Answer:
The correct option is A
Explanation:
Some amino acids, called glucogenic amino acids, when catabolized convert there carbon backbones to tricarboxylic acid (TCA) cycle intermediates. These intermediates can be subsequently metabolized into carbon dioxide and water with the release of ATP or the formation of glucose (known as gluconeogenesis.
All amino acids (with the exception of leucine and lysine) are glucogenic and can thus generate the carbon backbones required for gluconeogenesis. Thus, the correct option is a.
For the following reaction, 11.6 grams of sulfur are allowed to react with 23.8 grams of carbon monoxide .
sulfur(s) + carbon monoxide(g) sulfur dioxide(g) + carbon(s)
What is the maximum amount of sulfur dioxide that can be formed?
What is the formula for the limiting reagent?
What amount of the excess reagent remains after the reaction is complete?
Answer:
S + 2CO = SO2 + 2C
First, look for the amount of substance of sulfur:
n(S) = m / M
n(S) = 14.8 g/32 g / mol = 0.4625 mol
n(CO) = m (CO) / M (CO)
M(CO) = 12 + 16 = 28 g/mol
n(CO) = 19.9 g/28 g/mol = 0.71 mol
S in excess, so for calculating we take CO:
n(SO2) = n(CO)/2 = 0.71 mol/2 = 0.355 mol
m(SO2) = M(SO2)*n(SO2)
M(SO2) = 32 + 16*2 = 64 g/mol
m(SO2) = 64 g/mol * 0.355 mol = 22.74 g
write any two things that should be remembered while writing chemical equation
Answer:
the product and the reactant must be balanced
if u are required to give the mechanism if the reaction it must be written
Que es la actividad física y en qué mejora
Please please help help please
C3H8 is ________
A. unsaturated
B. saturated
Please help me ASAP in my final project I am ready to pay 20$
Answer:
$20
ASAP PROJECT
Given the following list of densities, which materials would float in a molten vat of lead provided that they do not themselves melt? Densities (g/mL): lead = 11.4, glass = 2.6, gold = 19.3, charcoal = 0.57, platinum = 21.4.
a. gold and platinum
b. glass and charcoal
c. gold, platinum, glass and coal
d. gold and charcoal
e. None of these
Answer:
b. glass and charcoal
Explanation:
Step 1: Given data
Density of Pb: 11.4 g/mLDensity of Glass: 2.6 g/mLDensity of Au: 19.3 g/mLDensity of charcoal: 0.57 g/mLDensity of platinum: 21.4 g/mLStep 2: Determine which material will float in molten lead
Density is an intrinsic property of matter. Less dense materials float in more dense materials. The materials whose density is lower than that of lead and will therefore float on it are glass and charcoal.
the force of attraction between non polar molecules are what
Answer:
dispersion force
Explanation:
>
Which statement describes an electron?
EEEE
It has a positive charge and is located in the nucleus.
O It has a positive charge and is located in orbitals around the nucleus.
It has a negative charge and is located in the nucleus.
O It has a negative charge and is located in orbitals around the nucleus.
Answer:
It has a negative charge and is located in orbitals around the nucleus
Explanation:
The statement describes an electron is " It has a negative charge and is located in orbitals around the nucleus."
What is electron?The electron would be a subatomic particle with a negatively one elementary charge electric charge.
What is nucleus?Protons, that have a positive charge, as well as neutrons, which have no electrical charge, make up the nucleus. Quarks were subatomic particles that make up protons but also neutrons.
Electrons were present surrounding the atom's nucleus, in contrast to protons as well as neutrons, that are contained within the nucleus at its core. Negative electrons were drawn to the positive nucleus since the electric charges of opposite polarity attract one another.
To know more about electrons and nucleus.
https://brainly.com/question/23366064
#SPJ3
Identify the possible quantitative analysis you can do using only the 28.02 g/mol as a unit factor. Select one or more:
Answer:
Calculate the moles of N2 molecules in 3.94 grams of nitrogen.
Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules.
Explanation:
Calculate the moles of N2 molecules in 4.73 liters of nitrogen gas. FALSE. You can't make this conversion using only the conversion factor with units of g/mol. To convert liters to moles are necessaries pressure, temperature and volume of the gas to use PV = nRT
Calculate the grams of N2 in 10.58 liters of nitrogen gas. FALSE. As explained, you need, P,V and T to find the moles of the gas. With the moles you can find the mass using the conversion factor of 28.02g/mol
Calculate the moles of N2 molecules in 3.94 grams of nitrogen. TRUE. You can find the moles of N2 as follows:
3.94g N2 * (1mol/28.02g) = 0.14 moles of N2 molecules
Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules. TRUE. The mass in 5.03x10²⁰ moles of nitrogen molecules is:
5.03x10²⁰ moles * (28.02g/mol) = 1.4x10²²g of nitrogen.
If 0.250 L of a 5.90 M HNO₃ solution is diluted to 2.00 L, what is the molarity of the new solution?
Answer:
0.74 M
Explanation:
From the question given above, the following data were obtained:
Molarity of stock solution (M₁) = 5.90 M
Volume of stock solution (V₁) = 0.250 L
Volume of diluted solution (V₂) = 2 L
Molarity of diluted solution (M₂) =?
The molarity of the diluted solution can be obtained by using the dilution formula as illustrated below:
M₁V₁ = M₂V₂
5.90 × 0.250 = M₂ × 2
1.475 = M₂ × 2
Divide both side by 2
M₂ = 1.475 / 2
M₂ = 0.74 M
Thus, the molarity of the diluted solution is 0.74 M
Identify the options below that are results of adding a catalyst to a chemical system.
The reaction rates are increased.
The reaction quotient is unaffected.
The reaction quotient decreases.
The equilibrium constant is unaffected.
Answer:
The correct options are a, b and d
Explanation:
A catalyst is a substance that increases the rate of a chemical reaction by reducing the activation energy. Le Catelier's principle explains how a substance or an "action" can affect a reaction in equilibrium.
The principle states that when a change is made to the conditions of a reacting system at equilibrium, the position of the equilibrium moves to counteract the change made. These changes are change in temperature, pressure, volume and/or concentration. These changes will either cause the equilibrium to shift forward or backward.
However, the presence of a catalyst DOES NOT affect a chemical equilibrium/equilibrium constant nor does it affect the reaction quotient because the same amount of reactants and products are available just as in uncatalyzed reaction except that the reaction proceeds faster (which does not affect equilibrium).
The rate of reaction is given as the time required by the reactant to convert into the product. The addition of catalyst increases the rate of reaction, while the reaction quotient and the equilibrium remain unaffected.
What is a catalyst?A catalyst is a chemical or compound that adds to the reaction and lowers the activation energy by providing an alternative path to the reaction.
The catalyst takes part in the reaction but did not consume in the chemical reaction.
The equilibrium and the reaction quotient are dependent on the conversion of the reactant to the product. The catalyst is not used in the reaction and thus did not affect the reaction quotient or the equilibrium.
Hence, options A, B, and D are correct for the use of catalysts in the chemical reaction.
Learn more about catalysts, here:
https://brainly.com/question/17052831
Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol
Answer:
Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol
Explanation:
According to IUPAC rules, the name of a compound is:
Prefix+root word+suffix
1) Select the longest carbon chain and it gives the root word.
2) The substituents give the prefix.
3) The functional group gives the secondary suffix and the type of carbon chain gives the primary suffix.
The structure of the given compounds are shown below:
You are asked to prepare a buffer solution with a pH of 3.50. The following solutions, all 0.100 M, are available to you: HCOOH, CH3COOH, H3PO4 , NaCHOO, NaCH3COO, and NaH2PO4. What would be the best combination to make the required buffer solution? Select one:
a. NaH2PO4 and NaCHOO
b. H3PO4 and NaH2PO4
c. NaH2PO4 and HCOOH
d. CH3COOH and NaCH3COO e. HCOOH and NaCHOO
can someone helo me with this
Answer:
e. HCOOH and NaCHOO
Explanation:
For a buffer solution, both an acid and its conjugate base are required.
