C12H26 has a what boiling point than C10H22. higher or lower

Answers

Answer 1
lower fee free to give me brainpower answer

Related Questions

How many moles of potassium in 73.56g of potassium chlorate (V) (KClO 3 )?

Answers

Answer:

Approximately [tex]0.6003\; \rm mol[/tex] formula units.

Explanation:

Formula Mass of KClO₃

Look up the relative atomic mass data for [tex]\rm K[/tex], [tex]\rm Cl[/tex], and [tex]\rm O[/tex] on a modern periodic table:

[tex]\rm K[/tex]: [tex]39.908[/tex].[tex]\rm Cl[/tex]: [tex]35.45[/tex].[tex]\rm O[/tex]: [tex]15.999[/tex].

The relative atomic mass of an element is numerically equal to the mass (in grams) of one mole of its atoms. For example, the relative atomic mass of [tex]\rm K[/tex] is [tex]39.908[/tex]. Therefore, the mass of one mole of [tex]\rm K\![/tex] atoms should be [tex]39.908\; \rm g[/tex].

Each [tex]\rm KClO_3[/tex] "formula" unit includes one [tex]\rm K[/tex] atom, one [tex]\rm Cl[/tex] atom, and three [tex]\rm O[/tex] atoms. Therefore, one mole of [tex]\rm KClO_3\![/tex] formula units would include:

one mole of [tex]\rm K[/tex] atoms, one mole of [tex]\rm Cl[/tex] atoms, and three moles of [tex]\rm O[/tex] atoms.

From the relative atomic mass of these three elements:

The mass of one mole of [tex]\rm K[/tex] atoms would be [tex]39.908\; \rm g[/tex].The mass of one mole of [tex]\rm Cl[/tex] atoms would be [tex]35.45\; \rm g[/tex].The mass of three moles of [tex]\rm O[/tex] atoms would be [tex]3 \times 15.999\; \rm g = 47.997\; \rm g[/tex].

Combining these three parts should give the mass of one mole of [tex]\rm KClO_3[/tex] formula units:

[tex]\begin{aligned}& M(\mathrm{KClO_3}) \\ &= 39.908 + 35.45 + 3 \times 15.999 \\ &= 122.545\; \rm g \cdot mol^{-1}\end{aligned}[/tex].

Number of moles of KClO₃ formula units in the sample

The formula mass of [tex]\rm KClO_3[/tex] is [tex]M(\mathrm{KClO_3}) = 122.545\; \rm g \cdot mol^{-1}[/tex], meaning that the mass of one mole of [tex]\rm KClO_3\![/tex] formula units would be [tex]122.545\; \rm g\![/tex].

The mass of this [tex]\rm KClO_3\!\![/tex] sample is [tex]m(\mathrm{KClO_3}) = 73.56\; \rm g[/tex]. The number of moles of formula [tex]\rm KClO_3\![/tex] units in this sample would be:

[tex]\begin{aligned}n(\mathrm{KClO_3}) &= \frac{m(\mathrm{KClO_3})}{M(\mathrm{KClO_3})} \\ &= \frac{73.56\; \rm g}{122.545\; \rm g \cdot mol^{-1}} \approx 0.6003\; \rm mol\end{aligned}[/tex].

73.56 g of potassium chlorate (v), KClO₃ contains 0.6 mole of potassium, K.

To know the exact number of mole of potassium (K) in 73.56 g of potassium chlorate (v), KClO₃ do the following:

Step 1:

Determination of the number of mole in 73.56 g of potassium chlorate (v), KClO₃

Mass of KClO₃ = 73.56 g

Molar mass of KClO₃ = 39 + 35.5 + (16×3)

= 39 + 35.5 + 48

= 122.5 g/mol

Mole of KClO₃ =?

[tex]Mole =\frac{mass}{molar mass}\\\\Mol KClO_{3} = \frac{73.56}{122.5}[/tex]

Mole of KClO₃ = 0.6 mole

Step 2:

Determination of the number of mole of potassium, K in 0.6 mole (i.e 73.56 g) of KClO₃

Considering the molecular formula of potassium chlorate (v), KClO₃, we can see that:

1 mole of KClO₃ contains 1 mole of K.

Therefore, 0.6 mole of KClO₃ will also contain 0.6 mole of K.

