Answer:
the air around you
Explanation:matter is physical like the particles in the air or the oxygen in the air. so rocks, earth the sun, anything you can touch is matter. even gasses.
Which substance has the highest melting point? Select one: a. sugar b. Oxygen c. Diamond
Answer:
Diamonds
Explanation:
The melting point of sugar is 186C
The melting point of oxygen is -218C
The melting point of diamonds are 4078C
Therefore diamonds have the highest melting point.
You can also think of their structures, as diamonds have a covalent network structure, meaning they are really strong and have a high melting point
Oxygen has a covalent molecular structure
Sugar has a much weaker covalent network structure
What is the complete ionic equation for this reaction?
2KOH(aq) + H2SO4(aq) → 2H20(1) + K2SO4(aq)
O A. 2K+ + OH + H2SO4 → OH + 2H+ + K2SO4
B. OH + 2H+ + 2H20()
C. 2KOH + H2SO4 → 2H20 + K2SO4
D. 2K+ + OH + 2H+ + SO42- → 2H20() + 2K+ + SO42-
SUBMIT
Answer:
The answer is "Option D".
Explanation:
The entire ionic equation for all the substances, which are ionic compounds but are available in an aquatic is represented in the form with ions in the full ionic equation.
In the Net ionic equation, it doesn't have the particulate matter throughout the net ionic equations throughout the equations.
In the Spectator ions, it doesn't participate in interactions mostly on reaction and the material hand. From both sides, the very same ions are present.
The evenly balanced chemical formula is,
[tex]2KOH (aq)+ H_2SO_4(aq) \longrightarrow 2H_2O(l) + K_2SO_4[/tex]
It is the separate organic compound that full ion formula will match the choice D.
A botanist measures a plant growth at 3cm over a two week period. The information she gathers is called.
Answer:
The correct answer is quantitative data.
Explanation:
The value of data in the form of numbers of counts where each set of data exhibits a specific numerical value associated with it is termed as quantitative data. This information refers to any quantifiable knowledge, which can be used for statistical analysis and mathematical calculations so that decisions of real-life can be taken based on the mathematical outcomes. The quantitative data is used to find the solutions of the queries like how often, how much, or how many.
In the given case, a botanist measured the growth of the plant for two weeks, and the outcome came in the form of numerical value. Thus, the knowledge she collected is known as quantitative data.
Why do.we need inactive ingredients?
Answer:
Inactive ingredients are components of a drug product that do not increase or affect the therapeutic action of the active ingredient, which is usually the active drug. Inactive ingredients are added during the manufacturing process of pharmaceutical products such as tablets, capsules, suppositories, and injections
For the set of ionic compounds, CaSO4, CaCO3, Ca(OH)2, choose the correct characterization of their solubilities in water from the response list. Group of answer choices None of the three salts are soluble. All three salts are soluble. Two of the three salts are soluble. One of the three salts is soluble.
Answer:
None of the three salts are soluble.
Explanation:
According to the solubility rule, the carbonates and sulphates of group two elements are insoluble in water.
All three substances mentioned possess very low solubility in water and can be said to be slightly soluble in water. If we compare them with other ionic substances that dissolve readily in water, we can rightly say that they are insoluble in water.
Hence all three substances are insoluble in water.
3. How many meters above sea level is the base of your landform?
How many meters above sea level is the top of your platform?
Answer:
Base is 715 and top is 850.
Explanation:
715 meters above sea level is the base of my landform and 850 meters above sea level is the top of my platform. Base of landform from a sea level is a starting point of a city or region having same topography. This region has a specific height where it spreads we called it top of the platform. The starting point of my location is 715 meters above sea level spreads up to 850 meters of elevation.
Which of the following statements is true? A. Isotopes of the same element have the same number of protons and neutrons. B. Isotopes have the same physical properties as the normal atom but different chemical properties. C. Isotopes have the same chemical properties as the normal atom but different physical properties. D. If an isotope of one element has the same atomic mass as another element, they will have the same properties.