With the information above in mind, we can discard options a) and c), as those combinations are not of an acid and its conjugate base.
Now it is a matter of comparing the pKa (found in literature tables) of the acids of the remaining three acids:
H₃PO₄ pKa = 2.12CH₃COOH pKa = 2.8HCOOH pKa = 3.74The acid with the pKa closest to the desired pH is HCOOH, so the correct answer is e. HCOOH and NaCHOO
the force of attraction between non polar molecules are what (a)electrovalent bond (b)covalent bond (c)Hydrogen bond (d)Van der waals forces
Answer:
d. van der waals force
Explanation:
Van der Waals force :
the weakest intermolecular forceand consist of dipole-dipole force and dispersion force.
Linoleic acid is a polyunsaturated fatty acid found, in ester form, in many fats and oils. Its doubly allylic hydrogens are particularly susceptible to abstraction by radicals, a process that can lead to the oxidative degradation of the fat or oil.
a. True
b. Flase
Answer:
True.
Explanation:
The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.
True or false: Boron contains 2s22p1 valence electrons, so only one p orbital is needed to form molecular orbitals.
Answer:
True
Explanation:
The valence orbitals of boron are 2s2 2p1. We have to recall that all the valence orbitals whether full or empty are involved in the formation of molecular orbitals.
The number of molecular orbitals formed is equal to the number of atomic orbitals that are combined.
Since there are two valence orbitals and there is only one p orbital among the valence orbitals, it is true that only one p orbital is needed to form molecular orbitals in boron.
Pls pls help me me pls
Answer:
Danger
Explanation:
What are the uses of Sulphuric acid?
Answer:
The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.
The major use of sulfuric acid is in the production of fertilizers, e.g., superphosphate of lime and ammonium sulfate. It is widely used in the manufacture of chemicals, e.g., in making hydrochloric acid, nitric acid, sulfate salts, synthetic detergents, dyes and pigments, explosives, and drugs.
Rank each of the following gases in order of increasing urms assuming equivalent amounts and all gases are at the same temperature and pressure where 1 has the lowest urms and 4 has the highest urms.
a. Gas 1 : H2S
b. Gas: He
c. Gas 3: NF3
d. Gas 4: H2O
The Urms refers to the root mean square speed of the gas. The order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.
What is the Urms?The Urms refers to the root mean square speed of the gas. This is ultimately dependent on the relative molecular mass of the gases when they are maintained at the same temperature.
Now, let us look at the order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.
Learnmore about Urms: https://brainly.com/question/365923
To what volume (in mL) would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN?
Answer:
To 318.18 mL would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN
Explanation:
Dilution is the reduction of the concentration of a chemical in a solution and consists simply of adding more solvent.
In a dilution the amount of solute does not vary. But as more solvent is added, the concentration of the solute decreases, as the volume (and weight) of the solution increases.
In a solution it is fulfilled:
Ci* Vi = Cf* Vf
where:
Ci: initial concentration Vi: initial volume Cf: final concentration Vf: final volumeIn this case:
Ci= 1.40 MVi= 20 mLCf= 0.088 MVf= ?Replacing:
1.40 M* 20 mL= 0.088 M* Vf
Solving:
[tex]Vf=\frac{1.40 M* 20 mL}{0.088 M}[/tex]
Vf= 318.18 mL
To 318.18 mL would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN
Name the compound CuI2
Answer:
Copper iodide. I think
Answer:
copper iodide(Cul2)hope it helps
stay safe healthy and happy..once a recrystallization is completed and filtered, what solvent would be suitable for transferring the leftover solids to filtration funnel
Answer:
To transfer leftover solids to the filtration funnel and wash out crystals after recrystallization, ice cold methanol should be used (the mother liquor used for recrystallization).
