What is the solution to this system of equations? 2x + 3y = 7 and -4x - 6y = -2

Answers

Answer 1

Answer:

No Solution

Step-by-step explanation:

I used a graphing tool to graph the lines. When graphed, the lines are parallel, and they do not intercept at a point.

There is no solution to the system.

What Is The Solution To This System Of Equations? 2x + 3y = 7 And -4x - 6y = -2
Answer 2

Answer:

Step-by-step explanation:

We will use the graphing method.

Graph the both equations. The intersection point coordinates are the solution of the system.

● 2x + 3y = 7

● -4x -6y = -2

The two lines are parallel. So the system has no real solution. If we tried solve it with calculations we will find an impossible result ( 12 = 0)

What Is The Solution To This System Of Equations? 2x + 3y = 7 And -4x - 6y = -2

Related Questions

10 points to the person who answers this whole thing:)

Answers

Answer:

perimeter = 24

Step-by-step explanation:

it´s a regular hexagon = 6 sides

perimeter = 6(4x) = 24x

a plane is a _ figure

Answers

two deminsional or flat fuigure!
A plane is a 2d figure

Please answer answer question

Answers

Answer:

c=13.42

Step-by-step explanation:

[tex]A^2+B^2=C^2\\6^2+14^2=C^2\\C^2=144+36\\C^2=180\\\sqrt{c^2}=\sqrt{180} \\c=13.42[/tex]

The National Weather Service collects data on the number of hours of consecutive rainfall and the number of minor traffic accidents in a particular city. The scatter plot shows the data it gathered and the line of best fit. For a school project, Peyton uses technology to calculate the equation for line of best fit. If Peyton's calculation is correct, which equation could represent the line of best fit for this data?

Answers

The equation that could best represent the line of best fit for the given data is; y = 0.625x

How to find a linear equation from a scatter plot?

The formula for the equation of a line in slope intercept form is;

y = mx + c

where;

m is slope

c is y-intercept which is the point where the line intersects the y-axis

Now, in this question, we see that the line intersects the y-axis at 0. Thus;

y-intercept; c = 0

Now, let us find the slope from the formula;

m = (y₂ - y₁)/(x₂ - x₁)

Using the first and penultimate coordinate which are;

(0, 0) and (8, 5), we have;

m = (5 - 0)/(8 - 0)

m = 0.625

Thus, the equation is;

y = 0.625x

Read more about Scatter plot equation at; https://brainly.com/question/6592115

#SPJ1

Answer:

y=0.625x

Step-by-step explanation:

plato

Simplify.
Remove all perfect squares from inside the square root.
V63 =

I need the answer ASAP can anyone help?

Answers

Answer: [tex]3\sqrt{7}[/tex]

3*sqrt(7)

3 times the square root of 7

====================================================

Explanation:

I'm assuming the V stands for square root. You can write sqrt(63).

[tex]\sqrt{63} = \sqrt{9*7}\\\\\sqrt{63} = \sqrt{9}*\sqrt{7}\\\\\sqrt{63} = 3\sqrt{7}[/tex]

The idea is to factor 63 in such a way that one factor is the largest perfect square possible, that way we can pull the root apart to simplify as shown above. The rule I used for the second step is [tex]\sqrt{x*y} = \sqrt{x}*\sqrt{y}[/tex]

Explain how the tangents of complementary angles are related.

Answers

Answer:

  tan(α) = 1/tan(90°-α)

Step-by-step explanation:

The tangent of one is the reciprocal of the tangent of the other.

__

In a right triangle, ...

  tan = opposite/adjacent

For the two complementary acute angles in such a triangle, opposite and adjacent are swapped. That is the tangent of one is the inverse of the tangent of the other. (That inverse is also known as the cotangent.)

  tan(α) = cot(90°-α) = 1/tan(90°-α)

which is a true statement about an exterior angle of a triangle

Answers

Answer:

D

Step-by-step explanation:

The exterior angles are out of the triangle at all times and it adds up to make 180 with anyone of the inside angle of the triangle.

The pair also rests on the same flat/straight line and that makes a pair.

Therefore we can say that it is formed by a linear pair/group with one of the interior/inside angles of the triangle.

So, the correct answer would be D.

