William's assembly unit has decided to use a p-Chart with 2-sigma control limits to monitor the proportion of defective castings produced by their production process. The quality control manager randomly samples 150 castings at 10 successively selected time periods and counts the number of defective castings in the sample.

Sample Defects
1 9
2 14
3 9
4 9
5 13
6 8
7 12
8 10
9 12
10 11

Required:
a. What is the Center Line of the control chart?
b. What value of z should be used to construct the control chart?
c. What is the Upper Control Limit?
d. What is the Lower Control Limit?

Answers

Answer 1

Answer: attached below is the missing p chart

a)  0.07133

b)  2

c)  0.098

d) 0.045

Step-by-step explanation:

sample size = 150 castings

number of periods = 10

a) Determine the center Line of the control chart

( 0.06 + 0.0933 + 0.06 + 0.06 + 0.0867 + 0.0533 + 0.08 + 0.067 + 0.08 + 0.073) / 10

mean = 0.07133

standard deviation = 0.01335

b) Determine the value of Z to be used

Given that we are using 2sigma limits .

the value of Z to be used = 2

c) Upper limit control

= mean value +  z-value * std

= 0.0713 + 2*0.01335 =  0.098

d) Lower Control Limit

= mean value - z-value * std

= 0.0713 - 2*0.01335 = 0.045

William's Assembly Unit Has Decided To Use A P-Chart With 2-sigma Control Limits To Monitor The Proportion

Related Questions

This graph represents which of these expressions?

Answers

Answer:

x > 43

Step-by-step explanation:

Open circle at 43, which means it is not equal to 43

Line goes to the right, which means x is greater than

x > 43

Answer:

B

Step-by-step explanation:

Which two shapes make up the digital camera below?

Answers

Rectangular prism and cylinder

Rectangular prism and cylinder make up a camera.

What is rectangular prism and cylinder?

A cube is a rectangular prism with all of its sides being the same length, a triangular prism has a triangle as its base, and a rectangular prism has a rectangle as its foundation. Another form of right prism that has a circle as its basis is a cylinder.

A rectangular prism includes a total of 6 faces, 12 sides, and eight vertices. Like a cuboid, it contains three dimensions- the base width, the height, and the length. The top and base of the rectangular prism exist rectangular. The pairs of opposite faces of a rectangular prism exist as identical or congruent.

A cylinder contains traditionally been a three-dimensional solid, one of the most essential curvilinear geometric shapes. Geometrically, it includes been regarded as a prism with a circle as its base.

Hence, Rectangular prism and cylinder make up a camera.

To learn more about rectangular prisms and cylinders refer to:

https://brainly.com/question/15594686

#SPJ2

5 A machine puts tar on a road at the rate of 4 metres in 5 minutes.
a) How long does it take to cover 1 km of road
b) How many metres of road does it cover in 8 hours?​

Answers

Answer:

5 a) Total = 20.83 hrs = 20 hrs and 50 mins  (1250mins total)

5 b) Total = 96 meters. = 0.096km in 8 hrs.

Step-by-step explanation:

1km = 1000 meters

5 mins = 4 meters

1000/4 = 250 multiplier

250 x 5mins = 1250 minutes

1250/60 = 20hrs + 50 minutes

50 / 60 =  0.83 = 20.83hrs

b)  8 hrs = 8 x 60 = 480 minutes

480/5 = 24 multiplier of 4 meters

24 x 4 = 96 meters

look at the image below

Answers

Answer:

201.1 km²

Step-by-step explanation:

Surface area of a sphere= 4πr², where r = radius

so,

4πr²

= 4×π×4²

= 64π

= 201.1 km² (rounded to the nearest tenth)

please helpppp i need it by tonight its very important

Answers

Answer:

m<1=145

m<2=35

m<3=35

Step-by-step explanation:

measure one is supplementary(the angles add to 180) to measure four.

so we do 180-35=145

measure 2 is congruent to measure four because they are corresponding angles

so measure 2=35

and measure 3 is also congruent to measure 4 because the are corresponding angles

so m<3=35

Please help me with this on the picture

Answers

9514 1404 393

Answer:

  (-5, 4)

Step-by-step explanation:

The inside corner moves from (2, -2) to (-3, 2). That is 5 is subtracted from the x-coordinate, and 4 is added to the y-coordinate. (x, y) ⇒ (x -5, y +4)

The translation vector can be written horizontally as (-5, 4), or vertically as ...

