What type of oxide is each of the following? NO2, CO, Fe2O3, Al2O3, P20,​

Answers

Answer 1

Nitrogen Dioxide

Carbon Monoxide

Iron (II) Oxide

Aluminum Oxide

DiPhosphorus Monoxide


Related Questions

what is the bond energy required to break one mole of carbon-carbon bonds​

Answers

Answer:

100 kcal of bond energy

A central atom has two lone pairs on opposite sides and four single bonds. What is the molecule geometry of the result?

A. octahedral

B. tetrahedral

C. square planar

D. linear

Answers

The correct answer is C. square planar

According to the Valence Shell Electron Pair Repulsion Theory(VSEPR), The shape of a molecule depends on the number of electron pairs in the molecule.

VSEPR theory was first coined by Gillespie  and Nyhlom in 1957 as an improvement over the Sidgwick - Powell theory.

According to this theory, the shape of a molecule is determined by the number of electron pairs that surround the valence shell of the central atom in the molecule.  The electron pairs are positioned as far apart in space as possible to minimize repulsion of electron pairs.

However, the presence of lone pairs distorts the shape anticipated for the molecule on the basis of VSEPR.

For a molecule having six electron pairs, an octahedral geometry is expected(electron domain geometry). However, the presence of two lone pairs which are positioned at opposite side of the four single bonds leads to an observed square planar molecular geometry.

https://brainly.com/question/13591921

Answer:

square planar

Explanation:

When hydrogen gas reacts with oxygen gas, water vapour is formed according to the
reaction 2H2 + O2 2H2O. If 3.00 mol of hydrogen gas react with 3.00 mol
of oxygen gas, which reactant will be the reactant in excess?

Answers

Explanation:

here's the answer to the question

How did Kepler's discoveries contribute to astronomy?
O They supported the heliocentric model.
O They established the laws of planetary motion.
O They explained how the Sun rises and sets.
O They made astronomy accessible to people who spoke Italian.
They made astronomy accessible to people who spoke italian

Answers

Answer:

"They established the laws of planetary motion"

Explanation:

Mr. Kepler was the astronomer who came up with the "Laws of Planetary Motion."

a. You have a stock solution of 14.8 M NH3. How many milliliters of this solution should you dilute to make 1000.0 mL of 0.250 M NH3?
b. If you take a 10.0 mL portion of the stock solution and dilute it to a total volume of 0.500 L, what will be the concentration of the final solution?

Answers

Answer:A) V = 16.892 ml

Explanation:

M1 * V1 = M2 * V2

14.8 M * V1 =0.250 M * 1000 ml

V1 = 16.892 ml

a. The volume of 16.89 milliliters of the stock solution of 14.8 M  should be diluted to make 1000.0 mL of 0.250 M.

b. The concentration of the final solution is 0.296 M.

What is the dilution law?

The concentration or the volume of the concentrated or dilute solution can be calculated by using the equation:

M₁V₁ = M₂V₂

where M₁ and V₁ are the concentration and volume of the concentrated solution respectively and M₂ and V₂ are the concentration and volume of the dilute solution.

A stock solution is a solution that has a high concentration and that will be diluted to a low concentration by the addition of water in it.

Given, a stock solution of concentration, M₁ = 14.8 M

The concentration of the diluted solution, M₂ = 0.250 M

The volume of diluted solution, V₂  = 1000ml

Substitute the value of the molarity and volume in equation (1):

(14.8)× (V₁) = (1000) × (0.250)

V₁ = 16.89 ml

Similarly, for part (b): M₁ = 14.8 M, V₁ = 10 ml and V₂  = 0.5L = 500 ml

(14.8)× (10) = (500) × (M₂)

M₂ = 0.296 M

Learn more about dilution law, here:

https://brainly.com/question/15718488

#SPJ5

# of protons
# of neutrons
# of electrons
Atomic Number
Mass Number
18
17
35
17
37
6
8
6
6
15

Answers

Answer:

35

Explanation:

is the answer for your question

Please help 15 points
What is the change in electrons for nitrogen in the
following reaction?
S + NO3 --> SO2 + NO

Answers

Nitrogen gained 4 electrons.

Because Nitrogen's redox number went from +6 to +2, it must have gained 4 electrons (-4) in order to achieve this number. Thus, Nitrogen is reduced.

