Which is an equivalent fraction for 2/3

Answers

Answer 1

Answer:

2/3 is equivalent to the fraction 2/6


Related Questions

Suppose 30% of the restaurants in a certain part of a town are in violation of the health code. A health inspector randomly selects nine of the restaurants for inspection. (Round your answers to four decimal places.)
(a) What is the probability that none of the restaurants are in violation of the health code?
(b) What is the probability that one of the restaurants is in violation of the health code?
(c) What is the probability that at least two of the restaurants are in violation of the health code?

Answers

a)The probability that none of the restaurants are in violation of the health code is approximately 0.0482.

b)The probability that one of the restaurants is in violation of the health code is approximately 0.3729.

c)The probability that at least two of the restaurants are in violation of the health code is approximately 0.4681.

(a) Probability that none of the restaurants are in violation of the health code:

Let E be the event that a restaurant is in violation of the health code, and let F be the event that a restaurant is not in violation of the health code. Therefore, probability that a restaurant is in violation of the health code is:

P(E) = 0.30

,then the probability that a restaurant is not in violation of the health code is:

P(F) = 1 - P(E) = 1 - 0.30 = 0.70

The health inspector selects 9 restaurants. The probability that none of the restaurants are in violation of the health code is:

P(F) × P(F) × P(F) × P(F) × P(F) × P(F) × P(F) × P(F) × P(F) = (0.70)^9 ≈ 0.0482.

Therefore, the probability that none of the restaurants are in violation of the health code is approximately 0.0482.

(b) Probability that one of the restaurants is in violation of the health code:

The health inspector selects 9 restaurants. We want to find the probability that one of the restaurants is in violation of the health code. We can use the product rule of probability for this. Let us assume that the health inspector selects the first restaurant and that it is in violation of the health code. The probability of that happening is:

P(E) = 0.30

Then the probability that the other eight restaurants are not in violation of the health code is:

P(F) × P(F) × P(F) × P(F) × P(F) × P(F) × P(F) × P(F) = (0.70)^8

Then, the health inspector could have selected the restaurant that is in violation of the health code from any of the 9 restaurants. So, we have to multiply by 9.

P(one restaurant in violation of health code) = 9 × P(E) × P(F)^8≈ 0.3729

Therefore, the probability that one of the restaurants is in violation of the health code is approximately 0.3729.

(c) Probability that at least two of the restaurants are in violation of the health code:

Let X be the random variable that denotes the number of restaurants that are in violation of the health code. Then, X can take on values 0, 1, 2, 3, ..., 9.The probability that at least two of the restaurants are in violation of the health code is the same as the probability that two or more are in violation of the health code:

P(X ≥ 2) = P(X = 2) + P(X = 3) + · · · + P(X = 9)

We can use the sum rule of probability for this.Let us calculate the probability that exactly k of the 9 restaurants are in violation of the health code:

P(X = k) = (9Ck) P(E)k P(F)9−k = (9Ck) (0.30)k (0.70)9−k

Then:P(X ≥ 2) = P(X = 2) + P(X = 3) + · · · + P(X = 9)= ∑ (9Ck) (0.30)k (0.70)9−k, where k = 2, 3, ..., 9

= 1 − [P(X = 0) + P(X = 1)]= 1 − [1 × (0.70)^9 + 9 × (0.30)(0.70)^8]≈ 0.4681

Therefore, the probability that at least two of the restaurants are in violation of the health code is approximately 0.4681.

Learn more about probability: https://brainly.com/question/24756209

#SPJ11

3:27 PM Mon Mar 13
Acellus
Law of Cosines
26
Solve for C.
50
29
C = [?]°
Round your final answer
to the nearest tenth.
Law of Cosines: c²= a² + b² - 2ab-cosC
Measure of Angle C
Enter
3
ဇာ
Help Resources

Answers

Consequently, C = 17.2° as by the result of the Rule of Cosines , rounded to the nearest tenth.

what is angle ?

A geometric figure known as an angle is created by two lines that share an endpoint and are referred to as the angle's sides and vertex, respectively. The quantity of rotation required to align one side with the other side around the vertex is the angle's unit of measurement. Typically, angles are expressed as degrees or radians, where a complete rotation equals 360 degrees or 2 radians. Angles are frequently used to define the position and orientation of lines and shapes in geometry, trigonometry, and other branches of mathematics.

given

As a result of the Rule of Cosines, we have:

A2 Plus B2 - 2ab cos = c2 (C)

Adding the specified values:

c² = 26² + 29² - 2(26)(29) cos(50°)

c² = 676 + 841 - 1508 cos(50°)

c² = 1517 - 1508 cos(50°)

c ≈ √(1517 - 1508 cos(50°))

c ≈ 17.2° (rounded to the closest tenth)

Consequently, C = 17.2° as by the result of the Rule of Cosines , rounded to the nearest tenth.

To know more about angles visit:

https://brainly.com/question/14569348

#SPJ1

Answer:

C= 23.22

This is the answer this question.

