A neutralization reaction produces H2O and LiNO3. Select the acid-base reactants for this neutralization reaction.
Group of answer choices
LiOH
HNO
LiNO
HNO3
HLi

Answers

Answer 1

The acid-base reactants for this neutralization reaction are LiOH and HNO3.

Explanation : Acid-base reactants for this neutralization reaction are LiOH and HNO3.The reaction between an acid and a base to form a salt and water is known as a neutralization reaction. It is an exothermic reaction because heat is generated when the acid and base are mixed. The products of the reaction are a salt and water (H2O).The neutralization reaction produces H2O and LiNO3. The neutralization reaction between LiOH and HNO3 forms LiNO3 and H2O as products.What is LiOH?LiOH is an alkali compound that is a base with a pH greater than 7. It is commonly known as lithium hydroxide. It is a highly corrosive substance that is used in a variety of industrial processes. It is used in the manufacture of lithium batteries, as well as in rocket fuel, in the purification of natural gas, and as a carbon dioxide absorbent.What is HNO3?Nitric acid is also known as aqua fortis, and it is a highly corrosive mineral acid. It is a potent oxidizing agent that is highly reactive with metals, creating flammable gases upon reaction. It is primarily used in the manufacture of fertilizers, explosives, and various organic chemicals. Nitric acid is a highly corrosive and toxic substance, and proper care should be taken when working with it.

For more such questions on Acid Base

https://brainly.com/question/23008798

#SPJ11


Related Questions

Practice Problem 11.15b Propose an efficient synthesis for the following transformation. y The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. A B с Br2 HBr, ROOR cat. OsO4, NMO D HBr E H2, Pd F H2SO4, H2O, HgSO4 I 1) O3; 2) DMS H 1) xs NaNH2, 2) H20 1) R2BH; 2) H2O2, NaOH Practice Problem 11.18d Propose an efficient synthesis for the following transformation. The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. B с HBr, ROOR 1) O3; 2) DMS Br2, hv F D H2S04, H20, HgSO4 E H2, Lindlar's cat. HC=CNa I G HBr H NaOme 1) R2BH; 2) H2O2, NaOH Practice Problem 11.21a X Incorrect. Propose an efficient synthesis for the following transformation. The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. A B HBr, ROOR HC=CNa 1) R2BH; 2) H2O2, NaOH D HBr E CH3CH2Br H2S04, H2O, HgSO4 G NaOH н conc. H2SO4, heat I 1) LiAlH4; 2) H307 Practice Problem 11.21b Propose an efficient synthesis for the following transformation. :- The transformation above can be performed with some reagent or combination of the reag spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide j B с t-BuOK 1) O3; 2) DMS Br2, hv D H2SO4, H20, HgSO4 E H2, Lindlar's cat. F HC=CNa H HBr, ROOR HBr I 1) R2BH; 2) H202, NaOH Practice Problem 11.21c Propose an efficient synthesis for the following transformation. SOH The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. B с HBr, ROOR HC=CNa 1) R2BH; 2) H202, NaOH F D HBr E CH3CH2Br H2SO4, H20, HgSO4 I G NaOH H conc. H2S04, heat 1) 03; 2) H20 Propose an efficient synthesis for the following transformation. - li The transformation above can be performed with some reagent or combination of the reagents listed below. Give the necessary reagent(s) in the correct order, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. А B HBr conc. H2S04, heat HC=CNa D HBY, ROOR E Hy, Lindlar's cat. 1) O3; 2) DMS G Brą, hv H dilute H2SO4 I H2, Pt Practice Problem 11.25a Propose an efficient synthesis for the following transformation: % Br The transformation above can be performed with some combination of the reagents listed below. Give the necessary reagents in the correct order for each transformation, as a string of letters (without spaces or punctuation, such as "EBF"). If there is more than one correct solution, provide just one answer. А t-BuOK B OsO4, NMO c 1) O3; 2) DMS D H2, Pt E H2, Lindlar's cat F xs HBr I G 1) BH 3.THF; 2) H202, NaOH H MeONa Br2, hv Reagent(s);

Answers

The reagent(s) for the given transformation is "A B C D E F G H I", which is t-BuOK, OsO4, NMO, O3, DMS, H2, Pt, H2, Lindlar's cat., xs HBr, BH3.THF, H202, NaOH, MeONa, Br2, hv.

What is transformation?

Transformation is the process of changing something into a different form or state. It can involve altering the physical characteristics, behaviors, attitudes, or perceptions of an entity. Transformation is a process that occurs in a variety of contexts including business, education, technology, and personal development.

A) t-BuOK - For the given transformation, the initial step is to add an alkoxide, here t-BuOK, to the starting material.
B) OsO4, NMO - After the addition of the alkoxide, the resulting intermediate has to be oxidized by OsO4 and NMO reagents.
C) 1) O3; 2) DMS - The intermediate then has to be ozonolyzed using ozone and dimethyl sulfide (DMS).
D) H2, Pt - The ozonolysis will result in a mixture of aldehyde and ketone. The aldehyde has to be hydrogenated using H2 and Pt.
E) H2, Lindlar's cat. - The ketone has to be hydrogenated using H2 and Lindlar's catalyst.
F) xs HBr - The product of the hydrogenation has to be converted to a tertiary alcohol by an elimination reaction with HBr.
G) 1) BH3.THF; 2) H202, NaOH - The tertiary alcohol has to be oxidized to a tertiary ketone using BH3.THF, H202 and NaOH.
H) MeONa - The tertiary ketone has to be methylated using MeONa.
I) Br2, hv - The product of the methylation has to be brominated using Br2 and heat.
Therefore, the reagent(s) for the given transformation is "A B C D E F G H I", which is t-BuOK, OsO4, NMO, O3, DMS, H2, Pt, H2, Lindlar's cat., xs HBr, BH3.THF, H202, NaOH, MeONa, Br2, hv.