The true statement about an exterior angle of a triangle is C; It forms a linear pair with one of the interiior angles of the triangle .

What is the Exterior Angle of a Triangle Property?

An exterior angle of a triangle is equal to the sum of the opposite interior angles.

We know that the exterior angles are out of the triangle at all times and it adds up to make 180 with anyone of the inside angle of the triangle.

The pair also rests on the same straight line and that makes a pairs.

Therefore we can say that it is formed by a linear pair with one of the interior angles of the triangle.

So, the correct answer would be C.

Learn more about exterior angles;

https://brainly.com/question/14164971

#SPJ2

Ncluding a 6% sales tax, a new stereo costs $492.9. Find the cost of the stereo before tax. A) First write an equation you can use to answer this question. Use x x as your variable and express any percents in decimal form in the equation. (1)

Answers

Answer:

1.06x = 429.9

Cost of stereo before sales tax = $405.6

Step-by-step explanation:

Given the following :

Full cost of stereo(cost after sales tax) :

(cost before sales tax + sales tax)

Sales tax = 6%

Cost after sales tax = $492.9

Take the cost before sales tax as 'x'

Therefore, cost after sales tax:

x + 6% of x = $492.9

Equation to solve the problem :

x + 0.06x = 429.9

1.06x = 429.9 - - - (1)

We can then solve for x:

1.06x = 429.9

x = 429.9 / 1.06

x = $405.56603

x = $405.6

Donny has three times as many candy canes as Marc. Marc has thirty more candy canes than Bob. They have 500 candy canes altogether. How many candy canes does Donny have?

Answers

Answer:

318

Step-by-step explanation:

Bob=x

Marc=x+30

Donny=3(x+30)

x+x+30+3x+90=500

5x=500-120

5x=380

x=76

Bob has x = 76

Marc has x+30=106

Donny has 3*112=318

318+106+76=500

Distribute 10 (3x + 8x2).

Answers

Answer:

30x+160

simple all you had to do is 10*3x and 8x2=16 and 10*16 and you will get 30x+160

Step-by-step explanation:

Answer:

30x + 80x^2

Step-by-step explanation:

10 (3x + 8x^2)

10 * 3x + 10 * 8x^2

30x + 80x^2

If the area of the rectangle shown below is given by the expression 3x2 + 7x – 6,
and the width is (x + 3), which of the following could represent the length?

Answers

Answer:

Step-by-step explanation:

3x² + 7x - 6 = 3x² + 9x - 2x - 2*3

                  = 3x (x + 3) - 2(x +3)

                  = (3x - 2)(x + 3)

Area of the rectangle = 3x² + 7x - 6

length * width = 3x² + 7x - 6

length * (x + 3) = (3x -2)(x +3)

          length = [tex]\frac{(3x-2)(x+3)}{(x+3)}[/tex]

          length = (3x - 2)

50.For the direct variation such that when y = 2 then x = 3, find the constant of variation ( k ) and then find the value of y when x = –0.5.

Answers

Step-by-step explanation:

Since it's a direct variation

y = kx

where k is the constant of proportionality

To find the value of y when x = –0.5 we must first find the relationship between the variables

When

x = 3

y = 2

2 = 3k

Divide both sides by 3

[tex]k = \frac{3}{2} [/tex]

So the formula for the variation is

[tex]y = \frac{3}{2} x[/tex]

When x = - 0.5 or - 1/2

[tex]y = \frac{3}{2} ( - \frac{1}{2} )[/tex]

We have the final answer as

[tex]y = - \frac{3}{4} [/tex]

Hope this helps you

Joey went for 15 auditions. Out of those 15 auditions, he got called back for 30% of them. Approximately how many did he get called back for?

Answers

Answer:

2

Step-by-step explanation:

Basically,

You just have to find 30% of 15...

So

The formula is...

BASE x PERCENT= AMOUNT

x times 0.3= 15

0.3/15=0.02

0.02 x 100= 2

So

Joey got called back for approximately 2 auditions.

A. (-2,-1)
B. (-1,-2)
C. (1.-2)
D. (2,-1)

Answers

Answer:

D. 2,-1

Step-by-step explanation:

When a line is reflected by y=x, the x and y switch.

