Answer:
azertyuiopazertyuiiop
Linoleic acid is a polyunsaturated fatty acid found, in ester form, in many fats and oils. Its doubly allylic hydrogens are particularly susceptible to abstraction by radicals, a process that can lead to the oxidative degradation of the fat or oil.
a. True
b. Flase
Answer:
True.
Explanation:
The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.
Identify the options below that are results of adding a catalyst to a chemical system.
The reaction rates are increased.
The reaction quotient is unaffected.
The reaction quotient decreases.
The equilibrium constant is unaffected.
Answer:
The correct options are a, b and d
Explanation:
A catalyst is a substance that increases the rate of a chemical reaction by reducing the activation energy. Le Catelier's principle explains how a substance or an "action" can affect a reaction in equilibrium.
The principle states that when a change is made to the conditions of a reacting system at equilibrium, the position of the equilibrium moves to counteract the change made. These changes are change in temperature, pressure, volume and/or concentration. These changes will either cause the equilibrium to shift forward or backward.
However, the presence of a catalyst DOES NOT affect a chemical equilibrium/equilibrium constant nor does it affect the reaction quotient because the same amount of reactants and products are available just as in uncatalyzed reaction except that the reaction proceeds faster (which does not affect equilibrium).
The rate of reaction is given as the time required by the reactant to convert into the product. The addition of catalyst increases the rate of reaction, while the reaction quotient and the equilibrium remain unaffected.
What is a catalyst?A catalyst is a chemical or compound that adds to the reaction and lowers the activation energy by providing an alternative path to the reaction.
The catalyst takes part in the reaction but did not consume in the chemical reaction.
The equilibrium and the reaction quotient are dependent on the conversion of the reactant to the product. The catalyst is not used in the reaction and thus did not affect the reaction quotient or the equilibrium.
Hence, options A, B, and D are correct for the use of catalysts in the chemical reaction.
Learn more about catalysts, here:
https://brainly.com/question/17052831
A technical machinist is asked to build a cubical steel tank that will hold "265" L of water. Calculate in meters the smallest possible inside length of the tank. Round your answer to the nearest .
Answer:
0.64 m
Explanation:
Given that;
1L = 0.001 cubic metre
Then;
263 L = 263 L × 0.001 cubic metre/1L
= 0.263 cubic metre
Volume of a cube = l^3
l= 3√V
l= 3√0.263 cubic metre
l= 0.64 m
How do I solve this?
Explanation:
a) Since this is a double displacement reaction, we write the balanced equation as
[tex]2AgNO_3(aq) + CaCl_2(aq) \\ \rightarrow 2AgCl(s) + Ca(NO_3)_2(aq)[/tex]
b) Next we find the number of moles of AgNO3 in the solution.
[tex](0.005\:\text{L})(0.500\:M\:AgNO_3) \\ = 0.0025\:\text{mol}\:AgNO_3[/tex]
Next, use the molar ratio to find the necessary amount of CaCl2 to react with the AgNO3:
[tex]0.0025\:\text{mol}\:AgNO_3× \left(\dfrac{1\:\text{mol}\:CaCl_2}{2\:\text{mol}\:AgNO_3} \right)[/tex]
[tex]= 0.00125\:\text{mol}\:CaCl_2[/tex]
The volume of 0.500 M solution of CaCl2 necessary to react all of the given AgNO_3 is then
[tex]V = \dfrac{0.00125\:\text{mol}\:CaCl_2}{0.500\:\text{M}\:CaCl_2}[/tex]
[tex]= 0.0025\:\text{L} = 2.5\:\text{mL}\:CaCl_2[/tex]
c) The theoretical yield can then be calculated as
[tex]0.0025\:\text{mol}\:AgNO_3 × \left(\dfrac{2\:\text{mol}\:AgCl}{2\:\text{mol}\:AgNO_3} \right)[/tex]
[tex]= 0.0025\:\text{mol}\:AgCl[/tex]
Converting this amount of AgCl into grams, we get
[tex]0.0025\:\text{mol}\:AgCl × \left(\dfrac{143.32\:\text{g}\:AgCl}{1\:\text{mol}\:AgCl} \right)[/tex]
[tex]= 0.358\:\text{g}\:AgCl[/tex]
An atom has 20 electrons. Find out
i. It’s atomic numbers and total number of p-electrons
ii. The value of azimuthal quantum number (l) and magnetic quantum number (m) of the 19th electron of the atom.
iii. It’s group position in the periodic table.