Therefore, we can conclude that 73.56 g of KClO₃ contains 0.6 mole of potassium, K.

Learn more: https://brainly.com/question/2264224

A wittig reaction occurs when 4-methylbenzaldehyde and benzyltriphenylphosphonium chloride are stirred together at room temperature in the presence of sodium hydroxide base. Draw the major isomer produced by this reaction.

Answers

Answer:

See explanation

Explanation:

The wittig reaction is an organic reaction in which an aldehyde or a ketone reacts with a phosphonium ylide to give an alkene. This phoshonium ylide that participates in the reaction is usually generated insitu in the system by reaction of an alky or aryl triphenylphosphonium halide salt with a base(sodium hydroxide is mostly used).

In this particular reaction 4-methylbenzaldehyde and benzyltriphenylphosphonium chloride were reacted together in the presence of sodium hydroxide and the product with the structure shown in the answer was obtained as the major isomer produced in the reaction.

Which of the following statements is true? A. Isotopes of the same element have the same number of protons and neutrons. B. Isotopes have the same physical properties as the normal atom but different chemical properties. C. Isotopes have the same chemical properties as the normal atom but different physical properties. D. If an isotope of one element has the same atomic mass as another element, they will have the same properties.

Answers

Answer:

B

Explanation:

Isotopes have the same number of protons but different number of neutrons.

The true statement is,

Isotopes have the same chemical properties as the normal atom but different physical properties.

So, option C is correct one.

What is isotopes?The elements have same number of proton but different number of neutrons.Example: hydrogen, deuterium, tritium

Why isotopes of same elements have different physical properties?

The isotopes have different physical properties like freezing point , mass, melting or boiling point etc because they have different mass number .

learn about isotopes,

https://brainly.com/question/11904263

#SPJ2

A botanist measures a plant growth at 3cm over a two week period. The information she gathers is called.

Answers

Answer:

The correct answer is quantitative data.

Explanation:

The value of data in the form of numbers of counts where each set of data exhibits a specific numerical value associated with it is termed as quantitative data. This information refers to any quantifiable knowledge, which can be used for statistical analysis and mathematical calculations so that decisions of real-life can be taken based on the mathematical outcomes. The quantitative data is used to find the solutions of the queries like how often, how much, or how many.  

In the given case, a botanist measured the growth of the plant for two weeks, and the outcome came in the form of numerical value. Thus, the knowledge she collected is known as quantitative data.  

Increasing temperature can

Answers

A- Change the phase of the matter

Os subníveis mais energéticos de um dado átomo são: ...4s2 3d10 4p5 a) indique o seu número atomico b) quantos electrões de valência apresenta esse átomo c) a que família pertence?

Answers

Answer:

A. 35

B. 7

C. halogênios

Explanation:

Aqui, para responder a essa pergunta, precisaremos conhecer o elemento particular em questão.

..... 4s ^ 2 3d ^ 10 4p ^ 5 significa que está a cinco elétrons da configuração eletrônica do último elemento na primeira camada dos metais pesados.

O último elemento da 1ª série do elemento de transição é o zinco, portanto, como está a apenas 5 elementos de distância, o átomo de que estamos falando é o átomo de Bromo de Bromo.

A. O zinco tem um número atômico 30 e como o bromo está a 5 elementos de distância, seu número atômico é 35

B. Uma vez que pertence ao grupo halogênio, tem 7 elétrons de valência como o resto da família

C. Pertence à família dos halogênios

what’s the answer to this?

Answers

the mass weight of the rock is 6.8g

What is the complete ionic equation for this reaction?
2KOH(aq) + H2SO4(aq) → 2H20(1) + K2SO4(aq)
O A. 2K+ + OH + H2SO4 → OH + 2H+ + K2SO4
B. OH + 2H+ + 2H20()
C. 2KOH + H2SO4 → 2H20 + K2SO4
D. 2K+ + OH + 2H+ + SO42- → 2H20() + 2K+ + SO42-
SUBMIT

Answers

Answer:

The answer is "Option D".

Explanation:

The entire ionic equation for all the substances, which are ionic compounds but are available in an aquatic is represented in the form with ions in the full ionic equation.  

In the Net ionic equation, it doesn't have the particulate matter throughout the net ionic equations throughout the equations.  

In the Spectator ions, it doesn't participate in interactions mostly on reaction and the material hand. From both sides, the very same ions are present.  