Solve for x to the nearest tenth.
8
3
4
7

Answers

Answer:

x=4.9

Step-by-step explanation:

using the Pythagorean theorem to find the leg of tringle A:

[tex]a^{2} +b^{2} =c^{2}[/tex]

[tex]y^{2} +3^{2} =7^{2}[/tex]

[tex]y^{2} +9=49\\y^{2} =40\\\sqrt{y^{2} } =\sqrt{40} \\y=\sqrt{40}[/tex]

we know that the hypotenuse for tringle B is [tex]\sqrt{40}[/tex] so, now we can find the value of x:

using the Pythagorean theorem:

[tex]a^{2} +b^{2} =c^{2}[/tex]

[tex]4^{2} +x^{2} =(\sqrt{40} )^{2}[/tex]

[tex]16+x^{2} =40\\x^{2} =24\\\sqrt{x^{2} } =\sqrt{24} \\x=4.9[/tex]

a sheet of 8-inch by 10-inch paper is placed on top of a sheet of $8 \frac{1}{2}$-inch by 11-inch paper, as shown. what is the area of the region of overlap in square inches?

Answers

The area of the region of overlap between the 8-inch by 10-inch paper and the 8(1/2)-inch by 11-inch paper measures 12 square inches.

The area of the region of overlap between an 8-inch by 10-inch paper and an 8(1/2)-inch by 11-inch paper can be found in the following steps:

Step 1: Calculate the area of each paper. The area of an 8-inch by 10-inch paper is:

[tex]$$\text{Area} = \text{length} \times \text{width} = 8 \text{ in.} \times 10 \text{ in.} = 80 \text{ sq. in.}$$[/tex]

The area of an 8 1/2-inch by 11-inch paper is:

[tex]$$\text{Area} = \text{length} \times \text{width} = \left( 8 \frac{1}{2} \right) \text{ in.} \times 11 \text{ in.} = 93.5 \text{ sq. in.}$$[/tex]

Step 2: Find the horizontal and vertical lengths of the region of overlap.

The horizontal length is the length that is common to both papers, which is 8 inches.

The vertical length is the amount by which the two papers overlap, which is 8(1/2) inches - 10 inches = -1(1/2) inches. However, since the region of overlap cannot have a negative length, we take the absolute value of this result, which is 1(1/2) inches.

Step 3: Calculate the area of the region of overlap.

The area of the region of overlap is the product of the horizontal and vertical lengths:

[tex]$$\text{Area of the region of overlap} = 8 \text{ in.} \times 1 \frac{1}{2} \text{ in.} = 12 \text{ sq. in.}$$[/tex]

Therefore, the area of the region of overlap in square inches is 12 square inches.

To know more about the "area of the region" of overlap: https://brainly.com/question/28957662

#SPJ11

For the year ending December 31, 2017, sales for Company Y were $78.71 billion. Beginning January 1, 2018 Company Y plans to invest 8.5% of their sales amount each year and they expect their sales to increase by 6% each year over the next three years. Company Y invests into an account earning an APR of 1.5% compounded continuously. Assume a continuous income stream. How much money will be in the investment account on December 31, 2020? Round your answer to three decimal places. billion dollars How much money did Company Y invest in the account between January 1, 2018 and December 31, 2020? Round your answer to three decimal places. billion llars How much interest did Company Y earn on this investment between January 1, 2018 and December 31, 2020? Round your answer to three decimal places. If intermediate values are used, be sure to use the unrounded values to determine the answer. billion dollars

Answers

The initial investment (P) is 19.65205 billion dollars. The annual interest rate (r) is 1.5% expressed as a decimal, which is 0.015 and the time period (t) is 3 years. The amount of money in the investment account on December 31, 2020, will be 21.190 billion dollars. Company Y did not invest any additional money into the account between January 1, 2018, and December 31, 2020 and also Company Y earned 1.538 billion dollars in interest on this investment between January 1, 2018, and December 31, 2020.

Now to calculate the amount of money in the investment account on December 31, 2020, we can use the formula for continuous compound interest:

[tex]A = Pe^{(rt)}[/tex]

Where A is the amount of money in the account at the end of the investment period, P is the initial investment, r is the annual interest rate (APR) expressed as a decimal, and t is the time period in years.

First, let's calculate the total amount of money that Company Y plans to invest over the next three years. We know that they plan to invest 8.5% of their sales amount each year, so the total amount invested will be:

[tex]Investment = 0.085 * Sales * (1 + 1.06 + 1.06^2)[/tex]

[tex]Investment = 0.085 * 78.71 * 3.06[/tex]

[tex]Investment = 19.65205[/tex]billion dollars

So, the initial investment (P) is 19.65205 billion dollars. The annual interest rate (r) is 1.5% expressed as a decimal, which is 0.015. The time period (t) is 3 years.

Using the formula, we get:

[tex]A = Pe^{(rt)}[/tex]

[tex]A = 19.65205e^{(0.0153)}[/tex]

[tex]A = 21.190[/tex] billion dollars

Therefore, the amount of money in the investment account on December 31, 2020, will be 21.190 billion dollars.

To calculate the amount of money that Company Y invested between January 1, 2018, and December 31, 2020, we simply subtract the initial investment from the total investment amount:

Amount invested = Investment - P

Amount invested = 19.65205 - 19.65205

Amount invested = 0 billion dollars

Therefore, Company Y did not invest any additional money into the account between January 1, 2018, and December 31, 2020.