Answer:
it's atomic number is 5 and total number is 10
The atom has an atomic number of 20 and has a total of 12 p electrons.
The azimuthal quantum number (l) of the 19th electron is 0 and the magnetic quantum number (m) of the 19th electron is 0.
It is an element of group 2
The number of electrons in the neutral atom is equal to the number of protons and is also the atomic number of an atom.
An atom is known to be electrically neutral. This is because the number of electrons in the atom is equal to the number of protons in the neutral atom.
The number of protons in the neutral atom is called the atomic number of the atom.
For an element that has 20 electrons, its electronic configuration is;
1s2 2s2 2p6 3s2 3p6 4s2.
The 19th electron is in the 4s orbital hence both the azimuthal and magnetic quantum numbers are zero.
The element has outermost electron configuration ns2 so it mus belong to group 2 of the periodic table.
https://brainly.com/question/16979660
The metal tantalum becomes superconducting at temperatures below 4.483 K. Calculate the temperature at which tantalum becomes superconducting in degrees Celsius.
Answer:
The correct answer is "-268.667°C".
Explanation:
Given:
Temperature,
= 4.483 K (below)
Now,
The formula of temperature conversion will be:
⇒ [tex]T(^{\circ} C)=T(K)-273.15[/tex]
By putting the values, we get
⇒ [tex]=4.483-273.15[/tex]
⇒ [tex]=-268.667^{\circ} C[/tex]
Thus the above is the correct answer.
Excluding any secondary chemical reactions,
which would be more effective as an antifreeze; a
solution containing
Select one:
25m CH3OH
the combination of 25m CH3OH and 25m
KCI.
O 25m KCI.
O
none of these
Answer:
Excluding any secondary chemical reactions,
which would be more effective as an antifreeze; a
solution containing
Select one:
25m CH3OH
the combination of 25m CH3OH and 25m
KCI.
25m KCI.
Explanation:
Antifreeze is the one that reduces the freezing point of a solvent further and will not allow the solvent to freeze.
Among the given options, the correct option is:
25 m CH3OH and 25m KCl.
Since, KOH is a strong electrolyte and dissociates into two ions.
So, the freezing point of solvent decreases further.
Que es la actividad física y en qué mejora
write any two things that should be remembered while writing chemical equation
Answer:
the product and the reactant must be balanced
if u are required to give the mechanism if the reaction it must be written
the force of attraction between non polar molecules are what (a)electrovalent bond (b)covalent bond (c)Hydrogen bond (d)Van der waals forces
Answer:
d. van der waals force
Explanation:
Van der Waals force :
the weakest intermolecular forceand consist of dipole-dipole force and dispersion force.
#6 and #7. How many carbon atoms are in a mixture of 7.00 mol c2F2 and 0.400 mol carbon dioxide and also #7
Answer:
#6 8.67x10²⁴ atoms
#7
1. Atom
2. Formula unit
3. Molecule
4. Ion
Explanation:
#6 First we calculate how many carbon moles are there in 7.00 moles of C₂F₂, keeping in mind that there are 2 C moles per C₂F₂ mol:
7.00 mol C₂F₂ * 2 = 14.00 mol CAs for carbon dioxide, there are 0.400 C moles in 0.400 moles of CO₂.
We calculate the total number of C moles:
14.00 mol + 0.400 mol = 14.4 mol CFinally we calculate the number of atoms in 14.4 C moles, using Avogadro's number:
14.4 mol * 6.023x10²³ atoms/mol = 8.67x10²⁴ atoms#7
1. Radon - Atom (Ra)2. Formula unit (It is a crystalline solid, BaBr₂)3. Molecule (NH₃)4. Ion (It has a formal charge, +2)the force of attraction between non polar molecules are what
Answer:
dispersion force
Explanation:
Please please help help please
Assign oxidation state to each atom in each element ion or compound.