The evenly balanced chemical formula is,

[tex]2KOH (aq)+ H_2SO_4(aq) \longrightarrow 2H_2O(l) + K_2SO_4[/tex]

It is the separate organic compound that full ion formula will match the choice D.

Which substance has the highest melting point? Select one: a. sugar b. Oxygen c. Diamond

Answers

Answer:

Diamonds

Explanation:

The melting point of sugar is 186C

The melting point of oxygen is -218C

The melting point of diamonds are 4078C

Therefore diamonds have the highest melting point.

You can also think of their structures, as diamonds have a covalent network structure, meaning they are really strong and have a high melting point

Oxygen has a covalent molecular structure

Sugar has a much weaker covalent network structure

Question 9 of 10
How could an electron configuration be used to predict relative atomic size?
A. The more valence electrons listed, the larger the atomic radius.
B. The larger the highest energy level number, the larger the atomic
radius.
C. The more sublevels occupied, the larger the atomic radius.
D. The greater number of total electrons, the larger the atomic radius.
SUBMIT

Answers

Answer: B

Explanation: Apex

An electron configuration be used to predict relative atomic size because the larger the highest energy level number, the larger the atomic

radius.

The electron configuration of an element shows the arrangement of electrons in atoms of that element.

As more sublevels are added, repulsion between electrons occupying shells increases causing a greater shielding and consequent increase in the size of the atom.

Hence, the larger the highest energy level number, the larger the atomic

radius.

Learn more: https://brainly.com/question/238050

Examine the given reaction. NH4NO3(s) → NH4+(aq) + NO3–(aq) ΔH° = 25.45 kJ/mol ΔS° = 108.7 J/mol·K Which of the given is correct about the ΔG° at 25 °C?
A)+4,360 J
B)−6,942 J
C)−4,360 J
D)+6,942 J

Answers

Answer:

B)−6,942 J /mol

Explanation:

At constant temperature and pressure, you cand define the change in Gibbs free energy, ΔG, as:

ΔG = ΔH - TΔS

Where ΔH is enthalpy, T absolute temperature and ΔS change in entropy.

Replacing (25°C = 273 + 25 = 298K; 25.45kJ/mol = 25450J/mol):

ΔG = ΔH - TΔS

ΔG = 25450J/mol - 298K×108.7J/molK

ΔG = -6942.6J/mol

Right solution is:

B)−6,942 J /mol

BRAINLIEST!!! ❣


How do scientists use ice to study ancient climates?


A. through glacial deposits and ice cores

B. through glacial deposits and ice ages

C. through ice cores and pollen grains

D. through pollen grains and ice ages



Which greenhouse gas is produced by commercial refrigeration and air conditioning systems?


A. carbon dioxide

B. fluorinated gas

C. nitrous oxide

D. methane

Answers

Q1. A.

Q2. Nitrous oxide

Hope this helped ♥︎

Explanation:

the first question's answer is a

the second question's answer is c

which statement is true about this reaction 14/7n + 1/1h ------> 15/8o
A. it is a practical source of energy on earth
B.it occurs only outside the solar system
C.its product is heavier than each of its reactants
D.it shows the critical mass of an element

Answers

Answer: answer is C

Explanation:

Its product is heavier than each of its reactants is true about this ₇N¹⁴ + ₁H¹ →  ₈O¹⁵ reaction

What is Nuclear reaction ?

A nuclear reaction is a reaction in which one or more than one nuclides are generate and it collides between two atomic nuclei or one atomic nucleus.

The reaction is  

₇N¹⁴ + ₁H¹ →  ₈O¹⁵

Now equating the mass number of both sides

14 + 1 = 15 + a

a = 0

Equating atomic number of both sides

7 + 1 = 8 + x

x = 0

Thus, we can say that its product is heavier than each of its reactants is true about this reaction

Hence, option C is correct answer.

Learn more about Nuclear reaction here: https://brainly.com/question/25387647
#SPJ2

why is an element considered a pure substance​

Answers

Answer:

Because they cannot be separated into more then one type of substance.

Explanation:

Answer:

Elements are made of only one kind of atom. The particles can be a single atom or a molecule made of only one kind of atom. There is no physical change that can separate elements into more than one kind of substance. This makes an element a pure substance.An element is made up of only one type of atom. An element cannot be broken down into a simpler form.

