HELP ASAP!!!!! Which statement is not always true for a parallelogram?

HELP ASAP!!!!! Which Statement Is Not Always True For A Parallelogram?

Answers

Answer 1

Answer:

D

Step-by-step explanation:

The consecutive angles in a parallelogram are supplementary.

Thus statement D is not always true.


Related Questions

Find the y-intercept of the following equation. Simplify your answer.
y = -10x -3/7

Answers

Answer: (0, -3/7)

Step-by-step explanation:

The Y-intercept would be the value of y when x is at 0, which is when the Y axis is intercepted. -3/7 is the starting position of the function when the the X = 0.

TRIGONOMETRY
Could someone please help me with 5.2 please...it would really help alot:)​

Answers

sin(x+y) - sin(x-y) - 1 = cos(2x)

sin(90) - sin(x-y) - 1 = cos(2x)

1 - sin(x-(90-x)) - 1 = cos(2x)

-sin(2x-90) = cos(2x)

-1*(sin(2x)cos(90) - cos(2x)sin(90)) = cos(2x)

-1*(sin(2x)*0 - cos(2x)*1) = cos(2x)

-1*(0 - cos(2x)) = cos(2x)

-1*(-cos(2x)) = cos(2x)

cos(2x) = cos(2x)

This confirms the identity is true.

Notice that throughout this proof, I only changed the left hand side.

On the 5th line, I used the identity sin(A-B) = sin(A)cos(B)-cos(A)sin(B).

Find the center and foci of the ellipse: 9x2 + 16y² + 126x + 96y + 441 = 0

Answers

Center : ( –7 , –3 )Focus 1: (–7 + √7 , –3 )Focus 2: ( –7 –√7 , –3 )

[tex] \frac{(x + 7)^{2} }{16} + \frac{(y + 3) ^{2} }{9} = 1 \\ \frac{(x - h)^{2} }{ {a}^{2} } + \frac{(y - k)^{2} }{ {b}^{2} } = 1[/tex]

a= 4 , b= 3 , k = – 3 , h = –7

The center: ( h , k ) —> ( –7 , –3 )

[tex]c = \sqrt{ {a}^{2} - {b}^{2} } = \sqrt{ {4}^{2} - {3}^{2} } \\ = \sqrt{16 - 9} = \sqrt{7} [/tex]C = √7

Focus 1: ( h + c , k ) —> ( –7 + √ 7 , –3 )

Focus 2: ( h – c , k ) —> ( –7 –√7 , –3 )

I hope I helped you^_^

The function (1) describes the height, in feet, of an object at time, in seconds, when it is launched upward from the ground at an initial speed of 112 feet per second.

a. Find the domain.
b. What does the domain mean in this context?

Answers

Answer:

see below

Step-by-step explanation:

The domain is the values that the input takes

The values go from 0 to 7

0≤x≤7

This is the time from the initial launch until the object hits the ground

Need help on this activity!!

In this activity, you will rearrange and solve a rational equation and find and use the inverse of a rational equation.

As we’ve seen, for a circuit with two resistors arranged in parallel, we can calculate the total resistance in the circuit, , in ohms, with this equation.

Question 1
Part A
Question
Rewrite the equation to represent the resistance of resistor 2, , in terms of and .

Answers

Answer:

My best guess rn is the first option

Step-by-step explanation:

the last dude had it close but it was basically flipped as you can tell.

The answer is (C) [tex]R_2=\frac{R_TR_1}{(R_1-R_T)}[/tex]

We need to make [tex]R_2[/tex] the subject of the formula [tex]R_T=\frac{R_1R_2}{R_1+R_2}[/tex]

First remove the denominator by multiplying both sides by the binomial [tex](R_1+R_2)[/tex]

[tex]R_T\times (R_1+R_2)=\frac{R_1R_2}{R_1+R_2}\times(R_1+R_2)\\\\R_TR_1+R_TR_2=R_1R_2[/tex]

Arrange all terms containing [tex]R_2[/tex] on one side

[tex]R_1R_2-R_TR_2=R_TR_1[/tex]

Factor out [tex]R_2[/tex] from the LHS

[tex]R_2(R_1-R_T)=R_TR_1[/tex]

Finally, divide both sides by the binomial [tex](R_1-R_T)[/tex] to leave [tex]R_2[/tex]

[tex]R_2(R_1-R_T)\times\frac{1}{(R_1-R_T)}=R_TR_1\times\frac{1}{(R_1-R_T)}\\\\R_2=\frac{R_TR_1}{(R_1-R_T)}[/tex]

Learn more about change of subject of formula here: https://brainly.com/question/343660

Rewrite
4/10 : 1/25 as a unit rate.