  [tex]\displaystyle\binom{-5}{4}[/tex]

How to make my answer for 0.70 a fraction

Answers

Answer:

0.70 = 7/10

Step-by-step explanation:

Answer:

70/100 or 7/10 (Simplified)

Step-by-step explanation:

0.70 is basically .70 of 1. You can wrote this as a fraction, 70/100. If you divide 70 by 100, it gives you .70.

If you want to simplify it, it becomes 7/10, and if you divide 7 by 10, it also gives you 0.70.

Depends if you want your fraction simplified or not.

have a great day.

A car insurance company has determined that6% of all drivers were involved in a car accident last year. If14drivers are randomly selected, what is the probability of getting at most 3 who were involved in a car accidentlast year

Answers

Answer:

[tex]P(x \le 3) = 0.9920[/tex]

Step-by-step explanation:

Given

[tex]p = 6\%[/tex] --- proportion of drivers that had accident

[tex]n = 14[/tex] -- selected drivers

Required

[tex]P(x \le 3)[/tex]

The question is an illustration of binomial probability, and it is calculated using:

[tex]P(x ) = ^nC_x * p^x * (1 - p)^{n-x}[/tex]

So, we have:

[tex]P(x \le 3) = P(x = 0) +P(x = 1) +P(x = 2) +P(x = 3)[/tex]

[tex]P(x=0 ) = ^{14}C_0 * (6\%)^0 * (1 - 6\%)^{14-0} = 0.42052319017[/tex]

[tex]P(x=1 ) = ^{14}C_1 * (6\%)^1 * (1 - 6\%)^{14-1} = 0.37578668057[/tex]

[tex]P(x=2 ) = ^{14}C_2 * (6\%)^2 * (1 - 6\%)^{14-2} = 0.15591149513[/tex]

[tex]P(x=3 ) = ^{14}C_3 * (6\%)^3 * (1 - 6\%)^{14-3} = 0.03980719024[/tex]

So, we have:

[tex]P(x \le 3) = 0.42052319017+0.37578668057+0.15591149513+0.03980719024[/tex]

[tex]P(x \le 3) = 0.99202855611[/tex]

[tex]P(x \le 3) = 0.9920[/tex] -- approximated

Triangle ABL is an isosceles triangle in circle A with a radius of 11, PL = 16, and ∠PAL = 93°. Find the area of the circle enclosed by line PL and arc PL. Show all work and round your answer to two decimal places.

Answers

The area bounded by a chord and arc it intercepts is known as a segment of a circle segment of a circle

The area of the circle enclosed by line PL and arc PL is approximately 37.62 square units

The reason the above value is correct is as follows:

The given parameters in the question are;

The radius of the circle, r = 11

The length of the chord PL = 16

The measure of angle ∠PAL = 93°

Required:

The area of part of the circle enclosed by chord PL and arc PL

Solution:

The shaded area of the given circle is the minor segment of the circle enclosed by line PL and arc PL

The area of a segment of a circle is given by the following formula;

Area of segment = Area of the sector - Area of the triangle

Area of segment = Area of minor sector APL - Area of triangle APL

Area of minor sector APL:

Area of a sector = (θ/360)×π·r²

Where;

r = The radius of the circle

θ = The angle of the sector of the circle

Plugging in the the values of r and θ, we get;

Area of the minor sector APL = (93°/360°) × π × 11² 98.2 square units

Area of Triangle APL:

Area of a triangle = (1/2) × Base length × Height

Therefore;

The area of ΔAPL = (1/2) × 16 × 11 × cos(93°/2) ≈ 60.58 square units

Required shaded area enclosed by line PL and arc PL:

Therefore, the area of shaded segment enclosed by line PL and arc PL is found as follows;

Area of the required segment PL (98.2 - 60.58) square units = 37.62 square units

The area of the circle enclosed by line PL and arc PL ≈ 37.62 square units

Learn more about the finding the area of a segment can be found here:

https://brainly.com/question/22599425

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

The calculation of the area between line segment PL and circle arc PL is described below:

1) Calculation of the area of the circle arc.

2) Calculation of the area of the triangle.

3) Subtracting the area found in 2) from the area found in 1).

Step 1:

The area of a circle arc is determined by the following formula:

[tex]A_{ca} = \frac{\alpha\cdot \pi\cdot r^{2}}{360}[/tex] (1)

Where:

[tex]A_{ca}[/tex] - Area of the circle arc.

[tex]\alpha[/tex] - Arc angle, in sexagesimal degrees.

[tex]r[/tex] - Radius.

If we know that [tex]\alpha = 93^{\circ}[/tex] and [tex]r = 11[/tex], then the area of the circle arc is:

[tex]A_{ca} = \frac{93\cdot \pi\cdot 11^{2}}{360}[/tex]

[tex]A_{ca} \approx 98.201[/tex]

Step 2:

The area of the triangle is determined by Heron's formula:

[tex]A_{t} = \sqrt{s\cdot (s-l)\cdot (s-r)^{2}}[/tex] (2)

[tex]s = \frac{l + 2\cdot r}{2}[/tex]

Where:

[tex]A_{t}[/tex] - Area of the triangle.

[tex]r[/tex] - Radius.

[tex]l[/tex] - Length of the line segment PL.

If we know that [tex]l = 16[/tex] and [tex]r = 11[/tex], then the area of the triangle is:

[tex]s = \frac{16+2\cdot (11)}{2}[/tex]

[tex]s = 19[/tex]

[tex]A_{t} = \sqrt{19\cdot (19-16)\cdot (19-11)^{2}}[/tex]

[tex]A_{t} \approx 60.399[/tex]

Step 3:

And the area between the line segment PL and the circle arc PL is:

[tex]A_{s} = A_{ca}-A_{t}[/tex]

[tex]A_{s} = 98.201 - 60.399[/tex]

[tex]A_{s} = 37.802[/tex]

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

Can someone do #4 and #5

Answers

Answer:

First, find two points on the graph:

(x₁, y₁) = (0, 2)(x₂, y₂) = (2, 8)

Slope = [tex]\frac{y_{2}-y_{1} }{x_{2}-x_{1}} = \frac{8-2}{2-0} =\frac{6}{2}=3[/tex]

16 + (-3) = 16 - 3 = 13

What is an explicit formula for the geometric sequence -64,16,-4,1,... where the first term should be f(1).

Answers

Answer:

[tex]a_{n} = -64(-\frac{1}{4})^{n-1}[/tex]

it seems like the first term is -64, so lets write the formula accordingly:

a_n = a1(r)^(n-1)

where 'n' is the number of terms

a1 is the first term of the sequence

'r' is the ratio

the ratio is [tex]-\frac{1}{4}[/tex] because -64 * [tex]-\frac{1}{4}[/tex] = 16 and so on...

the explicit formula is :

[tex]a_{n}[/tex] = [tex]-64(-\frac{1}{4} )^{n-1}[/tex]

find the sum of all multiples of 9 between 0 and 200​

Answers

Answer:

I thick the answer is 2277

12/1,000 into decimal​

Answers

0.012 is the answer!