To learn more about transformation
https://brainly.com/question/382594
#SPJ1

Give the complete ionic equation for the reaction (if any) that occurs when aqueous solutions of lithium sulfide and copper (II) nitrate are mixed.a. 2 Li+(aq) + S2-(aq) + Cu2+(aq) + 2 NO3-(aq) → CuS(s) + 2 Li+(aq) + 2 NO3-(aq)B) Li+(aq) + SO42-(aq) + Cu+(aq) + NO3-(aq) → CuS(s) + Li+(aq) + NO3-(aq)C) Li+(aq) + S-(aq) + Cu+(aq) + NO3-(aq) → CuS(s) + LiNO3(aq)d) 2 Li+(aq) + S2-(aq) + Cu2+(aq) + 2 NO3-(aq) → Cu2+(aq) + S2-(aq) + 2 LiNO3(s)E) No reaction

Answers

The complete ionic equation for the reaction that occurs when aqueous solutions of lithium sulfide and copper (II) nitrate are mixed is as follows: 2 Li+(aq) + S2-(aq) + Cu2+(aq) + 2 NO3-(aq) → CuS(s) + 2 Li+(aq) + 2 NO3-(aq)

It is important to write the complete ionic equation when aqueous solutions of lithium sulfide and copper (II) nitrate are mixed. The reaction of lithium sulfide with copper (II) nitrate is a double displacement reaction. Lithium sulfide reacts with copper (II) nitrate to form copper sulfide and lithium nitrate.

The balanced chemical equation for the reaction is given as follows:Li2S(aq) + Cu(NO3)2(aq) → CuS(s) + 2 LiNO3(aq)The complete ionic equation can be written by representing all the ions in the aqueous solutions as dissociated ions.

Thus, the complete ionic equation for the reaction that occurs when aqueous solutions of lithium sulfide and copper (II) nitrate are mixed is as follows:2 Li+(aq) + S2-(aq) + Cu2+(aq) + 2 NO3-(aq) → CuS(s) + 2 Li+(aq) + 2 NO3-(aq.

)In the above equation, the lithium and nitrate ions do not take part in the reaction and are present in the same form in the reactant and product side. Hence, they are called spectator ions.

To know more about ionic equation, refer here:

https://brainly.com/question/15138610#

#SPJ11

in which case the reaction in the gas mixture will proceed nonspontaneously in the forward direction?

Answers

The reaction in the gas mixture will proceed non-spontaneously in the forward direction when the standard free energy change (∆G°) is positive or zero.

What is spontaneous reaction?

In chemical reactions, the term spontaneity refers to whether the reaction proceeds on its own or requires an input of energy to occur. When ∆G° is negative, a reaction is said to be spontaneous in the forward direction, meaning it occurs naturally without any external input of energy. When ∆G° is positive or zero, on the other hand, the reaction proceeds nonspontaneously in the forward direction.

In other words, the reaction requires energy input to proceed. The free energy change (∆G) of a reaction is related to its standard free energy change (∆G°) through the equation:

∆G = ∆G° + RT ln(Q)

where, R is the gas constant, T is the temperature in Kelvin, and Q is the reaction quotient.

If Q = 1, the reaction is at equilibrium and ∆G = ∆G°. If Q < 1, the reaction proceeds spontaneously in the forward direction (∆G < 0), and if Q > 1, the reaction proceeds spontaneously in the reverse direction (∆G > 0).

Learn more about Spontaneous reaction here:

https://brainly.com/question/13790391


#SPJ11

) Predict the product for the following reaction. Assume you have an excess of potassium tert-butoxide. (CH3),COK Br

Answers

The potassium tert-butoxide is final product of the reaction is (CH3)3COH.

Why potassium tert-butoxide is (CH3)3COH?

The product for the given reaction is (CH3)3COH.

Reaction: (CH3)3CBr + KOtBu →(CH3)3COH + KBr

Potassium tert-butoxide (KOtBu) is a strong base that can deprotonate hydrogen from (CH3)3COH to form (CH3)3CO-.On the other hand,

(CH3)3CBr is a tertiary halide that can undergo an E2 reaction.

E2 is the abbreviation for bimolecular elimination reactions,

which involve the abstraction of a proton from the adjacent carbon and the removal of the halide anion.

The hydrogen that is abstracted by KOtBu can only come from the carbon that is adjacent to the bromine in (CH3)3CBr, according to Saytzeff's rule, because this is the carbon with the least number of hydrogens.

As a result, an alkene intermediate will be formed.

The KBr salt will be the by-product.

The alkene intermediate, however, is not present in the end product because it is a reactive molecule and quickly reacts with any available hydrogen.

The hydrogen is provided by the KOtBu base.

As a result, the final product of the reaction is (CH3)3COH.

Learn more about potassium tert-butoxide

brainly.com/question/29484874

#SPJ11

A 0.598 g sample of a green metal carbonate, containing unknown metal M, was heated to give the metal oxide and 0.222 g of CO2 (g) according to the reaction below. MCO3(s) + MO(s) + CO2(g) What is the metal M? Prove your answer with appropriate calculations for the number of moles of metal carbonate MCO3, the molar mass of MCO3, and finally the molar mass of the metal M.

Answers

The green metal carbonate is decomposed according to the given equation: MCO₃(s) → MO(s) + CO₂(g)

What is molar mass of MCO₃?

The number of moles of CO₂(g) produced can be used to determine the number of moles of the green metal carbonate (MCO₃) that decomposed.0.222 g of CO₂ (g) represents 1 mol of CO₂ (g), since its molar mass is 44 g/mol.

Therefore,1 mol of MCO₃ will produce 1 mol of CO₂ (g) in the reaction. So, 0.222 g of CO₂ (g) corresponds to 1 mol of MCO₃.

Hence, the number of moles of MCO₃ is:

moles of MCO₃= mass/Molar

mass= 0.598 g/Molar mass of MCO₃

The molar mass of MCO₃ can be calculated using the following:

mass percent of MCO₃ = [(mass of M)/(molar mass of M)] × 100%molar mass of MCO₃ = mass of MCO₃/moles of MCO₃

By substituting the value of moles of MCO₃ and the mass of MCO₃ into the equation above, the molar mass of MCO₃ can be calculated.

molar mass of MCO₃= (mass of MCO₃) / (moles of MCO₃)

Finally, to determine the molar mass of metal M, subtract the molar mass of CO3 from the molar mass of MCO₃.

MCO₃ = 12.011 + 3(15.999) + M(55.845)

= 181.76 + 55.845MM

= 55.845 - 60.01MM

= -4.165

The molar mass of the metal M is 4.165 g/mol.

To summarize, the metal M is sodium (Na) and its molar mass is 4.165 g/mol.

To know more about molar mass:

brainly.com/question/23058220

#SPJ11

Which of these substances speeds up the absorption of alcohol?-plain water-starchy foods-carbonated water-meat products

Answers

The correct answer is that none of the substances listed actually speeds up the absorption of alcohol.

