A buffer is prepared such that [H2PO4-] = 0.095M and [HPO42-] = 0.125M? What is the pH of this buffer solution? (pKa = 7.21 for H2PO4-)

Answers

Answer 1

Answer:

pH of the buffer is 7.33

Explanation:

The mixture of the ions H₂PO₄⁻ and HPO₄²⁻ produce a buffer (The mixture of a weak acid, H₂PO₄⁻, with its conjugate base, HPO₄²⁻).

To find pH of a buffer we use H-H equation:

pH = pka + log [A⁻] / [HA]

Where A⁻ is conjugate base and HA weak acid.

For the H₂PO₄⁻ and HPO₄²⁻ buffer:

pH = pka + log [HPO₄²⁻] / [H₂PO₄⁻]

Computing values of the problem:

pH =7.21 + log [0.125M] / [0.095M]

pH = 7.33

pH of the buffer is 7.33


Related Questions

Acetonitrile (CH3CN) is an important industrial chemical. Among other things, it is used to make plastic moldings, which have multiple uses, from car parts to Lego bricks. Which one of the following statements about acetonitrile is not correct?a. Acetonitrile has 16 valence electrons in its Lewis structure. b. Acetonitrile has one triple bond. c. Acetonitrile has one pair of nonbonding electrons. d. All atoms satisfy the octet rule in acetonitrile. e. One carbon atom and the nitrogen atom have nonzero formal charges.

Answers

Answer:

One carbon atom and the nitrogen atom have nonzero formal charges.

Explanation:

The compound Acetonitrile has sixteen valence electrons as is easily San from its structure. It contains a carbon nitrogen triple bond with a lone pair of electrons on nitrogen. All atoms satisfy the octet rule and there is no hyper valent atom in the molecule.

The formal charge an carbon and nitrogen is calculated as follows;

No. of valence electron on atom - [non bonded electrons + no. of bonds]

Therefore, for carbon and nitrogen, we have;

formal charge on carbon = 4 - (0 + 4) = 0

formal charge on nitrogen = 5 - (2 + 3) = 0

Hence carbon and nitrogen both possess zero formal charges.

Enter the complementary strand of this DNA strand. Give your answer as a string.

Answers

Answer:

atagcca

Explanation:

t goes with a, and c goes with g

atagcca matches with

ta tcggt

Name the following compound from the concise formula:______.
CH3CH(CH3)CHCHCH(CH3)CH2CH3
A. 2,4-dimethyl-3-heptene
B. 2,5-dimethyl-3-heptene
C. 3,5-dimethyl-3-heptene
D. 2,5-dimethyl-4-heptene

Answers

Answer:

B. 2,5-dimethyl-3-heptene

Explanation:

Answer:

B. 2,5-dimethyl-3-heptene

Explanation:

Using the standard reduction potentials Ni2+(aq) + 2 e‑Ni(s) ‑0.25 volt Fe3+(aq) + e‑Fe2+(aq) +0.77 volt Calculate the value of E°cell for the cell with the following reaction. Ni2+(aq) + 2 Fe2+(aq) →Ni(s) + 2 Fe3+(aq)

Answers

Answer:

The correct answer is - 1.02 V

Explanation:

From the reduction-oxidation reaction:

Ni²⁺(aq) + 2 Fe²⁺(aq) → Ni(s) + 2 Fe³⁺(aq)

Ni²⁺ is reduced to Ni(s) while Fe²⁺ is oxidized to Fe³⁺. Thus, the half reactions are:

Reduction (cathode) : Ni²⁺(aq) + 2 e‑ → Ni(s)                    Eº= ‑0.25 V

Oxidation (anode) :  2 x (Fe²⁺ → Fe³⁺ + e-)(aq)                Eº= -0.77 V

                                -------------------------------------

                     Ni²⁺(aq) + 2 Fe²⁺(aq) → Ni(s) + 2 Fe³⁺(aq)

In order to calculate the Eºcell, we have to add the reduction potential of the reaction in cathode (reduction) to the oxidation potential of the anode (oxidation):

Eºcell= Eºr + Eºo= (-0.25 V) + (-0.77 V) = - 1.02 V

Which of the following is a salt that could be generated by combining a weak acid and a weak base? Select the correct answer below:
a) NaCl
b) Na2SO4
c) NH4NO3
d) NH4F

Answers

Answer:

d) NH4F

Explanation:

Hello,

In this case, the base resulting from mixing a weak acid and a weak base is d) NH4F since ammonium hydroxide is a wear base and hydrofluoric acid is a weak acid.

