An unidentified gas is determined to be 24.0% carbon and 76% fluorine by mass. What is the empirical formula of this gas

Answers

Answer 1

Answer:

CF₂

Explanation:

Let's assume we have 100 g of the gas. If that were the case we'd have

24 g of C76 g of F

Now we convert both masses into moles, using their respective molar mass:

24 g C ÷ 12 g/mol = 2 mol C76 g F ÷ 19 g/mol = 4 mol F

We can express those results as C₂F₄.

To determine the empirical formula we reduce those coefficients to the lowest possible integers, leaving us with CF₂.


Related Questions

Choose the most correct answer: The endothermic (∆H > 0) reaction:
a) Cannot occur at all temperature.
b) Can occur with the positive ∆S at high temperature.
c) Can occur with the negative ∆S at low temperature.
d) Cannot occur with the positive ∆S at high temperature.

Answers

Answer:

B

Explanation:

In order to create spontaneity, an endothermic process has to occur along with positive entropy and high temperature

# of protons
# of neutrons
# of electrons
Atomic Number
Mass Number
18
17
35
17
37
6
8
6
6
15

Answers

Answer:

35

Explanation:

is the answer for your question

Determine the number of hydrogen atoms connected to each carbon atom: The bond-line structure of a compound has a SMILES string of CC1CCN(CC1N(C)C2=NC=NC3=C2C=CN3)C(=O)CC#N. All the carbon atoms of the compound are highlighted and labeled a through p.

Answers

Answer:

dsgsdfd

Explanation:

A substance which is made up of the same kind
of atom is known as?

Answers

Answer:

Element

Element : A pure substance composed of the same type of atom throughout. Compound : A substance made of two or more elements that are chemically combined in fixed amounts.

Explanation:

how many CH4 molecules are in 14.8 g of CH4

Answers

1.8021•1024 molecules

Answer:

[tex]\boxed {\boxed {\sf 5.56 \times 10^{23} \ molecules \ CH_4}}[/tex]

Explanation:

We are asked to find how many molecules of methane are in 14.8 grams of the substance.

1. Convert Grams to Moles

First, we convert grams to moles. We use the molar mass, or the mass of 1 mole of a substance. These values are equivalent to the atomic masses found on the Periodic Table, however the units are grams per mole instead of atomic mass units.

We are given the compound methane, or CH₄. Look up the molar mass of the individual elements (carbon and hydrogen).

C: 12.011 g/mol H: 1.008 g/mol

Check the formula for subscripts. Hydrogen (H) has a subscript of 4, so there are 4 moles of hydrogen in 1 mole of methane. We must multiply hydrogen's molar mass by 4, then add carbon's molar mass.

H₄: 1.008 * 4 = 4.032 g/mol CH₄: 12.011 + 4.032 = 16.043 g/mol

Now we use dimensional analysis to convert. To do this, we set up a ratio using the molar mass.

[tex]\frac {16.043 \ g \ CH_4 }{ 1 \ mol \ CH_4}[/tex]

Since we are converting 14.8 grams of methane to moles, we multiply by this value.

[tex]14.8 \ g \ CH_4 *\frac {16.043 \ g \ CH_4 }{ 1 \ mol \ CH_4}[/tex]

Flip the ratio so the units of grams of methane cancel.

[tex]14.8 \ g \ CH_4 *\frac{ 1 \ mol \ CH_4} {16.043 \ g \ CH_4 }[/tex]

[tex]14.8 *\frac{ 1 \ mol \ CH_4} {16.043}[/tex]

[tex]\frac {14.8}{16.043} \ mol \ CH_4= 0.9225207256 \ mol \ CH_4[/tex]

2. Moles to Molecules

Next, we convert moles to molecules. We use Avogadro's Number or 6.022  × 10²³. This is the number of particles (atoms, molecules, formula units, etc.) in 1 mole of a substance. In this problem, the particles are moles of methane. Set up another ratio using Avogadro's Number.

[tex]\frac { 6.022 \times \ 10^{23} \ molecules \ CH_4}{ 1 \ mol \ CH_4}[/tex]

Multiply by the number of moles we calculated.

[tex]0.9225207256\ mol \ CH_4 * \frac { 6.022 \times \ 10^{23} \ molecules \ CH_4}{ 1 \ mol \ CH_4}[/tex]

The units of moles of methane cancel.

