Which of the following equations correctly represents the law of cosines?

Which Of The Following Equations Correctly Represents The Law Of Cosines?

Answers

Answer 1

Answer:

C

Step-by-step explanation:


Related Questions

can someone help me with this?

Answers

Answer:

The answer is 660

Step-by-step explanation:

30×2200÷100= 660

Answer:

660

Step-by-step explanation:

to know 30%

2200÷10×3=660

Not sure how to do this! I’m supposed to find the area of each shape, but the slits in the shapes are confusing me and I’m not too sure how to do these problems!

Answers

sorry i don't know answe're of this question

What is the length of CD

Answers

Answer:

Step-by-step explanation:

3(x-2)

Answer:

CD = 7

Step-by-step explanation:

CD and GI are of same lenghth so

3x - 6 = x + 8

transpose

3x - x = 8+6

2x = 14

x = 14/2

x = 7

12. PLEASE HELP ME
Which of the following are the coordinates of the vertex of y= x2 - 10x + 2?

A. (–10, 2)

B. (2, –10)

C. (–5, 23)

D. (5, –23)

Answers

Answer:

I think b no. is the correct answer

Answer:

D. (5, –23)

Step-by-step explanation:

The vertex is in essence the turning point of the parabola y = x² − 10x + 2

the x coordinate of the turning point =  

                                                        =  

                                                        =  5

when x = 5, y = (5)² - 10(5) + 2

                     = -23

Thus coordinate or vertex is ( 5, -23)

5 right 23 down

Help pls will give brainliest

Answers

Answer:

b

Step-by-step explanation:

area of triangle = 1/2 x c x d =cd/2

area of semicircle = 1/2 x π x r^2 = 1/2 x π x (a/2)^2 = 1/2 x π x a^2/4 =πa^2/8

area of shape = area of triangle + area of semicircle

What is the slope of the line that contains the points (9,-4) and (1,-5)? O A. 8 O B. - O c. 1 1 O D. 8​

Answers

Answer:

1/8

Step-by-step explanation:

-5-(-4)/1-9

ntroduction to Functions
Assignment Active
Creating a Function from a Mapping
The mapping shows a relationship between input and
output values.
Input
Output
Which ordered pair could be removed to make this
relation a function?
O (-5,0)
0 (-1, -3)
O (4, -2)
O (6,-1)

Answers

Answer:

To be a function, each input must only have one output. In this case, input 4 has two outputs, so (4 , -2) can be removed for it to be a function.

Let me know if you have any other questions!

The ordered pair (4,2) could be removed to make the given relation a function.

What is the relation?

A relation is a function if for every input (x-value) there is exactly one output (y-value).

If there are two or more ordered pairs with the same x-value but different y-values, then the relation is not a function. In this case, one of those ordered pairs would need to be removed in order to make it a function.

As per the question, the relation was given as {(-5,0), (2, -3), (-1, -3), (4, -2), (4, -2), (6,-1)}, the ordered pair (4,-2) would need to be removed because there are two outputs (-2 and 2) for the input of 4.

Thus, removing (4,2) would result in the function.

Learn more about the relations here:

https://brainly.com/question/29207494

#SPJ7

The total number of cupcakes soldduring 5 days was 2087. The number of cupcakes sold by the shop on Thursday was 3 times the cupcakes sold on Monday. How many cupcakes were sold on Thursday?

Answers

Answer:

1252

Step-by-step explanation:

We're assuming that the same amount of cupcakes were sold each day.

2087/5 = 417.4

417.4 x 3 = 1252.2

Since we can't sell fractions of a cupcake, 1252 were sold on Thursday.

If C.P. = Rs. 480, S.P. =Rs.528 find profit and profit percent​

Answers

In this question first you should find profit amount by using formula and you should use profit amount in profit percentage formula then you should calculate it

What is the range of the given data set? OA) 30 OB) 32 OC) 37 OD) 40​

Answers

Answer:

Range = maximum number - minimum number

maximum number = 99minimum number = 62

Range = 99 - 62 = 37

Answer:

37

Step-by-step explanation:

The range is the difference between the highest number and the smallest number.