Ammonium hydroxide is a weak base since it is not completely ionized in ammonium and hydroxyl ions:

[tex]NH_4OH\rightarrow NH_4^++OH^-[/tex]

Moreover, hydrofluoric acid is a weak acid since it is not completely ionized in hydrogen and fluoride ions:

[tex]HF\rightleftharpoons H^++F^-[/tex]

For the both of the substances, the limit is established by the basic and the acid dissociation constant respectively.

Regards.

Based on relative bond strengths, classify these reactions as endothermic (energy absorbed) or exothermic (energy released).
Strongest Bond
A-B
A-A
B-B
C-C
B-C
A-C
1. A2 + C2 rightarrow 2AC
2. B2 + C2 rightarrow 2BC
3. A + BC rightarrow AB + C
4. A2 + B2 rightaarrow 2AB
5. AB + C rightarrow AC + B
a. endothermic
b. exothermic

Answers

Answer:

1. Exothermic 2.  Exothermic 3. Endothermic 4. Endothermic 5. Exothermic.

Explanation:

1. An A-A and a C-C bond results in 2 A-C bonds which are lower than the A-A and C-C bonds so this reaction is exothermic.

2. A B-B bond and a C-C bond results in 2 B-C bonds which are lower than the first 2 bonds so this reaction is also exothermic.

3. There is no bond for single A, a single B-C bond results in a A-B bond and a C molecule. A-B bond is stronger than the B-C bond so the reaction absorbed energy along the way. This shows that it is endothermic.

4. An A-A bond and a B-B bond results in 2 A-B bonds which are stronger than the first two bonds so this reaction is also endothermic.

5. An A-B bond and a C molecule result in an A-C bond and a B molecule. A-C bond is weaker than the A-B bond so there is energy released. This reaction is exothermic.

I hope this answer helps.

In which list are the three compounds above correctly listed in order of increasing boiling point? A) lowest b.p.... isopropanol < isobutane < acetone ...highest b.p. B) lowest b.p.... isobutane < acetone < isopropanol ...highest b.p. C) lowest b.p.... isobutane < isopropanol < acetone ...highest b.p. D) lowest b.p.... acetone < isobutane < isopropanol ...highest b.p. E) lowest b.p.... acetone < isopropanol < isobutane ...highest b.p.

Answers

Answer:

The correct answer is - option B -  lowest b.p.... isobutane < acetone < isopropanol ...highest b.p.

Explanation:

Isobutane has lowest boiling point due to no hydrogen bonding and no diole to dipole interaction found in them. Isobutane only shows weak dispersion force.

Acetone has dipole dipole interaction but due to lack of Hydrogen bonding they have low boiling point than isopropanol but higher than isobutanol.

Isopropanol is the compound that has ability to form hydrogen bonding with other molecule its boiling point is maximum among all three.

Thus, the correct answer is - option B -  lowest b.p.... isobutane < acetone < isopropanol ...highest b.p.

The last group of elements on the periodic table are called _____. noble gases halogens metals noble solids

Answers

Answer:

The answer is noble gases

Explanation:

Here is your explanation The vertical columns are called groups. There are eighteen groups. The last group on the far right is called the noble, or inert gases. Elements in a group have similar chemical properties. For example, elements in the noble gas group are all gases under. This is the thing from the passege bye god bless you

The last group of elements on the periodic table are called "noble gases."

The noble gases are a group of elements located in Group 18 of the periodic table. They are also known as Group 0 or the "inert gases." The noble gases include helium (He), neon (Ne), argon (Ar), krypton (Kr), xenon (Xe), and radon (Rn).

The noble gases are unique because they have a full complement of valence electrons in their outermost energy level. This full electron configuration gives them exceptional stability, making them chemically unreactive or inert under normal conditions. In other words, noble gases are less likely to form chemical bonds with other elements.