Answer:
B
Explanation:
Isotopes have the same number of protons but different number of neutrons.
The true statement is,
Isotopes have the same chemical properties as the normal atom but different physical properties.So, option C is correct one.
What is isotopes?The elements have same number of proton but different number of neutrons.Example: hydrogen, deuterium, tritiumWhy isotopes of same elements have different physical properties?The isotopes have different physical properties like freezing point , mass, melting or boiling point etc because they have different mass number .
learn about isotopes,
https://brainly.com/question/11904263
#SPJ2
How many moles of potassium in 73.56g of potassium chlorate (V) (KClO 3 )?
Answer:
Approximately [tex]0.6003\; \rm mol[/tex] formula units.
Explanation:
Formula Mass of KClO₃Look up the relative atomic mass data for [tex]\rm K[/tex], [tex]\rm Cl[/tex], and [tex]\rm O[/tex] on a modern periodic table:
[tex]\rm K[/tex]: [tex]39.908[/tex].[tex]\rm Cl[/tex]: [tex]35.45[/tex].[tex]\rm O[/tex]: [tex]15.999[/tex].The relative atomic mass of an element is numerically equal to the mass (in grams) of one mole of its atoms. For example, the relative atomic mass of [tex]\rm K[/tex] is [tex]39.908[/tex]. Therefore, the mass of one mole of [tex]\rm K\![/tex] atoms should be [tex]39.908\; \rm g[/tex].
Each [tex]\rm KClO_3[/tex] "formula" unit includes one [tex]\rm K[/tex] atom, one [tex]\rm Cl[/tex] atom, and three [tex]\rm O[/tex] atoms. Therefore, one mole of [tex]\rm KClO_3\![/tex] formula units would include:
one mole of [tex]\rm K[/tex] atoms, one mole of [tex]\rm Cl[/tex] atoms, and three moles of [tex]\rm O[/tex] atoms.From the relative atomic mass of these three elements:
The mass of one mole of [tex]\rm K[/tex] atoms would be [tex]39.908\; \rm g[/tex].The mass of one mole of [tex]\rm Cl[/tex] atoms would be [tex]35.45\; \rm g[/tex].The mass of three moles of [tex]\rm O[/tex] atoms would be [tex]3 \times 15.999\; \rm g = 47.997\; \rm g[/tex].Combining these three parts should give the mass of one mole of [tex]\rm KClO_3[/tex] formula units:
[tex]\begin{aligned}& M(\mathrm{KClO_3}) \\ &= 39.908 + 35.45 + 3 \times 15.999 \\ &= 122.545\; \rm g \cdot mol^{-1}\end{aligned}[/tex].
Number of moles of KClO₃ formula units in the sampleThe formula mass of [tex]\rm KClO_3[/tex] is [tex]M(\mathrm{KClO_3}) = 122.545\; \rm g \cdot mol^{-1}[/tex], meaning that the mass of one mole of [tex]\rm KClO_3\![/tex] formula units would be [tex]122.545\; \rm g\![/tex].
The mass of this [tex]\rm KClO_3\!\![/tex] sample is [tex]m(\mathrm{KClO_3}) = 73.56\; \rm g[/tex]. The number of moles of formula [tex]\rm KClO_3\![/tex] units in this sample would be:
[tex]\begin{aligned}n(\mathrm{KClO_3}) &= \frac{m(\mathrm{KClO_3})}{M(\mathrm{KClO_3})} \\ &= \frac{73.56\; \rm g}{122.545\; \rm g \cdot mol^{-1}} \approx 0.6003\; \rm mol\end{aligned}[/tex].