Looking at the stem and leaf plot we can identify the largest and smallest number

Largest number: 99

Smallest number: 62

If range = largest number - smallest number then range = 99 - 62 = 37

Which of the following is a parent function?
O A. f(x) = e*
O B. f(x) = 2.34
O x
C. f(x) = x4 +3
O D. f(x) = 2e2x

Answers

Answer:

[tex]f(x) = e^x[/tex]

Step-by-step explanation:

Given

Options (a) to (d)

Required

Which is a parent function

A parent function is such that has a single term without coefficients

From the list of given options

[tex]f(x) = e^x[/tex] suits the above definition

Other options (b) to (d) either have coefficients, or have multiple terms

Read is solving the quadratic equation 0 equals X over two minus 2X -3 using the quadratic formula which shows the correct substitution of the values ABC into the quadratic formula quadratic formula X equals negative B+

Answers

Answer:

[tex]x = \frac{-(-2) \± \sqrt{(-2)^2 - 4*1*-3}}{2*1}[/tex]

Step-by-step explanation:

Given

[tex]0 = x^2 - 2x -3[/tex]

Required

The correct quadratic formula for the above

A quadratic equation is represented as:

[tex]ax^2 + bx + c = 0[/tex]

And the formula is:

[tex]x = \frac{-b \± \sqrt{b^2 - 4ac}}{2a}[/tex]

So, we have:

[tex]0 = x^2 - 2x -3[/tex]

Rewrite as:

[tex]x^2 - 2x - 3 = 0[/tex]

By comparison:

[tex]a= 1; b = -2; c = -3[/tex]

So, we have:

[tex]x = \frac{-b \± \sqrt{b^2 - 4ac}}{2a}[/tex]

[tex]x = \frac{-(-2) \± \sqrt{(-2)^2 - 4*1*-3}}{2*1}[/tex]

Tim works as a server in a restaurant.
A
group
for $112.50. They leave Tim a tip of 20%.
Another group at Table 15 have a bill of
$142.75 and leave a 15% tip. Which table
of people at Table 22 have a bill
left Tim the greater tip

Answers

Answer:

The first group left a greater tip

Step-by-step explanation:

The first group left a tip of 20%. 20% of 112.5 is 22.5

The first group left a tip of 15%. 15% of 142.75 is 21.4125. Round to the nearest hundredth -> 21.41.

Therefore, the first group left a greater tip

I hope this helps!

pls ❤ and give brainliest pls

In right triangle ABC, AB = 3 and AC = 9. What is the measure of angle B to the nearest degree?

Answers

Answer:

90 degrees

Step-by-step explanation:

see image

make x A

y B

z C

AB=3 (given)

AC=9 (given)

measure of angel B or y, is 90

if

x= A

y= C

z= B

then the hypotenuse would be shorter than one of the legs

3<9

so B has to be the right angle (90 degrees)

A wholesaler purchased an electric item for Rs 2,700 and sold to retailer at
10% profit. The retailer sold it at 20% profit to a consumer. How much did the
consumer pay for it.


PLZ PLZ HELP.......​

Answers

Step-by-step explanation:

10 % of 2700 = 270

so he had 2970 rupee

20% of 2970 = 594

so customer have to pay 2970 + 594 = 3564

A sports scientist has made the formula below that gives the energy in joules provided,
e
per
ml
,
a
consumed of a power drink.



e=a×0.2



Substitute in
660
for the amount consumed,
a
, in an energy shake and give the energy provided,
e
.

Answers

Gotta space it better but I think it’s .35

find the ratio of Rs 20 and 900​

Answers

Answer:

1 : 45

Step-by-step explanation:

Given

Rs 20 and 900 ( divide both by 20 )

= 1 : 45

Given the function f(x) = -2c + cx - x^2? and f^-1(5) = -1, find c.

Answers

Answer:

c = - 2

Step-by-step explanation:

Given inverse function

[tex]f^{-1}[/tex] (5) = - 1 , then

f(- 1) = 5 , that is

- 2c + c(- 1) - (- 1)² = 5

- 2c - c - 1 = 5

- 3c - 1 = 5 ( add 1 to both sides )

- 3c = 6 ( divide both sides by - 3 )

c = - 2

What is 73+73+73+73+73+73+73+73+73+73+73+73+73+73+73+73+73+73+73+73+73=

Answers

Answer:

1533

Step-by-step explanation:

73x21= 1533

Answer:

73+73+73+73+73+73+73+73+73+73+73+73+73+73+73+73+73+73+73+73+73

=73x21=1533

Step-by-step explanation:

HURRY I NEED TO KNOW.... what term can you add to 5/6)x -4 to make it equivalent to 1/2x-4?