Learn more about noble gases from the link given below.

https://brainly.com/question/19024000

#SPJ2

What are the products in the following chemical reaction Pb(NO3)+KCI

Answers

Answer:

The products are KNO3 + PbCl2.....

Espero que te sirva.

A voltaic cell is set up as follows: Anode: Zn electrode in a solution of 0.050 M Zn(NO 3 ) 2 Cathode: Pt electrode with 0.500 atm H 2 (g) in 0.010 M HNO 3 a) Write the overall balanced cell reaction.

Answers

Answer:

[tex]Zn(s) + 2H+(aq)\Rightarrow Zn^{2+}(aq) + H_{2}(g)[/tex]

Explanation:

Given that,

Anode : Zn electrode in a solution of 0.050 M Zn(NO₃)₂

Cathode : Pt electrode with 0.500 atm H₂(g) in 0.010 M HNO₃

Anode :

[tex]Zn(s)\Rightarrow Zn^{2+}(aq) + 2e^{-}[/tex]

Cathode :

[tex]2H+(aq)+2e^{-}\Rightarrow H_{2}(g)[/tex]

We need to write the overall balanced cell reaction

Using anode and cathode

[tex]Zn(s) + 2H+(aq)\Rightarrow Zn^{2+}(aq) + H_{2}(g)[/tex]

Hence, This is required answer.

A student puts a glass of water in the freezer. Later, he notices ice forming on the surface of the water. Which property of water best explains why ice forms on its surface? A. It is made of polar molecules. B. It has low surface tension. C. It has weak adhesion. D. It is densest as a solid.

Answers

ℯ ℴ ℴ ℴℯℯ

it has a weak adhesion

Predict the reactants of this chemical reaction. That is, fill in the left side of the chemical equation. Be sure the equation you submit is balanced.

_______ → Ba(ClO)2 + H2O(l)

Answers

Answer:

2HClO(aq) + Ba(OH)₂(aq) →  Ba(ClO)₂(aq) + 2H₂O(l)

Explanation:

The reaction corresponds to a neutralization reaction between an acid and a base, as follows:

2HClO(aq) + Ba(OH)₂(aq)  →  Ba(ClO)₂(aq) + 2H₂O(l)            

From the equation above we have that the acid HClO reacts with the base Ba(OH)₂ to obtain a salt Ba(ClO)₂ and water.

In the balanced reaction, we have that 2 moles of HClO react with 1 mol of Ba(OH)₂ to produce 1 mol of Ba(ClO)₂ and 2 moles of water.

I hope it helps you!    

How do covalent bonds form? A Sharing valence electrons between atoms. B Donating and receiving valence electrons between atoms. C Opposite slight charges attract each other between compounds. D Scientists are still not sure how they form.

Answers

Answer:

A. Sharing valence electrons between atoms.

Explanation:

This is the definition of a covalent bond. Option B describes ionic bonds, Option C describes intermolecular forces, and Option D is wrong because then there wouldn't be any mention of them in our high school chemistry textbooks :).  

A sample of argon gas (molar mass 40 g) is at four times the absolute temperature of a sample of hydrogen gas (molar mass 2 g). Find the ratio of the rms speed of the argon molecules to that of the hydrogen. Assume hydrogen molecule has only translational degree of freedom.

Answers

Answer:

Ratio of Vrms of argon to Vrms of hydrogen = 0.316 : 1

Explanation:

The root-mean-square speed measures the average speed of particles in a gas, and is given by the following formula:  

Vrms = [tex]\sqrt{3RT/M}[/tex]

where R is molar gas constant = 8.3145 J/K.mol, T is temperature in kelvin, M is molar mass of gas in Kg/mol

For argon, M = 40/1000 Kg/mol = 0.04 Kg/mol, T = 4T , R = R

Vrms = √(3 * R *4T)/0.04 = √300RT

For hydrogen; M = 1/1000 Kg/mol = 0.001 Kg/mol, T = T, R = R

Vrms = √(3 * R *T)/0.001 = √3000RT

Ratio of Vrms of argon to that of hydrogen = √300RT / √3000RT = 0.316

Ratio of Vrms of argon to that of hydrogen = 0.316 : 1

The insoluble salts below are put into 0.10 M hydrochloric acid solution. Do you expect their solubility to be more, less, or about the same as in a pure water solution?
1. Zinc sulfide
2. Silver chloride
3. Lead iodide
4. Silver hydroxide