Which substance will sublimate when in the solid phase at room temperature and pressure?
Select the correct answer below:

A) carbon dioxide
B) water
C) mercury
D) helium

Answers

Answer:

I think carbon dioxide is right answer

c ) mercury













that’s the correct answer

What are the effects of global warming?​

Answers

the effects are: temperature rises, water shortages, and increased fire threats

Two common methods to generate an aldehyde is by oxidation of an alcohol and through ozonolysis.

a. True
b. False

Answers

Answer:

a. True.

Explanation:

Only primary and secondary alcohols can oxidise to give an aldehyde. But a weak oxidizing agent must be used to prevent formation of a carboxylic acid or ketone.

weak oxidizing agents: Chromyl chloride, silver/oxygen/500°C

take an example of ethanol:

[tex]{ \bf{CH _{3} CH_{2}OH \: \: \frac{Ag/O_{2} }{500 \degree C} > \: \:CH _{3} CHO}}[/tex]

[tex]{ \sf{CH _{3} CHO \: \: is \: ethanal}} [/tex]

By ozonolysis:

Here, reactants are Ozone gas, Carbon tetrachloride at a temperature (<20°C), ethanoic acid, zinc and water.

take an example of propanol:

if it undergoes ozonolysis, it gives ethanal and methanal.

Answer:

A. True

Explanation:

Only primary and secondary alcohols can oxidise to give an aldehyde. But a weak oxidizing agent must be used to prevent formation of a carboxylic acid or ketone.

weak oxidizing agents: Chromyl chloride, silver/oxygen/500°C

take an example of ethanol:

By ozonolysis:

Here, reactants are Ozone gas, Carbon tetrachloride at a temperature (<20°C), ethanoic acid, zinc and water.

take an example of propanol:

if it undergoes ozonolysis, it gives ethanal and methanal.

Identify the true statements regarding hydrogen bonding. Select all that apply. Group of answer choices Hydrogen bonding occurs when a hydrogen atom is covalently bonded to an N, O, or F atom.

Answers

Answer:

True

Explanation:

Hydrogen bonding occurs when hydrogen is covalently bonded to a highly electronegative element such as N, O, or F.

Hydrogen bonding affects several physical properties of molecules in which it occur. For example, the high boiling point of water is caused by intermolecular hydrogen bonding irrespective of the low relative molecular mass of water.

The statement stating the presence of hydrogen bonding between the hydrogen and N, O, and F has been true.

Hydrogen bonding has resulted when the electrostatic interaction has been found in the atoms that have been more electronegative than the Hydrogen atoms.

The electrostatic force helps in attracting the atoms towards the hydrogen and thereby the hydrogen bonding takes place. It has been a weak force present in the molecules. The hydrogen bonding can be easily breakable.

For more information about hydrogen bonding, refer to the link:

https://brainly.com/question/10904296

PLEASE HELP!!
this is on USAtestprep
a)
b)
c)
d)

Answers

Answer:

B

Explanation:

the fluorine has an high tendency to gain electrons from other elements with lower electronegativities

Determine the number of hydrogen atoms connected to each carbon atom: The bond-line structure of a compound has a SMILES string of CC1CCN(CC1N(C)C2=NC=NC3=C2C=CN3)C(=O)CC#N. All the carbon atoms of the compound are highlighted and labeled a through p.

Answers

Answer:

dsgsdfd

Explanation:

A s'more requires 2 graham cracker squares, 1 marshmallow, and 3 chocolate pieces. If an entire chocolate bar contains 12 chocolate pieces, a marshmallow bag contains 40 marshmallows, and a graham cracker package contains 48 squares, how many s'mores can you make from 8 chocolate bars, one bag of marshmallows, and a package of graham crackers?

Answers

Explanation:

try 96 if that's not right let me know and I'll try to fix it

Answer:24

Explanation:

What is the maximum number of electrons in the following energy level?
n = 4

Answers

Answer: 32 electrons

Explanation:

What does X represent in the following reaction?
239 239
93NP → 94Pu + X
A) a neutron
C) an alpha particle
B) a proton
D) a beta particle

Answers

Answer:

D. beta particle

Explanation:

Pu has 94 protons which is only one more than Np (93), that means beta decay. Atomic mass stays the same in beta decay. Beta is very small particle so atomic mass stays at 239.

The given reaction is an example of beta decay where the atomic number of the nuclei increases by one unit and mass number remains unchanged. Therefore, the particle X is a beta particle or an electron.

What is beta decay?

Heavy unstable isotopes of atoms undergoes nuclear decay by the emission of charged particles such as alpha or beta particle. In alpha decay, the helium nuclei is emitted and in beta decay, electrons are emitted.