[tex]0.9225207256* \frac { 6.022 \times \ 10^{23} \ molecules \ CH_4}{ 1 }[/tex]

[tex]5.55541981 \times 10^{23} \ molecules \ CH_4[/tex]

3. Round

The original measurement of grams (14.8) has 3 significant figures, so our answer must have the same. For the number we calculated, that is the hundredth place. The 5 in the thousandth place tells us to round the 5 in the hundredth place up to a 6.

[tex]5.56 \times 10^{23} \ molecules \ CH_4[/tex]

14.8 grams of methane is equal to approximately 5.56 × 10²³ molecules of methane.

Write chemical equations for the reactions that occur when solutions of the following substances are mixed:

a. HNO₂ (nitrous acid) and C₂H₇NO (aq) ethanolamine, a base.
b. H₃O+ and F-

Answers

a) HNO₂ + C₂H₇NO → N₂ + C₂H₆O + H₂O

b) H₃O⁺ + F⁻ → HF + H₂O

[tex]\large\color{lime}\boxed{\colorbox{black}{Answer : - }}[/tex]

a) HNO₂ + C₂H₇NO → N₂ + C₂H₆O + H₂O

b) H₃O⁺ + F⁻ → HF + H₂O

Each 5-ml teaspoon of Extra Strength Maalox Plus contains 450 mg of magnesium hydroxide and 500 mg of aluminum hydroxide. How many moles of hydronium ions H3O are neutralized by 1 teaspoon of antacid product?

Answers

Answer:

0.0347 moles of hydronium ions

Explanation:

The equation of the neutralization reaction between hydroxide and hydronium ions is given below:

H₃O+ (aq) + OH- (aq) ----> 2 H₂O (l)

From the equation above, 1 mole of hydroxide ions will neutralize one mole hydronium ions.

The moles of hydroxide ions present in 1 teaspoon or 5 mL of antacid product is calculated as follows:

Number of moles = mass / molar mass

Molar mass of Magnesium hydroxide, Mg(OH)₂ = 58 g/mol

Molar mass of aluminium hydroxide, Al(OH)₃ = 78 g/mol

Mass of magnesium hydroxide = 450 g = 0.45 g

Mass of aluminium hydroxide = 500 mg = 0.5 g

Moles of magnesium hydroxide = (0.45/58) moles

Moles of aluminium hydroxide = (0.5/78) moles

Equation of the ionization of magnesium hydroxide and aluminium hydroxide is given below:

Mg(OH)₂ (aq) ----> Mg²+ (aq) + 2 OH- (aq)

Al(OH)₃ (aq) ---> Al³+ (aq) + 3 OH- (aq)

Number of moles of hydroxide ions present in (0.45/58) moles of magnesium hydroxide = 2 × (0.45/58) moles = 0.0155 moles

Number of moles of hydroxide ions present in (0.5/78) moles of aluminium hydroxide = 3 × (0.5/78) moles = 0.0192 moles

Total moles of hydroxide ions = 0.0155 + 0.0192 = 0.0347 moles hydroxide ions

Therefore, 0.0347 moles of hydroxide ions will neutralize 0.0347 moles of hydronium ions.

A number is three times the difference between twenty and the number. What is the number?

Answers

Answer:

the number is 7

Explanation:

"Three times" means multiply by 3

"Difference" means subtract

"Sum" means add

3(x - 7) = 23 - (3x + 2)

3x - 21 = 23 - 3x - 2

3x - 21 = 21 - 3x

6x = 42

x = 7

Consider the reaction: A(aq) + 2B (aq) === C (aq). Initially 1.00 mol A and 1.80 mol B
were placed in a 5.00-liter container. The mole of B at equilibrium was determined to
be 1.00 mol. Calculate K value.
0.060
5.1
25
17
Ugh

Answers

Answer:

17

Explanation:

Step 1: Calculate the needed concentrations

[A]i = 1.00 mol/5.00 L = 0.200 M

[B]i = 1.80 mol/5.00 L = 0.360 M

[B]e = 1.00 mol/5.00 L = 0.200 M

Step 2: Make an ICE chart

        A(aq) + 2 B(aq) ⇄ C(aq)