I hope this helps you out! :D

[tex]\\ \sf\longmapsto \dfrac{12}{1000}[/tex]

1000 has 3zeros hence decimal will go 3 points left

[tex]\\ \sf\longmapsto 0.012[/tex]

More:-

[tex]\\ \sf\longmapsto \dfrac{1}{10}=0.1[/tex]

[tex]\\ \sf\longmapsto \dfrac{1}{100}=0.01[/tex]

The segments shown below could form a triangle.
A
C
7
9
12
B
А
a
A. True
B. False

Answers

Answer:

TRUE

Step-by-step explanation:

I SEEN SOME ONE ELSE WIT 5 STARS SAY SO(:

The given segment can form triangle. Therefore, the given statement is true.

What is triangle?

A polygon has three edges as well as three vertices is called a triangle. It's one of the fundamental geometric shapes. In Euclidean geometry, each and every three points that are not collinear produce a distinct triangle and a distinct plane. In other words, every triangle was contained in a plane, and there is only single plane that encompasses that triangle.

All triangles are enclosed in a single plane if all of geometry is the Euclidean plane, however this is no longer true in higher-dimensional Euclidean spaces. Unless when otherwise specified, this article discusses triangles within Euclidean geometry, namely the Euclidean plane. The given segment can form triangle.

Therefore, the given statement is true.

To know more about triangle, here:

https://brainly.com/question/14712269

#SPJ7

According to this diagram, what is tan 62°?
62°
17
18
280
90°
15
O A.
8
17
OB.끝
O c. 1
8
15
D.
15
8
O
E.
17
15
F.
15
17

Answers

Answer:

15/8

Step-by-step explanation:

tan(62)=P/B

tan(62)=15/8

please can anyone help me with this question what is the probability of the spinner landing on an even number.​

Answers

1/2 chance it will land on an even number


Explanation there is 4 even numbers and 4 odd numbers meaning it’s a 50/50 chance

prove that 2^n+1>(n+2).sin(n)​

Answers

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

Jack’s backpack weighs 15 pounds. Fernando’s backpack weighs less than Jack’s. Which graph shows how much Fernando’s backpack can weigh?

Answers

Answer:

A

Step-by-step explanation:

c and d out of the question

b has its circle filled in meaning it could be 15lbs, which it's not

A correct answer by default

Answer:b

Step-by-step explanation: it has a filled in diamond which mean it's that...

Michigan and Michigan State play each other this Saturday in football. Based on data from ESPN, Michigan averages 38.1 points per game with a SD of 8.4 and average 424 yards gained per game with a SD of 72. The correlation between points scored and yards gained is 0.68. Thus:

Average points = 38.1, SD= 8.4
Average yards gained = 424, SD= 72, r = 0.68

Required:
a. Find the slope of the regression equation for predicting number of points scored based on average yards gained per game). Report your answer to 4 decimal places.
b. If Michigan gains 500 yards in the game against Michigan State, what is Michigan's predicted points scored? Round to the nearest whole number.

Answers

Answer:

200000

by 10009

Step-by-step explanation:

nbebsbsbsbbsbsbsbsbBz

Complete the table for the given rule.
Rule: y is 0.750.750, point, 75 greater than x
x y
0
3
9

Answers

Answer:

está inglês não dá para entende

terms are there. Divide 51 into three parts in AP so that the largest exceeds the smallest by 10.​

Answers

The first three terms of the Arithmetic Progression are 12, 17 and 22.

For an ARITHMETIC PROGRESSION, AP ;

First term = a

Second term = a + d

Third term = a + 2d

Where, d = common difference ;

If third term exceeds smallest by 10 ;

Third term - first term

a + 2d - a = 10

2d = 10

d = 10/2

d = 5

Sum of the three terms :

a + (a + d) + a + 2d = 51

3a + 3d = 51

d = 5

3a + 3(5) = 51

3a + 15 = 51

3a = 51 - 15

3a = 36

a = 12

The AP would be:

First term, a = 12

Second term, a + d = 12 + 5 = 17

Third term = a + 2(d) = 12 + 10 = 22

Therefore , the first three terms of the AP are :

12, 17 and 22

Learn more about ARITHMETIC PROGRESSION :

https://brainly.com/question/12006170

Convert 0.450 to a proper fraction

Answers

Answer:

9/20

Step-by-step explanation:

450/1000

this is not the answer, because it is not simplified

so here we have to find common factor and simplifying

________________________________________________

450/1000 is simplified to 9/20, and it can no longer be simplified.