a. Ag
b. Ag+
c. CaF2
d. H2S
e.CO3
f. CrO4
g. Cl2
h. Fe
i. CuCl2
j. CH4
Answer:
a. [tex]Ag^0[/tex]
b. [tex]Ag^{+}[/tex]
c. [tex]Ca^{2+}F_2^-[/tex]
d. [tex]H_2^+S^{2-}[/tex]
e. [tex](C^{4+}O_3^{2-})^{-}[/tex]
f. [tex](Cr^{6+}O_4^{2-})^{2-}[/tex]
g. [tex]Cl_2^0[/tex]
h. [tex]Fe^0[/tex]
i. [tex]Cu^{2+}Cl_2^-[/tex]
j. [tex]C^{4-}H_4^+[/tex]
Explanation:
Hello there!
In this case, according to the concept of charge balance, which tell us that the overall charge is zero for any compound, except ions, it turns out possible to proceed as follows:
a. [tex]Ag^0[/tex]
b. [tex]Ag^{+}[/tex]
c. [tex]Ca^{2+}F_2^-[/tex]
d. [tex]H_2^+S^{2-}[/tex]
e. [tex](C^{4+}O_3^{2-})^{-}[/tex]
f. [tex](Cr^{6+}O_4^{2-})^{2-}[/tex]
g. [tex]Cl_2^0[/tex]
h. [tex]Fe^0[/tex]
i. [tex]Cu^{2+}Cl_2^-[/tex]
j. [tex]C^{4-}H_4^+[/tex]
Keep in mind lonely elements have 0 as their oxidation state.
Regards!
C3H8 is ________
A. unsaturated
B. saturated
Name the compound CuI2
Answer:
Copper iodide. I think
Answer:
copper iodide(Cul2)hope it helps
stay safe healthy and happy..what is the machine used to check melting point called?
Answer:
Melting-point apparatus
2- A 0.60 sample an unknown organic acid found in muscle cells is burned in air and found to contain 0.24 grams of carbon, 0.040 grams of hydrogen, with the rest being oxygen. If the molecular weight of the substance is 90 grams/n, what is the molecular formula
Answer:
C₃H₆O₃
Explanation:
To solve this question we need to find, as first, the moles of each atom in order to find empirical formula (Simplest whole-number ratio of atoms present in a molecule).
With the molar mass of the substance and the empirical formula we can find the molecular formula as follows:
Moles C -Molar mass:12.0g/mol-
0.24g * (1mol/12.0g) = 0.020 moles C
Moles H = Mass H because molar mass = 1g/mol:
0.040 moles H
Moles O -Molar mass: 16g/mol-
Mass O: 0.60g - 0.24g - 0.040g = 0.32g O
0.32g O * (1mol/16g) = 0.020 moles O
Ratio of atoms (Dividing in moles of C: Lower number of moles):
C = 0.020 moles C / 0.020 moles C = 1
H = 0.040 moles H / 0.020 moles C = 2
O = 0.020 moles O / 0.020 moles C = 1
Empirical formula:
CH₂O.
Molar mass CH2O:
12g/mol + 2*1g/mol + 16g/mol = 30g/mol
As molecular formula has a molar mass 3 times higher than empirical formula, the molecular formula is 3 times empirical formula:
C₃H₆O₃The molecular formula of the organic acid would be C3H6O3
Molecular formulaMolecular formula = [empirical formula]n
Where n = molar mass/mass of empirical formula
Empirical formula
C = 0.24/12 = 0.02
H = 0.040/1 = 0.04
O = 0.6 - (0.24+0.04) = 0.32/16 = 0.02
Divide by the smallest
C = 1
H = 2
O = 1
Empirical formula = CH2O
Empirical formula mass = 12 + 2 + 16 = 30
n = 90/30 = 3
Molecular formula = [CH2O]3
= C3H6O3
More on molecular formula can be found here: https://brainly.com/question/1247523
To what volume (in mL) would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN?
Answer:
To 318.18 mL would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN
Explanation:
Dilution is the reduction of the concentration of a chemical in a solution and consists simply of adding more solvent.
In a dilution the amount of solute does not vary. But as more solvent is added, the concentration of the solute decreases, as the volume (and weight) of the solution increases.