I       0.200    0.360        0

C        -x           -2x         +x

E     0.200-x  0.360-2x   x

Then,

[B]e = 0.360-2x = 0.200

x = 0.0800

The concentrations at equilibrium are:

[A]e = 0.200-0.0800 = 0.120 M

[B]e = 0.200 M

[C]e = 0.0800 M

Step 3: Calculate the concentration equilibrium constant (K)

K = [C] / [A] × [B]²

K = 0.0800 / 0.120 × 0.200² = 16.6 ≈ 17

What volume of water is produced when 38.5 g of ethanol reacts with oxygen at 500°C at 1.75 atm?
CH3CH2OH(g) + 3 O2(g)→ 2 CO2(g) + 3 H2O(g)

Answers

Answer:

90.99 or 91.0

Explanation:

Using the balanced equation, you convert 38.5g of ethanol to moles of water. From there, you plug the values into the Ideal Gas Equation: PV=nRT.

Answer: The volume of oxygen gas is 91.4 L.

Explanation:

The number of moles is defined as the ratio of the mass of a substance to its molar mass. The equation used is:

[tex]\text{Number of moles}=\frac{\text{Given mass}}{\text{Molar mass}}[/tex] ......(1)

Given mass of ethanol = 38.5 g

Molar mass of ethanol = 46 g/mol

Plugging values in equation 1:

[tex]\text{Moles of ethanol}=\frac{38.5g}{46g/mol}=0.840 mol[/tex]

The given chemical equation follows:

[tex]CH_3CH_2OH(g)+3O_2(g)\rightarrow 2CO_2(g)+3H_2O(g)[/tex]

By stoichiometry of the reaction:

If 1 mole of ethanol produces 3 moles of water

So, 0.840 moles of ethanol will produce = [tex]\frac{3}{1}\times 0.840=2.52mol[/tex] of water

The ideal gas equation is given as:

[tex]PV=nRT[/tex] .......(2)

where

P = pressure = 1.75 atm

V = volume of oxygen gas = ?

n = number of moles= 2.52 moles

R = Gas constant = 0.0821 L.atm/mol.K

T = temperature of the tank = [tex]500^oC=[500+273]K=773K[/tex]

Putting values in equation 2, we get:

[tex]1.75 atm\times V=2.52mol\times 0.0821L.atm/mol.K\times 773K\\\\V=\frac{2.52\times 0.0821\times 773}{1.75}=91.4L[/tex]

Hence, the volume of oxygen gas is 91.4 L.

H2+O=???????????????????

Answers

Answer:

H₂O

Explanation:

Two molecules of Hydrogen and one molecules of Oxygen, when mixed, create H₂O, or water. There is no scientific name for H₂O due to it's common name. It is just refereed to as "water" or H₂O.

What is the biggest cause of change in Earth's systems?
A. Heat
B. Motion
C. Friction
D. Plate tectonics

Answers

Answer:

heat

Explanation:

because it's the cause of change

Answer:

heat

Explanation:

because it is a natural factor that causes the change in Earth's system

how hydrogen chloride gas is prepared on labrotary by conc sulpheric acid

Answers

Answer:

It is prepared small amounts of hydrogen cloride for uses in the lab.

It can be  "generated in an HCl generator by dehydrating hydrochloric acid with either sulfuric acid or anhydrous calcium chloride."

Forcus on the yellow highlighted texts, your help is appreciated.
[tex]{ \sf{ \red{no \: pranks}}}[/tex]

Answers

Answer:

Transition temperature is the temperature at which a substance changes from one state to another.

Allotropy is the existence of an element in many forms.

Lewis Structures are used to describe the covalent bonding in molecules and ions. Draw a Lewis structure for NO3- and answer the following questions based on your drawing.

1. For the central nitrogen atom:

The number of lone pairs = ________
The number of single bonds=_______
The number of double bonds= ______

2. The central nitrogen atom :

Answers

Answer:

The lewis structure for NO₃⁻ is shown in the attachment below

For the central nitrogen atom:

The number of lone pairs = 0

The number of single bonds = 2  

The number of double bonds= 1

Explanation:

The lewis structure for NO₃⁻ is shown in the attachment below.