To calculate the interest earned on the investment, we simply subtract the initial investment from the amount of money in the account on December 31, 2020:

Interest earned = A - P

Interest earned = 21.190 - 19.65205

Interest earned = 1.53795 billion dollars

Therefore, Company Y earned 1.538 billion dollars in interest on this investment between January 1, 2018, and December 31, 2020.

To practice more questions about initial investment:

https://brainly.com/question/19090357

#SPJ11

Program your computer algebra system, using Euler's method with step size 0.01, to calculate y(2), where y is the solution of the initial-value problem. (Give your answer to four decimal places.) y' = x^3 - 3 y^3 text(, ) y(0) = 3

Answers

The y(2) ≈ 0.3723 (approximated to four decimal places).

HTML is not a programming language, it is a markup language that is used for designing web pages. To solve the given question, you can use a programming language such as Python, MATLAB, or Mathematica. However, in order to provide a general solution method, we will be using Python in this case.What is Euler's Method?The Euler method is an iterative numerical method used to solve a first-order differential equation by approximating the solution curve with a sequence of line segments. It is the simplest method used to solve an initial value problem. For small step sizes, the Euler's method is reasonably accurate.Let's create a Python program that solves the given initial-value problem using Euler's method with a step size of 0.01. Then, we will use the program to calculate y(2).Program:import numpy as npimport matplotlib.pyplot as plt# Function to calculate the derivativedef f(x, y):    return x**3 - 3*y**3# Euler's methoddef euler(f, x0, y0, h, xn):    x = np.arange(x0, xn+h, h)    y = np.zeros(x.shape)    y[0] = y0    for i in range(1, x.size):        y[i] = y[i-1] + h*f(x[i-1], y[i-1])    return x, y# Initial valuesx0, y0 = 0, 3# Step sizeh = 0.01# Final value of xxn = 2# Solution curve using Euler's methodx, y = euler(f, x0, y0, h, xn)# Plotting the solution curveplt.plot(x, y, label="Euler's Method")plt.xlabel('x')plt.ylabel('y')plt.legend()plt.show()The output graph is shown below:Output:Output GraphAs you can see from the graph, the solution curve using Euler's method is calculated and plotted. Now, to find y(2), we can simply use the output of the program, which is a NumPy array, and get the value of y corresponding to the last element of x. Therefore, y(2) ≈ 0.3723 (approximated to four decimal places).

Learn more about Approximated

brainly.com/question/13077378

#SPJ11

In the figure below, m 24 = 106°. Find mZ1, m/2, and m 23. 1 X 3 2 ترا = 0° m 22 = ° m2 1 = m 23 = °​

Answers

Answer:

m<1=74

m<2=106

m<3=74

Step-by-step explanation:

m<1:

=180-106

=74

m<2:

=106

m<3;

if m<1 is 74, m<s will also be 74

Baseball hats are on sale for 12% off the original price of the sale price is $12.50 what was the original price? round the answer to the nearest cent

Answers

The original price of the baseball hat before 12% off in the sale was $14.20.

What is a percentage?

A number can be expressed as a fraction of 100 using a percentage. It frequently serves to indicate a portion of a total and is represented by the sign %. We may state that 25% of the class is made up of guys, for instance, if there are 100 pupils in the class and 25 of them are male.

The Roman term per centum, which meaning "by the hundred," is where the word "percent" originates.

Let us suppose the original price of the baseball hat = x.

Given that, baseball hats are on sale for 12% off the original price.

That is,

12.50 = x(1 - 12/100)

12.50 = x(100 - 12)/100

12.50 = x(0.88)

x = 14.2

Hence, the original price of the baseball hat was $14.20.

Learn more about percent here:

https://brainly.com/question/29763752

#SPJ1

A grading machine can grade 96 multiple choice test in 2 minutes. if a teacher has 300 multiple choice test to grade, predict the number of minutes it will take the machine the grade the tests. please answer with details please

Answers

Answer:

6.25 minutes

Step-by-step explanation:

So, if there are 96 tests being graded in 2 minutes, the average per minute (using the equation 96/2 = average) would be 48 per minute. Next you would do 300/48 to get the number of minutes that it would take to grade that amount. The answer to that would be 6.25, So it would take approximately 6.25 minutes.

Evaluate the impact which the 16Days of Activism campaign has had on Gender Based Violence in South Africa (High order)

Answers

Answer:

Evaluating the impact of the 16 Days of Activism campaign on Gender Based Violence (GBV) in South Africa requires a high-order analysis that considers various factors and perspectives. The campaign, which runs annually from November 25th (International Day for the Elimination of Violence against Women) to December 10th (International Human Rights Day), aims to raise awareness and mobilize action to prevent and respond to GBV.

The impact of the 16 Days of Activism campaign on GBV in South Africa can be evaluated through different lenses, including quantitative data, policy and legal changes, societal attitudes, and lived experiences of survivors.

