various methods, including X-ray diffraction and spectroscopy. The atomic size of elements generally decreases from left to right across a period and increases from top to bottom down a group in the periodic table.

To know more about spectroscopy, visit:

https://brainly.com/question/28523860

#SPJ1

Answer:

Transcribed Image Text: Rank the following substances in order of increasing acid strength. (1 as least and 4 as most in acid strength) ✓ H₂Se ✓ HBr HI ✓ AsH3 Expert Solution

Explanation:

HOPE IT HELPS!!

The empirical formula of a molecule containing 65.5% carbon, 5.5% hydrogen, and 29% oxygen is CH2O.

To calculate this, you need to first convert the percentage composition into mass composition. This is done by multiplying the percentages by the molecular weight of each element.

Carbon: 65.5% x 12 g/mol = 0.786 g/mol
Hydrogen: 5.5% x 1 g/mol = 0.055 g/mol
Oxygen: 29% x 16 g/mol = 0.464 g/mol
Now that you have the mass composition, you can calculate the moles of each element by dividing the mass of each element by its molar mass.
Carbon: 0.786 g/mol / 12 g/mol = 0.065 mol
Hydrogen: 0.055 g/mol / 1 g/mol = 0.055 mol
Oxygen: 0.464 g/mol / 16 g/mol = 0.029 mol
Finally, divide each element's moles by the smallest moles to get the empirical formula.

Carbon: 0.065 mol / 0.029 mol = 2.24 = 2 mol
Hydrogen: 0.055 mol / 0.029 mol = 1.90 = 1 mol
Oxygen: 0.029 mol / 0.029 mol = 1.00 = 1 mol
Therefore, the empirical formula of the molecule is CH2O.

For more such questions on empirical formula , Visit:

https://brainly.com/question/1603500

#SPJ11

Mn3+, an ion of manganese(III), can function as an acid by giving a proton (H+) to a base. Here's an illustration: Mn3+ (aq) + 3OH- (aq) Mn(OH)3 (s)

There is no need to add an indicator because MnO4's vivid purple colour serves as one enough. In the conical flask, there is Fe2+. The Fe2+ solution is added, and the Fe2+ lowers the MnO4- to Mn2+. As Mn2+ is a colourless solution, the purple colour disappears.

The divalent metal cation manganese(2+) contains manganese as the metal. It plays the part of a cofactor. It consists of a monoatomic dication, a manganese cation, and a divalent metal cation.

To know more about cation visit:-

https://brainly.com/question/28710898

#SPJ1

Answer:

See Below.

Explanation:

Problem 1

Let x be the mass of 15% solution needed and y be the mass of 20% solution needed. Then, we have the following system of equations:

x + y = 200 (total mass of solution)

0.15x + 0.20y = 0.17(200) (total amount of solute)

Solving this system of equations gives:

x = 60 g (mass of 15% solution)

y = 140 g (mass of 20% solution)

Therefore, 60 g of 15% solution and 140 g of 20% solution are needed to prepare 200 g of 17% solution.

Problem 2

Let x be the mass of 18% solution needed and y be the mass of 5% solution needed. Then, we have the following system of equations:

x + y = 300 (total mass of solution)

0.18x + 0.05y = 0.07(300) (total amount of solute)

Solving this system of equations gives:

x = 120 g (mass of 18% solution)

y = 180 g (mass of 5% solution)

Therefore, 120 g of 18% solution and 180 g of 5% solution are needed to prepare 300 g of 7% solution.

Problem 3

The total mass of the final solution is

200 g + 350 g = 550 g

The total amount of solute in the final solution is:

0.15(200 g) + 0.20(350 g) = 95 g + 70 g = 165 g

Therefore, the mass percentage of the final solution is:

(mass of solute / total mass of solution) x 100% = (165 g / 550 g) x 100% = 30%

Therefore, the mass percentage of the final solution is 30%.

Problem 4

The total mass of the final solution is

300 g + 35 g = 335 g

The total amount of solute in the final solution is:

0.15(300 g) + 35 g = 75 g + 35 g = 110 g

Therefore, the mass percentage of the final solution is:

(mass of solute / total mass of solution) x 100% = (110 g / 335 g) x 100% = 32.8%

Therefore, the mass percentage of the final solution is 32.8%.

Problem 5

The total mass of the final solution is

400 g + 150 g = 550 g

The total amount of solute in the final solution is

0.25(400 g) = 100 g

Therefore, the mass percentage of the final solution is

(mass of solute / total mass of solution) x 100% = (100 g / 550 g) x 100% = 18.2%

Therefore, the mass percentage of the final solution is 18.2%.