From the Lewis structure

For the central nitrogen atom:

The number of lone pairs = 0

The number of single bonds = 2  

The number of double bonds= 1

Sean plated an unknown metal onto his silver ring which initially weighed 1.4 g. He constructs an electrolytic cell using his ring as one of the electrodes. After running the cell, 0.022 moles of the unknown metal was plated onto his ring and the mass of the ring increased to 3.137 g. What is the atomic weight of the unknown metal in g/mol

Answers

Answer:

79 g/mol

Explanation:

Mass of unknown metal deposited = 3.137 g - 1.4 g = 1.737 g

Number of moles of metal deposited = 0.022 moles

Since;

Number of moles = reacting mass/molar mass

Molar mass = reacting mass/number of moles

Molar mass = 1.737 g/0.022 moles

Molar mass= 79 g/mol

What is ethane?
A. A polymer
B. An alkyne
C. An alkane
D. An alkene ​

Answers

Answer:

D. An alkene ​

Explanation:

because Ethane is C2H4

Answer:

It's a alkANE. C.

Explanation:

The easiest way to memorize this is to look at the endings. Substances that end in -ANE are alkANEs. Substances that end in -ENE are alkENEs. Substances that end in -YNE are alkYNEs.

Which is the electronic configuration for oxygen?

Answers

the answer is [He] 2s² 2p⁴

một chất hữu cơ có cấu tạo c2h2 cho khí br2 vào ta được hỗn hợp khí

Answers

Answer:

C2H2 + Br2 → C2H2Br2

Explanation:

Write balanced equations for the reaction of each of the following carboxylic acids with NaOH. Part A formic acid Express your answer as a chemical equation. A chemical reaction does not occur for this question. Request Answer Part B 3-chloropropanoic acid Express your answer as a chemical equation. nothing A chemical reaction does not occur for this question.

Answers

Answer:

Part A

HCOOH(aq) + NaOH(aq) → HCOONa(aq) + H2O(l)

Part B

ClCH2CH2CO2H(aq) + NaOH(aq) ------> ClCH2CH2CO2Na(aq) + H2O(l)

Explanation:

The reaction between an alkanoic acid and a base is a neutralization reaction. The reaction occurs as follows;

RCOOH + NaOH ----> RCOONa + H2O

We have to note the fact that the net ionic reaction still remains;

H^+(aq) + OH^-(aq) ---> H2O(l)

In both cases, the reaction can occur and they actually do occur as written.

Determine the number of moles of aluminum in 2.154 x 10-1 kg of Al. Group of answer choices 5816 mol 7.984 mol 6.02 X 1023 mol 4.801 mol 8.783

Answers

Answer:

Avogadro's number is 1 mol  = 6.02 * 10^23 elements

It means that 1 mol of atoms is 6.02 * 10^23 atoms

1 mol of atoms = 6.02 * 10^23 atoms

From there, if you divide both sides by 1 mol of atoms, you get

1 = 6.02 * 10^23 atoms / 1 mol of atoms.

That means, that to pass from a number of moles of atoms to number of atoms you have to multipby by the conversion factor

         6.02*10^23  atoms Al/ 1 mol Al

That is the second option of the list.

Explanation:

Critique this statement: Electrons can exist in any position
outside of the nucleus.

Answers

Answer:

However, there has to be 2 electrons on the first shell, and 8 on the others.

Explanation:

Hope this helps :)

Manganese-55 has _____neutrons.
55 Mn
25

A. 55
B. 30
C. 25​

Answers

QUESTION:- Manganese-55 has _____neutrons.

OPTIONS :-

A. 55

B. 30

C. 25

ANSWER:- NUMBER OF NEUTRONS IS EQUAL TO THE DIFFERENCE BETWEEN THE MASS IF THE ATOM AND ATOMIC NUMBER

SO DIFFERENCE IS EQUAL TO :- 55-25 = 30 NEUTRONS.

SO THERE IS 30 NEUTRONS IN SINGLE ATOM OF THE MANGANESE-55 ATOM.

Answer:

the mass of an atom is the sum of proton and neutron which are both concentrated in nocleus of an atom. from the question the mass is given as 55 and the proton is 25.

Explain why you get a basic solution when you dissolve NaF in water.

Answers

Answer:

The fluoride ion is capable of reacting, to a small extent, with water, accepting a proton. The fluoride ion is acting as a weak Brønsted-Lowry base. The hydroxide ion that is produced as a result of the above reaction makes the solution slightly basic.