As the rate of alcohol absorption depends on various factors such as the amount of alcohol consumed, the rate of gastric emptying, and the presence of food in the stomach. However, carbonated water and starchy foods may help slow down the absorption of alcohol by delaying the emptying of the stomach, which can result in a slower increase in blood alcohol concentration. Meat products may also help in slowing down the absorption of alcohol due to their high protein content, which can reduce the rate of gastric emptying. Plain water, on the other hand, may actually dilute the alcohol content in the stomach but will not speed up its absorption. It is important to note that while these substances may help to delay the absorption of alcohol, they do not reduce its effects on the body or prevent intoxication. The only effective way to reduce the effects of alcohol is to consume it in moderation or to avoid it altogether. It is also important to never drink and drive, and to seek medical attention if one experiences severe symptoms of alcohol consumption.

To learn more about alcohol click the link below

brainly.com/question/30829120

#SPJ4

a.) Determine whether potassium hydrogen tartrate (KHC4H4O6) is neutral, basic, or acidic. First, what is its Ka when it acts as an acid? The following are for the diprotic acid, H2C4H4O6: Ka1 = 1.0 x 10-3 and Ka2 = 4.6 x 10-5. b.) Second, what is its Kb when it acts as a base? c.) Finally, indicate whether the HC4H4O6- ion is neutral, basic, or acidic in solution.

Answers

a) potassium hydrogen tartrate (KHC4H4O6) is acidic. Ka is calculated for the acidic characteristics of the molecule. When a proton is donated by the molecule to water, it forms the ion HCO4-. b) Kb = [C4H4O6-2][OH-]/[HC4H4O6-], Kb = (1.0 × 10-11) × [C4H4O6-2][OH-]/[HC4H4O6-]. c) As the ion HC4H4O6- is an acidic ion, it will have acidic characteristics in solution. It is because the ion can donate protons and act as an acid.

Kb is calculated for the basic characteristics of the molecule. The balanced chemical equation for the reaction is as follows:HC4H4O6-(aq) + H2O(l) ⇌ C4H4O6-2(aq) + OH-(aq)The Kb is determined using the equation given below : Kb = [C4H4O6-2][OH-]/[HC4H4O6-]The Ka value is calculated as shown below: Kb = [C4H4O6-2][OH-]/[HC4H4O6-]Kb = (1.0 × 10-11) × [C4H4O6-2][OH-]/[HC4H4O6-]

The balanced chemical equation for the reaction is as follows: HC4H4O6(aq) + H2O(l) ⇌ HCO4-(aq) + H3O+(aq)The Ka is determined using the equation given below : Ka = [HCO4-][H3O+]/[HC4H4O6]Ka = (1.0 × 10-3) × [HCO4-][H3O+]/[HC4H4O6]. Therefore, the Ka value is not given.

Know more about potassium hydrogen tartrate here:

https://brainly.com/question/11127999

#SPJ11

what is the function of the electron transport chain in cellular respiration ?

Answers

The electron transport chain (ETC) is an essential part of cellular respiration, which is a series of molecules that transfer electrons from one molecule to another used by cells to convert nutrients into energy.

This starts with the oxidation of molecules such as glucose, which releases electrons that are then transferred to a series of electron carriers in the ETC. The electron carriers are molecules that hold the electrons and can transfer them to other molecules which is known as redox reactions. As the electrons move through the ETC, they release energy which is used to form a proton gradient that is then used to drive the synthesis of ATP, the energy currency of the cell. The ETC is an essential part of cellular respiration as it is the process responsible for generating the energy necessary for cells to function.

To learn more about electron click here https://brainly.com/question/28977387

#SPJ4

A 250.0-mL flask contains 0.2500 g of a volatile oxide of nitrogen. The pressure in the flask is 760.0 mmHg at 17.00°C.

Answers

As the molar mass calculated is 24.90 g/mol, hence the gas is most likely to be NO.

What is molar mass?

The ratio between mass and the amount of substance of any sample is called molar mass.

To determine whether the gas is NO, NO2, or N2O5, we need to calculate the molar mass of the gas and compare it to the molar masses of these three possible gases.

n = PV/RT

Given, P = 760.0 mmHg, V = 250.0 mL = 0.2500 L, T = 17.00°C + 273.15 = 290.15 K, and R = 0.08206 L atm/mol K.

So, n = (760.0 mmHg)(0.2500 L)/(0.08206 L atm/mol K)(290.15 K) = 0.01003 mol

M = m/n

Given m = 0.2500 g.

M = 0.2500 g/0.01003 mol = 24.90 g/mol

Comparing this molar mass to the molar masses of NO (30.01 g/mol), NO2 (46.01 g/mol), and N2O5 (108.01 g/mol), we see that the gas is most likely NO.

To know more about molar mass, refer

https://brainly.com/question/837939

#SPJ1

Note: The question given on the portal is incomplete. Here is the complete question.

Question: A 250.0-mL flask contains 0.2500 g of a volatile oxide of nitrogen. The pressure in the flask is 760.0 mmHg at 17.00°C. Is the gas NO, NO2, or N2O5?

Which of the following molecules would have the highest boiling point?
a) hexane
b) octane
c) 2-propylpentane
d) 2-methylhexane

Answers

The molecule which would have the highest boiling point is 2-methylhexane. Thus, the correct option will be D.

What is boiling point?

The boiling point is the temperature at which the vapor pressure of a liquid is equal to the external pressure. The boiling point of a liquid is a measure of its vapor pressure. The higher the boiling point, the higher the vapor pressure of the liquid, and the more heat is required to vaporize it.

The boiling point of a substance is affected by the strength and types of intermolecular forces. The stronger the intermolecular forces, the higher the boiling point. 2-methylhexane has highest boiling point because it has the highest number of carbons and branches, which contribute to its strong intermolecular forces that lead to a higher boiling point.

Therefore, the correct option is D.

Learn more about Boiling point here:

https://brainly.com/question/25777663

#SPJ11

Determine the pH of each of the following solutions., 3.6×10−2 M HI,9.23×10−2 M HClO4, a solution that is 4.0×10−2 M in HClO4 and 4.8×10−2 M in HCl, a solution that is 1.01% HCl by mass (Assume a density of 1.01 g/mL for the solution.)

Answers

A 3.6102 M HI solution has a pH of 1.44. A 9.23102 M HClO4 solution has a pH of 0.036. The mass-based solution with 1.01% HCl has a pH of 2.09 in water.