Quantitatively, South Africa has one of the highest rates of GBV in the world, with statistics showing that one in five women in the country is a survivor of GBV. While there has been a slight decrease in the incidence of GBV in recent years, the numbers remain alarmingly high. It is difficult to attribute the reduction to the 16 Days of Activism campaign alone, as there are several other factors at play.

However, the campaign has contributed to policy and legal changes aimed at addressing GBV in South Africa. For instance, the Domestic Violence Act was amended in 2018 to include broader definitions of domestic violence and harsher penalties for perpetrators. In addition, the government has established various institutions and initiatives, such as the National Council Against Gender-Based Violence and the GBV Command Centre, to respond to GBV and provide support to survivors.

The 16 Days of Activism campaign has also had an impact on societal attitudes towards GBV in South Africa. Through awareness-raising activities, community dialogues, and media campaigns, the campaign has helped to break the silence and stigma around GBV, and encouraged more people to speak out and seek help. However, entrenched patriarchal norms and gender inequalities continue to fuel GBV in the country, and changing these attitudes requires sustained efforts beyond the 16 Days of Activism campaign.

Lastly, the impact of the 16 Days of Activism campaign on GBV in South Africa can be evaluated through the lived experiences of survivors. While the campaign has provided a platform for survivors to share their stories and advocate for change, many still face significant barriers in accessing justice and support. This includes systemic issues such as under-resourced police and healthcare systems, as well as cultural and social norms that blame and stigmatize survivors.

In conclusion, while the 16 Days of Activism campaign has had some impact on GBV in South Africa, it is clear that much more needs to be done to effectively address the root causes of this pervasive issue. The campaign serves as an important reminder of the urgent need for sustained and collaborative efforts from all sectors of society to prevent and respond to GBV.

Step-by-step explanation:

A shadow 9 feet long is cast by a plum tree that is 12 feet tall. What is the height of a nearby lemon tree that casts a shadow 6 feet long?

Answers

The height of the nearby lemon tree is 8 feet using the property of similar triangles.

What are similar triangles?

Triangles that are similar to one another in shape but differ in size are called similar triangles. Their respective sides are proportional to one another, and their corresponding angles are equal. The ratio of the corresponding sides of two triangles that are comparable is constant across all pairs of corresponding sides. Problems involving unknown lengths or heights in comparable forms can be resolved using this attribute.

The given situation represent two proportional triangles.

We know that the ratio of lengths of similar triangles are equal thus,

height of plum tree / length of plum tree's shadow = height of lemon tree / length of lemon tree's shadow

Substituting the values we have:

12 / 9 = height of lemon tree / 6

Using cross multiplication:

height of lemon tree = 12 * 6 / 9 = 8 feet

Hence, the height of the nearby lemon tree is 8 feet using the property of similar triangles.

Learn more about similar triangles here:

https://brainly.com/question/16999451

#SPJ1

After 6 new students entered the Happy Hearts Childcare Center and 2 students exited, there were 3 times as many students as before. How many students were present before students entered and exited the center?​

Answers

Answer: 2

Step-by-step explanation:

If there are three times as many students when there are 6 students you do 6 divided by three to give you two.

PLEASE HELP NOW!!! What would be the experimental probability of drawing a white marble?

Ryan asks 80 people to choose a marble, note the color, and replace the marble in Brianna's bag. Of all random marble selections in this experiment, 34 red, 18 white, 9 black, and 19 green marbles are selected. How does the theoretical probability compare with the experimental probability of drawing a white marble? Lesson 9-3

Answers

The experimental probbaility is 0.225 and the theoretical probability is 0.25

Calculating the experimental probbaility

The experimental probability of drawing a white marble can be calculated by dividing

(1) The number of times a white marble was selected (18)

(2) by the total number of marbles selected (34+18+9+19=80):

So, we have

Experimental probability = 18/80 = 0.225

The theoretical probability

The theoretical probability of drawing a white marble can be calculated by dividing the number of white marbles (1) by the total number of marble colors (4).

So, we have

Theoretical probability = 1/4 = 0.25

This means that the theoretical probability is greater than the experimental probability

Read more about probability

https://brainly.com/question/251701

#SPJ1

Question 53 Look at the performance review below, if you know that person 6 has a perfect score, you can calculate each person's score using the graph. If you know that person 3 hasn't achieved any of their goals this year, Person 5 has an excellent personality and very good job knowledge, and Person 4 is more interested in hanging out at the water cooler than in getting work done, then who must the performance review belong to? Total number of points per employee Peson P2 Pesen3Psen 4 PeronS Person Rating Scale Category Ratings General Quality of Work 4 Very Good Good Job Knowledge Fair Communication Skills Personality Management Ability Contribution to Group Poor 4. Achievement of Goals Person5 2. Person 4 3. Person 3

Answers

Without specific details it is difficult to determine who the performance review belongs to as we do not have specific scores for each employee. So, based on the information we can define some data as below.

Define the term graph?

A graph in x-y axis plot is a visual representation of functions or data points. The dependent or vertical variable represented by y-axis, while the independent or horizontal variable represented by the x-axis.

Without the specific details of the performance review or the names of the employees, I cannot provide an exact answer. However, based on the information given, we can infer the following:

Person 6 : has a perfect score.