So

we get a basic solution when you dissolve NaF in water.

Na is a alkaline earth metal

Metallic compound dissolved in water acts as base

Also there is another reason

Na F is ioniC

Fluorine is known as having highest electron affinity in world

It can accept a line pair of OH-

So it's Bronsted Lowry base .

It can also acts as Arrhenius base

Hence its basic

How many moles of Al are needed to react exactly with 10.00 moles of Fe2O3 according to the following
equation?
Fe2O3 + 2 Al → Al2O3 + 2Fe
A) 15.0 moles
1
B) 20.0 moles
C) 30.0 moles
D) 60.0 moles
E) 35.0 moles

Answers

Answer:

Answer is B) 20.0 moles

Explanation:

From the equation,

1 mole of Fe2O3 = 2 moles of Al

therefore 10.0 moles of Fe2O3 = 10×2

= 20.0 moles.

What mass of water is formed in the reaction of 4.16g H with excess oxygen gas.

Answers

Answer:

Explanation:

Start with a balanced equation.

2H2 + O2 → 2H2O

Calculate mole H2 using the formula: n = m/M, where:

n = mole

m = mass (g)

M = molar mass (g/mol)

Calculate molar mass of H2.

M H2 = 2 × 1.008 g/mol = 2.016 g/mol

Calculate moles H2.

n H2 = 4.16 g H2/2.016 g/mol = 2.063 mol H2

Calculate moles H2O by multiplying moles H2 by the mole ratio between H2O and H2 from the balanced equation, so that moles H2 cancel.

2.063 mol H2 × (2 mol H2O/2 mol H2) = 2.063 mol H2O

The mass of water will be calculated by rearranging the n = m/M formula to isolate m;

m = n × M

Calculate the molar mass H2O.

M H2O = (2 × 1.008 g/mol) + (1 × 15.999 g/mol) = 18.015 g/mol

Calculate the mass H2O.

m = n × M = 2.063 mol H2O × 18.015 g/mol = 37.2 g H2O

4.16 g H2 with excess O2 will produce 37.2 g H2O.

2. Calculate the wavelength of the emitted photon from hydrogen for the transition from ni = 3 to nf = 2. What part of the visible spectrum is this wavelength? Visible wavelengths are: Red  700 - 620 nm, Yellow  620 - 560 nm, Green  560 - 500 nm, Blue 500 - 440 nm, and Violet  440 - 400 nm.

Answers

Answer:

The correct answer is "654.54 nm".

Explanation:

According to the question,

⇒ [tex]\frac{1}{\lambda}= Rh(\frac{1}{n1^2} -\frac{1}{n2^2} )[/tex]

By substituting the values, we get

       [tex]=1.1\times 10^7(\frac{1}{4} -\frac{1}{9} )[/tex]

       [tex]=1.1\times 10^7(\frac{9-4}{36} )[/tex]

       [tex]=1.1\times 10^7(\frac{5}{36} )[/tex]

       [tex]=654.54\ nm[/tex]

Thus the above is the right solution.

Two common methods to generate an aldehyde is by oxidation of an alcohol and through ozonolysis.

a. True
b. False

Answers

Answer:

a. True.

Explanation:

Only primary and secondary alcohols can oxidise to give an aldehyde. But a weak oxidizing agent must be used to prevent formation of a carboxylic acid or ketone.

weak oxidizing agents: Chromyl chloride, silver/oxygen/500°C

take an example of ethanol:

[tex]{ \bf{CH _{3} CH_{2}OH \: \: \frac{Ag/O_{2} }{500 \degree C} > \: \:CH _{3} CHO}}[/tex]

[tex]{ \sf{CH _{3} CHO \: \: is \: ethanal}} [/tex]

By ozonolysis:

Here, reactants are Ozone gas, Carbon tetrachloride at a temperature (<20°C), ethanoic acid, zinc and water.

take an example of propanol:

if it undergoes ozonolysis, it gives ethanal and methanal.

Answer:

A. True

Explanation:

Only primary and secondary alcohols can oxidise to give an aldehyde. But a weak oxidizing agent must be used to prevent formation of a carboxylic acid or ketone.

weak oxidizing agents: Chromyl chloride, silver/oxygen/500°C

take an example of ethanol:

By ozonolysis:

Here, reactants are Ozone gas, Carbon tetrachloride at a temperature (<20°C), ethanoic acid, zinc and water.

take an example of propanol:

if it undergoes ozonolysis, it gives ethanal and methanal.