Answers

Answer:

(-1/3)x

Step-by-step explanation:

You can either solve this algebraically or solve it by testing one possible answer at a time.

First example:  To (5/6)x - 4, add (-1/3)x.  Result:  (3/6)x - 4.  This is correct.

The correct answer is the first one:  (-1/3)x.

HELP ME PLEASE I NEED HELP

Consider the end behavior of the function g(x) = 4|x − 2| − 3.

As x approaches negative infinity, f(x) approaches POSITIVE OR NEGATIVE infinity.


As x approaches positive infinity, f(x) approaches POSITIVE OR NEGATIVE infinity.

Answers

Answer:

Step-by-step explanation:

This is a narrower-than-normal absolute value graph, which is a v-shaped graph. It's pointy part, the vertex, lies at (2, -3) and it opens upwards without bounds along both the positive and negative x axes. Therefore, as x approaches negative infinity, f(x) or y (same thing) approaches positive infinity. As x approaches positive infinity, f(x) approaches positive infinity.

I NEED HELP ASAP!!! i dont understand

Answers

Answer:

b

Step-by-step explanation:

A parabola represents a quadratic equation. For a point called the focus and a line called the directrix, the distance from each point of the parabola to the focus is equal to its distance to the directrix. For example, if the directrix of the parabola was y=0 and the focus was (1,1), the distance between each point on the parabola to (1,1) would be equal to its distance from the line y=0.

For a parabola that has a horizontal axis of symmetry (or when y² is in the equation rather than x²), one way to write its equation is of the form

(y-k)²  =4p(x-h), where (h,k) is the vertex. Now, we can try to match up this form with the equation we have,

y² = 24x

(y-k)² = 4p(x-h)

We can start by setting both sides with y equal to each other, as well as both sides containing x

y² = (y-k)²

square root both sides

y = y-k

k=0

24x = 4p(x-h)

divide both sides by 4

6x = p(x-h)

expand

6x = p*x - p*h

Because p*h does not contain an x value, we can say

6x = p * x

p = 6

6x = p*x - p*h

6x = 6x-6*h

subtract 6x from both sidex

6*h=0

h=0

Our equation is thus

y= 4(6)(x), with our vertex being (0,0) = (h,k)

The directrix is equal to x=h-p, and with p being 6, our directrix is thus

x=0-6 = -6

x=-6

x = 3

x = 5

x = 0

x = 2

Answers

Answer:

x=2 is incorrect

Step-by-step explanation:

Y(2)=(3/4)*x^2=(3/4)*4=3

What is the area of the following circle?

Answers

Answer:

[tex]16\pi\:\mathrm{units^2}\text{ or }50.24\:\mathrm{ units^2}[/tex]

Step-by-step explanation:

The area of a circle with radius [tex]r[/tex] is given as [tex]A=r^2\pi[/tex].

In the question, we're given [tex]r=4[/tex] and asked to solve for [tex]A[/tex].

Substituting [tex]r=4[/tex] into [tex]A=r^2\pi[/tex], we get:

[tex]A=4^2\pi,\\A=\boxed{16\pi\:\mathrm{units^2}}[/tex]

If we use [tex]\pi=3.14[/tex] as mentioned in the question, we would have:

[tex]A=16\pi=16\cdot 3.14=\boxed{50.24\:\mathrm{units^2}}[/tex]

Find the nth term of each of the sequences.
(a) 16, 19, 22, 25, 28, ...
(b) 1,3,9,27,81,...

Answers

Answer:

a) 16, 19, 22, 25, 28, 31, 34, 37, 40

b) 1, 3, 9, 27, 81, 243, 729, 2187

Explanation:

a) Add 3 on every number.

b) Multiply every number by 3.

Geometry, please answer question ASAP

Answers

Answer:

Triangle ACB =~ triangle DFE, by adding 6 units to each side of both triangles their relationship will not change. They are still similar.

Step-by-step explanation:

The answer isn't great in all honesty but it's been a long time since I took geometry and I don't 100% remember the proper way of stating it. Though I am 100% sure they stay similar.

Sorry couldn't be of more help but figured something was better then nothing

The foot of a ladder is placed 10 feet from a wall. If the top of the ladder rests 13 feet up on the wall, find the length of the ladder.

Answers

10 squared + 13 squared = your answer squared.
So do that then take the square root of whatever you get.