Why do.we need inactive ingredients?

Answers

Answer:

Inactive ingredients are components of a drug product that do not increase or affect the therapeutic action of the active ingredient, which is usually the active drug. Inactive ingredients are added during the manufacturing process of pharmaceutical products such as tablets, capsules, suppositories, and injections


3. why are fire tornadoes rare ?


Answers

True fire tornadoes have only been documented now twice. and once in Canberra, Australia during 2003. of this tornado. Then, updraft is simply a rising current of air.

4. The mass of a silver liberty (coin) was measured three times and each measurement was made
to five digits. The mass values were 12.519 9.12.521 g, and 12.496 g. The average mass was
reported as 12.512 g.
Why is the average mass of the gold coin reported to five significant figures, even though you
had to divide by "3" to obtain the average?

Answers

Answer:

The average mass of the gold coin reported to five significant figures, even though you  had to divide by "3" to obtain the average.

Explanation:

Given that,

The mass of a silver liberty was measured three times and each measurement was made  to five digits.

The mass values are,

[tex]m_{1}=12.519\ g[/tex]

[tex]m_{2}=12.521\ g[/tex]

[tex]m_{3}=12.496\ g[/tex]

The average mass of the gold  coin is 12.512 g.

We know that,

Significant figures :

Significant figures is explained the nonzero, leading zero and zeros between two nonzero digits.

For example,

The digits is 0.003405

In the digit, 345 = nonzero

0.00 = leading zero

The average mass of the gold coin reported to five significant figures because average mass is 12,512. All digits are nonzero.

Nonzero digit are significant.

Hence, The average mass of the gold coin reported to five significant figures, even though you  had to divide by "3" to obtain the average.

Please be I need this quick
2. For each pair of atoms determine which can steal an electron easier (higher electronegativity),
draw a picture of Bohr's model, and explain why:

a. Oxygen and Fluorine
b. Sodium and Potassium
c. Boron and Calcium

Answers

Answer: Option (A) is the correct answer.

Explanation:

An atom who has seven valence electrons in its ground state will have the following electronic configuration in its sub shells as 2, 7.

Thus, there will be in total 9 electrons and it is known that fluorine has atomic number 9.

Whereas sodium has 2, 8, 1 electrons in its sub-shell.

Calcium has 2, 8, 8, 2 electrons in its sub-shell and oxygen has 2, 6 electrons in its sub-shell.

Thus, we can conclude that out of the given options, fluorine is the element whose atom in the ground state has seven valence electrons.

All the simple machines make work easier to do by changing the _____ or _____ of a force. A. size; type B. work; type C. size; direction D. type; direction

Answers

Answer:

C. size; direction

Explanation:

By definition, a machine is referred to any device that makes work easier. It takes force to do work, hence, work refers to the application of force over a particular distance. A machine aims at making the work easy by changing how it is done. Simple machines, which include: levers, pulleys, inclined planes etc. all carry out the same thing, which is to make work easier, by changing the size/magnitude and direction of the applied force.

A simple machine tends to change the size of the inputted force by increasing it over a shorter distance. The machine increases the force applied better than it can be done manually e.g. a plier and nutcracker increases/changes the applied force better than it can be done with bare hands.

Also, a simple machine can achieve making work easier by changing the direction at which the force is applied. The machine applies the force on the object in an opposite direction or contrary to the way it was manually applied.

1. The Tyndall Effect is most useful for distinguishing between: *
a solute and a solvent
O a suspension and a solution
a colloid and a suspension
a colloid and a solution

Answers

Answer:

a colloid and a solution

Explanation:

When solute particles completely dissolve in a solvent, a true solution is formed. The solute particles in this case are so little that they can not be seen with naked eyes. A true solution does not scatter rays of light.

In a false solution, the solute particles are larger than the solute particles in true solutions but are not large enough to be seen with naked eyes. False solutions scatter rays of light. False solutions are also called colloids.

The major difference between a solution and a colloid is that colloids scatter light rays (Tyndall effect) while a true solution does not scatter light rays.

In the image above the ruler is measuring in centimeters. The blue cylinder falls somewhere between 2.7cm and 2.8cm according to the ruler. Since we can estimate the last digit I would say that the length of the cylinder is 2.76cm. Since I am estimating any number 2.72cm or 2.78cm could also be correct.

Why would 2.755 not be a correct measurement according to estimating the last digit?

Answers

Answer:

The answer is below

Explanation:

Resolution is the smallest unit of measurement that can be measured by a measuring instrument. Each point on the ruler is 0.1 cm and the difference between any two points, about 0.01 cm cam be measured. The minimum measurement (resolution) that can be measured by the ruler is 0.01 cm (two decimals), therefore it cannot measure up to three decimal places such as numbers like 2.755.

Define physical and chemical properties, provide three examples of each, discuss their reversibility, and explain the fundamental differences between them.

Answers

Answer:

Physical properties are defined as the properties which can be observed without changing its chemical composition.

For example: color, volume, and molecular weight.

Chemical properties are defined as the properties which can be observed only after changing chemical identity of the substance.

For example: reactivity, toxicity, and flammability.

The fundamental differences between physical and chemical properties are as follows:

Chemical properties are related to chemical bonds of the substance while physical properties are not.In chemical properties, chemical identity of substance changes while physical properties do not have any change.Chemical properties predict the reaction of substance while physical properties only describe the appearance of the substance.

Answer:

Chemical properties are related to chemical bonds of the substance while physical properties are not.

In chemical properties, chemical identity of substance changes while physical properties do not have any change.

Chemical properties predict the reaction of substance while physical properties only describe the appearance of the substance.

Explanation:

What is the product of the reaction of pentanoic acid with ethanol in the presence of a strong acid?

Answers

Answer:

ethylpentanoate

Explanation:

Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.

The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;

CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)

The name of the compound formed is ethylpentanoate.

Is iodine a atom,a molecule,an ion or a formule unit?

Answers

Answer:

It's an atom

Explanation:

It can't be a molecule since it's only one element, the ion would've been Iodide (I-), and it's not a formula

For the set of ionic compounds, CaSO4, CaCO3, Ca(OH)2, choose the correct characterization of their solubilities in water from the response list. Group of answer choices None of the three salts are soluble. All three salts are soluble. Two of the three salts are soluble. One of the three salts is soluble.

Answers

Answer:

None of the three salts are soluble.

Explanation:

According to the solubility rule, the carbonates and sulphates of group two elements are insoluble in water.

All three substances mentioned possess very low solubility in water and can be said to be slightly soluble in water. If we compare them with other ionic substances that dissolve readily in water, we can rightly say that they are insoluble in water.

Hence all three substances are insoluble in water.

differences between properties of convalent and ionic bond.​

Answers

Ionic bonds will be a metal + a nonmetal, and electrons

are transferred from the metal to the nonmetal.

A covalent bond will be a nonmetal only. Nonmetals will not give up their electrons so electrons are shared.

I have also written this on the whiteboard in the image provided.

3. How many meters above sea level is the base of your landform?

How many meters above sea level is the top of your platform?

Answers

Answer:

Base is 715 and top is 850.

Explanation:

715 meters above sea level is the base of my landform and 850 meters above sea level is the top of my platform. Base of landform from a sea level is a starting point of a city or region having same topography. This region has a specific height where it spreads we called it top of the platform. The starting point of my location is 715 meters above sea level spreads up to 850 meters of elevation.

Which of the following is not an antioxidant _________
1) Sodium benzoate 2) Sulphur dioxide 3) Sulphite salts 4) Citric acid

Answers

Answer: 1. Sodium Benzoate

Explanation: An anti-oxidant is a substance that can help prevent or stop the damage done by free radicals. Examples include; Sulphur Dioxide, Sulphite Salts, Citric Acid, e.t.c

Sodium benzoate is a pure preservative.

Chemical change example

Answers

Answer: burning paper

Explanation:

The paper burns in air to form smoke and ash. which makes it a chemical change.

how many primary carbon are in 2,3 dimethylpentane​

Answers

Answer:

There are 7 carbons in 2,3 dimethylpentane

Explanation:

Because 2,3-dimethlypentane is an organic compound of carbon and hydrogen with formula C7H16

Other Questions
Answer the following question in 3-4 complete sentences.This is a design by Leonardo da Vinci called, Old Man Contemplating the Flow of Water. What do you see when you lookat this image? Why do you think the artist designed the image the way he did? The Adjacent Coins Problem Published on 2017-08-30 Consider N coins aligned in a row. Each coin is showing either heads or tails. The adjacency of these coins is the number of adjacent pairs of coins with the same side facing up. Write a program that given a non-empty zero-indexed array A consisting of N integers representing the coins, returns the maximum possible adjacency that can be obtained by reversing exactly one coin (that is, one of the coins must be reversed). Consecutive elements of array A represent consecutive coins in the row. Array A contains only 0s and/or 1s: Based on the context clue in the sentence, what is thebest definition of the word fiction?de-O a true storyO a factual storyan invented storyan interesting story Name two planets without satelites 13. The election of which President directly led to the secession of South Carolina and then other Southern states leading to the Civil War?A Thomas JeffersonB Abraham LincolnC Theodore RooseveltD John Quincy Adams Need HelpPlease Show Work Suppose that 200 students are randomly selected from a local college campus to investigate the use of cell phones in classrooms. When asked if they are allowed to use cell phones in at least one of their classes, 40% of students responded yes. Using these results, with 95% confidence, the margin of error is 0.068. How would the margin of error change if the sample size increased from 200 to 400 students? In 1937, a man employed to lay water pipes was found to be the source of a severe epidemic of typhoid fever. The man, an asymptomatic carrier of Salmonella enterica serotype Typhi, the bacterium that causes typhoid, habitually urinated at his job site. In the process, he contaminated the town's water supply with bacteria from his bladder. Over 300 cases of typhoid fever developed, and 43 people died before the man was identified as the carrier.How was this carrier identified?a) nasal swabb) sputum samplec) throat swabd) urine culture What is the degree of the monomial 5x^4? A. Degree 20 B. Degree 5 C. Degree 9 D. Degree 4 Which of the following group behaviors is primarily offensive, rather than defensive? Which of the following is NOT a requirement of testing a claim about two population means when 1 and 2 are unknown and not assumed to be equal? Choose the correct answer below. A. The two samples are dependent. B. Both samples are simple random samples. C. Either the two sample sizes are large (30 and 30) or both samples come from populations having normal distributions, or both of these conditions are satisfied. D. The two samples are independent. How can you assist the ProServices team in serving Pro customers in yourdepartment? Select all that apply.A. Pull orders for Pro customers in advance and have them ready to pick-upB. Call Pro customers to maintain relationships and proactively seek out businessC. Monitor inventory levels to make sure key Pro items are in-stockD. Price match other retailers to give Pro the best priceE. Identify pro customers and introduce them to the ProServices team an electric device is plugged into a 110v wall socket. if the device consumes 500 w of power, what is the resistance of the device Which organelle is labeled I? cell membrane ribosome endoplasmic reticulum nucleus PLEASE HELP ME I DONT HAVE THAT MANY POINTS AND ITS DUE TODAY I NEED HELP ASAP The table contains the data for your first weeks sales. Complete the table by calculating your commission and earnings for each day of the week What is the approximate pressure of a storage cylinder of recovered r-410a that does not contain any non-condensable impurities and is stored in a room where the temperature is 80f? An isolated system consists of two masses. The first, m1, has a mass of 1.90 kg, and is initially traveling to the east with a speed of 6.71 m/s. The second, m2, has a mass of 2.94 kg, and is initially traveling to the west with an unknown initial speed. The two masses collide head-on in a completely inelastic collision that stops them both. Calculate the initial kinetic energy of m2. Financial statement data for the year ending December 31 for Navajo Company follow: Sales $2,550,000 Net income 1,258,000 Fixed assets (net): Beginning of year 800,000 End of year 985,000 The fixed asset turnover ratio for Navajo Company on December 31 would be 2.9. 2.6. 1.4. None of these choices are correct. A test-preparation company advertises that its training program raises SAT scores by an average of at least 30 points. A random sample of test-takers who had completed the training showed a mean increase smaller than 30 points. (a) Write the hypotheses for a left-tailed test of the mean.(b) Explain the consequences of a Type I error in this context. Which of the following statements can be used as evidence that ancient Greek beliefs and art has been influential? Select the three correct answers. A. The Metropolitan Museum of Art in Modern in New York City contains many abstract paintings. B. We read fables as children to learn moral lessons. C. Today sculptors and painters avoid realism in their art. D. The columns of the Lincoln Memorial in Washington D.C. provide balance and harmony. E. Comedies and dramas are popular types of theater on Broadway.Fist one will mark brainlyest