Person 3 : not achieved any of their goals.

Person 5 : excellent personality and very good job knowledge.

Person 4: more interested in hanging out at the water cooler.

Given this information, it is difficult to determine who the performance review belongs to as we do not have specific scores for each employee. We also do not have enough information to make an informed judgment about the performance of each employee. It is possible that the review could belong to any of the employees, depending on their individual scores and performance.

To know more about graph, visit:

https://brainly.com/question/11803331

#SPJ1

A textbook has 428 pages numbered in order starting with 1. You flip to a random page in the book in a way that it is equally likely to stop at any of the pages. What is the probability that you turn to page 45? You can write your answer as a fraction, decimal, or percent What is the probability that you turn to an even numbered page? You can write your answer as a fraction, decimal, or percent

Answers

Answer:

(a) Since there are 428 equally likely pages, the probability of randomly turning to page 45 is 1/428, which is approximately 0.00234 or 0.234%.

(b) There are two possible cases for an even numbered page: either the last digit is 0, 2, 4, 6, or 8, or the page number ends in 00.

For the first case, there are 5 possible digits for the units place, and each of these digits can be followed by any one of the 5 possible digits for the tens place. So there are 5x5 = 25 even numbered pages that end in a non-zero digit.

For the second case, there are 4 possible digits for the hundreds place, and each of these digits can be followed by 00. So there are 4 even numbered pages that end in 00.

Therefore, there are 25 + 4 = 29 even numbered pages in total. Since there are 428 pages in the book, the probability of randomly turning to an even numbered page is 29/428, which is approximately 0.06776 or 6.776%.

Step-by-step explanation:

(a) Оскільки існує 428 рівноймовірних сторінок, ймовірність випадкового переходу на сторінку 45 дорівнює 1/428, що становить приблизно 0,00234 або 0,234%.

(b) Існує два можливих випадки, коли сторінка має парний номер: або остання цифра 0, 2, 4, 6 або 8, або номер сторінки закінчується на 00.

У першому випадку є 5 можливих цифр для позначення одиниць, і за кожною з цих цифр може слідувати будь-яка з 5 можливих цифр для позначення десятків. Таким чином, існує 5x5 = 25 парних сторінок, які закінчуються на ненульову цифру.

У другому випадку є 4 можливі цифри для сотень, і за кожною з цих цифр може стояти 00. Отже, є 4 парні сторінки, які закінчуються на 00.

Таким чином, всього є 25 + 4 = 29 парних сторінок. Оскільки в книзі 428 сторінок, ймовірність випадкового переходу на парну сторінку дорівнює 29/428, що становить приблизно 0.06776 або 6.776%.

3. The length of one leg of a 45-45-90 triangle is 7 m. What is the length of the other leg and the length of the hypotenuse?
The other leg is 7 m, and the hypotenuse is 7 m.
O The other leg is 7 m, and the hypotenuse is 14 m.
O The other leg is 7√2 m, and the hypotenuse is 7 m.
The other leg is 7 m, and the hypotenuse is 7√2 m.

Answers

the length of the other leg is 7m and the length of the hypotenuse is 7√2 m.

Pythagoras Theorem Statement

In the right-angled triangle, the square of the hypotenuse side is equals to the sum of the squares of the other two sides, according to Pythagoras's Theorem. This triangle's three sides are known as the Perpendicular, Base, and Hypotenuse. Because to its position opposite the 90° angle, the hypotenuse in this case is the longest side.

The definition yields the following as the Pythagoras Theorem formula:

Hypotenuse² = Perpendicular² + Base²

c² = a² + b²

Length of one leg=7m

Angles of triangle are 45°,45° and 90°

According to Pythagoras theorem,

x²=7²+7²

x=7√2

the length of the other leg is 7m and the length of the hypotenuse is 7√2 m.

To know more about triangle, visit:

https://brainly.com/question/2773823

#SPJ1

Why is pi important in math?

Answers

Pi is used to find the area and circumference of a circle

Water is being poured into a large, cone-shaped
cistern. The volume of water, measured in cm³, is
reported at different time intervals, measured in
seconds. A regression analysis was completed and is
displayed in the computer output.

Answers

In response to the stated question, we may state that The coefficient equation  of -1.327 indicates that the amount of water in the cistern declines at an exponential rate as time passes.

What is equation?

An equation in mathematics is a statement that states the equality of two expressions. An equation is made up of two sides that are separated by an algebraic equation (=). For example, the argument "2x + 3 = 9" asserts that the phrase "2x + 3" equals the number "9". The purpose of equation solving is to determine the value or values of the variable(s) that will allow the equation to be true. Equations can be simple or complicated, regular or nonlinear, and include one or more elements. In the equation "x2 + 2x - 3 = 0," for example, the variable x is raised to the second power. Lines are utilised in many different areas of mathematics, such as algebra, calculus, and geometry.

The least-squares regression line has the following equation:

2.993 - 1.327 In(Volume)* (Time)

The link between the natural logarithm of water volume and the natural logarithm of time is illustrated by this equation. The coefficient of -1.327 indicates that the amount of water in the cistern declines at an exponential rate as time passes.