In a solution it is fulfilled:
Ci* Vi = Cf* Vf
where:
Ci: initial concentration Vi: initial volume Cf: final concentration Vf: final volumeIn this case:
Ci= 1.40 MVi= 20 mLCf= 0.088 MVf= ?Replacing:
1.40 M* 20 mL= 0.088 M* Vf
Solving:
[tex]Vf=\frac{1.40 M* 20 mL}{0.088 M}[/tex]
Vf= 318.18 mL
To 318.18 mL would you need to dilute 20.0 mL of a 1.40 M solution of LiCN to make a 0.0880 M solution of LiCN
Would 1 pound of peanut butter occupy more or less space than 1 pound of water?
Post-Lab Questions
1. A beverage company is having trouble with the production of the dye in their drinks. The color of their drink mix is supposed to be a pale green color, but they often get different results. For each unwanted result, choose the most plausible explanation to help the company improve the formula.
(1pts)
The color of the drink is too pale after adding the dye to the drink because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
The color of the dye is appearing as red, instead of green because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
The drink started out the correct color but it is getting darker over time, even though nothing has been added to the drink, because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
2. Beer's Law states that A=εbc, where A is the absorbance, ε is the molar absorptivity of the solute, b is the path length, and c is the concentration. Identify the experimental evidence from the activity that you have for the dependence of absorbance on each variable.
The evidence for the dependence of absorbance on the variable ε is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
The evidence for the dependence of absorbance on the variable b is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
The evidence for the dependence of absorbance on the variable c is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
3. Describe how you could use the Beer's Law simulation to experimentally determine the best wavelength at which to perform an experiment.
Measure the absorbance for solutions of multiple different solutes and find the minimum absorbance.
Measure the absorbance for solutions with different concentrations and find the slope of the trendline.
Measure the absorbance for the same solution at different wavelengths and find the maximum absorbance.
Measure the absorbance for the same solution in different cuvette sizes and find the y-intercept.
Answer:
1. not enough dye was added to the drink.
The wrong dye was added to the drink
the water in the drink is evaporating
2. Changing the compound changes the absorbance behavior.
3. Measure the absorbance for the same solution in different cuvette sizes and find the y-intercept.
Explanation:
When the beverage company adds dye to the drink, there should be standard quantity added to the drink so that the color of the drink remains constant. When too much dye is added to the drink, the color will get dark brown or black. When the color of drink get lighter than green this means dye is not added in required quantity.
If 0.250 L of a 5.90 M HNO₃ solution is diluted to 2.00 L, what is the molarity of the new solution?
Answer:
0.74 M
Explanation:
From the question given above, the following data were obtained:
Molarity of stock solution (M₁) = 5.90 M
Volume of stock solution (V₁) = 0.250 L
Volume of diluted solution (V₂) = 2 L
Molarity of diluted solution (M₂) =?
The molarity of the diluted solution can be obtained by using the dilution formula as illustrated below:
M₁V₁ = M₂V₂
5.90 × 0.250 = M₂ × 2
1.475 = M₂ × 2
Divide both side by 2
M₂ = 1.475 / 2
M₂ = 0.74 M
Thus, the molarity of the diluted solution is 0.74 M
PLEASE HELP!!
How does temperature, agitation, and particle size affect solubility?
Answer:
At higher temperatures, particles move faster and collide more, increasing solubility rates.
Agitation increases solubility rates as well, by bringing fresh solvent into contact with the undissolved solute
The smaller the particle size, the higher (faster) solubility rate. Vice versa, the bigger the particle size, the lower (slower) solubility rate.
Explanation:
once a recrystallization is completed and filtered, what solvent would be suitable for transferring the leftover solids to filtration funnel
Answer:
To transfer leftover solids to the filtration funnel and wash out crystals after recrystallization, ice cold methanol should be used (the mother liquor used for recrystallization).
Explanation:
Hope this helped
Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol
Answer:
Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol
Explanation:
According to IUPAC rules, the name of a compound is:
Prefix+root word+suffix
1) Select the longest carbon chain and it gives the root word.
2) The substituents give the prefix.
3) The functional group gives the secondary suffix and the type of carbon chain gives the primary suffix.