In alpha decay, the mass number of the nuclei decreases by 4 units and atomic number by 2 units. In beta decay, the mass number does not change but the atomic number increases by one unit.

Neptunium undergoes beta decay and forms the plutonium nuclei. Thus X is a beta particle. The reaction is written as follows:

[tex]\rm _{93} ^{239}Np \rightarrow _{94}^{239}Pu + _{-1}^{0}e[/tex]

To find more on beta decay, refer here:

https://brainly.com/question/25455333

#SPJ2

Which of the following is an example of a physical, rather than a chemical, change?

Answers

Answer: The question is not clear

Explanation:

how is the Sun classified?
A as a giant star
B as a medium star
C as a white star as a neutron star
D as a white dwarf​

Answers

Answer:

As a giant star.

Explanation:

A

How many moles of iron is equivalent to 4.45 x 10^22 atoms of iron

Answers

Answer:

0.074 moles

Explanation:

For every mole (of any element), there are 6.022 x 10^23 atoms.

There are 4.45 x 10^22 atoms of iron.

To find the moles we divide the number of atoms by Avogadro's number

4.45 x 10^22 / 6.022 x 10^23 = 0.0738957

Don't forget sig figs

Answer:

[tex]\boxed {\boxed {\sf 0.0739 \ mol \ Fe}}[/tex]

Explanation:

We are asked to convert a number of iron atoms to moles of iron.  

We will use Avogadro's Number for this, which is 6.022 × 10²³. This is the number of particles (atoms, molecules, formula units, etc.) in 1 mole of a substance. For this problem, the particles are atoms of iron. There are 6.022 ×10²³ atoms of iron in 1 mole of iron.  

We will also use dimensional analysis to solve this problem. To do this, we use ratios. Set up a ratio using the underlined information.

[tex]\frac {6.022 \times 10^{23} \ atoms \ Fe} {1 \ mol \ Fe}[/tex]

Since we are converting 4.45 × 10²² atoms of iron to moles, we multiply the ratio by that value.

[tex]4.45 \ \times 10^{22} \ atoms \ Fe *\frac {6.022 \times 10^{23} \ atoms \ Fe} {1 \ mol \ Fe}[/tex]

Flip the ratio. The value is the same, but it allows us to cancel the units of atoms of iron.

[tex]4.45 \ \times 10^{22} \ atoms \ Fe *\frac {1 \ mol \ Fe}{6.022 \times 10^{23} \ atoms \ Fe}[/tex]

[tex]4.45 \ \times 10^{22} *\frac {1 \ mol \ Fe}{6.022 \times 10^{23}}[/tex]

Condense into 1 fraction.

[tex]\frac {4.45 \ \times 10^{22} }{6.022 \times 10^{23}} \ mol \ Fe[/tex]

[tex]0.07389571571 \ mol \ Fe[/tex]

The original measurement of atoms ( 4.45 × 10²²) has 3 significaint figures, so our answer must have the same. For the number we calculated, that is the ten-thousandths place. The 9 to the right of this place (0.07389571571) tells us to round the 8 up to a 9.

[tex]0.0739 \ mol \ Fe[/tex]

There are approximately 0.0739 moles of iron in 4.45 × 10²² atoms of iron.  

Which is the electronic configuration for oxygen?

Answers

the answer is [He] 2s² 2p⁴

What is the difference between the chemical formula of water and carbon dioxide?

Answers

The chemical formula of water is H2O, and the chemical formula of carbon dioxide is CO2. This means that water has 2 atoms of hydrogen and 1 atom of oxygen, which carbon dioxide has 1 atom of carbon and 2 atoms of oxygen. The only similar atom that the two molecules have in common is oxygen. CO2 has one more atom of oxygen than H2O. Hope this helps!

H2O is water. CO2 is CD.

Which of the following statements is true about what happens in all chemical reactions? A. The ways in which atoms are joined together is not changed. B. Bonds between atoms are broken and new bonds are formed. C. The final substances are called reactants.

Answers

Answer:

B.bonds are broken and new bonds are formed

how hydrogen chloride gas is prepared on labrotary by conc sulpheric acid

Answers

Answer:

It is prepared small amounts of hydrogen cloride for uses in the lab.

It can be  "generated in an HCl generator by dehydrating hydrochloric acid with either sulfuric acid or anhydrous calcium chloride."