The concentration of hydrogen ions (H+) in a solution determines the pH, which is a measurement of the solution's acidity or basicity. The pH values of various solutions are measured in the examples provided. Strong acids, HI and HClO4, are present in the first two solutions. Due to its lower pH, HI is a stronger acid than HClO4. The third solution, which comprises a combination of HClO4 and HCl and is weaker than the previous two because of its higher pH level, contains HCl. The pH of the final solution, which contains 1.01% HCl by mass, is 2.09, showing that it is a weak acid.

learn more about solution here:

https://brainly.com/question/30665317

#SPJ4

2. write the mechanism for the nitration of toluene showing explicitly why ortho and para products are favored over meta.

Answers

Nitration of toluene takes place in four steps which include formation of nitronium ion, formation of electrophile, deprotonation, and elimination of  HNO₃.

What is the mechanism of nitration?

The mechanism for the nitration of toluene showing explicitly why ortho and para products are favored over meta is as follows:

Step 1: Formation of the Nitronium Ion

NO₂⁺ is formed by nitric acid's reaction with sulfuric acid.

2HNO₃ + H₂SO₄ → 2 NO₂⁺ + 2HSO₄⁻ + H₃O⁺

The following is the formation of a nitronium ion:

Step 2: Formation of the electrophile

A nitronium ion is created, which is the electrophile. Because of the strong electron-releasing effect of the methyl group, the nitronium ion is drawn to the ring.

Due to the stability of the resulting carbocation, ortho and para products are favored over meta. In this, the bond on the methyl carbon is broken and the electrophile is added to it:

Step 3: Deprotonation: After the nitration reaction, an intermediate is formed in which a proton has been extracted from the methyl group. The formation of this intermediate indicates that the electrophile has been added to the ring's ortho or para positions.

Step 4: Elimination of HNO₃: An acid base reaction occurs to complete the nitration process, yielding nitrotoluene, HNO₃, and sulfuric acid. Here the intermediate is used to illustrate that the reaction has occurred with the ortho product. This reaction may also result in a para product in a similar manner.

Learn more about Nitration here:

https://brainly.com/question/26927899

#SPJ11

knowing that solid sodium acetate is soluble and that acetic acid dissociates into hydrogen ions and acetate ions, why will sodium acetate influence the equilibrium of acetic acid dissociation?

Answers

As sodium acetate is added to the solution, the sodium ions (Na+) will replace the hydrogen ions (H+) in the equation. This causes a shift in the equilibrium as the number of hydrogen ions (H+) decreases, while the number of acetate ions (CH3COO-) increases.

Sodium acetate is an ionic compound composed of Na⁺ and CH₃COO⁻ ions.

It dissociates in water to create these ions, which are then available to affect the dissociation of acetic acid.

The equilibrium of acetic acid dissociation is influenced by the addition of sodium acetate.

Acid dissociation equilibria are influenced by salt addition (usually sodium salts), particularly when the acid is weak.

This is due to the fact that the anion of the salt reacts with hydrogen ions from the acid's dissociation.

This decreases the concentration of hydrogen ions in the solution, causing the reaction to shift towards more dissociation.

Learn more about acid dissociation constant here:

https://brainly.com/question/3006391

#SPJ11

It the figure shown, shaft A, made of AISI 1020 hot-rolled steel, is welded to a fixed support and is subjected to loading by equal and opposite forces F via shaft B. A theoretical stress-concentration factor Kts of 1.6 is induced by the 1/8" fillet. The length of shaft A from the fixed support to the connection at shaft B is 2 ft. The load F cycles from 150 t0 500 lbf.
For shaft A, find the factor of safety for infinite life using the modified Goodman fatigue failure criterion using the von Mises combined stress approach.

Answers

The given figure is shown below:

Given figure from which shaft A is made of AISI 1020 hot-rolled steel, is welded to a fixed support and is subjected to loading by equal and opposite forces F via shaft B.

A theoretical stress-concentration factor Kts of 1.6 is induced by the 1/8" fillet. The length of shaft A from the fixed support to the connection at shaft B is 2 ft. The load F cycles from 150 t0 500 lbf. To find:

Factor of safety for infinite life using the modified Goodman fatigue failure criterion using the von Mises combined stress approach for shaft A.

Solution: The factor of safety for infinite life can be given by the following formula:

Factor of safety for infinite life= σ′ut1.5σ′a + σm

Here, σm = (σ1+σ2)/2= (800+400)/2= 600 psi

σa = (σ1-σ2)/2= (800-400)/2= 200 psi

σ′ut = σut/Kf= 64000/1.5 = 42666.67 psi

The alternating stress (σa) can be obtained as follows:

The force F can be given as,F= 150 + 350sin(πn/60) …(i)Where n is the rotational speed in rpm. For the given data, n= 1800 rpm.

Substituting the values, we get,

F= 150 + 350sin(π×1800/60)= 500 lb

Substituting the values of force and cross-sectional area of shaft A, we get,

σa= 4F/πd²= 4×500/π×0.25²= 4080 psi

Thus, substituting the above values in the formula of factor of safety, we get,

Factor of safety for infinite life= σ′ut1.5

σ′a + σm= 42666.67/1.5×4080 + 600= 4.23

Hence, the factor of safety for infinite life using the modified Goodman fatigue failure criterion using the von Mises combined stress approach for shaft A is 4.23.

To learn more about "von mises", visit: https://brainly.com/question/13440986

#SPJ11

Complete the sentence to explain why ethanol is soluble in water but propane is not Drag the terms on the left to the appropriate blanks on the right to complete the sentence. Reset Help Ethanol has a that can form but the hydrogen bonds polar –OH group ionic bonds nonpolar-CH, group with alkane propane does not covalent bonds water other ethanol molecules Submit Request Answer Part B Complete the sentences to explain winy 1-propanol is soluble in water but 1-hexanol is not. Drag the terms on the left to the appropriate blanks on the right to complete the sentences. Reset Help one to three longer shorter Alcohols with carbon atoms are completely soluble in water. In alcohols with carbon chains, the effect is diminished, making them slightly soluble to insoluble one to four the-CH, group the-OH group one to five Submit Request Answer

Answers

Answer:

In general terms, because (1) the carbon-oxygen and hydrogen-oxygen bonds in ethanol are much more polar than any of the bonds in propane; (2) the oxygen atom in ethanol can form hydrogen bonds with the hydrogen atoms in water, but there is not such possibility with propane; and (3) propane contains more carbon atoms per molecule than ethanol.