Someone pls help me . Will mark brainliest !!

Answers

Answer:

3, 10, 1080

Step-by-step explanation:

A coefficient, is the number that is multiplying a variable, such as x. A constant is any other number, not multiplying a variable.

For part one, the number multiplying the variable x is 3, so 3 is the coefficient.

For part two, the only number not multiplying a variable is the 10, so that is the constant.

To find how many miles she drove, we first need to subtract the first 30 dollars from the final payment.

300-30=270

We than need to divide 270 by .25, because that is how much it costed per mile.

270/.25=1080

Answer:

In the first question shown, the answer is 3

In the second question shown, the answer is 10

In the third question shown, the answer is 1080 miles

Step-by-step explanation:

First question - 3 is the number before x, making it the coefficient

Second question - 10 is the only number without a variable, making it a constant

Third question - .25 * 1080 = 270. 270 + 30 = 300.

Help, Answer ASAP; will give brainliest

Answers

Answer:

The value of k is 16, the angle of OLN and MNL is 72° .

Step-by-step explanation:

Given that alternate interior angles are the same. So we can assume that ∠OLN and ∠MNL have the same angle. In order to find k, we have to let ∠OLN = ∠MNL :

[tex]4k + 8 = 5k - 8[/tex]

[tex]5k - 4k = 8 + 8[/tex]

[tex]k = 16[/tex]

Next, we have to find the angle of OLN and MNL :

[tex]OLN = 4k + 8 = 4(16) + 8 = 72[/tex]

[tex]MNL = 5k - 8 = 5(16) - 8 = 72[/tex]

Consider the equation: 12x=13-x^212x=13−x 2 12, x, equals, 13, minus, x, squared 1) Rewrite the equation by completing the square. Your equation should look like (x+c)^2=d(x+c) 2 =dleft parenthesis, x, plus, c, right parenthesis, squared, equals, d or (x-c)^2=d(x−c) 2 =dleft parenthesis, x, minus, c, right parenthesis, squared, equals, d. 2) What are the solutions to the equation

Answers

Answer:

[tex](x + 6)^2 = 49[/tex]

[tex]x = 1[/tex]    or [tex]x = -13[/tex]

Step-by-step explanation:

Given

[tex]12x = 13 - x^2[/tex]

Using Completing the Square

[tex]12x = 13 - x^2[/tex] ---- Add [tex]x^2[/tex] to both sides

[tex]x^2 + 12x = 13 - x^2 + x^2[/tex]

[tex]x^2 + 12x = 13[/tex]

Divide the coefficient of x by 2; then add the square to both sides

[tex]x^2 + 12x + 6^2 = 13 + 6^2[/tex]

[tex]x^2 + 12x + 36 = 13 + 36[/tex]

[tex]x^2 + 12x + 36 = 49[/tex]

Factorize

[tex]x^2 + 6x + 6x + 36 = 49[/tex]

[tex]x(x + 6) + 6(x + 6) = 49[/tex]

[tex](x + 6)(x + 6) = 49[/tex]

[tex](x + 6)^2 = 49[/tex]

Hence, the equation is [tex](x + 6)^2 = 49[/tex]

Solving further

Take square root of both sides

[tex](x + 6) = \sqrt{49}[/tex]

[tex]x + 6 = \±7[/tex]

[tex]x = \±7- 6[/tex]

This implies that

[tex]x = 7 - 6[/tex]     or [tex]x = -7 -6[/tex]

[tex]x = 1[/tex]    or [tex]x = -13[/tex]

HEnce, the solutions are [tex]x = 1[/tex]    or [tex]x = -13[/tex]

Answer:

(x+6)^2=49 and  x=−6±7

Step-by-step explanation:

Please help! Algebra 2!!

Answers

Mistake found

3x-2(2x-4)=2

3x - 4x - 8 = 2 instead of 3x - 4x + 8 = 2

Correct answer

x= -13 y= -30

Answer:

See below.