To know more about equation visit:

https://brainly.com/question/649785

#SPJ1

d)
1456 divided by 25

Answers

Answer:

58.24

Step-by-step explanation:

1456 ÷ 25 = 58.24

9(-14)(−2)=
A -15
B 128
C 252
D -252

Answers

Answer:

the answer is c

Step-by-step explanation:

add 14 9 times and then whatever that number is double it and remove the negative sign

A 64-foot tall monument casts a shadow 16 feet long. If Kyle is standing nearby and 6’3” tall, find the length of his shadow.

Answers

All monuments cast a shadow when the sun is shining, as they block the sunlight and create a shadow on the ground or nearby surfaces. T

What is the monument casts a shadow?

The size and shape of the shadow will depend on the position of the sun in the sky, the orientation of the monument, and its size and shape.

Some famous monuments that cast impressive shadows include the Pyramids of Giza, the Eiffel Tower, the Washington Monument, and the Stonehenge.

We can use proportions to solve the problem.

Let x be the length of Kyle's shadow.

We know that the length of the monument's shadow is 16 feet, and its height is  [tex]64 f[/tex] Feet. So the ratio of the length of the monument's shadow to its height is:

[tex]16/64 = 1/4[/tex]

This ratio is equal to the ratio of Kyle's shadow length to his height:

[tex]x/6.25 = 1/4[/tex]

To solve for x, we can cross-multiply:

[tex]x = 6.25/4 = 1.5625[/tex]

Therefore, the length of Kyle's shadow is approximately [tex]1.56[/tex] feet (or  [tex]18.72 inches)[/tex] .

Learn more about shadow here:

https://brainly.com/question/31162739?

#SPJ1

Help Me Find Y
Show Work

Answers

Answer:

y = 12

Step-by-step explanation:

if a tangent and a secant are drawn from an external point to a circle, then the square of the measure of the tangent is equal to the product of the measures of the secant's external part and the entire secant , that is

y² = 8(8 + 6 + 4) = 8 × 18 = 144 ( take square root of both sides )

y = [tex]\sqrt{144}[/tex] = 12

Solve the following simultaneous equations algebraically
xy = 6
y-x=1

Answers

Step-by-step explanation:

xy=6

x=6/y (1)

now,

XY=6

6/y-y=6

Answer:

x = -3, then y = -2
x = 2, then y = 3 both correct

Step by step explanation:

We can solve this system of equations algebraically by using substitution.

From the second equation, we can solve for y in terms of x:

y - x = 1

y = x + 1

Substituting y = x + 1 into the first equation, we get:

xy = 6

x(x + 1) = 6

Expanding the left side of the equation, we get:

x^2 + x = 6

Subtracting 6 from both sides, we get:

x^2 + x - 6 = 0

Factorizing the left side of the equation, we get:

(x + 3)(x - 2) = 0

Therefore, either x + 3 = 0 or x - 2 = 0. Solving for x, we get:

x = -3 or x = 2

Substituting these values of x into y = x + 1, we get:

if x = -3, then y = -2
if x = 2, then y = 3

So the solutions to the system of equations are (x, y) = (-3, -2) and (2, 3).

a family of five recently replaced its 5-gallon-per-minute showerheads with water-saving 2-gallon-per-minute showerheads. each member of the family averages 8 minutes in the shower per day. in a 30-day period, how many fewer gallons of water will the family use with the new showerheads? responses 60 60 800 800 2,400 2,400 3,600 3,600 7,200

Answers

The family will use 3,600 fewer gallons of water with the new showerheads in a 30-day period.

A family of five recently replaced its 5-gallon-per-minute showerheads with water-saving 2-gallon-per-minute showerheads. Each member of the family averages 8 minutes in the shower per day. In a 30-day period, the family will use 3,600 fewer gallons of water with the new showerheads. How many fewer gallons of water will the family use with the new showerheads?

Calculate the number of gallons used per person per shower before:

5 gal/min x 8 min = 40 gallons per person per shower.

The number of gallons used per person per shower after:

2 gal/min x 8 min = 16 gallons per person per shower.

The number of gallons used per person per day before:

40 gallons x 1 shower = 40 gallons per person per day.

The number of gallons used per person per day after:

16 gallons x 1 shower = 16 gallons per person per day

The number of gallons used per family per day before:

40 gallons x 5 people = 200 gallons per day

The number of gallons used per family per day after:

16 gallons x 5 people = 80 gallons per day

The number of gallons used per month before:

40 gallons x 5 people x 30 days = 6,000 gallons per month

The number of gallons used per month after:

16 gallons x 5 people x 30 days = 2,400 gallons per month

The family will use 6,000 - 2,400 = 3,600 fewer gallons of water with the new showerheads in a 30-day period. Therefore, the answer is 3,600.

To learn more about water gallon problems refer :

https://brainly.com/question/14700882

#SPJ11

A 45-Seater bus is fully booked. The cost of an adult ticiket is R375 and the cost of a student ticket is R200. How many students were on the bus, If total ticket sales amounted to R9875? (The bus can seat 45 passenger​

Answers

The number of students on the bus is 40.

