CORRECT ANSWER ONLY ND WILL GIVE BRAINLIEST✌
Calculate the mass of nitrogen dioxide gas that would occupy
the same volume as 10g of hydrogen gas at ē same pressure and temperature
(H= 1.0 N = 14.0 O= 16.0) GAS LAWS/MOLES
Answer:
150g
Explanation:
Assuming they are ideal gases at the same temperature and pressure, equal moles of gasses have equal volume. IN this case, if we have 10g of hydrogen gas, that is 5 moles of H2 gas. That means 5 moles og NO2 will occupy the same volume which is 5*(14.0 + 16.0*2) = 230 g
Is FeS iron (ll) sulfide or iron (lll) sulfide?
Answer:
the valence of S is -2. For FeS to be neutral the valence of Fe used must be +2
and since Iron (II) has its valency 2, FeS will be Iron (II) Sulfide.
what is the molarity of HCL solution that has a density of 1.17g/ml at 25°?
Here, we have been given that;
$ \bf{1 ml}$ = 1.17 g$ \bf{1 l}$ = 1170 gHence, we can note that,
No. of moles of HCL (n) = $ \sf{\frac{1170}{36.5}}$(n) = 32.05
[tex] \\ [/tex]
Thus,
Molarity = 32.05 mg/LHence, molarity of the given solution will be 32.05 mg/L.
Below is a picture of two blocks made of different materials. Block A Block B grams grams If Block A is located on the Moon and Block B is located on Earth, which of the following is true about the two blocks?
a: they have the same density.
b: they have the same volume.
c: they have the same mass.
d: they have the same weight.
Answer:
A
Explanation:
this is because density is the mass per unit volume of an object
If Block A is located on the Moon and Block B is located on Earth, then the truth about the two blocks will be they have the same mass, and they have the same density. The correct option is a and c.
What is mass?Mass is a physical body's total amount of matter. By multiplying the object's volume and density, it can be determined.
Density, volume, mass, and weight are the four entities that are supplied. The volume and weight of the object on the moon will alter as a result of these entities. They will be different in the universe if he goes to Earth.
The location and gravitational field of an object do not affect its density or mass.
Thus, the correct options are a: they have the same density, and c. they have the same mass.
To learn more about mass, refer to the link:
https://brainly.com/question/20195594
#SPJ2
nguyên tử sắt có điện tích hạt nhân là 26+. trong nguyên tử, số hạt mang điện nhiều hơn số hạt không mang điện là 22. Hãy xác định số khối của nguyên tử sắt
Answer:
I don't know yr language
Which element has 2 valence electrons in the 2s sublevel?
Answer:
beryllium is the answer.
I hope this will help you
Calculate the volume (in L) that 3.25 mol of helium gas will occupy at a temperature of 25.0 °C and a pressure of 799 mm Hg.
Answer:
V = 6.34 L
Explanation:
Given that,
Number of moles of Helium gas, n = 3.25 mol
Temperature, T = 25 °C = 298 K
Pressure, P = 799 mm Hg
We know that,
PV = nRT
Where
R is the gas constant, R = 62.4 L-mm Hg/mol K
So,
[tex]V=\dfrac{nRT}{P}\\\\V=\dfrac{3.25\times 62.4\times 25}{799}\\\\V=6.34\ L[/tex]
So, the volume of the gas is 6.34 L.
Which pair of substances would react the
fastest?
a. Copper sheet and concentrated
nitric acid.
b. Copper powder and dilute nitric acid
C. Copper powder and concentrated
nitric acid.
Answer:
C. It has the highest rate of reaction. Copper has the highest TSA/V and concentrated nitric acid has huggest num of solute
True or false, The universal gas constant, R, is . 0821 when we use mm Hg as our unit for pressure
Answer:
False
Explanation:
R = gas constant = 0.0821 atm•L/mol•K
plz answer (g) i will give rating 5 and thanks who answer plz fast
Answer:
Like many common group 2 metal carbonates, magnesium carbonate reacts with aqueous acids to release carbon dioxide and water
MgCO3 + 2 HCl → MgCl2 + CO2 + H2O.