Explanation:
Hope this helped
what is the machine used to check melting point called?
Answer:
Melting-point apparatus
The metal tantalum becomes superconducting at temperatures below 4.483 K. Calculate the temperature at which tantalum becomes superconducting in degrees Celsius.
Answer:
The correct answer is "-268.667°C".
Explanation:
Given:
Temperature,
= 4.483 K (below)
Now,
The formula of temperature conversion will be:
⇒ [tex]T(^{\circ} C)=T(K)-273.15[/tex]
By putting the values, we get
⇒ [tex]=4.483-273.15[/tex]
⇒ [tex]=-268.667^{\circ} C[/tex]
Thus the above is the correct answer.
Vocabulary: dipole, dipole-dipole force, dipole-induced dipole force, electronegativity, intermolecular force, ionic bond, London dispersion force, molecule, nonpolar, nonpolar covalent bond, partial charges, polar, polar covalent bond, valence electron Prior Knowledge Questions (Do these BEFORE using the Gizmo.) 1. A big bully is having a tug-of-war with a small child. There is a ball attached to the middle of the rope. Toward whom will the ball move
Answer:
Towards the big bully
Explanation:
If a big bully and a small child are involved in a thug of war, it is clear that the bully is stronger than the child and he/she will pull the rope used in the thug of war with a greater force.
By so doing, the ball attached at the centre of the rope will naturally be drawn towards the stronger bully.
Liquid octane will react with gaseous oxygen to produce gaseous carbon dioxide and gaseous water . Suppose 10.3 g of octane is mixed with 23. g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to significant digits.
Answer:
9.36 g
Explanation:
The equation of the reaction is;
C8H18(g) + 25/2 O2(g) ----> 8CO2(g) + 9H2O(g)
Number of moles of octane = 10.3g/ 114 g/mol = 0.09 moles
1 mole of octane yields 9 moles of water
0.09 moles of octane yields 0.09 × 9/1 = 0.81 moles of water
Number of moles of oxygen = 23g/32g/mol = 0.72 moles
12.5 moles of oxygen yields 9 moles of water
0.72 moles of oxygen yields 0.72 × 9/12.5 = 0.52 moles of water
Hence oxygen is the limiting reactant;
Maximum mass of water produced = 0.52 moles of water × 18 g/mol = 9.36 g
#6 and #7. How many carbon atoms are in a mixture of 7.00 mol c2F2 and 0.400 mol carbon dioxide and also #7
Answer:
#6 8.67x10²⁴ atoms
#7
1. Atom
2. Formula unit
3. Molecule
4. Ion
Explanation:
#6 First we calculate how many carbon moles are there in 7.00 moles of C₂F₂, keeping in mind that there are 2 C moles per C₂F₂ mol:
7.00 mol C₂F₂ * 2 = 14.00 mol CAs for carbon dioxide, there are 0.400 C moles in 0.400 moles of CO₂.
We calculate the total number of C moles:
14.00 mol + 0.400 mol = 14.4 mol CFinally we calculate the number of atoms in 14.4 C moles, using Avogadro's number:
14.4 mol * 6.023x10²³ atoms/mol = 8.67x10²⁴ atoms#7
1. Radon - Atom (Ra)2. Formula unit (It is a crystalline solid, BaBr₂)3. Molecule (NH₃)4. Ion (It has a formal charge, +2)4.106
Calculate the moles and the mass of solute in each of the following solutions.
(a) 150.0 mL of 0.245 M CaCl2
molarity = moles of solute / volume of solution
moles of solute = molarity × volume of solution
moles of solute = 0.245 mol/L × 0.1500 L
moles of solute = 0.03675 mol
moles of solute = 0.0368 mol
-----------------------------------------------------------
Solution: (mass of solute)Step 1: Calculate the molar mass of solute.
molar mass of solute = (40.08 g/mol × 1) + (35.45 g/mol × 2)
molar mass of solute = 110.98 g/mol
Step 2: Calculate the mass of solute.
mass of solute = moles of solute × molar mass of solute
mass of solute = 0.03675 mol × 110.98 g/mol
mass of solute = 4.08 g
Note: The volume of solution must be expressed in liters (L).