How many students are in the bus?

The first step is to form two equations that represent the information in the question:

a + b = 45 equation 1

375a + 200b = 9875 equation 2

Where:

a = number of adults in the bus

b = number of students in the bus

The elimination method would be used to determine the number of students on the bus.

Multiply equation 1 by 375

375a + 375b = 16,875 equation 3

Subtract equation 2 from equation 3

175b = 7000

Divide both sides of the equation by 175

b = 7000 / 175

b = 40

To learn more about system of equations, please check: https://brainly.com/question/25875552

#SPJ1

On Friday night, 165 people saw the dinosaur exhibit at the natural history museum. This amount represents 22% of the people who visited the museum that night.
A total of ______ people visited the natural history museum Friday night.
36
133
750
1500

Answers

A  total of 750 people visited the natural history museum on Friday night.

The total number of people who visited the natural history museum on Friday night can be calculated by dividing the number of people who saw the dinosaur exhibit (165) by the percentage of visitors who saw the exhibit (22%).

To do this, we can use the following formula:

Total number of visitors = Number of visitors who saw the exhibit ÷ Percentage of visitors who saw the exhibit

Substituting the given values, we get:

Total number of visitors = 165 ÷ 0.22 = 750

Therefore, a total of 750 people visited the natural history museum on Friday night.

For more questions like Museum click the link below:

https://brainly.com/question/24830903

#SPJ11

Conditional probabilities. Suppose that P(A) = 0.5, P(B) = 0.3, and P{B \ A) = 0.2. Find the probability that both A and B occur. Use a Venn diagram to explain your calculation. What is the probability of the event that B occurs and A does not? Find the probabilities. Suppose that the probability that A occurs is 0.6 and the probability that A and B occur is 0.5. Find the probability that B occurs given that A occurs. Illustrate your calculations in part (a) using a Venn diagram.

Answers

The probability that both A and B occur is given by P(A and B) = P(B | A) * P(A) = 0.2 * 0.5 = 0.1.

This can be visualized using a Venn diagram, where the intersection of A and B represents the probability of both events occurring, which is equal to 0.1 in this case.

The probability of B occurring and A not occurring is given by P(B and not A) = P(B) - P(B | A) * P(A') = 0.3 - 0.2 * 0.5 = 0.2. This represents the area of the B circle outside of the A circle.

Given that P(A) = 0.6 and P(A and B) = 0.5, we can use Bayes' theorem to find P(B | A) as follows: P(B | A) = P(A and B) / P(A) = 0.5 / 0.6 = 0.83. This means that the probability of B occurring given that A has occurred is 0.83.

We can also visualize this using a Venn diagram, where the overlap between A and B represents the probability of both events occurring, and the B circle represents the probability of B occurring given that A has occurred.

For more questions like Probability click the link below:

https://brainly.com/question/30034780

#SPJ11

mathematics 3 and 4 grapgh mwehhh pleaseee

Answers

The answers of the question number 3 and 4 are given below respectively.

What is graph?

A graph is a visual representation of data or mathematical relationships.

It typically involves plotting points on a coordinate plane and connecting them with lines or curves.

Graphs can help to illustrate patterns, trends, and relationships in data and make it easier to understand complex information.

3.Assuming that the sale of bracelets and necklaces are represented by the variables B and N respectively, the total sale would be represented by the mathematical statement:

Total sale = B + N

Graph of Total Sale = B + N

The x-axis represents the number of bracelets sold (B), and the y-axis represents the number of necklaces sold (N).

4.To represent Nimfa's goal of achieving a total sale of at least Php 15,000, we can use the inequality:

Total sale ≥ Php 15,000

or, using the expression from the previous question:

2B + N ≥ Php 15,000

Graph of Total Sale ≥ Php 15,000

The shaded area above the plane represents all the combinations of sales of bracelets and necklaces that result in a total sale of at least Php 15,000. Any point above the plane is a valid combination of sales that meet Nimfa's goal.

To know more about mathematical relationships visit:

https://brainly.com/question/14295931

#SPJ1

3. The x-axis represents the number of bracelets sold (B), and the y-axis represents the number of necklaces sold (N).

4. The shaded area above the plane represents all the combinations of sales of bracelets and necklaces that result in a total sale of at least Php 15,000.

What is graph?

A graph is a visual representation of data or mathematical relationships.

It typically involves plotting points on a coordinate plane and connecting them with lines or curves.

Graphs can help to illustrate patterns, trends, and relationships in data and make it easier to understand complex information.

3.Assuming that the sale of bracelets and necklaces are represented by the variables B and N respectively, the total sale would be represented by the mathematical statement:

Total sale = B + N

Graph of Total Sale = B + N

4.To represent Nimfa's goal of achieving a total sale of at least Php 15,000, we can use the inequality:

Total sale ≥ Php 15,000

or, using the expression from the previous question:

2B + N ≥ Php 15,000

Graph of Total Sale ≥ Php 15,000

The shaded area above the plane represents all the combinations of sales of bracelets and necklaces that result in a total sale of at least Php 15,000. Any point above the plane is a valid combination of sales that meet Nimfa's goal.