The procedure to obtain pure magnesium chloride from the reaction is as thus
Step 1: Reaction
- Leave the dilute hydrochloric acid in a beaker.
- Add Magnesium carbonate slowly until it is in excess or until no more gas seem to be getting liberated.
Step 2: Filtration
- Filter with filter paper and funnel.
- Filter off the excess magnesium carbonate as magnesium chloride will be in aqueous form (liquid) and will come out with the filtrate. The residue is the excess magnesium carbonate.
Step 3: Crystallization to obtain solid crystals from the filtrate.
- Pour filtrate solution into evaporating dish/basin
- Provide heat using Bunsen burner
- Pour solution into an evaporating basin and heat over a water bath
- Stop heating when crystals start to form
allow water to evaporate until pure crystals remain.
- Dry crystals using absorbent paper or warm oven.
Precautions
- Use personal protective equipment such as gloves, a lab coat and wear eye protection, especially when heating.
- Avoid inhaling unnecessary gases during the whole process.
Name each compound. Do not capitalize element names. An example can be seen
below.
Ex. SF6: sulfur hexfluoride
a. H2O:
b. PC15:
C. SiF4:
d. N20
Answer:
a. H2O: dihydrogen monoxide
b. PCl5: Phosphorus pentachloride
c. SiF4: Silicon tetrafluoride
d. N20: dinitrogen oxide
option with explaination
Answer:
B. it's water of crystallization.
the water of crystallization, that is the number of molecules of water attached to One Copper atom gives blue color to the hydrated salt (CuSO4.5H2O)
name and describe four different types of chemical reactions and explain how you can predict which type might occur
Answer:
1. Combination (Synthesis) reaction
A + B → AB
2. Decomposition reaction
AB → A + B
3. Displacement reaction
A + BC → AB + C
4. Double displacement reaction
AB + CD → AD + BC
5. Combustion reaction
[tex]CH_{4} + 20_{2} → CO_{2} 2Hx_{2} O[/tex]
A combination reaction, also known as a synthesis reaction, is a reaction in which two or more substances combine to form a single new substance. Combination reactions can also be called synthesis reactions.
A decomposition reaction is a reaction in which a compound breaks down into two or more simpler substances.
A single-replacement reaction is a reaction in which one element replaces a similar element in a compound.
A double-replacement reaction is a reaction in which the positive and negative ions of two ionic compounds exchange places to form two new compounds.
A combustion reaction is a reaction in which a substance reacts with oxygen gas, releasing energy in the form of light and heat. Combustion reactions must involve O2 as one reactant. The combustion of hydrogen gas produces water vapor
Explanation: Hope this helps and good luck :))
Over a period of 2 minutes, 180 coulombs of charge pass through a resistor. What is the current through the resistor during this time?
Type the correct answer in the box. Use numerals instead of words.
The current through the resistor during this time is
A.
Answer:
Explanation:
Formula
The current = charge / time
The charge is in coulombs
The time has to be in seconds.
1 minute = 60 seconds
2 minutes = 120 seconds.
charge = 180 coulombs
current = 180 / 120
current = 1.5 amperes.
What is the percent yield of a reaction?
O A. The difference between measured and calculated amounts
OB.
The amount of produd obtained
amount possible
* 100
C. The amount of product actually obtained in a reaction
D. The amount of product that is possible from a reaction
Answer:
B. The amount of produd obtained/amount possible * 100
Explanation:
In chemistry, the yield of a chemical reaction is the quantity or amount of products obtained in that chemical reaction. It is calculated by using the following formula:
Percentage yield = Actual yield/theoretical yield × 100
- The actual yield is the amount of products got from a chemical reaction
- The theoretical yield is the amount of product got from using the balanced equation (stoichiometry).
For a reaction: aA → Products, [A]o -4.3 M, and the first two half-lives are 56 and 28 minutes, respectively. Calculate k (without units). Show Work!
A. 7.7 x 10^-2
B. 4.2 x 10^-3
C. 3.8 x 10^-2
D. 8.3 x 10^-3
E. None of these
Answer:
C.[tex]3.8\times 10^{-2}[/tex]
Explanation:
We are given that
Initial concentration, [tex][A]_o=4.3 M[/tex]
First half life, [tex]t_{\frac{1}{2}}=56[/tex]minutes
Second half life, [tex]t'_{\frac{1}{2}}=28[/tex]minutes
We have to find K.
The given reaction is zero order reaction.
We know that for zero order reaction
[tex]t_{\frac{1}{2}}=\frac{[A]_o}{2k}[/tex]
Using the formula
[tex]56=\frac{4.3}{2k}[/tex]
[tex]k=\frac{4.3}{2\times 56}[/tex]
[tex]k=3.8\times 10^{-2}[/tex]
Hence, option C is correct.
Zero-order reactions are the reactions when a surface or a catalyst is required for the reaction to proceed and is saturated by the reactant chemicals. The result of the concentration versus the time plot will be a straight line in a zero-order reaction.
[tex]3.8 \times 10 ^{-2}[/tex] is the value of k.
How to calculate the value of k?Given,
Initial concentration [tex][A_{0}][/tex] = 4.3 MThe first half-life of the reactant [tex](t \dfrac{1}{2})[/tex] = 56 minutesThe second half-life of the reactant [tex](t \dfrac{1}{2})[/tex] = 28 minutesThe given reaction in the question is of zero-order and for that, we know that,
[tex]t \dfrac{1}{2} = \dfrac{[A_{0}] }{2\;\rm k}[/tex]
Substituting the values in the equation we get:
[tex]\begin{aligned}56 &= \dfrac{4.3 }{2\; \rm k}\\\\\rm k &= {4.3 }{2 \times 56}\\\\\rm k &= 3.8 \times 10^{ -2}\end{aligned}[/tex]
Therefore, option C is correct.
Learn more about the zero-order reaction here:
https://brainly.com/question/4638382
HELP ME PLZ Which of the following describes the structure of a fish's swim bladder?
A. Expands and contracts to allow the fish to rise or sink in the water
B. Internal organ filled with liquid
c. Holds urine until it can be released into the environment
D. Internal organ filled with air sacs
What is the name of the molecule shown below?
A) ethanol
B) ethanal
C) ethanoic acid
D) ethylamine
The name of the molecule shown is Ethanol.
What is Ethanol?Ethanol is a alcoholic substance that is formed from fermentation of glucose in the presence of yeast or microorganisms.
It has a chemical group that have methyl group, hydroxyl group OH which is bonded to carbon atom.
Therefore, The name of the molecule shown is Ethanol.
Learn more about ethanol below.
https://brainly.com/question/13423304
#SPJ2
Draw the following structures and name them :
I. CH3CH2(OH)
II.CH3CH2CH(CH3)C(Cl)2C(l)2CH(F)OH
III.CH3CH(CH3)CHO
IV.CH2=CH(OH)
V.CH3OCH2CH3
Answer:
hope this helps.answer is in the picture
What happens if kinetic energy of a gas is lowered
Answer:
"If you lower the kinetic energy of a gas its temperature will decrease because temperature is a measure of the average kinetic energy of a substance."
Explanation:
An organic compound has the empirical formula C2H4O. what is the compound?
a. butanoic acid
b. butanol
c. ethanoic acid
d. ethanol
Answer:
The correct answer is - butanoic acid
Explanation:
An empirical formula is the general formula or base formula that is the simplest positive integer ratio of atoms present in a compound. The empirical formula is specific to specific compounds or types of compounds.
Among the given options, the empirical formula C2H4O is butanoic acid as the molecular formula of butanoic acid is - C4H8O2 which is multiple of C2H4O. Other compounds have different than this empirical formula.
how much energy is required to melt 2kg of aluminium
Exprese la concentración de una solución de H3PO4 al 30 % en masa y con una densidad de 1.39 g/mL en: M, y N.
Respuesta:
4.26 M; 12.8 N
Explicación:
Primer paso: Calcular la concentración volumétrica (Cv)
Usaremos la siguiente expression.
Cv = Cg × ρ
Cv = 30 g%g × 1.39 g/mL = 41.7 g%mL
Segundo paso: Calcular la molaridad
La concentración volumetrica es 41.7 g%mL, es decir, hay 41.7 gramos de soluto cada 100 mL de solución. Usaremos la siguiente fórmula para molaridad.