A: 10:1
B: 25:4
C: 2:125
D: 100:1

Answers

Answer:

4/10 : 1/25

4/10 / 1/25 = 4/10 x 25/1 = 100/10 = 10.

10 can also be written as 10:1, so A is correct.

Hope this helps!

If BC = 5, DE = 9, and AB = 4, what is the length of AD?


7
8
7.2
7.5

Answers

There are two triangles here: ABC and ADF. These triangles are similar, and thus proportional. So, we can set up a proportion between the left side of each triangle and the base of each triangle.

AB / AD = BC / DE

4 / (4 + BD) = 5 / 9

---AD is made up of AB and DB. We know AB, but not BD, so we need to find its value to find the length of AD.

5(4 + BD) = 9 x 4

20 + 5BD = 36

5BD = 16

BD = 3.2

AD = AB + BD

AD = 4 + 3.2

AD = 7.2

Hope this helps!

(x-4)°=1
giải hộ em với ạ

Answers

Answer: 5

Step-by-step explanation:

⇒ (x - 4) = 1

⇒ x = 1 + 4

⇒ x = 5

Therefore value of x = 5

Answered by Gauthmath must click thanks and mark brainliest

x = 3

x = 5

x = 0

x = 2

Answers

Answer:

x=2 is incorrect

Step-by-step explanation:

Y(2)=(3/4)*x^2=(3/4)*4=3

The velocity of a particle moving along a straight line is given by v(t)=6t2+4t−5 cm/sec at time t seconds with initial position s(0)=3 cm. What is the position of the particle at t=2 seconds, in cm?

Answers

Answer:

s(2) = 17 cm

Step-by-step explanation:

We are told that the velocity function is;

v(t) = 6t² + 4t − 5 cm/sec

Integral of velocity gives distance.

Thus;

s(t) = ∫v(t) = ∫6t² + 4t − 5

s(t) = 2t³ + 2t² - 5t + c

We are told that s(0)=3 cm

Thus;

s(0) = 2(0)³ + 2(0)² - 5(0) + c = 3

Thus; c = 3

Thus;

s(t) = 2t³ + 2t² - 5t + 3

At t = 2 secs

s(2) = 2(2)³ + 2(2)² - 5(2) + 3

s(2) = 17 cm

Rewrite the expression in the form z^n.
z^3/4 x z^2

Answers

Step-by-step explanation:

here's the answer to your question

What is the solution for z?
24=z/0.6?

Answers

Answer:

[tex]z=14.4[/tex]

Step-by-step explanation:

One is given the following equation:

[tex]24=\frac{z}{0.6}[/tex]

Use inverse operations to solve this equation. Multiply both sides of the equation by (0.6) to undo the division of (0.6).

[tex]24=\frac{z}{0.6}[/tex]

[tex](0.6)(24)=z[/tex]

Simplify,

[tex](0.6)(24)=z[/tex]

[tex]z=14.4[/tex]

Find the nth term of each of the sequences.
(a) 16, 19, 22, 25, 28, ...
(b) 1,3,9,27,81,...

Answers

Answer:

a) 16, 19, 22, 25, 28, 31, 34, 37, 40

b) 1, 3, 9, 27, 81, 243, 729, 2187

Explanation:

a) Add 3 on every number.

b) Multiply every number by 3.

What's 672 divided by 32

Answers

Answer:

the answer is 21

Step-by-step explanation:

x3 + (y +z) factorize​

Answers

I think you wrote the question wrong this question is not factorable

In right triangle ABC, AB = 3 and AC = 9. What is the measure of angle B to the nearest degree?

Answers

Answer:

90 degrees

Step-by-step explanation:

see image

make x A

y B

z C

AB=3 (given)

AC=9 (given)

measure of angel B or y, is 90

if

x= A

y= C

z= B

then the hypotenuse would be shorter than one of the legs

3<9

so B has to be the right angle (90 degrees)

Can I please get help with these 2 questions about polygons

Answers

Answer:

a)139°

Step-by-step explanation:

two co interior angles make one opposite exterior angle

49+90=139°

2 + 16 + 48 factorizar
alguien que me ayude??