A wavelength of 489.2 nm is observed in a hydrogen spectrum for a transition that ends in the nf level of the Balmer series. What was ni for the initial level of the electron

Answers

Answer:

[tex]n_1=4[/tex]

Explanation:

From the question we are told that:

Wavelength [tex]\lambda=489.2 nm =>4.86*10^{-7}[/tex]

nf level= Balmer series

nf level= 2

Generally the equation for Wavelength is mathematically given by

[tex]\frac{1}{\lambda}=R[\frac{1}{nf^2}-\frac{1}{n_1^2}][/tex]

Where

[tex]R=Rydberg Constant[/tex]

[tex]R=1.097*10^7[/tex]

Therefore

[tex]\frac{1}{4.86*10^{-7}}=1.097*10^7[\frac{1}{2^2}-\frac{1}{n_1^2}][/tex]

[tex]n_1=4.0021[/tex]

[tex]n_1=4[/tex]

pplication)Using multiple models simultaneously: This FNT refers to a processinvolving three moles of a diatomic gas (which behaves as an ideal gas).The PV curve at right describes this process.Assume, as is typical near room temperature,vibrational modes are frozen out.a)Determine the energy transferred as work, the change in internal energy, and the energy transferred as heat in this process. b)Could youhave stillansweredthe questions in a) if the temperature was not provided on the plot

Answers

Complete Question

Questions Diagram is attached below

Answer:

*  [tex]W=1142.86Joule[/tex]

*  [tex]Q=997.7J[/tex]

*  [tex]H=2140.5J[/tex]

Explanation:

From the question we are told that:

Temperature [tex]T=337K[/tex]

Pressure [tex]P=(60-55)Pa*10^5[/tex]

Volume[tex]V=(1.6-1.4)m^3*10^{-3}[/tex]

Generally the equation for gas Constant is mathematically given by

[tex]\frac{P_2}{P_1}=\frac{V_1}{V_2}^n[/tex]

 [tex]\frac{55*10^5}{60*10^5}=\frac{1.4*10^{-3}}{1.6*10^{-3}}^n[/tex]

 [tex]n=0.65[/tex]

Therefore

Work-done

 [tex]W=\int{pdv}[/tex]

 [tex]W=\frac{55*10^5*1.6*10^{-3}*60*10^5*1.4*10^{-3}}{1-0.65}[/tex]

 [tex]W=1142.86Joule[/tex]

Generally the equation for internal energy is mathematically given by

 [tex]Q=mC_vdT\\\\Q=\frac{3*1*3.314*16}{1.4-1}[/tex]

 [tex]Q=997.7J[/tex]

Therefore

 [tex]H=Q+W[/tex]

 [tex]H=997.7J-11.42.9[/tex]

 [tex]H=2140.5J[/tex]

A chunk of a metal alloy displaces 0.58 L of water and has a mass of 2.9 kg. What is the density of the alloy in g/cm3?

Answers

Answer:

5g/cm3

Explanation:

firstly convert the litres and kilograms to grams and centimeters.

1l is equivalent to 1000cm3

0.58×1000

580cm3

and 1kg is equivalent to 1000g

2.9×1000

2900

then find the density by using the formula

density=mass/volume

=2900g/580cm3

=5g/cm3

I hope this helps

Describe a NAMED example of a non-equilibrium system with respect to it’s energetic nature and equilibrium status.

Answers

Answer:

Non-equilibrium thermodynamics is a branch of thermodynamics that deals with physical systems that are not in thermodynamic equilibrium but can be described in terms of variables (non-equilibrium state variables) that represent an extrapolation of the variables used to specify the system in thermodynamic equilibrium.

Explanation:

For a different reaction, the plot of the reciprocal of concentration versus time in seconds was linear with a slope of 0.056 M-1 s -1 . If the initial concentration was 2.2 M, calculate the concentration after 100 seconds. Show your work.

Answers

Answer:

[tex]C_t=0.165M[/tex]

Explanation:

From the question we are told that:

Slope [tex]K=0.056 M-1 s -1[/tex]

initial Concentration [tex]C_1=2.2M[/tex]

Time [tex]t=100[/tex]

Generally the equation for Raw law is mathematically given by

[tex]\frac{1}{C}_t=kt+\frac{1}{C}_0[/tex]

[tex]\frac{1}{C}_t=0.056*100+\frac{1}{2.2}_0[/tex]

[tex]C_t=0.165M[/tex]

The second-order reaction is the reaction that depends on the reactants of the first or the second-order reaction. The concentration after 100 seconds will be 0.165 M.

What is the specific rate constant?