M = masa de soluto / masa molar de soluto × litros de solución
M = 41.7 g / 97.99 g/mol × 0.1 L = 4.26 M
Tercer paso: Calcular la normalidad
Usaremos la siguiente fórmula.
N = M × Z
donde Z para un ácido es igual al número de protones.
N = M × Z
N = 4.26 mol/L × 3 eq/mol = 12.8 N
. The Ksp of barium sulfate is 1.1 × 10–10. What is the sulfate-ion concentration of a 1.0-L saturated solution of BaSO4 to which 0.025 mol of Ba(NO3)2 is added? 4.4 × 10–9M 1.0 × 10–5M 6.6 × 10–5M 2.8 × 10–12M
Answer:
[tex][SO_4^{2-}]=4.4*10^{-9}M[/tex]
Explanation:
From the question we are told that:
[tex]Ksp=1.1*10^{-10}[/tex]
Volume of [tex]SO_4^{2-}=1.O[/tex]
Moles of [tex]Ba(NO_3)^2 =0.025[/tex]
Generally the equation for Ksp is mathematically given by
[tex]Ksp=[Ba^{2+}][SO_4^{2-}][/tex]
[tex]1.1*10^{-10}=[0.025][SO_4^{2-}][/tex]
Therefore
[tex][SO_4^{2-}]=4.4*10^{-9}M[/tex]
which best describes the relationship between internal energy and thermal energy
Answer:
answer is d on edge
Explanation:
How are the vapor pressure and boiling point of alkynes affected as the chain length increases?
Answer:
Answer to the following question is as follows;
Explanation:
Alkynes' vapour pressure and normal boiling points are altered when chain length grows, since vapour pressure rises while boiling point falls.
Vapour pressure always include pressure entered by vapour with its condensed phase, pressure include molecules force of attraction include vapour
If an atom contains more
electrons than protons, it is
Answer:
If an atom has the same number of electrons as protons, it is a neutral atom.
Explanation:
Is this population more likely to grows slowly or quickly in the next 10 years
nobody can say it is uncertain but in my opinion it will grow quickly in the next 10 years
Which is a mixture?
Sodium metal
chlonne gas
sodium metal and chlonne gas
sodium chlonde (salt) and water
Answer:
I believe it's salt and water
Explanation:
not sure
Answer:
Mixture is a electronic device used to peel the things such as onion ,tomato,ginger, garlic etc.
Hiii pls help me to write out the ionic equation
Answer:
STEP I
This is the balanced equation for the given reaction:-
[tex] 2KOH_{(aq)} + H_2SO_4{}_{(aq)} \rightarrow K_2SO_4{}_{(aq)} + 2H_2O_{(l)} [/tex]
STEP II
The compounds marked with (aq) are soluble ionic compounds. They must be
broken into their respective ions.
see, in the equation KOH, H2SO4, and K2SO4 are marked with (aq).
On breaking them into their respective ions :-
2KOH -> 2K+ + 2OH-H2SO4 -> 2H+ + (SO4)2-K2SO4 -> 2K+ + (SO4)2-STEP III
Rewriting these in the form of equation
[tex] \underline{\pmb{2K^+} }+ 2OH^- + 2H^+ + \pmb{\underline{{SO_4{}^{2-}}} \: \rightarrow \: \underline{\pmb{2K^+}}} + \underline{\pmb{SO_4{}^{2-}}} + 2H_2O [/tex]
STEP IV
Canceling spectator ions, the ions that appear the same on either side of the equation
(note: in the above step the ions in bold have gotten canceled.)
[tex] \boxed{ \mathfrak{ \red{ 2OH^-{}_{(aq)} + 2H^+{(aq.)} \rightarrow H_2O{}_{(l)}}}} [/tex]
This is the net ionic equation.
____________________________
[tex] \\ [/tex]
[tex]\mathfrak{\underline{\green{ Why\: KOH \:has\: been\: taken\: as\: aqueous ?}}} [/tex]
KOH has been taken as aqueous because the question informs us that we have a solution of KOH. by solution it means that KOH has been dissolved in water before use.[Alkali metal hydroxides are the only halides soluble in water ]