Explanation:

In general terms, because (1) the carbon-oxygen and hydrogen-oxygen bonds in ethanol are much more polar than any of the bonds in propane; (2) the oxygen atom in ethanol can form hydrogen bonds with the hydrogen atoms in water, but there is not such possibility with propane; and (3) propane contains more carbon atoms per molecule than ethanol.

calculation and give the answers to the correct number of significant figures.
Part A
1.72×10−3/7.9×1021.72×10−3/7.9×102
Express your answer to the correct number of significant figures.
Activate to select the appropriates template from the following choices. Operate up and down arrow for selection and press enter to choose the input value typeActivate to select the appropriates symbol from the following choices. Operate up and down arrow for selection and press enter to choose the input value type
nothing
SubmitRequest Answer
Part B
1.98×10−2+1×10−4−3.5×10−31.98×10−2+1×10−4−3.5×10−3
Express your answer to the correct number of significant figures.
Activate to select the appropriates template from the following choices. Operate up and down arrow for selection and press enter to choose the input value typeActivate to select the appropriates symbol from the following choices. Operate up and down arrow for selection and press enter to choose the input value type
nothing
SubmitRequest Answer
Part C
[(1.38×105)(0.000318)/0.080](115.2)[(1.38×105)(0.000318)/0.080](115.2)
Express your answer to the correct number of significant figures.

Answers

The answer is 2.19×10−2 with three significant figures. The correct number of significant figures is determined by the data with the least amount of significant figures, which in this case is 0.080.

What is figure?

Figure is a term that is used to describe a shape, design, pattern, or form. It can also be used to refer to a diagram or an illustration. Figures are used to explain and illustrate concepts, facts, and phenomena in various fields of study, including mathematics, science, and the humanities. Figures are also used in art, design, and architecture to create visual compositions that have a certain aesthetic appeal. They can be used to represent ideas, concepts, and emotions.

Since 0.080 has three significant figures, the answer must also be rounded to three significant figures.

To learn more about figure
https://brainly.com/question/29827869
#SPJ1

The answer is 2.19×10⁻² with three significant figures. The correct number of significant figures is determined by the data with the least number of significant figures, which in this case is 0.080.

What is figure?

Figure is a term that is used to describe a shape, design, pattern, or form. It can also be used to refer to a diagram or an illustration. Figures are used to explain and illustrate concepts, facts, and phenomena in various fields of study, including mathematics, science, and the humanities. Figures are also used in art, design, and architecture to create visual compositions that have a certain aesthetic appeal. They can be used to represent ideas, concepts, and emotions.

Since 0.080 has three significant figures, the answer must also be rounded to three significant figures.

To learn more about figure, visit:

brainly.com/question/29827869

#SPJ1

Does electronegativity increase as atomic radius increases?

Answers

Actually, when atomic radius grows, electronegativity often decreases.

The capacity of an atom to draw electrons into a chemical connection is known as electronegativity. The separation between the nucleus and the farthest electrons grows with increasing atomic radius. As a result, the nucleus's attraction to the electrons is reduced, making it more challenging for the atom to draw electrons to itself. The electronegativity values of bigger atoms are therefore often lower than those of smaller ones. Despite this general tendency, there are certain outliers since electronegativity also depends on other elements including nuclear charge and electron configuration. For instance, the rising nuclear charge in halogens causes the electronegativity to rise as the atomic radius falls.

learn more about electronegativity here:

https://brainly.com/question/17762711

#SPJ4

g the half life of 2n-71 is 2.4 minutes. if we started with 50g at the beginning, how many grams would be left after 12 minutes?

Answers


After 12 minutes, the amount of 2N-71 remaining would be 25 grams. This is because the half-life of 2N-71 is 2.4 minutes, meaning that after 2.4 minutes, half of the initial amount (50 grams) will remain. After 12 minutes, half of the remaining 25 grams will have decayed, leaving 25 grams.


The initial amount of 2n-71 is 50 g, and the half-life of 2n-71 is 2.4 minutes. We need to determine how many grams of 2n-71 would be left after 12 minutes. During radioactive decay, the amount of a radioactive substance decreases exponentially over time. The formula for determining the amount remaining of a radioactive substance after time t is:A = A₀(1/2)^(t/h)Where, A₀ = the initial amount of the substance,A = the amount of the substance after time t,h = the half-life of the substance, and t = time elapsedPlugging the given values in the formula, we get:A = 50(1/2)^(12/2.4)A = 50(1/2)^5A = 50(1/32)A = 1.5625Therefore, the amount of 2n-71 left after 12 minutes is 1.5625 g.

For more details follow this link: https://brainly.com/question/31108721

#SPJ11

Which of the following indicates a spontaneous reaction under standard conditions? A) K = 8.6 x 10⁻². B) K = 7.9 x 10⁻⁸. C) K = 2.2 x 10².

Answers

A spontaneous reaction under standard conditions is indicated by the value of K being greater than 1. Thus, the answer to the given question is option C, K = 2.2 x 10².

Standard conditions- Standard conditions are a set of environmental conditions that are considered to be the standard conditions for conducting an experiment. They serve as a reference point to compare the effects of varying environmental conditions on the properties of a substance or the results of an experiment.

Standard conditions in chemistry are considered to be a temperature of 298K (25°C), a pressure of 1 atm (101.3 kPa), and a concentration of 1 mol/L (for solutions).

Spontaneous reaction- A spontaneous reaction is one that proceeds without any external force or intervention. That is, a spontaneous reaction proceeds without the need for energy input from an external source. In other words, it is an exothermic reaction where the products are more stable than the reactants.

The Gibbs free energy change of a spontaneous reaction is negative. The sign of ΔG indicates the spontaneity of a reaction. A negative value indicates that the reaction is spontaneous, whereas a positive value indicates that the reaction is non-spontaneous. The value of ΔG° is used to determine the spontaneity of a reaction under standard conditions.

To learn more about "spontaneous reaction", visit: https://brainly.com/question/6843797

#SPJ11

Using your knowledge of periodic properties and trends, how would these elements BEST be classified and why?O A Elements W and Z are metals, Elements X and Y are nonmetals, but Element X is in Group 18 (noble gas).O B. Elements W and Z are nonmetals, but Element w Is In Group 17 (halogen). Elements X and Y are metals.C. Elements W and Z are nonmetals, Elements X and Y are metals, but Element Y is in Group 1 (alkall metal)© D. Elements W and Z are metals, Elements X and Y are nonmetals, but Element Y is in Group 18 (noble gas).