Answers

Answer:

2*6*11

Step-by-step explanation:

I am not sure what your question is because I think you are asking the factor of these numbers. so u do 2+16+48 which is 66 and if you prime factorize it then you get 2*6*11. so the answer is 2*6*11.

12. PLEASE HELP ME
Which of the following are the coordinates of the vertex of y= x2 - 10x + 2?

A. (–10, 2)

B. (2, –10)

C. (–5, 23)

D. (5, –23)

Answers

Answer:

I think b no. is the correct answer

Answer:

D. (5, –23)

Step-by-step explanation:

The vertex is in essence the turning point of the parabola y = x² − 10x + 2

the x coordinate of the turning point =  

                                                        =  

                                                        =  5

when x = 5, y = (5)² - 10(5) + 2

                     = -23

Thus coordinate or vertex is ( 5, -23)

5 right 23 down

Find the equation of a line perpendicular to 8x - 2y = 4 and passes through the point (4, 3).

Answers

y = -2x-3

Lines that are perpendicular have slopes that are negative reciprocals of each other. Meaning, if a line has slope  , then a line perpendicular to this has slope . That means the slope of our perpendicular line is

The equation of the line that is perpendicular to 8x - 2y = 4 and passes through the point (4, 3) is y = (-1/4)x + 4.

To find the equation of a line that is perpendicular to the line 8x - 2y = 4 and passes through the point (4, 3), we can use the fact that the slopes of perpendicular lines are negative reciprocals of each other.

First, let's rewrite the given equation in slope-intercept form (y = mx + b), where m represents the slope:

8x - 2y = 4

-2y = -8x + 4

Divide both sides by -2:

y = 4x - 2

The slope of the given line is 4.

The slope of a line perpendicular to this line would be the negative reciprocal of 4, which is -1/4.

Now, we have the slope (-1/4) and a point (4, 3). We can use the point-slope form of a linear equation:

y - y₁ = m(x - x₁)

Substituting the values, we have:

y - 3 = (-1/4)(x - 4)

Expanding and simplifying, we get:

y - 3 = (-1/4)x + 1

Adding 3 to both sides, we have:

y = (-1/4)x + 4

To learn more about equation click on,

https://brainly.com/question/20712656

#SPJ2

ntroduction to Functions
Assignment Active
Creating a Function from a Mapping
The mapping shows a relationship between input and
output values.
Input
Output
Which ordered pair could be removed to make this
relation a function?
O (-5,0)
0 (-1, -3)
O (4, -2)
O (6,-1)

Answers

Answer:

To be a function, each input must only have one output. In this case, input 4 has two outputs, so (4 , -2) can be removed for it to be a function.

Let me know if you have any other questions!

The ordered pair (4,2) could be removed to make the given relation a function.

What is the relation?

A relation is a function if for every input (x-value) there is exactly one output (y-value).

If there are two or more ordered pairs with the same x-value but different y-values, then the relation is not a function. In this case, one of those ordered pairs would need to be removed in order to make it a function.

As per the question, the relation was given as {(-5,0), (2, -3), (-1, -3), (4, -2), (4, -2), (6,-1)}, the ordered pair (4,-2) would need to be removed because there are two outputs (-2 and 2) for the input of 4.

Thus, removing (4,2) would result in the function.

Learn more about the relations here:

https://brainly.com/question/29207494

#SPJ7


What value of x is in the solution set of -2(3x + 2) >-8x + 6

Answers

Answer:

x >5

Step-by-step explanation:

-2(3x + 2) >-8x + 6

Distribute

-6x-4 > -8x+6

Add 8x to each side

-6x-4+8x > -8x+8x+6

2x-4 > 6

Add 4 to each side

2x-4+4 > 6+4

2x> 10

Divide by 2

2x/2 >10/2

x >5

Step-by-step:

-2(3x+2)>-8x+6. divided by 2,-3x-2>-4x+3. the solution set of -2(3x+3)>-8x+6 is {x/x>5}

Answer:

6

Monica took a survey of her classmates' hair and eye color. The results are in the table below.