Step-by-step explanation:

So we have the system of equations:

[tex]3x-2y=21 \text{ and } y=2x-4[/tex]

The student took the following steps:

[tex]3x-2(2x-4)=21\\3x-4x-8=21\\-x-8=21\\-x=29\\x=-29\\y=2(-29)-4=-58-4=-62[/tex]

The student's mistake is in step 2. He/she distributed incorrectly. You are supposed to distribute the -2 to both terms, so it should be -4x plus 8, since -2 times -4 is positive 8. Fixing that mistake, we will have:

[tex]3x-2(2x-4)=21\\3x-4x+8=21 \\-x+8=21\\-x=13\\x=-13\\y=2(-13)-4=-26-4=-30[/tex]

Thus, the final answers should be (-13, -30).

COMPUTE

3 ( 2 1/2 - 1 ) + 3/10

Answers

Answer:

[tex] \boxed{ \frac{24}{5} }[/tex]

Step-by-step explanation:

[tex] \mathsf{3(2 \frac{1}{2} - 1) + \frac{3}{10} }[/tex]

Convert mixed number to improper fraction

[tex] \mathrm{3( \frac{5}{2} - 1) + \frac{3}{10} }[/tex]

Calculate the difference

⇒[tex] \mathrm{3( \frac{5 \times 1}{2 \times 1} - \frac{1 \times 2}{1 \times 2} }) + \frac{3}{10} [/tex]

⇒[tex] \mathrm{ 3 \times( \frac{5}{2} - \frac{2}{2}) } + \frac{3}{10} [/tex]

⇒[tex] \mathrm{3 \times ( \frac{5 - 2}{2} ) + \frac{3}{10} }[/tex]

⇒[tex] \mathrm{3 \times \frac{3}{2} + \frac{3}{10} }[/tex]

Calculate the product

⇒[tex] \mathrm{ \frac{3 \times 3}{1 \times 2} + \frac{3}{10} }[/tex]

⇒[tex] \mathrm{ \frac{9}{2} + \frac{3}{10}} [/tex]

Add the fractions

⇒[tex] \mathsf{ \frac{9 \times 5}{2 \times 5} + \frac{3 \times 1}{10 \times 1} }[/tex]

⇒[tex] \mathrm{ \frac{45}{10} + \frac{3}{10} }[/tex]

⇒[tex] \mathrm{ \frac{45 + 3}{10 } }[/tex]

⇒[tex] \mathrm{ \frac{48}{10} }[/tex]

Reduce the numerator and denominator by 2

⇒[tex] \mathrm{ \frac{24}{5} }[/tex]

Further more explanation:

Addition and Subtraction of like fractions

While performing the addition and subtraction of like fractions, you just have to add or subtract the numerator respectively in which the denominator is retained same.

For example :

Add : [tex] \mathsf{ \frac{1}{5} + \frac{3}{5} = \frac{1 + 3}{5} } = \frac{4}{5} [/tex]

Subtract : [tex] \mathsf{ \frac{5}{7} - \frac{4}{7} = \frac{5 - 4}{7} = \frac{3}{7} }[/tex]

So, sum of like fractions : [tex] \mathsf{ = \frac{sum \: of \: their \: number}{common \: denominator} }[/tex]

Difference of like fractions : [tex] \mathsf{ \frac{difference \: of \: their \: numerator}{common \: denominator} }[/tex]

Addition and subtraction of unlike fractions

While performing the addition and subtraction of unlike fractions, you have to express the given fractions into equivalent fractions of common denominator and add or subtract as we do with like fractions. Thus, obtained fractions should be reduced into lowest terms if there are any common on numerator and denominator.

For example:

[tex] \mathsf{add \: \frac{1}{2} \: and \: \frac{1}{3} }[/tex]

L.C.M of 2 and 3 = 6

So, ⇒[tex] \mathsf{ \frac{1 \times 3}{2 \times 3} + \frac{1 \times 2}{3 \times 2} }[/tex]

⇒[tex] \mathsf{ \frac{3}{6} + \frac{2}{6} }[/tex]

⇒[tex] \frac{5}{6} [/tex]

Multiplication of fractions

To multiply one fraction by another, multiply the numerators for the numerator and multiply the denominators for its denominator and reduce the fraction obtained after multiplication into lowest term.