TRIGONOMETRY
Could someone please help me with 5.2 please...it would really help alot:)​

Answers

sin(x+y) - sin(x-y) - 1 = cos(2x)

sin(90) - sin(x-y) - 1 = cos(2x)

1 - sin(x-(90-x)) - 1 = cos(2x)

-sin(2x-90) = cos(2x)

-1*(sin(2x)cos(90) - cos(2x)sin(90)) = cos(2x)

-1*(sin(2x)*0 - cos(2x)*1) = cos(2x)

-1*(0 - cos(2x)) = cos(2x)

-1*(-cos(2x)) = cos(2x)

cos(2x) = cos(2x)

This confirms the identity is true.

Notice that throughout this proof, I only changed the left hand side.

On the 5th line, I used the identity sin(A-B) = sin(A)cos(B)-cos(A)sin(B).

Find the equation of a line perpendicular to 8x - 2y = 4 and passes through the point (4, 3).

Answers

y = -2x-3

Lines that are perpendicular have slopes that are negative reciprocals of each other. Meaning, if a line has slope  , then a line perpendicular to this has slope . That means the slope of our perpendicular line is

The equation of the line that is perpendicular to 8x - 2y = 4 and passes through the point (4, 3) is y = (-1/4)x + 4.

To find the equation of a line that is perpendicular to the line 8x - 2y = 4 and passes through the point (4, 3), we can use the fact that the slopes of perpendicular lines are negative reciprocals of each other.

First, let's rewrite the given equation in slope-intercept form (y = mx + b), where m represents the slope:

8x - 2y = 4

-2y = -8x + 4

Divide both sides by -2:

y = 4x - 2

The slope of the given line is 4.

The slope of a line perpendicular to this line would be the negative reciprocal of 4, which is -1/4.

Now, we have the slope (-1/4) and a point (4, 3). We can use the point-slope form of a linear equation:

y - y₁ = m(x - x₁)

Substituting the values, we have:

y - 3 = (-1/4)(x - 4)

Expanding and simplifying, we get:

y - 3 = (-1/4)x + 1

Adding 3 to both sides, we have:

y = (-1/4)x + 4

To learn more about equation click on,

https://brainly.com/question/20712656

#SPJ2

(x-4)°=1
giải hộ em với ạ

Answers

Answer: 5

Step-by-step explanation:

⇒ (x - 4) = 1

⇒ x = 1 + 4

⇒ x = 5

Therefore value of x = 5

Answered by Gauthmath must click thanks and mark brainliest

Other Questions
__ is an art style of the 1960s, often deriving its subject-matter from easily-recognizable, mass-produced imagery or products. It often focused on over-familiar objects of daily life to give them new meanings as visual emblems. Group of answer choices jane is X years old. How old will she be in 2 year's time? How old will she be in 5 year's time? what does it mean when x is a constant, in a maths equation 2x +4>- 6 and 5x -12 Please help from 1 to 24 please Another learning aid provides a step-by-step walk-through showing the solution process for a problem similar to the one you are working on. You would click Continue to advance through each step in the solution process to show intermediate calculations at key points. While you are attempting to solve the given exercise, this learning aid can be referenced multiple times and does not load a new version of the exercise when it is accessed. Choose the described learning aid below. A cage holds two litter of rats. One litter comprises one female and five males. The other litter comprises seven females and two males. A random selection of two rats is done. Find the probability that the two rats are from the same litter. n eight-sided die, which may or may not be a fair die, has four colors on it; you have been tossing the die for an hour and have recorded the color rolled for each toss. What is the probability you will roll a blue on your next toss of the die Name two things the colonists did not find at Jamestown. The opposite angles of a parallelogram are (3x + 5) and (61 x). Find the measure of four angles. which statement best describes a chemical property of a mineral 00Use base units to check whether the following equations are balance(a) pressure = depth x density gravitational field strength,(b) energy = mass x (speed of light).dod to molt solid add question tags to the following statements1. you like pizza,...? what is poverty according to Parker? Can you help me guys I need help as soon as possible. construct a rectangle PQRS, In which AB= 8cm and diagonal AC= 10cm What is a comparison of two things, which suggests they are the same?A. Metaphor B. Simile C. Passive Voice D. Active Voice cho 3,8g hn hp na2co3 v nahco3 tc dng vi dung dch hcl.Thot ra 896 kh ktc a/ tnh thnh phn % theo khi lng mi mui trong hn hp u.b/ tnh th tch dung dch hcl 20% bit d= 1,1g trn ml la reproduccion es un conjunto de procesos de las que surge un individuo nuevo