The structure of the given compounds are shown below:
Given the following list of densities, which materials would float in a molten vat of lead provided that they do not themselves melt? Densities (g/mL): lead = 11.4, glass = 2.6, gold = 19.3, charcoal = 0.57, platinum = 21.4.
a. gold and platinum
b. glass and charcoal
c. gold, platinum, glass and coal
d. gold and charcoal
e. None of these
Answer:
b. glass and charcoal
Explanation:
Step 1: Given data
Density of Pb: 11.4 g/mLDensity of Glass: 2.6 g/mLDensity of Au: 19.3 g/mLDensity of charcoal: 0.57 g/mLDensity of platinum: 21.4 g/mLStep 2: Determine which material will float in molten lead
Density is an intrinsic property of matter. Less dense materials float in more dense materials. The materials whose density is lower than that of lead and will therefore float on it are glass and charcoal.
For the following reaction, 11.6 grams of sulfur are allowed to react with 23.8 grams of carbon monoxide .
sulfur(s) + carbon monoxide(g) sulfur dioxide(g) + carbon(s)
What is the maximum amount of sulfur dioxide that can be formed?
What is the formula for the limiting reagent?
What amount of the excess reagent remains after the reaction is complete?
Answer:
S + 2CO = SO2 + 2C
First, look for the amount of substance of sulfur:
n(S) = m / M
n(S) = 14.8 g/32 g / mol = 0.4625 mol
n(CO) = m (CO) / M (CO)
M(CO) = 12 + 16 = 28 g/mol
n(CO) = 19.9 g/28 g/mol = 0.71 mol
S in excess, so for calculating we take CO:
n(SO2) = n(CO)/2 = 0.71 mol/2 = 0.355 mol
m(SO2) = M(SO2)*n(SO2)
M(SO2) = 32 + 16*2 = 64 g/mol
m(SO2) = 64 g/mol * 0.355 mol = 22.74 g
Rank each of the following gases in order of increasing urms assuming equivalent amounts and all gases are at the same temperature and pressure where 1 has the lowest urms and 4 has the highest urms.
a. Gas 1 : H2S
b. Gas: He
c. Gas 3: NF3
d. Gas 4: H2O
The Urms refers to the root mean square speed of the gas. The order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.
What is the Urms?The Urms refers to the root mean square speed of the gas. This is ultimately dependent on the relative molecular mass of the gases when they are maintained at the same temperature.
Now, let us look at the order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.
Learnmore about Urms: https://brainly.com/question/365923
What is the molecular formula of the structure below?
Picture is attached pls help I’ll mark as brainliest for the right answer
Answer:
C₆H₆
Explanation:
Each border of the figure represents 1 atom of carbon. We have 6 borders = 6 atoms of carbon.
Each atom of carbon form 4 bonds. All the carbons are doing a double bond and a single bond with other carbons. That means are bonded 3 times. The other bond (That is not represented in the figure. See the image) comes from hydrogens. As we have 6 carbons that are bonded each 1 with one hydrogen. There are six hydrogens and the molecular formula is:
C₆H₆This structure is: Benzene
Identify the possible quantitative analysis you can do using only the 28.02 g/mol as a unit factor. Select one or more:
Answer:
Calculate the moles of N2 molecules in 3.94 grams of nitrogen.
Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules.
Explanation:
Calculate the moles of N2 molecules in 4.73 liters of nitrogen gas. FALSE. You can't make this conversion using only the conversion factor with units of g/mol. To convert liters to moles are necessaries pressure, temperature and volume of the gas to use PV = nRT
Calculate the grams of N2 in 10.58 liters of nitrogen gas. FALSE. As explained, you need, P,V and T to find the moles of the gas. With the moles you can find the mass using the conversion factor of 28.02g/mol
Calculate the moles of N2 molecules in 3.94 grams of nitrogen. TRUE. You can find the moles of N2 as follows:
3.94g N2 * (1mol/28.02g) = 0.14 moles of N2 molecules
Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules. TRUE. The mass in 5.03x10²⁰ moles of nitrogen molecules is:
5.03x10²⁰ moles * (28.02g/mol) = 1.4x10²²g of nitrogen.