Read the following statement:

Energy cannot be created or destroyed.

Does the statement describe a scientific law? (3 points)

a
No, because it universally applies to all objects

b
No, because it is not true in all circumstances

c
Yes, because it universally applies to all objects

d
Yes, because it is not true in all circumstances

Answers

Answer:

C. yes, because it is universally applies to all objects

A wavelength of 489.2 nm is observed in a hydrogen spectrum for a transition that ends in the nf level of the Balmer series. What was ni for the initial level of the electron

Answers

Answer:

[tex]n_1=4[/tex]

Explanation:

From the question we are told that:

Wavelength [tex]\lambda=489.2 nm =>4.86*10^{-7}[/tex]

nf level= Balmer series

nf level= 2

Generally the equation for Wavelength is mathematically given by

[tex]\frac{1}{\lambda}=R[\frac{1}{nf^2}-\frac{1}{n_1^2}][/tex]

Where

[tex]R=Rydberg Constant[/tex]

[tex]R=1.097*10^7[/tex]

Therefore

[tex]\frac{1}{4.86*10^{-7}}=1.097*10^7[\frac{1}{2^2}-\frac{1}{n_1^2}][/tex]

[tex]n_1=4.0021[/tex]

[tex]n_1=4[/tex]

Other Questions
Hydrogen fluoride, HF exist as liquid at room temperature. Explain this phenomenon based on the formation of hydrogen bonds. How much fudge will each person get if 7 people share one half of a pound of fudge equally? Ow much fudge will each person get if 7 people share one half of a pound of fudge equally? Use the number line to help you. (2 points) A number line showing zero to one divided into two equal parts. Each part is divided into seven equal parts. Select one: a. One ninth pound of fudge b. One fourteenth pound of fudge c. One fifth pound of fudge Which sentence option correctly uses a semicolonA.P.E.X What proportion of elected officials in the United States represents single-member districts? Which person is an example of an entrepreneur?A - a lawyer who represents clients with very little money.B - a restaurant server who take college classes after work?C - an architect who designs buildings for the government D - an inventor who creates a new computer company oCreating a thesis statement is the first step in developing your topic.Please select the best answer from the choices providedOF Ted can clear a football field of debris in 3 hours. Jacob can clear the same field in 2 hours. When they work together, the situation can be modeled by the equation, where t is the number of hours it would take to clear the field together.How long will it take Ted and Jacob to clear the field together? for the equation BaCI2 + Na2SO4 > BaSO4 + 2NaCIA. reactants: 1 ;products: 1B. reactants: 1 ;products: 2C. reactants: 2 ;products: 1 D. reactants: 2 ;products: 2 What is the confidence interval estimate of the population mean percentage change in the price per share of stock during the first quarter? Do not round intermediate calculations. Enter negative values as negative numbers, if any. hich statement correctly compares and contrasts My Story and "On the Bus with Rosa Parks"? The memoir and the poem are both told from first-person point of view, but the poem is shorter. Both the memoir and poem describe the bus ride of Rosa Parks, but the memoir includes more facts. The memoir includes facts and opinions, but the poem includes only facts. Both the memoir and the poem are about Rosa Parks, but the poem talks more about her personal feelings. What does the engine driver's use of the phrase "It ain't so bad as all that 'ere" reveal about his use of language? A. He uses formal language. B. He uses informal language. C. He uses poetic language. D. He uses descriptive language. a car is travelling at 36 km per hour if its velocity increases to 72 km per hour in 5 seconds then find the acceleration of car in SI unit I really need help on this What is the distance between -10.2 and 5.7? Hello! i need help with question 67 & 68 Solve for x. Round to the nearest tenth of a degree, if necessary. Help me out plz bbbhbbhh 6. What is the relationship between genes and alleles? Gsggagsgsvhdgdvdvdvdvdg help me fast Ill give you brainliste A uniform metre ruler scale balanced at 40 cm mark, when weight 25 gf and 10gf are suspended at 10cm mark and 75 cm mark respectively.Calculate the weight of the metre scale.