To know the exact number of mole of potassium (K) in 73.56 g of potassium chlorate (v), KClO₃ do the following:
Step 1:Determination of the number of mole in 73.56 g of potassium chlorate (v), KClO₃
Mass of KClO₃ = 73.56 g
Molar mass of KClO₃ = 39 + 35.5 + (16×3)
= 39 + 35.5 + 48
= 122.5 g/mol
Mole of KClO₃ =?[tex]Mole =\frac{mass}{molar mass}\\\\Mol KClO_{3} = \frac{73.56}{122.5}[/tex]
Mole of KClO₃ = 0.6 moleStep 2:Determination of the number of mole of potassium, K in 0.6 mole (i.e 73.56 g) of KClO₃
Considering the molecular formula of potassium chlorate (v), KClO₃, we can see that:
1 mole of KClO₃ contains 1 mole of K.
Therefore, 0.6 mole of KClO₃ will also contain 0.6 mole of K.
Therefore, we can conclude that 73.56 g of KClO₃ contains 0.6 mole of potassium, K.
Learn more: https://brainly.com/question/2264224
BRAINLIEST!!! ❣
How do scientists use ice to study ancient climates?
A. through glacial deposits and ice cores
B. through glacial deposits and ice ages
C. through ice cores and pollen grains
D. through pollen grains and ice ages
Which greenhouse gas is produced by commercial refrigeration and air conditioning systems?
A. carbon dioxide
B. fluorinated gas
C. nitrous oxide
D. methane
Explanation:
the first question's answer is a
the second question's answer is c
All the simple machines make work easier to do by changing the _____ or _____ of a force. A. size; type B. work; type C. size; direction D. type; direction
Answer:
C. size; direction
Explanation:
By definition, a machine is referred to any device that makes work easier. It takes force to do work, hence, work refers to the application of force over a particular distance. A machine aims at making the work easy by changing how it is done. Simple machines, which include: levers, pulleys, inclined planes etc. all carry out the same thing, which is to make work easier, by changing the size/magnitude and direction of the applied force.
A simple machine tends to change the size of the inputted force by increasing it over a shorter distance. The machine increases the force applied better than it can be done manually e.g. a plier and nutcracker increases/changes the applied force better than it can be done with bare hands.
Also, a simple machine can achieve making work easier by changing the direction at which the force is applied. The machine applies the force on the object in an opposite direction or contrary to the way it was manually applied.
PLEASE PLEASE HELP!!!! What is the mass of a sample material that has a volume of 72.2cm³ and a density of 7.7g/cm³?
Answer:
The answer is
555.94g
Explanation:
To find the mass of a substance given it's density and volume we use the formula
[tex]Density \: = \frac{mass}{volume} [/tex]Making mass the subject we have
mass = Density × volume
From the question
Density = 7.7 g/cm³
Volume = 72.2 cm³
Substitute the values into the above formula
That's
mass = 7.7 g/cm³ × 72.2 cm³
We have the final answer as
mass = 555.94gHope this helps you
Is iodine a atom,a molecule,an ion or a formule unit?
Answer:
It's an atom
Explanation:
It can't be a molecule since it's only one element, the ion would've been Iodide (I-), and it's not a formula
which statement is true about this reaction 14/7n + 1/1h ------> 15/8o
A. it is a practical source of energy on earth
B.it occurs only outside the solar system
C.its product is heavier than each of its reactants
D.it shows the critical mass of an element
Answer: answer is C
Explanation:
Its product is heavier than each of its reactants is true about this ₇N¹⁴ + ₁H¹ → ₈O¹⁵ reaction
What is Nuclear reaction ?A nuclear reaction is a reaction in which one or more than one nuclides are generate and it collides between two atomic nuclei or one atomic nucleus.
The reaction is
₇N¹⁴ + ₁H¹ → ₈O¹⁵
Now equating the mass number of both sides
14 + 1 = 15 + a
a = 0
Equating atomic number of both sides
7 + 1 = 8 + x
x = 0
Thus, we can say that its product is heavier than each of its reactants is true about this reaction
Hence, option C is correct answer.