Answers

0.14 would be correct

What is the range of the given data set? OA) 30 OB) 32 OC) 37 OD) 40​

Answers

Answer:

Range = maximum number - minimum number

maximum number = 99minimum number = 62

Range = 99 - 62 = 37

Answer:

37

Step-by-step explanation:

The range is the difference between the highest number and the smallest number.

Looking at the stem and leaf plot we can identify the largest and smallest number

Largest number: 99

Smallest number: 62

If range = largest number - smallest number then range = 99 - 62 = 37

Please help me solve this short problem guys

Answers

Answer:

Step-by-step explanation:

Given equation of the quadratic function is,

y = x² + 5x - 7

Convert this equation into vertex form,

y = x² + 2(2.5x) - 7

  = x² + 2(2.5x) + (2.5)² - (2.5)² - 7

  = (x + 2.5)²- 6.25 - 7

  = (x + 2.5)² - 13.25

Therefore, vertex of the function is (-2.5, -13.25)

For the solutions,

y = 0

(x + 2.5)² - 13.25 = 0

x = (±√13.25) - 2.5

x = (±3.64) - 2.5

x = 1.14, -6.14

Solutions → (-6.14, 0) and (1.14, 0)

Nghiệm của bất phương trình | 2x - 3| - 1 <0

Answers

Answer:

x = 1 và 2       x= 1 and 2

Step-by-step explanation:

Đầu tiên trừ đi 1 để được 2x-3 nhỏ hơn -1 sau đó bạn lập phương trình bằng 2x-3 = -1 và 2x-3 = 1 để nhận được kết quả cuối cùng là 1 và 2 do đó x = 1 và 2

First subtract 1 to get 2x-3 is less then -1 then you let the equation equal 2x-3=-1 and 2x-3=1 to get a final answer of 1 and 2 therefore x=1 and 2

In an experiment, a student is to flip a quarter 10 times and record the number of times heads appears. A group of students performs the experiment 21 times, with these results.

6 4 5 6 5 6 4 6 2 4 3 4 5 7 5 8 7 5 3 5 5

Construct a dotplot with these data and then identify the dotplot you created.

Answers

Answer:

The average, mode, and median of the results are 5, meaning that half of the time the quarter will land on heads.

Step-by-step explanation:

The required dot plot shows the result of the experiment performed by flipping a quarter 21 times.


In an experiment, a student is to flip a quarter 10 times and record the number of times heads appears. A group of students performs the experiment 21 times, with these results. 6 4 5 6 5 6 4 6 2 4 3 4 5 7 5 8 7 5 3 5 5.


What is arithmetic?

In mathematics, it deals with numbers of operations according to the statements. There are four major arithmetic operators, addition, subtraction, multiplication, and division,

What is Statistic?

Statistics is the study of mathematics that deals with relations between comprehensive data.

Here,
The dot plot has been made, for the number of outcomes and their frequencies. The dot plot gives the info about the mean mode and median.

Thus, the required a dot plot showing the result of the experiment performed by flipping a quarter 21 times.

Learn more about arithmetic here:

brainly.com/question/14753192

#SPJ2

Find the 13th term of the arithmetic sequence -3x – 1,42 + 4,112 + 9, ...

Answers

Answer:

The 13th term is 81x + 59.

Step-by-step explanation:

We are given the arithmetic sequence:

[tex]\displaystle -3x -1, \, 4x +4, \, 11x + 9 \dots[/tex]

And we want to find the 13th term.

Recall that for an arithmetic sequence, each subsequent term only differ by a common difference d. In other words:

[tex]\displaystyle \underbrace{-3x - 1}_{x_1} + d = \underbrace{4x + 4} _ {x_2}[/tex]

Find the common difference by subtracting the first term from the second:

[tex]d = (4x+4) - (-3x - 1)[/tex]

Distribute:

[tex]d = (4x + 4) + (3x + 1)[/tex]

Combine like terms. Hence:

[tex]d = 7x + 5[/tex]

The common difference is (7x + 5).

To find the 13th term, we can write a direct formula. The direct formula for an arithmetic sequence has the form:

[tex]\displaystyle x_n = a + d(n-1)[/tex]

Where a is the initial term and d is the common difference.