Answers

Answer:

1. Zinc sulfide : about the same solubility, no common ion is found.

2. Silver chloride : less solubility due to the presence of chloride ions provided by the 0.10 M hydrochloric acid.

3. Lead iodide  : about the same solubility, no common ion is found.

4. Silver hydroxide : about the same solubility, no common ion is found.

Explanation:

Hello,

In this case, we first must remember that adding a common ion (which is related with the dissolving solid) decreases the solubility of the insoluble solid due to the fact Le Chatelier's principle states the reaction will shift leftwards (reactants) to reestablish equilibrium, therefore, we have:

1. Zinc sulfide : about the same solubility, no common ion is found.

2. Silver chloride : less solubility due to the presence of chloride ions provided by the 0.10 M hydrochloric acid.

3. Lead iodide  : about the same solubility, no common ion is found.

4. Silver hydroxide : about the same solubility, no common ion is found.

Best regards.

write the balanced nuclear equation for the radioactive decay of radium-226 to give radon-222, and determine the type of decay

Answers

Answer:

226Ra88→222Rn86+4He2

Explanation:

An α-particle usually consists of a helium nucleus which indicates the type of decay that was undergone in this radioactive process.

During α-decay(alpha decay), an atomic nucleus emits an alpha particle.

A runner can cover 2.0 miles in 31 minutes, how long would it take for this runner to cover 6.0 Km. Hint (1 mile= 1.609 Km)

Answers

The answer to this question is approximately equal to 57.8

Predict the most likely bond type for the following.

a. Cu (Copper)
b. KCl (Potassium Chloride)
c. Si (Silicon)
d. CdTe (Cadmium Telluride)
e. ZnTe (Zinc Telluride)

Answers

Answer:

The three major types of bond are ionic, polar covalent, and covalent bonds. Ionic occurs majorly between metals and non-metals, which allows sharing of electrons to form an ionic compound. Whereas covalent bonding calls for complete transfer of electrons between atoms. Polar covalent bonds have unequaly shared electron-pair between two atoms.

Explanation:

a. Cu (Copper)- ionic bonding

b. KCl (Potassium Chloride) - ionic bonding

c. Si (Silicon) - covalent bonding

d. CdTe (Cadmium Telluride) - polar covalent bonding

e. ZnTe (Zinc Telluride)- polar covalent bonding

Candle wax melts low temperature, it is not conductive to electricity, it is insoluble in water and partially soluble in solvents nonpolar, like gasoline. Than type of links are present in the candle wax?

A. Electrostatics.
B. Apolar.
C. lónicos.
D. Hydrogen bridges.

Answers

electrostatic and ionic are definitely not the answer because they have high melting point

hydrogen bonds are too weak and not permanent.

so the answer is apolar as it is soluble in polar solvents (water)

Answer:

B. Nonpolar

Explanation:

The low melting point tells you the compound is not ionic, metallic, or a network solid.

It is almost certainly a molecular solid.

It does not conduct electricity, so it is not metallic (which we have already ruled out).

It is insoluble in polar solvents (water) and soluble in nonpolar solvents (gasoline).

Since like dissolves like, the molecule is nonpolar.

The type of links must be nonpolar.

Identify the term that matches each electrochemistry definition. The electrode where oxidation occurs Cathode The electrode where reduction occurs Choose... An electrochemical cell powered by a spontaneous redox reaction Choose... An electrochemical cell that takes in energy to carry out a nonspontaneous redox reaction Choose... A chemical equation showing either oxidation or reduction Choose...

Answers

Answer:

An electrochemical cell that takes in energy to carry out a nonspontaneous redox reaction

If an individual proton has mass 1.007825 amu, and an individual neutron has mass 1.008665 amu, what's the calculated mass of a neptunium-236 nucleus? options: A) 237.92482 amu B) 236.99873 amu C) 237.96682 amu D) 237.04817 amu

Answers

Answer:

C) 237.96682 amu

Explanation:

The symbol for neptunium-236 is given as;

²³⁶₉₃Np

This element has 93 protons and (236 - 93 = 143) neutrons.