A number is equal to twice a smaller number plus 3. The same number is equal to twice the sum of the smaller number and 1. How many solutions are possible for this situation?
* Infinitely many solutions exist because the two situations describe the same line.
* Exactly one solution exists because the situation describes two lines that have different slopes and different y-intercepts.
* No solutions exist because the situation describes two lines that have the same slope and different y-intercepts.
* Exactly one solution exists because the situation describes two lines with different slopes and the same y-intercept.

Answers

Answer:

There is no solution to this.

Explanation :

We have a double system of equation to solve. Let x be the big number and let y be the smaller number, such that y < x.

x is equal to twice a smaller number plus 3, which translates into : x = 2y + 3

and x is equal to twice the sum of the smaller number and 1 : x = 2 * (y + 1)

We get this system to solve : [tex]\left \{{{x=2y+3} \atop {x=2(y+1)}} \right. \left \{{{x-2y=3} \atop {x-2y=2}} \right.[/tex]

It's either x minus 2y equals 3, or x minus 2y = 2 but it can't be both. No solutions exist because the situation describes two lines that have the same slope and different y-intercepts

What is the volume of the cone

Answers

Answer:

The volume of this cone would be approximately equal to 2787.64 [tex]yd.^2[/tex].

Step-by-step explanation:

The formula used to calculate the volume of a cone is [tex]\pi r^2*\frac{h}{3}[/tex] where [tex]r[/tex] represents the radius of the circle at the base of the cone, and [tex]h[/tex] represents the vertical height of the cone. In this case, [tex]r[/tex] equals the diameter of the base divided by two, which is [tex]\frac{22}{2}[/tex] or 11 yards; and [tex]h[/tex] is equivalent to 22 yards. Insert these values into the formula and you'll get that the volume of this cone is equal to [tex]11^2*\pi*\frac{22}{3} = 121\pi * \frac{22}{3}[/tex] ≈ 2787.64 [tex]yd.^2[/tex], so that is the correct answer.

What is the value of the capacitance of a capacitor that stores 40
μ
C on each plate, when a potential difference of 10 V is applied to it?

Answers

Charge=Q=40uCPotential difference=V=10VCapacitance=C=?

We know

[tex]\boxed{\sf Q=CV}[/tex]

[tex]\\ \large\sf\longmapsto C=\dfrac{Q}{V}[/tex]

[tex]\\ \large\sf\longmapsto C=\dfrac{40}{10}[/tex]

[tex]\\ \large\sf\longmapsto C=4\mu F[/tex]

Where r is the radius of the cylinder and h is the height of the cylinder.
Find the surface area when r is 7 inches and h is 9 inches.




Sa of cylinder= 2(pi)rh + 2(pi)r squared

Answers

Answer:

703.7 in²

Step-by-step explanation:

SA = 2πrh+2πr²

= 2×π×7×9+2×π×7²

= 224π

= 703.7 in² (rounded to the nearest tenth)

Answer:

224π

in²

Step-by-step explanation:

Simplify the following expression

Answers

Answer:

[tex]\frac{98p^{6}}{q}[/tex]

Step-by-step explanation:

Distribute the exponents

[tex](\frac{(7^{-2}p^{-6}q^{-8})}{2q^{-9}} )^{-1}[/tex]

[tex](\frac{q}{98p^{6}} )^{-1}[/tex]

Distribute the -1

[tex]\frac{98p^{6}}{q}[/tex]

Write the ratio as a fraction in simplest form, with whole numbers in the numerator and denominator.
4L TO 7.2 L

Answers

9514 1404 393

Answer:

  5/9

Step-by-step explanation:

  [tex]\dfrac{4\text{ L}}{7.2\text{ L}}=\dfrac{40}{72}=\dfrac{5\cdot8}{9\cdot8}=\boxed{\dfrac{5}{9}}[/tex]

Shawn has 4 times as many candies as Jason, who has a third as many candies as
lan. If Shawn has 64 candies, how many candies does Ian have?