The initial term is (-3x - 1) and the common difference is (7x + 5). Hence:

[tex]\displaystyle x_n = (-3x - 1) + (7x+5)(n-1)[/tex]

To find the 13th term, let n = 13. Hence:

[tex]\displaystyle x_{13} = (-3x - 1) + (7x + 5)((13)-1)[/tex]

Simplify:

[tex]\displaystyle \begin{aligned}x_{13} &= (-3x-1) + (7x+5)(12) \\ &= (-3x - 1) +(84x + 60) \\ &= 81x + 59 \end{aligned}[/tex]

The 13th term is 81x + 59.

Expand the following
(x+2x)(2s-2t)
(m-n)²
(k+9)²
(4a-3b)(c+6d)​

Answers

please check the attachment for solutions

Geometry, please answer question ASAP

Answers

Answer:

Triangle ACB =~ triangle DFE, by adding 6 units to each side of both triangles their relationship will not change. They are still similar.

Step-by-step explanation:

The answer isn't great in all honesty but it's been a long time since I took geometry and I don't 100% remember the proper way of stating it. Though I am 100% sure they stay similar.

Sorry couldn't be of more help but figured something was better then nothing

Other Questions
Aaron, Blaine, and Cruz are solving the equation 4 7 (7 n) = 1. Aaron started his solution by multiplying both sides of the equation by 7 4 . Blaine started by using the distributive property to multiply 4 7 by both 7 and n. Cruz started by dividing both sides of the equation by 4 7 . Why did the Native American's observe the stars? What is the mean of the following list of extra credit points earned on a statistics test?10,8,18,17,7 List 4 Black American theatre makers (discussed in lecture) and briefly describe some of their significant contributions to contemporary theatre find the missing side length in the image below which primitive organic molecule was essential to form lipid bilayer? Researchers studied symptom distress and palliative care designation among a sample of 710 hospitalized patients. Controlling for age, they used a t-test to compare average distress from nausea scores in men and women. Lower scores indicated less distress from nausea. They report men had an average score of 1.02 and woman had an average score of 1.79. Which statement is correct?(2pts)Select Men had significantly less distress from nausea. as your answerMen had significantly less distress from nausea.Select Men had half as much distress from nausea as woman but we can not determine if this is a significant difference. as your answerMen had half as much distress from nausea as woman but we can not determine if this is a significant difference.Select Men had less distress from nausea on average than women but we can not determine if this is a significant difference. as your answerMen had less distress from nausea on average than women but we can not determine if this is a significant difference.Select There is a positive correlation between distress from nausea and gender. as your answerThere is a positive correlation between distress from nausea and gender. 1. alveoli, tiny air sacs within the lungs muscle below the lungs used for, 2. bronchi, breathing the two tubes into which the, 3. diaphragm, trachea divides before entering the lung HELP!!!!!!!!!!!!!!!!!!!!!!!!!! What is the median of 12, 9 , 16, 1, 6 , 5, 84 -3x^5y^7/6xy^8PLEASE HELP laws of thermodynamics Cho bit tan ca NH4Cl trong nc 20oC v 70oC ln lt l 37,2 g/100 gam nc v 60,2 gam/100 g nc. Ha tan 166,8 gam NH4Cl vo 400 gam nc 70oC thu c dung dch X. Sau , h nhit dung dch X xung 20oC. Tnh khi lng (gam) NH4Cl kt tinh li trong X? Please help with the Volume one Which of the following functions best describes this graph? y=(x+2)(x+7) There are two main methods of child study used todaythe ______________ and the __________ methods. Read the following paragraph and answer the question: "Beth lay in bed unable to fall asleep. Hereyes darted around the dark room. The wind roared causing the tree branch to scrape her windowwith an ear piercing scream. Suddenly she heard something coming up the steps. Thump, thump,thump, it was getting closer. She tightly squeezed her eyes shut as the door slowly creaked open.Which sentence gives an example of personification?A. Her eyes darted around the dark room.B. The wind roared causing the tree branch to scrape her window with an ear piercing scream.C. She tightly squeezed her eyes shut as the door slowly creaked open.D. Thump, thump, thump, it was getting closer. What does the underlined word mean in the following sentence?Salgo de la heladera muy satisfecha.ice cream parlorsupermarkettoy storeflower shop what would the equation, slope, and point be for this graph? In this diagram,which equation could prove to be true in order to conclude that the lines are parallel?