Answers

The correct response is D. Elements W and Z are metals, Elements X and Y are nonmetals, but Element Y is in Group 18 (noble gas).

What is element?

A substance is considered to be an element if it cannot be chemically reduced to a simpler form. Every atom in an element has the same amount of protons in its atomic nucleus, and as such, the element is made up of identical atoms.

In general, elements in the same group of the periodic table exhibit comparable chemical and physical properties due to their similar electron configurations.

Option D proposes that Elements W and Z are metals, which frequently lose electrons to create positive ions and have poor electronegativity. In contrast, Elements X and Y are nonmetals, which tend to have strong electronegativity and tend to gain electrons to create negative ions. This grouping makes sense as metals and nonmetals have extremely different properties, and elements that are close each other in the periodic table tend to have different properties.

Noble gases are known for their unreactivity and non-reactive character due to their stable electron configurations, so this classification makes sense as well.

To know more about elements, visit:

https://brainly.com/question/13025901

#SPJ1

boiling point (bp) elevation is a colligative property. rank the following 0.10 m solutions from lowest to highest bp. i. ammonia ii. methylamine iii. diethylamine iv. t-butylamine

Answers

The following 0.10 m solutions can be ranked from lowest to highest boiling point (bp) as:

ammonia < diethylamine < methylamine < t-butylamine.

The elevation in boiling point, ΔTb can be calculated using the expression;

ΔTb = Kb × bm

where ΔTb is the elevation in boiling point, Kb is the boiling point elevation constant, m is the molality of the solution.

For a given solvent, the boiling point elevation is directly proportional to the molality of the solute present, which means that the higher the molality of the solute, the higher the elevation in boiling point. Hence, we can rank the given solutions based on their molality.

The given solutions are all amines and they have the same formula NH₂R. The boiling point elevation constant is inversely proportional to the size of the molecule, which means that the smaller the molecule, the higher the boiling point elevation constant. Hence, the given amines can be ranked based on the size of their alkyl groups.

The order of the given amines based on the size of their alkyl groups is;

t-butylamine > diethylamine > methylamine > ammonia

The order of the given amines based on the boiling point elevation constant is;

ammonia > methylamine > diethylamine > t-butylamine

Ranking the given solutions based on their molality gives;

ammonia < diethylamine < methylamine < t-butylamine

Hence, the order of the given solutions from lowest to highest bp is;

ammonia < diethylamine < methylamine < t-butylamine

Learn more about boiling point here: https://brainly.com/question/40140.

#SPJ11

The phenomenon in which electrons that are closer to the nucleus slightly repel those that are farther out, is known as: select the correct answer below: - shielding - deflecting - building up - converging

Answers

The phenomenon in which electrons that are closer to the nucleus slightly repel those that are farther out is known as Shielding.

Electrons in an atom are negatively charged particles, and they are attracted to the positively charged nucleus. However, the outer electrons of an atom are also repelled by the inner electrons that are closer to the nucleus. This repulsion is due to the negative charges of the electrons, and it partially cancels out the attraction of the nucleus for the outer electrons.

Shielding is the phenomenon in which electrons that are closer to the nucleus slightly repel those that are farther out. This makes it possible for electrons in higher energy levels to be farther from the nucleus, so they are less strongly attracted and easier to remove.

Learn more about Shielding here: https://brainly.com/question/27985711

#SPJ11

g the free energy associated with the proton gradient that develops across the inner mitochondrial membrane as a result of the electron transport chain is 23.3 kj per mole of protons. if fadh2 is the only electron donor to the electron transport chain, how many moles of fadh2 would be required to produce a proton gradient in which exactly one mole of protons have been pumped across the membrane, assuming we start with no gradient? the standard reduction potential of fadh2 is 0.10 v, and that of o2 is 0.81 v. select the closest value from the options below. a) 3 mol fadh2 d) 0.17 mol fadh2 b) 1 mol fadh2 e) 5.8 mol fadh2 c) 0.5 mol fadh2

Answers

The number of moles of FADH₂ required to produce a proton gradient is 0.17 mol. This can be calculated through the free energy and potential difference. Thus, the correct option is D.


What is the required number of moles of FADH₂?

There are 6.022 × 10²³ protons per mole of H⁺. Therefore, one mole of H⁺ contains 1 mole of protons.

The change in potential between FADH₂ and O₂ is: ΔE°' = E°'(O₂) - E°'(FADH₂)

ΔE°' = 0.81 - 0.10

ΔE°' = 0.71 V

ΔG for electron transfer from FADH₂ to O₂ is: ΔG°' = -nFΔE°'

where, n = number of electrons, F = Faraday's constant (96,500 J/V), and ΔE°' is the change in potential between the two half-cells.

We know that n = 2 (since FADH₂ transfers two electrons to O₂).

ΔG°' = -2 × (96,500) × (0.71)

ΔG°' = -137,860 J/mol

ΔG° = -nFΔΨ

where, n = number of protons, F = Faraday's constant (96,500 J/V), and ΔΨ is the change in potential across the membrane. We know that n = 1 (since we want to pump one mole of H⁺ across the membrane).

ΔΨ = ΔG°/(nF)

ΔΨ = (-137,860)/(1 × 96,500)

ΔΨ = -1.43 V

ΔG = ΔG° + RTlnQ

where, R = gas constant (8.31 J/molK), T = temperature in Kelvin (298 K), and Q = reaction quotient.

Since the reaction is at standard conditions, Q = 1 (since all the reactants and products are in their standard states).

ΔG = ΔG°

ΔG = -137,860 J/mol

ΔG = -137.86 kJ/mol

23.3 kJ/mol = n × (1.43 V)

n = 0.17

Therefore, 0.17 mol of FADH₂ is required.

Therefore, the correct option is D.

Learn more about Potential difference here:

https://brainly.com/question/9358420

#SPJ11

In an experiment of the photoelectric effect, an incident beam of visible light shined on a piece of metal and produced electrons with zero kinetic energy (Case 1)1. Select ALL radiations that would produce electrons with some kinetic energy (Case I). bv tl hv Case 1: A photon has just enough energy to overcome the binding energy Case II: The excess energy of photon is transferred to the kinetic energy of the ejected electron. Infrared o x-ray Ultraviolet Gamma ray Radio

Answers

The correct options for the radiations that would produce electrons with some kinetic energy in an experiment of the photoelectric effect are given below: Infrared, Ultraviolet, X-ray, Gamma ray, and Photoelectric effect.