When any number or fraction is divided by a fraction, we multiply the dividend by reciprocal of the divisor. Let's consider a multiplication of a whole number by a fraction:

[tex] \mathsf{4 \times \frac{3}{2} = \frac{4 \times 3}{2} = \frac{12}{2} = 6}[/tex]

Multiplication for [tex] \mathsf{ \frac{6}{5} \: and \: \frac{25}{3} }[/tex] is done by the similar process

[tex] \mathsf{ = \frac{6}{5} \times \frac{25}{3} = 2 \times 5 \times 10}[/tex]

Hope I helped!

Best regards!

Please answer this question now

Answers

Answer:

72°

Step-by-step explanation:

From the figure given, angle D intercepts arc ABC. According to the Inscribed Angle Theorem:

m < D = ½(ABC) = ½(AB + BC)

Thus,

[tex] 56 = \frac{1}{2}(AB + 40) [/tex]

Solve for AB

[tex] 56 = \frac{AB + 40}{2} [/tex]

Multiply both sides by 2

[tex] 56*2 = \frac{AB + 40}{2}*2 [/tex]

[tex] 112 = AB + 40 [/tex]

Subtract both sides by 40

[tex] 112 - 40 = AB + 40 - 40 [/tex]

[tex] 72 = AB [/tex]

Arc AB = 72°

Christian ran 4 1/4 miles on Monday and 2 2/3 miles on Tuesday. On Wednesday, he ran 1 1/3 fewer miles than he ran on Monday. How many miles did he run in all? SHOW YOUR WORK AND EXPLAIN PLEASE I WILL MARK YOU BRAINIEST.

Answers

Answer:

9.83 miles

Step-by-step explanation:

Distance covered on Monday = 4.25 miles

Distance covered on Tuesday = 2.66 miles

Distance covered on Wednesday

= 4.25 - 1.33 = 2.92 miles

Total distance covered in Three days = 9.83miles

The dot plots show 9 scores on a 10 question trivia game for two students. Select all the statements that must be true.
..
:
2
3
5
6
7
4.
Noah's scores
...
2
3
5
6
7
Jada's scores
Noah's scores have greater variability than Jada's scores.
The standard deviation of Noah's scores is equal to the standard deviation of Jada's scores.
The mean of Noah's scores is greater than the mean of Jada's scores.
Noah scored better than Jada on every assignment.
Using only Noah's scores, the mean is equal to the median
d
e

Answers

Answer:

The correct statements are b, c and e.

Step-by-step explanation:

Consider the dot plot for Noah and Jada's score in the trivia game.

From the dot plot it is quite clear that the data form a bell-shaped curved or a normal curve.

For the normal distribution:

Mean = Median = Mode

Noah's mean score = 5

Jada's mean score = 3

The standard deviation of a data set is the measure of dispersion of the observations of that data set from their mean.

On closely studying the graphs we can see that the Noah and Jada's scores are almost at a same distance from the mean, i.e. the spread of Noah's score is same as the spread of Jada's score.

So, the correct statements are:

b. The standard deviation of Noah's scores is equal to the standard deviation of Jada's scores.

c. The mean of Noah's scores is greater than the mean of Jada's scores.

e. Using only Noah's scores, the mean is equal to the median

The two-way frequency table below shows data on years working with the company and college degree status for Tom's coworkers. Complete the following two-way table of row relative frequencies. (If necessary, round your answers to the nearest hundredth.)

Answers

Answer:

Lets start with the top row.

First, add the two values.

5+14=19

Now, divide each value by the total.

5/19=0.26315789473

Round the decimal to the nearest hundredth.

5/19=0.26

14/19=0.73684210526

Round it to the nearest hundredth.

14/19=0.74

Now, The second row.

Add the two values.

16+7=23

Divide the first value by the total.

16/23=0.69565217391

Round it to the nearest hundredth.

16/23=0.70

Divide the second value by the total.

7/23=0.30434782608

Round to the nearest hundredth.

7/23=0.30

Done!