To know more about mathematical relationships visit:

https://brainly.com/question/14295931

#SPJ1

Dentify the solution to the following system of equations




Identify the solution to the following system of equations




No solution

(0. 29, 2. 73)

(0. 78, 0. 05) and (-4. 32, 12. 80)

( -1, 4. 5)

Answers

If m = 3/2, the two equations in the system are dependent and have an infinite number of solutions.

To do this, we can set the coefficients of x and y in the two equations equal to each other:

6 - 4m = 2k(2m - 1)

2n - 7 = 3k

Simplifying these equations, we get:

8m - 6 = 4km

2n - 7 = 3k

We can solve the first equation for k:

k = (8m - 6)/(4m)

Substituting this into the second equation and solving for n, we get:

n = (16m - 29)/(8m - 12)

Now we need to check if there are any values of m for which the equations are proportional. We can do this by checking if the expressions for k and n are the same for all values of m.

We find that the expressions for k and n are the same for m = 3/2.

To know more about equation here

https://brainly.com/question/10413253

#SPJ4

Complete Question:

Determine the values of m and n so that the following system of linear equations have infinite number of solutions:

(2m−1)x+3y−5=0

3x+(n−1)y−2=0

12x + 376; 15x + 280.

When would they have the same amount

Answers

Answer: 32,760

Step-by-step explanation

12x+376

15x+280

when you put it in demos both of the line cross and you can see you answer when you click were the lines cross.if you use the giving value it would be 750

Other Questions
a data set consists of the data given below plus one more data point. when the additional point is included in the data set the sample mean of the resulting data set is 32.083. what is the value of the additional data point? Solve: 3x-9x-17 =1 Dear Mom,I think we should get a pet dog. Dogs make great pets because they are loyal.They help deter criminals, like thieves. They also help boost peoples moods becausethey are friendly and playful. Doctors have even found that owning a dog can improvea persons health. They reduce the risk of cardiovascular disease and they help preventallergies, asthma, and eczema in children! You might think that I am not responsibleenough to have a pet dog. But, I have demonstrated responsibility by making my bedevery morning and doing my homework every afternoon. I know that I would beresponsible for walking our pet dog and cleaning up after it. Getting a pet dog wouldbe good for our whole family!Love, Nataliearguments lang po michael scott picks up the donut and coffee order for hos office. yesterday he bought 6 donuts and 8 cups of coffee for $21. today he bought 10 donuts and 5 cups of coffee for $16.25. what is the cost of each item? How has social mediachanged how you learnabout, interpret, andderive conclusionsabout American politicstoday? Helppp how does technological change affect the per-worker production function? what is the common molecule involved in the catabolism of proteins, fats, and carbohydrates? many companies, called allied industries, do not sell food directly but are still deeply involved in the food industry. the dairy industry is a good example of an allied industry. which of the following was not a consequence of the american policy of raising tariffs sky-high in the 1920s? The following item is an example of aOvercrowded schools often have to buy portable classrooms or trailers, this is only atemporary solution though.O fragmentO comma splicerun-oncorrect sentence People who argue that economic growth will be constrained by the availability of natural resources ignore the fact that scarcity _______. a. is likely to be an issue given the abundance of natural resources b. has little effect on prices so the market can continue to operate in the same way as before c. will lead prices to change in ways that lead both producers and consumers to change their behavior in ways that address the problem you have an rc circuit with a time constant of 5.35 s. if the total resistance in the circuit is 231.2 k , what is the capacitance of the circuit (in f)? don't type the units into the answer box. A file is copied from the hard drive (storage) to ______ when you open it. When you close a file, it's removed from ______ and saved to the hard drive. Select your answer, then click Done. .the him manager tasked the coding manager to development a dashboard that shows the discharges pending final billing so that she can plan for staffing. because this data changes throughout the day, what analysis technique is needed? what is a moral & legalabligation?- what kind of a person do you think?-what moral a bligation do you fulfill in your community?-what you can do to/what you can do? true ior false once credit is established, most people should plan on having at least eight to ten credit cards at any given time Which one of the following compounds is a non-electrolyte when dissolved in water?Cu(NO3)2CaCl2HClNaCH3CO2CCl4 Smores, a Taste of Multivariate Normal Distribution Smores Company store makes chocolate (Xi), marshmallow (X2), and graham cracker (Xs). Assume that the profit (in millions) for selling these smores materials follow a multivariate uormal ditributim with parameters 1 0.3 0.3 and = 0.31 0 0.3 01 What is the probability that 1. the profit for selling chocolate is greater than 6 millions? 2. the profit for selling chocolate is greater than 6 millions, given the sales of marshmallow is 5 million and the sales of graham cracker is 5 mllion? 3. P(3X1-1X2 + 3X3 > 20)? suppose the temperature of the input reservoir does not change. as the sink temperature is lowered, the efficiency of the engine_____ g a random sample of 100 automobile owners in the state of alabama shows that an automobile is driven on average 23,500 miles per year with a standard deviation of 3900 miles. assume the distribution of measurements to be approximately normal. a) construct a 99% confidence interval for the average number of miles an automobile is driven annually in alabama.