What is the photoelectric effect?

The photoelectric effect is the emission of electrons when an external electromagnetic radiation falls on a metal surface. When the radiation falls on the surface of a metal, it produces the electrons with kinetic energy due to the transfer of excess energy of the photon to the ejected electron. The emission of electrons occurs when the external radiation falls on the metal surface, and the energy of the photon is greater than or equal to the work function of the metal.

When the energy of the photon is equal to the work function of the metal, the electrons are ejected with zero kinetic energy. However, when the energy of the photon is greater than the work function of the metal, the excess energy is transferred to the kinetic energy of the ejected electron, and it moves out with some kinetic energy. Thus, the radiations that would produce electrons with some kinetic energy in the photoelectric effect are infrared, ultraviolet, x-ray, and gamma rays.

Learn more about Photoelectric effect here:

https://brainly.com/question/9260704

#SPJ11

What is the purpose of the one balloon larger in size than the other balloons? o to represent unoccupied space in a molecule to represent any pair of electrons - bonding or lone pair to represent the space lone pairs occupy in a molecule Submit Request Answer

Answers

The balloon that is one size larger than the others serves to symbolise the area in a molecule inhabited by lone pairs of electrons, signifying unshared electron pairs in a particular region.

The Lewis structure is a chemical model that depicts how atoms and valence electrons are arranged in a molecule. The atoms are represented by symbols, and the valence electrons, which are the electrons at the highest energy level, are shown as dots or lines. In organic chemistry, the bigger balloon often designates a region of a molecule where electrons are not shared with any other atoms or groups. The structure and reactivity of the molecule are impacted by this region, which is referred to as a lone pair. The wider balloon makes it easier to see where these unshared electron pairs are located and how they affect the molecule's overall structure and behaviour.

learn more about lone pairs here:

https://brainly.com/question/30886923

#SPJ4

Complete the following radioactive decay problem.

234 U → 4^He +
92. 2

Answers

The complete radioactive decay equation is as follows:

234/92 → 4/2He + 230/90 Th

What is a radioactive decay?

Radioactive decay is a several processes by which unstable nuclei emit subatomic particles and/or ionizing radiation and disintegrate into one or more smaller nuclei.

According to this question, uranium with the mass number 234 and atomic number 92 undergoes a radioactive decay as follows:

234/92 U → 4/2 He + 230/90 Th

Uranium-234 nuclei decay by alpha emission to thorium-230, except for the tiny fraction (parts per billion) of nuclei that undergo spontaneous fission.

Learn more about radioactive decay at: https://brainly.com/question/1770619

#SPJ1

When 2.55g of an unknown weak acid (HA) with a molar mass of 85.0 g/mol is dissolved in 250.0 g of water, the freezing point of the resulting solution is -0.258 Degrees Celsius.
Calculate Ka for the unknown weak acid.

Answers

The Ka for the unknown weak acid (HA) with a molar mass of 85.0 g/mol will be about 9.26 × 10⁻¹⁴.

What is the freeing point of unknown acid solution?

The formula for calculating the freezing point depression of a solution is:

ΔTf = Kf × m × i

where, ΔTf is the change in freezing point, Kf is the freezing point depression constant, m is the molality of the solute, and i is the van't Hoff factor.

To calculate the molar mass of the unknown weak acid, we need to convert grams to moles:

2.55 g ÷ 85.0 g/mol = 0.03 molHA

We can then calculate the molality of the solution by dividing the moles of solute by the mass of the solvent in kilograms:

0.03 mol ÷ 0.250 kg = 0.12 mol/kg

ΔTf can be calculated by subtracting the freezing point of the pure solvent (water) from the freezing point of the solution:

0.258°C - 0°C = -0.258°C

The freezing point depression constant (Kf) for water is 1.86 °C/m. We can use this value, along with the molality of the solution, to solve for the dissociation constant (Kb) for the unknown weak acid:

ΔTf = Kf × m × i

0.258°C = 1.86 °C/m × 0.12 mol/kg × i

i = 1.08

Ka can be calculated using the relationship between Ka and Kb for an acid:

Kb = Kw / Ka

Kw is the ion product constant for water, which is 1.00 × 10⁻¹⁴ at 25°C. We can use this value, along with the value we just calculated for Kb, to solve for Ka:

Kb = Kw / Ka

1.08 = 1.00 × 10⁻¹⁴ / Ka

Ka = 9.26 × 10⁻¹⁴

So, the Ka for the unknown weak acid is 9.26 × 10⁻¹⁴.

Learn more about Freezing point depression here:

https://brainly.com/question/12844810

#SPJ11

What is the difference in electrochemical potential between two electrodes of an electrochemical cell called?

Answers

The difference in electrochemical potential between two electrodes of an electrochemical cell is called as the cell potential.

What is the cell potential?

The potential difference or voltage that exists between two electrodes in an electrochemical cell when no current is flowing through the cell is called the cell potential. Cell potential, also known as electromotive force (emf), is a measure of the driving force that drives a chemical reaction in an electrochemical cell forward.

The potential difference between the anode and cathode of an electrochemical cell is a quantitative measurement of the cell's capacity to generate electrical energy. The cell potential is usually measured in volts (V), and its sign is determined by the direction in which the electrons flow through the cell. When electrons flow spontaneously from the anode to the cathode, the cell potential is positive, whereas if electrons are forced to flow from the cathode to the anode, the cell potential is negative.

Learn more about Cell potential here:

https://brainly.com/question/1313684

#SPJ11

If a solid piece of shiny sodium metal is exposed to chlorine gas, a large amount of heat is released and the white solid sodium chloride (table salt) forms. Based on this information, which of the following statements is TRUE? A) This process was exothermic_ B) This process represents a physical change: C) Mass is lost during this process_ D) This process was endothermic_

Answers

Option A is the correct statement for the process was exothermic that a large amount of heat is released when sodium metal is exposed to chlorine gas.

What happens when sodium is exposed to chlorine? Sodium metal reacts with chlorine gas to produce sodium chloride. When solid shiny sodium metal is exposed to chlorine gas, a large amount of heat is generated, and the white solid sodium chloride (table salt) is formed. So the process is an exothermic reaction.A chemical reaction in which heat is given out, such as the one between sodium and chlorine, is exothermic. When the products' energy is less than the reactants' energy, energy is given out from the system into the surroundings, resulting in an increase in temperature in the surroundings. Therefore, this process was an exothermic and the correct option is 'A'.