Answer:

Row 1: 0.26 0.74

Row 2: 0.70 0.30

Step-by-step explanation:

Khan

I am doing a online course on rational expressions, specifically complex fractions without variables, does anyone know what happens in the explanation where I marked it in red. I don't know what they did to get 15/14

Answers

Answer:

see below

Step-by-step explanation:

9/ 14

----------

3/5

9/14 ÷ 3/5

Copy dot flip

9/14 * 5/3

Rewriting

9/3 * 5/14

3 * 5/14

Multiply 3*5

15/14

Change from an improper fraction to a mixed number

14/14 + 1/14

1 1/14

Answer:

[tex]\boxed{\mathrm{view \ explanation}}[/tex]

Step-by-step explanation:

9/14 × 5/3

The factors can be canceled if they are factors of both the numerator of the first fraction and the denominator of the second fraction. The factors get cancelled leaving the second fraction to a whole number.

3/14 × 5

(3 × 5)/14

15/14

5. Eight adults and six children travel in a cable car.
Estimate the total mass of the people in the cable car.​

Answers

Answer: 1880 pounds

Step-by-step explanation: when you take the average adult weight, around 160 lbs. you multiply that by eight. you get 1280. then you estimate that each of the children weigh around 100 lbs, then you add 600 to 1280 and get 1,880 lbs

Find the area of quadrilateral ABCD. [Hint: the diagonal divides the quadrilateral into two triangles.]
A. 28.93 units²
B. 29.98 units²
C. 29.79 units²
D. 30.73 units²

Answers

Answer:

Area of quadrilateral ABCD = 29.79 units² (Approx)

Step-by-step explanation:

Area of triangle ABD

s = (3.48+8.66+8.6) / 2

s = 10.37

Area of triangle ABD = √10.37(10.37-8.66)(10.37-8.6)(10.37-3.48)

Area of triangle ABD = √212.4616

Area of triangle ABD = 14.5760625 unit²

Area of triangle ACD

s = (3.54+8.84+8.6) / 2

s = 10.49

Area of triangle ACD = √10.49(10.49-8.6)(10.49-8.84)(10.49-3.54)

Area of triangle ACD = √227.3558

Area of triangle ACD = 15.0783222 unit²

Area of quadrilateral ABCD = Area of triangle ABD + Area of triangle ACD

Area of quadrilateral ABCD = 14.5760625 unit² + 15.0783222 unit²

Area of quadrilateral ABCD = 29.6542units²

Area of quadrilateral ABCD = 29.79 units² (Approx)

What type of number is that? Multiple answers.

Answers

Answer:

A & C

Step-by-step explanation:

-9 is a whole number is rational

solve for -5x-13(2+x)=5x-10

Answers

Answer:

[tex]x=-\frac{16}{23}[/tex]

I hope this helps!

The answer would be is x= -2

What are the solutions to the quadratic equation 4x2 = 64? A. x = −16 and x = 16 B.x = −8 and x = 8 C.x = −4 and x = 4 D.x = −2 and x = 2

Answers

Answer:

x = ±4

Step-by-step explanation:

4x^2 = 64

Divide each by 4

4x^2 /4= 64/4

x^2 = 16

Take the square root of each side

sqrt(x^2) = ±sqrt(16)

x = ±4

Answer:

[tex]\boxed{\boxed{x=\pm 4}}[/tex]

Step-by-step explanation:

[tex]4x^2 = 64[/tex]

Divide both sides by 4.

[tex](4x^2)/4 = 64/4[/tex]

Simplify.

[tex]x^2 =16[/tex]

Take the square root on both sides.

[tex]\sqrt{x^2 } =\pm \sqrt{16}[/tex]

Simplify.

[tex]x=\pm 4[/tex]

Quadrilateral ABCD is inscribed in a circle. m∠A is 64°, m∠B is (6x + 4)°, and m∠C is (9x − 1)°. What is m∠D?

Answers

Answer:

m∠D = 97.34°

Step-by-step explanation:

Concept used"

sum of all angles of Quadrilateral is 360 degrees.