Learn more about Nuclear reaction here: https://brainly.com/question/25387647
#SPJ2
1. The Tyndall Effect is most useful for distinguishing between: *
a solute and a solvent
O a suspension and a solution
a colloid and a suspension
a colloid and a solution
Answer:
a colloid and a solution
Explanation:
When solute particles completely dissolve in a solvent, a true solution is formed. The solute particles in this case are so little that they can not be seen with naked eyes. A true solution does not scatter rays of light.
In a false solution, the solute particles are larger than the solute particles in true solutions but are not large enough to be seen with naked eyes. False solutions scatter rays of light. False solutions are also called colloids.
The major difference between a solution and a colloid is that colloids scatter light rays (Tyndall effect) while a true solution does not scatter light rays.
Increasing temperature can
Question 9 of 10
How could an electron configuration be used to predict relative atomic size?
A. The more valence electrons listed, the larger the atomic radius.
B. The larger the highest energy level number, the larger the atomic
radius.
C. The more sublevels occupied, the larger the atomic radius.
D. The greater number of total electrons, the larger the atomic radius.
SUBMIT
Answer: B
Explanation: Apex
An electron configuration be used to predict relative atomic size because the larger the highest energy level number, the larger the atomic
radius.
The electron configuration of an element shows the arrangement of electrons in atoms of that element.
As more sublevels are added, repulsion between electrons occupying shells increases causing a greater shielding and consequent increase in the size of the atom.
Hence, the larger the highest energy level number, the larger the atomic
radius.
Learn more: https://brainly.com/question/238050
An atom X has a proton number of 19 and relative atomic mass of 39.
(i) How many electrons, protons and neutrons are there in an atom of X?
(ii) How many electrons will there be in the outer energy level (shell) of an atom of X?
(iii) What is the electronic configuration of X?
Answer:
1) electron=19 Proton=19 Neutron=39-19=20
2) 1
3) in pic
Answer:
(i)electrons = 19; Protons = 19 Neutrons =39-19=20
(ii) 1
(iii) 2,8,8,1
Hope this helps.
Please mark me as Brainliest:))
3. why are fire tornadoes rare ?
Os subníveis mais energéticos de um dado átomo são: ...4s2 3d10 4p5 a) indique o seu número atomico b) quantos electrões de valência apresenta esse átomo c) a que família pertence?
Answer:
A. 35
B. 7
C. halogênios
Explanation:
Aqui, para responder a essa pergunta, precisaremos conhecer o elemento particular em questão.
..... 4s ^ 2 3d ^ 10 4p ^ 5 significa que está a cinco elétrons da configuração eletrônica do último elemento na primeira camada dos metais pesados.
O último elemento da 1ª série do elemento de transição é o zinco, portanto, como está a apenas 5 elementos de distância, o átomo de que estamos falando é o átomo de Bromo de Bromo.
A. O zinco tem um número atômico 30 e como o bromo está a 5 elementos de distância, seu número atômico é 35
B. Uma vez que pertence ao grupo halogênio, tem 7 elétrons de valência como o resto da família
C. Pertence à família dos halogênios
In the image above the ruler is measuring in centimeters. The blue cylinder falls somewhere between 2.7cm and 2.8cm according to the ruler. Since we can estimate the last digit I would say that the length of the cylinder is 2.76cm. Since I am estimating any number 2.72cm or 2.78cm could also be correct.
Why would 2.755 not be a correct measurement according to estimating the last digit?
Answer:
The answer is below
Explanation:
Resolution is the smallest unit of measurement that can be measured by a measuring instrument. Each point on the ruler is 0.1 cm and the difference between any two points, about 0.01 cm cam be measured. The minimum measurement (resolution) that can be measured by the ruler is 0.01 cm (two decimals), therefore it cannot measure up to three decimal places such as numbers like 2.755.
4. The mass of a silver liberty (coin) was measured three times and each measurement was made
to five digits. The mass values were 12.519 9.12.521 g, and 12.496 g. The average mass was
reported as 12.512 g.
Why is the average mass of the gold coin reported to five significant figures, even though you
had to divide by "3" to obtain the average?
Answer:
The average mass of the gold coin reported to five significant figures, even though you had to divide by "3" to obtain the average.