Learn more about sodium chloride: https://brainly.com/question/28106660

#SPJ11

(science) explain the difffrence between a food chain and a food web

Answers

Answer: A food chain shows what eats what.  A food web is made up of all the food chains in the ecosystems.

Explanation: Hope that helps!

Answer:

Explanation:

A food chain outlines who eats whom.

A food web is all of the food chains in an ecosystem.

Other Questions
A machine produces 225,000 insulating washers for electrical devices per day. The production manager claims that no more than 4,000 insulating washers are defective per day. In a random sample of 200 washers, there were 4 defectives. Determine whether the production manager's claim is likely to be true. Explain. what was the significance of the naval quarantine of cuba? Which of the following is true about employee stock options after they have been issued?a. They have to be revalued every yearb. They have to be revalued every quarterc. They have to be revalued every day like other derivativesd. They never have to be revalued Fungal groups and relatives Classify each description into the correct fungal group or relative. If a description applies to more than one group, place it into both groups. Have the smallest known oukaryotic genome Produce zoospores Sister group to fung Use polar tube to infect host Alternation of haploid and diploid generations Found in digestivo tracts of herbivores Blastocladiomycota Neocallimastigomycota Microsporidia the concept of face refers to group of answer choices the public self image that every member of society wants to claim for himself or herself a psychological image that can be granted and lost and fought for and presented as a gift the projected image of one's self in a relational situation all of these L'essentielle libert2. a. Sur quelle anaphore chaque strophe, l'exception dela dernire, est-elle construite ? Quelle est la fonction gram-maticale des groupes ainsi introduits? b. Quelle est selonvous la place que le pote accorde la libert dans sa vie etdans son monde? Appuyez-vous sur la rponse la questionprcdente pour rpondre.3. Relevez quelques sonorits du mot libert et indi-quez quelle est la figure de style ici utilise. Quel effet celaproduit-il? Le vocabulaire de la posie, p. 396.Les figures de style, p. 403.4. Comment le pote instaure-t-il une relation intime etaffective avec la libert? Justifiez votre rponse en relevantdes vers ou des termes dans le pome.5. a. Vous attendiez-vous lire Libert la fin du pome?Pourquoi? b. Par quels moyens ce mot est-il mis en valeur? We always see the same side of the Moon because a. the Moon does not rotate on its axis. b. the Moon rotates on its axis once for each revolution around Earth. c. when tWe always see the same side of the Moon becausea. the Moon does not rotate on its axis.b. the Moon rotates on its axis once for each revolution around Earth.c. when the other side of the Moon is facing Earth, it is unlit.d. when the other side of the Moon is facing Earth, it is on the opposite side of Earth.e. none of the above When designing responsive organizations, what decisions do firms have to make? An introduction should briefly tell your reader what to expect from the essay. This should be done by providing 4 essential elements. Put these 4 elements in the correct order by matching the element to a number. where would be the best location to install an omnidirectional antenna that is connected to a wireless access point? For each problem, select the best response (a) A x2 statistic provides strong evidence in favor of the alternative hypothesis if its value is A. a large positive number. OB. exactly 1.96 c. a large negative number. D. close to o E. close to 1. (b) A study was performed to examine the personal goals of children in elementary school. A random sample of students was selected and the sample was given a questionnaire regarding achieving personal goals. They were asked what they would most like to do at school: make good grades, be good at sports, or be popular. Each student's sex (boy or girl) was also recorded. If a contingency table for the data is evaluated with a chi-squared test, what are the hypotheses being tested? A. The null hypothesis that boys are more likely than girls to desire good grades vs. the alternative that girls are more likely than boys to desire good grades. OB. The null hypothesis that sex and personal goals are not related vs. the alternative hypothesis that sex and personal goals are related. C. The null hypothesis that there is no relationship between personal goals and sex vs. the alternative hypothesis that there is a positive, linear relationship. OD. The null hypothesis that the mean personal goal is the same for boys and girls vs. the alternative hypothesis is that the means differ. O E. None of the above. (C) The variables considered in a chi-squared test used to evaluate a contingency table A. are normally distributed. B. are categorical. C. can be averaged. OD. have small standard deviations. E. have rounding errors. Suppose a $10 tax is placed on a good. The more inelastic the supply of the good, the- more of the tax will be paid by the sellers.- smaller the increase in the after-tax price.- larger the decrease in the quantity sold.- more of the tax will be paid by the buyers. the use of hashtags and posts to raise awareness about specific issues and causes is known as ___________. describe the pathophysiology of inspiration and expiration. how do these processes provide the body with oxygen? In an open manometer with an atmospheric pressure of 780 mm Hg, the mercury level in the arm connected to the gas is 45 mm Hg higher than in the arm connected to the atmosphere. What is the pressure of the gas sample? (answer in mm Hg) what proc step prints a dataset out? just put the proc name in your answer and nothing else. for instance, if the correct proc were proc sgplot, your answer should be sgplot. ciara's alarm clock blasts at 5:00am. the noise is deafening which causes her to jump up to turn it off. in this case, the alarm serves as a:negative punishmentpositive reinforcementnegative reinforcementpositive punishment ImagineXin the below is a missing value. If I were to run a median imputer on this set of data what would the returned value be?50,60,70,80,100,60,5000,x(It's okay to have to look up how to do this!) An. error 80 100 70 The features in a model.... None of these answers are correct Are always functions of each other Kecp the model validation process stable Are used as proxics for y-hatfy (that is yhat divided by y) Which of the below were discussed as being problems with the hold out method for validation? Outliers can skew the result Validation is sometimes too challengingK=3is not sufficiently large cnough Data is not available for test and control differences. The modefis not trained on all of the day 3) ____ is the expression, which tells the nature of the roots of a quadratic equation of the form 3) ____ is the expression, which tells the nature of the roots of a quadratic equation of the form Continue to consider the prior question. Assume that there is an increase in the wage rate per hour. If the income effect dominates the substitution effect and leisure is a normal good, mark the correct (or multiple correct) answer(s): - Hours worked will increase - Leisure will decrease - Leisure will increase - The labor supply curve is downward sloping, - The demand for leisure is downward sloping - The labor supply curve is upward sloping. - The demand for leisure is upward sloping. - Hours worked will decrease.