The specific rate constant (k) of the second-order reaction is given in L/mol/s or per M per s. It is the proportionality constant that gives the relation between the concentration and the rate of the reaction.

Given,

Slope (k)= 0.056 per M per s

Initial concentration of the reactant [tex](\rm C_{1})[/tex] = 2.2 M

Time (t) = 100 seconds

The concentration of the reaction after 100 seconds can be given by,

[tex]\rm \dfrac{1}{C_{t}} = kt + \dfrac{1}{C_{1}}[/tex]

Substitute values in the above equation:

[tex]\begin{aligned} \rm \dfrac{1}{C_{t}} &= 0.056 \times 100 + \dfrac{1}{2.02}\\\\&= 0.165 \;\rm M\end{aligned}[/tex]

Therefore, after 100 seconds the concentration is 0.165 M.

Learn more about the order of reaction here:

https://brainly.com/question/14810717

A number is three times the difference between twenty and the number. What is the number?

Answers

Answer:

the number is 7

Explanation:

"Three times" means multiply by 3

"Difference" means subtract

"Sum" means add

3(x - 7) = 23 - (3x + 2)

3x - 21 = 23 - 3x - 2

3x - 21 = 21 - 3x

6x = 42

x = 7

Sean plated an unknown metal onto his silver ring which initially weighed 1.4 g. He constructs an electrolytic cell using his ring as one of the electrodes. After running the cell, 0.022 moles of the unknown metal was plated onto his ring and the mass of the ring increased to 3.137 g. What is the atomic weight of the unknown metal in g/mol

Answers

Answer:

79 g/mol

Explanation:

Mass of unknown metal deposited = 3.137 g - 1.4 g = 1.737 g

Number of moles of metal deposited = 0.022 moles

Since;

Number of moles = reacting mass/molar mass

Molar mass = reacting mass/number of moles

Molar mass = 1.737 g/0.022 moles

Molar mass= 79 g/mol

Other Questions
4. Eric has 54 yards of fencing to use for a flowerbed. Some possible measurements are shown below. For which flowerbeds does Eric have enough fencing? Color in all the possible answers.A.length = 30 yardsarea = 300 square yardsB.length = 20 yardswidth = 5 yardsC.width = 12 yardsperimeter = 48 yardsD.length = 26 yardswidth = 22 yardsE.length = 16 yardswidth = 14 yardsF.width = 9 yardsarea = 162 square yard I need help with these questions from 11 to 20. I already did questions 1 through 10 with my math teacher but I'm not in school so please please please answer all of these answers it would mean a lot to me and would help me a lot with the math homework I need to get done, so yeah. Please help. find the largest 5 digit number which is a perfect square I need help with this question...Q: Five days last month it rained 6.5 inches. It rained 3.5 inches in 7 days last month. How many inches did it rain those 12 days? Convert 56 radians to degrees. Question 1 options: A) 25 B) 150 C) 150 D) 1080 5. How does the relationship between Adam and his parents helpreaders to understand the negative effects of role-reversal? When you exert 75 N on a jack to lift a 6000 N car, what is the jacks actual mechanical advantage? Show your work. Find the missing side of this righttriangle.712X =V[? Which of these is the main cause of habitat fragmentation? O A. Reduction in genetic diversity O B. Migration of mammal species O C. Demand for land use O D. Extinction of bird species Using the following equation, find the center and radius:x2 + 2x + y2 + 4y = 20 determine which of these are either noun-verb-noun , Noun-verb , noun-linking Verb-adjective , or Noun-linking verb-nounwill mark fastest and correct answer brainlist Please help!!! what is x: |6n+7|=8 find the h.c.f of 2357,535 Help please:)) 2. When shipping ice cream, melting is understandably a big concern. You will notice that ice cream is not generally packaged in a cube-shaped container. A standard container of ice cream contains 1 L, or 1000 cm3 of ice cream, a. What would be the optimal dimensions (radius and height) to minimize surface area? b. What would the surface area be? C. Suggest at least two reasons why this is different from the ice cream packaging that you see in the stores. Grease is applied to the moving part of machine. Translate each verbal expression to an algebraic expression. 1. 6 less than the product of a cubed number and 152. The sum of the product of 4 and a squared number and the quotient of 5 and 3. What is 150% of 90?please explain. What is the antonym of courageous?A.sillyB.braveC.smartD.fearful The fluid inside the hydraulic jack has a pressure of 30,000 Pa. If the surface ofthe piston that is used to lift an object is 0.1 min area, how much weight canthe jack lift? Why is the unit of velocity called derived unit?