Explanation:
Given that,
The mass of a silver liberty was measured three times and each measurement was made to five digits.
The mass values are,
[tex]m_{1}=12.519\ g[/tex]
[tex]m_{2}=12.521\ g[/tex]
[tex]m_{3}=12.496\ g[/tex]
The average mass of the gold coin is 12.512 g.
We know that,
Significant figures :
Significant figures is explained the nonzero, leading zero and zeros between two nonzero digits.
For example,
The digits is 0.003405
In the digit, 345 = nonzero
0.00 = leading zero
The average mass of the gold coin reported to five significant figures because average mass is 12,512. All digits are nonzero.
Nonzero digit are significant.
Hence, The average mass of the gold coin reported to five significant figures, even though you had to divide by "3" to obtain the average.
What is the product of the reaction of pentanoic acid with ethanol in the presence of a strong acid?
Answer:
ethylpentanoate
Explanation:
Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.
The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;
CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)
The name of the compound formed is ethylpentanoate.
Which of the following is not an antioxidant _________
1) Sodium benzoate 2) Sulphur dioxide 3) Sulphite salts 4) Citric acid
Answer: 1. Sodium Benzoate
Explanation: An anti-oxidant is a substance that can help prevent or stop the damage done by free radicals. Examples include; Sulphur Dioxide, Sulphite Salts, Citric Acid, e.t.c
Sodium benzoate is a pure preservative.
A wittig reaction occurs when 4-methylbenzaldehyde and benzyltriphenylphosphonium chloride are stirred together at room temperature in the presence of sodium hydroxide base. Draw the major isomer produced by this reaction.
Answer:
See explanation
Explanation:
The wittig reaction is an organic reaction in which an aldehyde or a ketone reacts with a phosphonium ylide to give an alkene. This phoshonium ylide that participates in the reaction is usually generated insitu in the system by reaction of an alky or aryl triphenylphosphonium halide salt with a base(sodium hydroxide is mostly used).
In this particular reaction 4-methylbenzaldehyde and benzyltriphenylphosphonium chloride were reacted together in the presence of sodium hydroxide and the product with the structure shown in the answer was obtained as the major isomer produced in the reaction.
Answer in the correct significant figures: 35.6 + 56.27 *
Answer:
101.87
Explanation:
that's the answer
why is an element considered a pure substance
Answer:
Because they cannot be separated into more then one type of substance.
Explanation:
Answer:
Elements are made of only one kind of atom. The particles can be a single atom or a molecule made of only one kind of atom. There is no physical change that can separate elements into more than one kind of substance. This makes an element a pure substance.An element is made up of only one type of atom. An element cannot be broken down into a simpler form.
how many primary carbon are in 2,3 dimethylpentane
Answer:
There are 7 carbons in 2,3 dimethylpentane
Explanation:
Because 2,3-dimethlypentane is an organic compound of carbon and hydrogen with formula C7H16
Examine the given reaction. NH4NO3(s) → NH4+(aq) + NO3–(aq) ΔH° = 25.45 kJ/mol ΔS° = 108.7 J/mol·K Which of the given is correct about the ΔG° at 25 °C?
A)+4,360 J
B)−6,942 J
C)−4,360 J
D)+6,942 J
Answer:
B)−6,942 J /mol
Explanation:
At constant temperature and pressure, you cand define the change in Gibbs free energy, ΔG, as:
ΔG = ΔH - TΔS
Where ΔH is enthalpy, T absolute temperature and ΔS change in entropy.
Replacing (25°C = 273 + 25 = 298K; 25.45kJ/mol = 25450J/mol):
ΔG = ΔH - TΔS
ΔG = 25450J/mol - 298K×108.7J/molK
ΔG = -6942.6J/mol
Right solution is:
B)−6,942 J /molwhat’s the answer to this?
Chemical change example
Answer: burning paper
Explanation:
The paper burns in air to form smoke and ash. which makes it a chemical change.