Answers

Ian has 48 candies. hope that helps!
Ian has 4 candies...........

Calculate the range and the standard deviation for the set of numbers.
6,5, 1, 5, 8, 5, 3, 5, 4,7
The range is
(Simplify your answer.)

Can I please get help with this problem?

Answers

Answer:

When time is short and you just want a rough estimate of the standard deviation, turn to the range rule to quickly estimate the standard deviation value. The standard deviation is approximately equal to the range of the data divided by 4. That's it, simple.

Other Questions
Are god real? what is ur point of view guys Why does a person travel or tour? Which expression is equivalent to x2 - 12x + 11?O (x+11)(x + 1)O (x - 11)(x+1)O (x + 11)(x - 1)o (x - 11)(x - 1) what is the solution ? 5a + 18 < 27 pre algibra The organs in the human body perform specific functions for survival.Organ A delivers blood to the bodyOrgan B delivers oxygen to the bodyOrgan C delivers messages to the bodyWhich of the following correctly identifies the organs that perform each function above? Organ A is the heart, Organ B is the brain, and Organ C is the lungs Organ A is the heart, Organ B is the lungs, and Organ C is the brain Organ A is the lungs, Organ B is the brain, and Organ C is the heart Organ A is the lungs, Organ B is the heart, and Organ C is the brain If give 7 billions for 7 millions people. What is total? Change the sentences as instructed in the brackets. a. He did his work with diligence. (Future Perfect)b. Most people want peace. (Simple Past)c. Will you be visiting this place? (Present Continuous) define cerebral action The fan below has been stretched open as far as it will go to form a semi-circle.Each of the eighteen sectors formed by the fan consists of the same amount of fabric. The length ofeach wooden rod that connects the center of the fan to its edge is 12 cm. The wooden rods areglued to the fabric forming the fan. Determine the approximate area of each sector. what is force? pls answer my question Which of the following is a compound-complex sentence? a. Because Cheryl is a farmer, she has very strong opinions about GMOs. b. Cheryl is a farmer, but she hasn't shared her opinions with me. c. Because Cheryl is a farmer, she has very strong opinions about GMOs, but she hasn't shared them with me. d. Cheryl, a farmer, has very strong opinions about GMOs. Below is the graph of a polynomial function with real coefficients(a) The function f is increasing over which intervals? Choose all that apply.D(-0, -8)O (-5,-2) O (-8, -2) O (-2,2) (2,5)O (5, 0 )?(b) The functionfhas local maxima at which x-values? If there is more than one value,separate them with commas.(c) What is the sign of the leading coefficient of f?Select One(d) Which of the following is a possibility for the degree of f? Choose all that apply.456Please help if you can thank you A park is 5 miles east of Roxana's home. A library is 4 miles north of the park. How far is Roxana's home from the library? Step by step plz on how to do this For the remaining questions, show your work.6. Solve each of the following equations.a. - 5 = -3 + ab.c + 2 = -22 define meningesplease give me ans What characteristic is related to Hashimoto's thyroiditis? a. Enlarged thyroid gland b. Viral-induced hyperthyroidism c. Bacterial or fungal infection of thyroid gland d. Chronic autoimmune thyroiditis with antibody destruction of thyroid tissue Evaluate 4(3 - 1)^2.. calculate the human development index of nepal if it mean schooling years is 4.9 and expected schooling years is 12.4 ( obtain necessary figure PCI life expectancy etc from the internat