If any Quadrilateral is inscribed in circles then sum of opposite angle of that Quadrilateral is 180 degrees

________________________________________________

Given

Quadrilateral ABCD is inscribed in a circle

thus,

pair of opposite angles will be

m∠A and m∠C

m∠B and m∠D

thus,

m∠B + m∠D = 180

Thus,

m∠A + m∠C = 180

64+  (9x - 1) = 180

9x = 180 - 63 + 1 = 118

x = 118/9 = 13.11

thus, value of

m∠B is (6x + 4)°

m∠B = (6*13.11 + 4)°  = 82.66°

m∠B + m∠D = 180

82.66 + m∠D = 180

m∠D = 180 - 82.66 = 97.34°

Thus,

m∠D is 97.34°

Other Questions
Watch the video Teen Stress. Now, imagine that a friend confides in you that he is going to the doctor because he feels that stress might be affecting his blood pressure. He wants you to help him develop a list of questions to ask the doctor. Come up with five questions for your friend to ask about stress and blood pressure. A triangle has a base that is increasing at a rate of 18 mm per minute with the height being held constant. What is the rate of change of the area of the triangle if the height is 7 mm Simplify.20 vAssume that the variable represents a positive real number. Think about a time you were surprised about something that happened to you. It could be a happy surprise or a disappointment. Write about the event. You are requested to write a personal narrative of about 200 to 250 words. You must include the following points: When and where you got the surprise What was the surprise (happy or disappointment) What were your feelings What statement was true about the English and French colonies? Question 11 options: A) New France had a smaller population. B) Both colonies encouraged religious freedom. C) Neither nation wanted the colonists to run their own colonies. D) Both countries had urban populations who moved to the colonies. The main purpose of the War Powers Act was to Group of answer choices show support for the troops. strengthen the president's powers as commander-in-chief. overrule a decision of the Supreme Court enhancing the president's ability to conduct war. rein in the war-making ability of the president. reassert Congress's budgetary authority over the financing of wars. The budgeted conversion costs for a just-in-time cell are $244,720 for 3,800 production hours. Each unit produced by the cell requires 45 minutes of cell process time. During the month, 2,100 units are manufactured in the cell. The estimated materials cost is $50 per unit. What would be the journal entry to record the materials purchased on account to produce 2,200 units It always travels at 3108 m/s. Please help me I don't know which one. Incident action planning and strategic communication planning A. should be contracted to incident action planning specialists during emergency responses. B. are both managed by the planning section chief. C. have no relationship. D. are related because the first step to each is understanding the situation. In trapezoid ABCD, AB CD , mA=90, AD=8 in, DC=9 in, CB=10 in, and B is acute. Find DB. HELP! WIll MARK BRAINLIEST! ACME Hardware is introducing a new product called Greener Cleaner. Complete the table by finding the cost per milliliter for each size based on the sales price. One liter is 1,000 milliliters. (Answer the questions too, please!) n 2017, the Pew Research Center published the results of a survey on gun ownership. A random sample of 3930 Americanadults aged 18 years and older participated in this survey. Of these 3930 individuals, 1269 individuals reported that theyowned at least one gun. Of these self-reported gun owners, 850 said the reason they owned a gun was for protection. Based onthis information, determine the sample proportion, p, of gun owners from this survey who own a gun for protection.(Use decimal notation. Give your answer to three decimal places.) A pool ball moving 1.83 m/s strikes an identical ball at rest. Afterward, the first ball moves 1.15 m/s at a 23.3 degrees angle. What is the y-component of the velocity of the second ball? A 20-year-old woman wants to purchase a $100,000 one-year life insurance policy. What should the insurance company charge the woman for the policy if it wants an expected profit of $50? Find the smallest value of $x$ such that $x^2 + 10x + 25 = 8$.[tex]Find the smallest value of $x$ such that $x^2 + 10x + 25 = 8$.[/tex] You purchased a machine for $1.19 million three years ago and have been applying straight-line depreciation to zero for a seven-year life. Your tax rate is 40%. If you sell the machine today (after three years of depreciation) for $724,000, what is your incremental cash flow from selling the machine? A pension fund manager is considering three mutual funds. The first is a stock fund, the second is a long-term government and corporate bond fund, and the third is a T-bill money market fund that yields a sure rate of 5.5%. The probability distributions of the risky funds are: Expected Return Standard Deviation Stock fund (S) 15 % 32 % Bond fund (B) 9 % 23 % The correlation between the fund returns is 0.15. What is the Sharpe ratio of the best feasible CAL? Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl-3-heptene D. 2,5-dimethyl-4-heptene let p and p+2 be prime numbers (i.e they are twin primes) with p>3. Show that 6|(p+1)