Answer:
[tex]\boxed {\sf \bold {0.0368 \ mol \ CaCl_2}}}}[/tex]
[tex]\boxed {\sf \bold {4.08 \ g \ CaCl_2}}}}}[/tex]
Explanation:
1. Moles of SoluteMolarity is a measure of concentration in moles per liter.
[tex]molarity= \frac {moles \ of \ solute}{liters \ of \ solution}[/tex]
In this solution, there are 150.0 milliliters of solution and the molarity is 0.245 M CaCl₂ or 0.245 mol CaCl₂ per liter.
First, convert the milliliters to liters. There are 1000 milliliters in 1 liter.
[tex]{150 \ mL * \frac{1 \ L}{1000 \ mL}= \frac{150}{1000} \ L = 0.150 \ L[/tex]Now, substitute the known values (molarity and liters of solution) into the formula. The moles of solution are unknown, so we can use x.
[tex]0.245 \ mol \ CaCl_2 /L= \frac{ x}{0.150 \ L}[/tex]
We are solving for x, so we must isolate this variable. It is being divided by 0.150 L. The inverse of divisions is multiplication, so we multiply both sides by 0.150 L.
[tex]0.150 \ L *0.245 \ mol \ CaCl_2 /L= \frac{ x}{0.150 \ L} * 0.150 L[/tex]
[tex]0.150 \ L *0.245 \ mol \ CaCl_2 /L=x[/tex]
The units of liters cancel.
[tex]0.150 *0.245 \ mol \ CaCl_2 =x[/tex]
[tex]0.03675 \ mol \ CaCl_2[/tex]
The original measurements have 3 significant figures, so our answer must have the same.
We should round to the ten thousandths place. The 5 to the right of this place tells us to round the 7 up to an 8.
[tex]\bold {0.0368 \ mol \ CaCl_2}[/tex]
2. Mass of the SoluteWe can convert mass to moles using the molar mass. These values are found on the Periodic Table. They are the same as the atomic masses, but the units are grams per mole (g/mol) instead of atomic mass units.
The solute is calcium chloride: CaCl₂. Look up the molar masses of the individual elements.
Ca: 40.08 g/mol Cl: 35.45 g/molNotice that chlorine has a subscript of 2. We must multiply the molar mass by 2.
Cl₂: 35.45 *2= 70.9 g/molAdd calcium's molar mass.
CaCl₂: 40.08 + 70.9 =110.98 g/molUse the molar mass as a ratio.
[tex]\frac {110.98 \ g\ CaCL_2}{ 1 \ mol \ CaCl_2}[/tex]
Multiply the moles of calcium chloride we calculated above.
[tex]0.0368 \ mol \ CaCl_2 *\frac {110.98 \ g\ CaCL_2}{ 1 \ mol \ CaCl_2}[/tex]
The units of moles of calcium chloride cancel.
[tex]0.0368 *\frac {110.98 \ g\ CaCL_2}{ 1 }[/tex]
[tex]4.084064 \ g\ CaCl_2[/tex]
Round to 3 significant figures again. For this number, it is the hundredths place. The 4 in the thousandths place tells us to leave the 8.
[tex]\bold {4.08 \ g \ CaCl_2}[/tex]
PLEASE HELP!!
How does temperature, agitation, and particle size affect solubility?
Answer:
At higher temperatures, particles move faster and collide more, increasing solubility rates.
Agitation increases solubility rates as well, by bringing fresh solvent into contact with the undissolved solute
The smaller the particle size, the higher (faster) solubility rate. Vice versa, the bigger the particle size, the lower (slower) solubility rate.
Explanation:
