Find the length of the missing side

Answers

Answer 1

Answer:

Step-by-step explanation:

Side=AC=9[tex]\sqrt{2}[/tex]

Side AB= x

Hypotenuse =CB= y

Side AB = 9[tex]\sqrt{2}[/tex]

Hypotenuse CB = 36


Related Questions

prove that 2^n+1>(n+2).sin(n)​

Answers

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

please helpppp i need it by tonight its very important

Answers

Answer:

m<1=145

m<2=35

m<3=35

Step-by-step explanation:

measure one is supplementary(the angles add to 180) to measure four.

so we do 180-35=145

measure 2 is congruent to measure four because they are corresponding angles

so measure 2=35

and measure 3 is also congruent to measure 4 because the are corresponding angles

so m<3=35

The segments shown below could form a triangle.
A
C
7
9
12
B
А
a
A. True
B. False

Answers

Answer:

TRUE

Step-by-step explanation:

I SEEN SOME ONE ELSE WIT 5 STARS SAY SO(:

The given segment can form triangle. Therefore, the given statement is true.

What is triangle?

A polygon has three edges as well as three vertices is called a triangle. It's one of the fundamental geometric shapes. In Euclidean geometry, each and every three points that are not collinear produce a distinct triangle and a distinct plane. In other words, every triangle was contained in a plane, and there is only single plane that encompasses that triangle.

All triangles are enclosed in a single plane if all of geometry is the Euclidean plane, however this is no longer true in higher-dimensional Euclidean spaces. Unless when otherwise specified, this article discusses triangles within Euclidean geometry, namely the Euclidean plane. The given segment can form triangle.

Therefore, the given statement is true.

To know more about triangle, here:

https://brainly.com/question/14712269

#SPJ7

look at the image below

Answers

Answer:

201.1 km²

Step-by-step explanation:

Surface area of a sphere= 4πr², where r = radius

so,

4πr²

= 4×π×4²

= 64π

= 201.1 km² (rounded to the nearest tenth)

Shawn has 4 times as many candies as Jason, who has a third as many candies as
lan. If Shawn has 64 candies, how many candies does Ian have?

Answers

Ian has 48 candies. hope that helps!
Ian has 4 candies...........

Triangle ABL is an isosceles triangle in circle A with a radius of 11, PL = 16, and ∠PAL = 93°. Find the area of the circle enclosed by line PL and arc PL. Show all work and round your answer to two decimal places.

Answers

The area bounded by a chord and arc it intercepts is known as a segment of a circle segment of a circle

The area of the circle enclosed by line PL and arc PL is approximately 37.62 square units

The reason the above value is correct is as follows:

The given parameters in the question are;

The radius of the circle, r = 11

The length of the chord PL = 16

The measure of angle ∠PAL = 93°

Required:

The area of part of the circle enclosed by chord PL and arc PL

Solution:

The shaded area of the given circle is the minor segment of the circle enclosed by line PL and arc PL

The area of a segment of a circle is given by the following formula;

Area of segment = Area of the sector - Area of the triangle

Area of segment = Area of minor sector APL - Area of triangle APL

Area of minor sector APL:

Area of a sector = (θ/360)×π·r²

Where;

r = The radius of the circle

θ = The angle of the sector of the circle

Plugging in the the values of r and θ, we get;

Area of the minor sector APL = (93°/360°) × π × 11² 98.2 square units

Area of Triangle APL:

Area of a triangle = (1/2) × Base length × Height

Therefore;

The area of ΔAPL = (1/2) × 16 × 11 × cos(93°/2) ≈ 60.58 square units

Required shaded area enclosed by line PL and arc PL:

Therefore, the area of shaded segment enclosed by line PL and arc PL is found as follows;

Area of the required segment PL (98.2 - 60.58) square units = 37.62 square units

The area of the circle enclosed by line PL and arc PL ≈ 37.62 square units

Learn more about the finding the area of a segment can be found here:

https://brainly.com/question/22599425

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

The calculation of the area between line segment PL and circle arc PL is described below:

1) Calculation of the area of the circle arc.

2) Calculation of the area of the triangle.

3) Subtracting the area found in 2) from the area found in 1).

Step 1:

The area of a circle arc is determined by the following formula:

[tex]A_{ca} = \frac{\alpha\cdot \pi\cdot r^{2}}{360}[/tex] (1)

Where:

[tex]A_{ca}[/tex] - Area of the circle arc.

[tex]\alpha[/tex] - Arc angle, in sexagesimal degrees.

[tex]r[/tex] - Radius.

If we know that [tex]\alpha = 93^{\circ}[/tex] and [tex]r = 11[/tex], then the area of the circle arc is:

[tex]A_{ca} = \frac{93\cdot \pi\cdot 11^{2}}{360}[/tex]

[tex]A_{ca} \approx 98.201[/tex]

Step 2:

The area of the triangle is determined by Heron's formula:

[tex]A_{t} = \sqrt{s\cdot (s-l)\cdot (s-r)^{2}}[/tex] (2)

[tex]s = \frac{l + 2\cdot r}{2}[/tex]

Where:

[tex]A_{t}[/tex] - Area of the triangle.

[tex]r[/tex] - Radius.

[tex]l[/tex] - Length of the line segment PL.

If we know that [tex]l = 16[/tex] and [tex]r = 11[/tex], then the area of the triangle is:

[tex]s = \frac{16+2\cdot (11)}{2}[/tex]

[tex]s = 19[/tex]

[tex]A_{t} = \sqrt{19\cdot (19-16)\cdot (19-11)^{2}}[/tex]

[tex]A_{t} \approx 60.399[/tex]

Step 3:

And the area between the line segment PL and the circle arc PL is:

[tex]A_{s} = A_{ca}-A_{t}[/tex]

[tex]A_{s} = 98.201 - 60.399[/tex]

[tex]A_{s} = 37.802[/tex]

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

Convert 0.450 to a proper fraction

Answers

Answer:

9/20

Step-by-step explanation:

450/1000

this is not the answer, because it is not simplified

so here we have to find common factor and simplifying

________________________________________________

450/1000 is simplified to 9/20, and it can no longer be simplified.

A car insurance company has determined that6% of all drivers were involved in a car accident last year. If14drivers are randomly selected, what is the probability of getting at most 3 who were involved in a car accidentlast year

Answers

Answer:

[tex]P(x \le 3) = 0.9920[/tex]

Step-by-step explanation:

Given

[tex]p = 6\%[/tex] --- proportion of drivers that had accident

[tex]n = 14[/tex] -- selected drivers

Required

[tex]P(x \le 3)[/tex]

The question is an illustration of binomial probability, and it is calculated using:

[tex]P(x ) = ^nC_x * p^x * (1 - p)^{n-x}[/tex]

So, we have:

[tex]P(x \le 3) = P(x = 0) +P(x = 1) +P(x = 2) +P(x = 3)[/tex]

[tex]P(x=0 ) = ^{14}C_0 * (6\%)^0 * (1 - 6\%)^{14-0} = 0.42052319017[/tex]

[tex]P(x=1 ) = ^{14}C_1 * (6\%)^1 * (1 - 6\%)^{14-1} = 0.37578668057[/tex]

[tex]P(x=2 ) = ^{14}C_2 * (6\%)^2 * (1 - 6\%)^{14-2} = 0.15591149513[/tex]

[tex]P(x=3 ) = ^{14}C_3 * (6\%)^3 * (1 - 6\%)^{14-3} = 0.03980719024[/tex]

So, we have:

[tex]P(x \le 3) = 0.42052319017+0.37578668057+0.15591149513+0.03980719024[/tex]

[tex]P(x \le 3) = 0.99202855611[/tex]

[tex]P(x \le 3) = 0.9920[/tex] -- approximated

Jack’s backpack weighs 15 pounds. Fernando’s backpack weighs less than Jack’s. Which graph shows how much Fernando’s backpack can weigh?

Answers

Answer:

A

Step-by-step explanation:

c and d out of the question

b has its circle filled in meaning it could be 15lbs, which it's not

A correct answer by default

Answer:b

Step-by-step explanation: it has a filled in diamond which mean it's that...

Simplify the following expression

Answers

Answer:

[tex]\frac{98p^{6}}{q}[/tex]

Step-by-step explanation:

Distribute the exponents

[tex](\frac{(7^{-2}p^{-6}q^{-8})}{2q^{-9}} )^{-1}[/tex]

[tex](\frac{q}{98p^{6}} )^{-1}[/tex]

Distribute the -1

[tex]\frac{98p^{6}}{q}[/tex]

Can someone do #4 and #5

Answers

Answer:

First, find two points on the graph:

(x₁, y₁) = (0, 2)(x₂, y₂) = (2, 8)

Slope = [tex]\frac{y_{2}-y_{1} }{x_{2}-x_{1}} = \frac{8-2}{2-0} =\frac{6}{2}=3[/tex]

16 + (-3) = 16 - 3 = 13

According to this diagram, what is tan 62°?
62°
17
18
280
90°
15
O A.
8
17
OB.끝
O c. 1
8
15
D.
15
8
O
E.
17
15
F.
15
17

Answers

Answer:

15/8

Step-by-step explanation:

tan(62)=P/B

tan(62)=15/8

5 A machine puts tar on a road at the rate of 4 metres in 5 minutes.
a) How long does it take to cover 1 km of road
b) How many metres of road does it cover in 8 hours?​

Answers

Answer:

5 a) Total = 20.83 hrs = 20 hrs and 50 mins  (1250mins total)

5 b) Total = 96 meters. = 0.096km in 8 hrs.

Step-by-step explanation:

1km = 1000 meters

5 mins = 4 meters

1000/4 = 250 multiplier

250 x 5mins = 1250 minutes

1250/60 = 20hrs + 50 minutes

50 / 60 =  0.83 = 20.83hrs

b)  8 hrs = 8 x 60 = 480 minutes

480/5 = 24 multiplier of 4 meters

24 x 4 = 96 meters

Which two shapes make up the digital camera below?

Answers

Rectangular prism and cylinder

Rectangular prism and cylinder make up a camera.

What is rectangular prism and cylinder?

A cube is a rectangular prism with all of its sides being the same length, a triangular prism has a triangle as its base, and a rectangular prism has a rectangle as its foundation. Another form of right prism that has a circle as its basis is a cylinder.

A rectangular prism includes a total of 6 faces, 12 sides, and eight vertices. Like a cuboid, it contains three dimensions- the base width, the height, and the length. The top and base of the rectangular prism exist rectangular. The pairs of opposite faces of a rectangular prism exist as identical or congruent.

A cylinder contains traditionally been a three-dimensional solid, one of the most essential curvilinear geometric shapes. Geometrically, it includes been regarded as a prism with a circle as its base.

Hence, Rectangular prism and cylinder make up a camera.

To learn more about rectangular prisms and cylinders refer to:

https://brainly.com/question/15594686

#SPJ2

2(4×+2)=10
[tex]6 \times + 4 = 10 \\ \\ 6 \times = 10 - 4 \\ \\ 6 \times = 6 \\ \\ [/tex]
that is the answer

Answers

Answer:

x = 3/4

Step-by-step explanation:

2(4x + 2) = 10           Remove the brackets

8x + 4 = 10               Subtract 4 from both sides

8x = 6                       Divide by 8

x = 6/8

x = 3/4

Check

2(4*3/4 + 2) =?10

2( 3 + 2) = 10

2*5 = 10

10 = 10

Your parents deposit 2 50-dollar bills at the bank.
How much money did they deposit?

Answers

$100 is what they deposited!!

Answer: $100

Step-by-step explanation:

Considering 50 + 50 = 100

This means that the amount of money is $100

Complete the table for the given rule.
Rule: y is 0.75 greater than x
x y
0
3
9

Answers

The complete table is

x    y

0    0.75

3     3.75

9     9.75

What is equation?

An equation is a mathematical statement that is made up of two expressions connected by an equal sign.

What is substitution?

Substitution means putting numbers in place of letters to calculate the value of an expression or equation.

According to the given question.

We have values of x.

Also, one rule that y is 0.75 greater than x.

So, we have a equation for finding the value of y  i.e.

[tex]y = x + 0.75..(i)[/tex]

For finding the value of y

At x = 0, substitute x = 0 in equation (i)

[tex]y = 0 + 0.75\\\implies y = 0.75[/tex]

At x = 3, substitute x = 3 in equation (i)

[tex]y = 3+0.75\\\implies y = 3.75[/tex]

At x = 9, substitute x = 9 in equation (i)

[tex]y = 9+0.75\\\implies y = 9.75[/tex]

Hence, the complete table is

x    y

0    0.75

3     3.75

9     9.75

Find out more information about equation and substitution here:

https://brainly.com/question/10852714

#SPJ2

HELPPPPP ASP PLZZZZZ

Answers

Answer:

[tex](f-g)(x)[/tex]

[tex]f(x)-g(x)[/tex]

[tex]x^{2} -6x-27-x+9[/tex]

[tex]x^{2} -7x-18[/tex]

----------------------

[tex](f*g)(x)[/tex]

[tex]=f(x)g(x)[/tex]

[tex](x^{2} -6x-27)(x-9)[/tex]

[tex]=x^{3} -15x^{2}+27x+243[/tex]

----------------------

[tex]\frac{f}{g} (x)[/tex]

[tex]\frac{x^{2} -6x-27}{x-9}[/tex]

[tex]\frac{(x-9)(x+3)}{x-9}[/tex]

[tex]x+3[/tex]

-----------------------

[tex](f+g)(x)[/tex]

[tex]f(x)+g(x)[/tex]

[tex]=x^{2} -6x-27+x-9[/tex]

[tex]=x^{2} -5x-36[/tex]

------------------------

OAmalOHopeO

------------------------

Im new to this app!
And im looking for help!!
Please help ASAP!!!
Please!!!!

Answers

y=x²-10x-7

a>0 so we will be looking for minimum

x=-b/2a=10/2=5

y=25-50-7=-32

Answer: (5;32)

look at the image for the question

Answers

It’s 16
You would multiply height (4) by the base (length(2) x width(2)=4) which is 16

Paul can install a 300-square-foot hardwood floor in 18 hours. Matt can install the same floor in 22 hours. How long would it take Paul and Matt to install the floor working together?
4 hours
9.9 hours
13.2 hours
30 hours

Answers

Answer:

9.9 hours

Step-by-step explanation:

The formula to determine the time together is

1/a+1/b = 1/c  where a and b are the times alone and c is the time together

1/18 + 1/22 = 1/c

The least common multiply of the denominators is 198c

198c(1/18 + 1/22 = 1/c)

11c+ 9c = 198

20c = 198

Divide by 20

20c/20 =198/20

c =9.9

Answer:

B - 9.9 hrs

Step-by-step explanation:

took the test.

find the missing side of the triangle

Answers

Answer:

x = 34

Step-by-step explanation:

Pytago:

x[tex]30^{2} + 16^{2} = x^2\\x = \sqrt{30^2 + 16^2} \\x = 34[/tex]

Find an equation of the plane orthogonal to the line
(x,y,z)=(0,9,6)+t(7,−7,−6)

which passes through the point (9, 6, 0).

Give your answer in the form ax+by+cz=d (with a=7).

Answers

The given line is orthogonal to the plane you want to find, so the tangent vector of this line can be used as the normal vector for the plane.

The tangent vector for the line is

d/dt (⟨0, 9, 6⟩ + ⟨7, -7, -6⟩t ) = ⟨7, -7, -6⟩

Then the plane that passes through the origin with this as its normal vector has equation

x, y, z⟩ • ⟨7, -7, -6⟩ = 0

We want the plane to pass through the point (9, 6, 0), so we just translate every vector pointing to the plane itself by adding ⟨9, 6, 0⟩,

(⟨x, y, z⟩ - ⟨9, 6, 0⟩) • ⟨7, -7, -6⟩ = 0

Simplifying this expression and writing it standard form gives

x - 9, y - 6, z⟩ • ⟨7, -7, -6⟩ = 0

7 (x - 9) - 7 (y - 6) - 6z = 0

7x - 63 - 7y + 42 - 6z = 0

7x - 7y - 6z = 21

so that

a = 7, b = -7, c = -6, and d = 21

An equation of the plane orthogonal to the line 7x - 7y - 6z = 21.

The given line is orthogonal to the plane you want to find,

So the tangent vector of this line can be used as

The normal vector for the plane.

The tangent vector for the line is,

What is the tangent vector?

A tangent vector is a vector that is tangent to a curve or surface at a given point.

d/dt (⟨0, 9, 6⟩ + ⟨7, -7, -6⟩t ) = ⟨7, -7, -6⟩

Then the plane that passes through the origin with this as its normal vector has the equation

⟨x, y, z⟩ • ⟨7, -7, -6⟩ = 0

We want the plane to pass through the point (9, 6, 0), so we just

translate every vector pointing to the plane itself by adding ⟨9, 6, 0⟩,

(⟨x, y, z⟩ - ⟨9, 6, 0⟩) • ⟨7, -7, -6⟩ = 0

Simplifying this expression and writing it in standard form gives

⟨x - 9, y - 6, z⟩ • ⟨7, -7, -6⟩ = 0

7 (x - 9) - 7 (y - 6) - 6z = 0

7x - 63 - 7y + 42 - 6z = 0

7x - 7y - 6z = 21

So that, a = 7, b = -7, c = -6, and d = 21.

To learn more about the equation of plane visit:

https://brainly.com/question/1603217

State if the scenario involves a permutation or a combination. Then find the number of possibilities.

A team of 15 basketball players needs to choose two players to refill the water cooler.

Permutation/Combination:

Answer:

Answers

Answer:

Permutation ; 210 ways

Step-by-step explanation:

Permutation and combination methods refers to mathematical solution to finding the number of ways of making selection for a group of objects.

Usually, selection process whereby the order of selection does not matter are being treated using permutation, while those which takes the order of selection into cognizance are calculated using combination.

Here, selecting 2 players from 15 ; since order does not matter, we use permutation ;

Recall :

nPr = n! ÷ (n - r)!

Hence,

15P2 = 15! ÷ (15 - 2)!

15P2 = 15! ÷ 13!

15P2 = (15 * 14) = 210 ways

Reason Can you subtract a positive integer from a positive integer
and get a negive result? Explain your answer.

Answers

Answer:

No

Step-by-step explanation:

No matter the situation, when you multiply a negative by a negativeyou get a positive and a positive by a positive you get a positive. but if its two different like a negative and a positive then its NEGITIVE.

let's say you have 23 and you're multiplying by 2.

It's always increasing so it doesnt ever reach the negitive numbers.

Find the length of the arc.

A. 539π/12 km
B. 9π/3 km
C. 9π/2 km
D. 18π km

Answers

Answer:

b because it is I found out cus I took test

The length of the arc 9π/2 km.

The answer is option C.9π/2 km.

What is the arc of the circle?

The arc period of a circle can be calculated with the radius and relevant perspective using the arc period method.

  ⇒angle= arc/radius

     ⇒  135°=arc/6km

     ⇒ arc =135°*6km

     ⇒arc=135°*π/180° * 6km

    ⇒arc = 9π/2 km

Learn more about circle here:-https://brainly.com/question/24375372

#SPJ2

Find the slope of the line that goes through the
(2,6) and (-1, -6)

Answers

We can use the formula y2-y1/x2-x1 to get our slope. y2 and x2 are our second y and x coordinates, meanwhile y1 and x1 are our first y and x coordinates. -6-6/-1 -2 is -12/-3. -12/-3 is 4, the slope is 4.
the slope is 1/4 because you use the slope intercept formula

please solve the question ​

Answers

Answer:

[tex]g(-1) = -1[/tex]

[tex]g(0.75) = 0[/tex]

[tex]g(1)= 1[/tex]

Step-by-step explanation:

Given

See attachment

Solving (a): g(-1)

We make use of:

[tex]g(x) = -1[/tex]

Because: [tex]-1 \le x < 0[/tex] is true for x =-1

Hence:

[tex]g(-1) = -1[/tex]

Solving (b): g(0.75)

We make use of:

[tex]g(x) = 0[/tex]

Because: [tex]0 \le x < 1[/tex] is true for x =0.75

Hence:

[tex]g(0.75) = 0[/tex]

Solving (b): g(1)

We make use of:

[tex]g(x) = 1[/tex]

Because: [tex]1 \le x < 2[/tex] is true for x =1

Hence:

[tex]g(1)= 1[/tex]

Solve for x: 10/3 = x/(−5/2)

Answers

9514 1404 393

Answer:

  x = -25/3

Step-by-step explanation:

Multiply by the inverse of the coefficient of x. Reduce the fraction.

  (-5/2)(10/3) = (-5/2)(x/(-5/2))

  -50/6 = x = -25/3

Answer:

-25/3

Step-by-step explanation:

the other person is also correct. khan said so

Which ratio is equal to 27 : 81?

Answers

3:9 and if you reduce it again, 1:3

Answer:

1:3

Step-by-step explanation:

27 : 81

Divide each side by 27

27/27 : 81/27

1:3

Other Questions
which of the following are human activities that can negatively impact ecosystems. Pls help .ZZZZZZZZA 2. . Complete the following past simple and continuous events. Choose the correct alternative (10 points)1. Sylvia _____________ when she ___________ the DVDs.a) was running / droppedb) ran / droppedc) was running / was droppingd) ran / was dropping 2. While Steve ___________ a documentary, he __________ asleep.a) was watched / fellb) was watching / fellc) watched / was fallingd) was watching / felt3. They _________ when you _________ for remote control.a) aren't listening / were askingb) weren't listening / were askingc) weren't listening / askedd) listened / asked How many meters are in 10 miles? use the formula v=u+at to find the velocity when the initial velocity is 3m/s2 the time is 7 seconds 1.2 m1.2 mSusie is 1.13 metres tallShe has a play tent in the shape of a triangular prism.The diagram shows the front view of the tent.The front of the tent has been drawn to scale below.a) Complete the scale drawing.1.5mNot drawn accuratelyb) Can Susie stand up in themiddle of the tent?1.5mScale: 1 cm represents 60 cm J00Sugar(C2H2011)260KNO220180Solubility (g solute per 100 g H,0)140NaNO,NaBr100KBr60Naci200020Ce (50)40 60Temperature (C)80100Which compound would make a saturated solution if 98 grams weredissolved in 100 grams of solution at 80 degrees Celsius?O KBrO SugarOKCIO NaClalish Which of the following is not a purpose of a nonfiction text?A. Entertain by satirizing a political candidateB. Inform a consumer about the nutrition of a productC. Create a fantasy worldD. Persuade someone to change their opinion about school uniforms A 2.0 kg puck is at rest on a level table. It is pushed straight north with a constant force of 5N for 1.50 s and then let go. How far does the puck move from rest in 2.25 s? 4. Join the pairs of sentences with the connectives given in the bracket:a. I like dancing. My father doesn't like dancing. (but) ji and jl are opposite rays Select All the correct answersSelect all the statements that are true for the following systems of equations.System A2x-3y=44x.y = 18System B3x - 4y 5y = 5x + 3System C2x-3y - 412x-3y 541. All three systems have different solutions.2. Systems A and B have different solutions3. Systems A and C have the same solution4. Systems B and C have the same solution5. System C simplifies to 2x - 3y = 4 and 4x - y = 18 by dividing the second equation by three What is the molecular geometry of a molecule made of two atoms that share one pair of electrons and have no lone electrons pairs?trigonal pyramidallineartrigonal planarbent Which statement best describes the trait of being tactful?A- Ability to be humble in every situationB- Ability to remain stress freeC- Ability to deal with others, especially in difficult situations D- Ability to comply with given instructions (Wrong answer)E- Ability to arrive at work on time What was the primary focus of the no child left behind act simplify the following without using calculator 50 + 98 __________Are the subunits making up nucleic acids Three important nutritional additions to training for a long distance race areO ProteinO WaterO Increase caloriesO All of the answer choices What process must happen for clouds to form? Mrs. Helton is making gift bags as prizes for her math classes. She has 30 little bags of Hershey Kisses and 15 Blow Pops. What is the greatest number of gift bags she can make if all gift bags are the same, and she does not want any left over?