Mass Number =Total mass of Protons + Total mass of neutrons

Total Mass pf protons = 93 * 1.007825 amu, = 93.727725 amu

Total mass of Neutrons = 143 * 1.008665 amu = 144.239095 amu

Mass = 144.239095 + 93.727725  = 237.96682 amu

Correct option is option C.

Determine the molarity for each of the following solutions A. 1.8×10^4mg of HCL in 0.075L of solutions

Answers

The answer would have to be a

What element is being reduced in the following redox reaction? MnO4-(aq) + H2C2O4(aq) → Mn2+(aq) + CO2(g) What element is being reduced in the following redox reaction? MnO4-(aq) + H2C2O4(aq) → Mn2+(aq) + CO2(g) H O Mn C

Answers

Answer: Mn is getting reduced.

Explanation:

Oxidation-reduction reaction or redox reaction is defined as the reaction in which oxidation and reduction reactions occur simultaneously.

Oxidation reaction is defined as the reaction in which a substance looses its electrons. The oxidation state of the substance increases.

Reduction reaction is defined as the reaction in which a substance gains electrons. The oxidation state of the substance gets reduced.

[tex]MnO_4^-(aq)+H_2C_2O_4(aq)\rightarrow Mn^{2+}(aq)+CO_2(g)[/tex]

Oxidation : As Manganese has an oxidation state of +7 in [tex]MnO_4^-[/tex] and +2 in [tex]Mn^{2+}[/tex], the oxidation state is decreasing and hence it is getting reduced.

Reduction : As carbon has an oxidation state of +3 in [tex]H_2C_2O_4[/tex] and +4 in [tex]CO_2[/tex], the oxidation state is increasing and hence it is getting oxidized.

The element which is reduced in the redox reaction is Mn.

The redox reaction is shown below:

MnO₄⁻(aq) + H₂C₂O₄(aq) → Mn²⁺(aq) + CO₂(g)

A redox reaction is the type of reaction which involves oxidation processes

occurring with a corresponding reduction process.

Oxidation reaction involves the reaction in which a substance loses its

electrons to become positively charged with an increase in the oxidation

state.

Reduction reaction is defined as the reaction in which a substance gains

electrons to become positively charged with a decrease in the oxidation

state.

MnO₄⁻ has an oxidation state of +7 and Mn²⁺ having an oxidation state of +2

signifies a decrease in the oxidation state.

Read more on https://brainly.com/question/10354645

A student is performing a Benedict’s test on an unknown substance. He adds the reagent (the chemical required to make a color change), and nothing happens. What can he conclude? A- The substance is glucose-based. B- The substance is not glucose-based. C- The test was inconclusive because he needed to also test with iodine or vinegar. D- The test was inconclusive because he forgot to add heat.

Answers

Answer:

The correct answer is : option D. The test was inconclusive because he forgot to add heat.

Explanation:

Benedict's test is a test that is used to confirm the presence of the simple carbohydrates (mono saccharides and some disaccharides). It is a reagent made by mixture of solution of CuSO4 with sodium citrate and Na2CO3.

Benedict's reagent is added to the substance to test and then heated if it turns yellow to orange or red the presence of simple sugar is confirmed.

Thus, the correct answer is : option D. The test was inconclusive because he forgot to add heat.

Answer:

The test was inconclusive because the student forgot to add heat.

Explanation:

If the test revealed it was not glucose, then the student could run these tests. The student, however, does not need these substances to run the glucose test properly.

What is buffers and mention its importance?

Answers

Answer:

Buffer is the chemical substance that addition of acids and bases, maintaining constant environment,its called Buffer.

Explanation:

Buffers are use in the system to maintain the value of pH, and the contain the pH value is not to change.Buffer maintain the body of pH for the optimal activity,and they are solution of pH constant.Buffer in used in the lab and that to maintain growth of the micro tissues and the culture media.Buffer are used in maintain necessary optimal reaction activity,determine the indicator of solution with pH.Buffer capacity is that concentration to the buffering agent, is the very small increase,buffer capacity to the pH is 32% , of the maximum value of pH.Buffers in a acid regions to the desired of that value to the particular buffer agent.Buffers can be made from that a mixture of the base and acid, buffer can be a wide range of the obtained.Buffers that the pH  calculation and they required to performed in the critic acid that the overlap over the buffer range.

Consider the bond dissociation energies listed below in kcal/mol. CH3-Br 70 CH3CH2-Br 68 (CH3)2CH-Br 68 (CH3)3C-Br 65 These data show that the carbon-bromine bond is weakest when bromine is bound to a __________.

Answers

Answer:

The answer is "Tertiary carbon".

Explanation:

Accent to the results, the carbon-bromine bond is weak, whenever, the bromine is connected to tertiary carbon so, bonding energy is separation for methyl-carbon, which is connected to the bromine = 70 kcal/mol and for the primary energy to the secondary energy is=  68 kcal/mol, and for tertiary CO2 = 65 kcal/mol.

The stronger the energy dissociating connection and the weaker, its power dissociation connection and its weaker bond becomes connecting with a tertiary carbon, that's why "Tertiary carbon" is the correct answer.

A 2.87g sample of carbon reacts with hydrogen to form 3.41g of car fuel. What is the empirical formula of the car fuel?

Answers

Answer:

The empirical formulae for the car fuel is C4H9

How are animals used in vaccine development?

Answers

Answer:

Animals whose certain organs closely match those of humans or have similar genetic makeup are used in vaccine tests because the results can closely resemble those same results on humans.

Explanation:

Answer:

they use them to test the effectiveness of the vaccine.

Explanation:

Draw the structure of beeswax.beeswax is made from the esterfication of a saturated 16-carbon fatty acid and a 30 carbon straight chain primary alcohol.

Answers

Answer:

Triacontyl palmitate

Explanation:

In this case, we have a reaction between an acid and an alcohol. When we put together these kind of compounds an ester is produced. This reaction is called "esterification".

In our case, the alcohol is a structure with 30 carbon in which the "OH" group is bonded on carbon 1. The name of this compound is "n-triacontanol". The acid is a structure in which we have 16 carbon in which the "COOH" group is placed on carbon 1. The name of this compound is "palmitic acid". The ester produced by the acid and the alcohol is "Triacontyl palmitate".

See figure 1.

I hope it helps!

For the following set of volume/temperature data, calculate the missing quantity after the change is made. Assume that the pressure and the amount of gas remain constant.

V=2.91 L at 23.0 °C
V= 4.20 L at ? °C

Answers

Answer:

155 °C

Explanation:

Step 1: Given data

Initial volume (V₁): 2.91 LInitial temperature (T₁): 23.0°CFinal volume (V₂): 4.20 LFinal temperature (T₂): ?

Step 2: Convert the initial temperature to Kelvin

We will use the following expression.

K = °C + 273.15 = 23.0°C + 273.15 = 296.2 K

Step 3: Calculate the final temperature

Assuming an ideal gas behavior, we can calculate the final temperature using Charles' law.

V₁/T₁ = V₂/T₂

T₂ = V₂ × T₁/V₁

T₂ = 4.20 L × 296.2 K/2.91 L

T₂ = 428 K

Step 4: Convert the final temperature to Celsius

We will use the following expression.

°C = K - 273.15 = 428 - 273.15 = 155 °C

Other Questions
Analyze the following scenarios to determine who can appropriately access health information.1. Mrs. John Smith is requesting the emergency room records from last week of her daughter, Katy. Mrs. Smith is the noncustodial parent of Katy, who lives with her dad. Should you release the records to her? Why or why not?2. Mr. Fred Mitchell is requesting the birth record for Amy, his birth daughter. Mr. and Mrs. Mitchell gave Amy up for adoption four years ago. Should you release the records to him? Why or why not?3. Mrs. Lynn Olsen is requesting the lab results of her husband, Tim. She has a note. signed by him, giving his permission for her to have the records. Should you release the records to her? Why or Why not?4. An investigator from the Health and Human Services department is conducting an audit of patient records and has provided a list of records that they want to review. Should you release the information to the investigator? Why or why not?5. Dr. Rex Harrisson is requesting the medical records of Martha Flynn. He states he is a family friend and has been asked by Mrs. Flynn's son to review her last inpatient admission for appropriateness of care. Should you release the records to Dr. Harrison? Why or why not? The scale for a drawing is 1 centimeter to 5 meters. If the actual object is 35 meters, the drawing is _____ centimeters long. A. 30 B. 17C. 7D. 40 If 2y = 6 - 3x, find y when x = 0 Where r is the radius of the cylinder and h is the height of the cylinder. Find the surface area when r is 3 inches and h is 5 inches. A. 50 in B. 112 in C. 48 in D. 80 in The Vedas of the Aryan people became the basis for the A. Buddhist religion. B. Indian calendar. C. Hindu religion. D. early Indian dances. what is an example of mechanical energy converting to heat energy? 15 points!! Please help me out! What were the events leading up to the dissolution of the soviet union that caused the dissolution? Please write your answer in paragraph form. Thank you for helping :) Amira has 3/4 of a bag of cat food her cat eats 1/10 of a bag per week how many weeks will the food last There are three commercial tax-preparation offices in City A. The local Better Business Bureau has been receiving some complaints that one of the offices does not understand tax law well enough to provide expert advice. The Better Business Bureau has decided to invest several hundred dollars in grant money to test the claim. It has selected four people at random and has asked that they allow each of the offices to prepare their taxes using the same information. The following data show the tax bills ($1,000s) as figured by each office. The following data show the tax bills as figured by each office. The data are also located in the CD-ROM file Tax-test.Return Office 1 Office 2 Office 31 4376.20 5100.10 4988.032 5678.45 6234.23 5489.233 2341.78 2242.60 2121.904 9875.33 10300.30 9845.605 7650.20 8002.90 7590.886 1324.80 1450.90 1356.89Required:Use the ANOVA procedure on your calculator for completely randomized designs to determine whether there is a significant difference in the mean taxes due on tax returns? The immune response of a host against an invading bacterium is often triggered by surface components on the bacterium that are recognized as "non-self" or "foreign" by the host. These non-self components, often protein or polysaccharide in nature, are referred to as antigens. The host responds to these antigens by making antibodies that will react with invading bacteria and mark them or tag them for destruction by phagocytes. Indicate the bacterial structures that are likely to be antigens, to which host antibodies bind, marking the invader for phagocytosisa. fimbriaeb. ribosomesc. cell walld. plasmidse. flagellaf. capsuleg. nucleoid Listed below are the commissions earned ($000) last year by a sample of 15 sales representatives at Furniture Patch Inc.$4.0 $6.0 $7.4 $10.6 $12.5 $13.6 $15.4 $15.8 $16.8 $17.4 $19.1 $22.3 $37.1 $43.2 $81.4a. Determine the mean, median, and the standard deviation. (Round your answers to 2 decimal places.)Mean $ Median $ Standard deviation $ b. Determine the coefficient of skewness using Pearson Which is the second step of the fusion process?OH+1H - ?H+e+ + v + energyO 6(3H) +21_e) - He +24H) + energy + 2u{H+1H He + energyOHe He He + 1H+1H + energy Which of the following are characteristics of the Coriolis effect? Choose one or more: It has a maximum effect at the equator. It is caused by the Earth's rotation. It deflects surface water to the right in the northern hemisphere. It deflects surface water to the left in the northern hemisphere. It influences the surface ocean currents. ANSWER ASAP PLEASEEEEEE!!!!!! ILL GIVE 100 POINTS!! Which of the following is true about food contact surfaces?O a. They only include dishes and utensils, not stationary surfaces like countersO b. They only include stationary surfaces and equipment, not dishes and utensilsO c. They need to be cleaned and sanitized between uses with different types of foodO d. If they can't be taken to the three-compartment sink, they don't need to be sanitized evaluate 1 whole number 2/5 + 3/4 and give your answer to one significant figure 4. Solve the system of equations. (6 points) Part I: Explain the steps you would take to solve the system by eliminating the x-terms. (1 point) Part II: Explain the steps you would take to solve the system by eliminating the y-terms. (2 points) Part III: Choose either of the methods described in parts I or II to solve the system of equations. Write your answer as an ordered pair. Show your work. (3 points) Answer it answer it answer it. If x = -1 then how much is 2x - 1a) 1b) -3c) -2hurry please need to turn in 10 min what is .7 of a mile