Hey I'm new can some talk

Answers

Answer 1

Answer:

Heyyy, What's going on??

Step-by-step explanation:

lol


Related Questions

The table shows the mass of a substance decreasing over a period of time during a chemical experiment.
Identify a quadratic model for the mass M, given the time t. Then use the model to predict the mass at t = 11
seconds
Time (s) Mass (g)
2
94.8
5
87.9
8
81.3
B
O M(x) = -0.02x2 - 2.42x + 99.57
M(11) - 75 g
O M(x) = 0.02x2 - 2.42x + 99.57
M(11) - 1299
O M(x) = -0.02x2 - 2.42X + 99.57
M(11) = 129 g
O M(x) = 0.02x2 - 2.42x + 99.57
M(11) = 75 g

Answers

So from a table, we want to find an equation that models the mass as a function of time, we will get the equation:

M(t) = 0.02*t^2 - 2.42*t + 99.57

And with that equation, we will find that the mass after 11 seconds is 75 grams.

From the table we have the points:

(2, 94.8)

(5, 87.9)

(8, 81.3)

And we know that this follows a quadratic model, then we have:

M(t) = a*t^2 + b*t + c

Notice that from the known points, we have 3 equations:

94.8 = a*2^2 + b*2 + c

87.9 = a*5^2 + b*5 + c

81.3 = a*8^2 + b*8 + c

So we have a system of equations, we can simplify the equations to get:

94.8 = a*4 + b*2 + c

87.9 = a*25 + b*5 + c

81.3 = a*64 + b*8 + c

To solve this, we start by isolating one of the variables in one of the equations, let's isolate c in the first one.

c = 94.8 - a*4 - b*2

now we replace this in the other two equations to get:

87.9 = a*25 + b*5 + (94.8 - a*4 - b*2)

81.3 = a*64 + b*8 + ( 94.8 - a*4 - b*2)

Now we simplify these two equations to get:

-6.9 = a*21 + b*3

-13.5 = a*60 + b*6

Now we do the same thing, I will isolate b in the first equation:

b = (-6.9 - a*21)/3 = -2.3 - a*7

Now we replace this in the other equation:

-13.5 = a*60 + (-2.3 - a*7)*6

Now we can just solve this for a:

-13.5 = a*(60 - 7*6) - 2.3*6

    0.3    = a*18

0.3/18 = a = 0.016

Wich can be rounded to:

a = 0.02

Then the value of b is:

b = -2.3 - a*7 = -2.3 - 0.016*7 = -2.42

And the value of c is:

c = 94.8 - a*4 - b*2 = 94.8 - 0.016*4 - (-2.42)*2 = 99.57

So the equation is:

M(t) = 0.02*t^2 - 2.42*t + 99.57

Now we can evaluate this in t = 11s to get:

M(11) = 0.02*11^2 - 2.42*11 + 99.57 = 75.37

Wich can be rounded to 75 grams.

If you want to learn more, you can read:

https://brainly.com/question/20067450

PLEASE HELP 10 POINTS✨

Write an equation for each problem. Use the variable M.

18) Five students are absent from math class today. If there are 22 students in math class today, how many students would there be if none were absent? =

19) Juan pays $22.05 more than Kim each month for his health club membership. Juan pays $59.95 each month. How much does Kim pay each month? =

Answers

Answer: 18)  there are 27 students

i am new to this so i am sorry if i got this wrong

Step-by-step explan If there are 22 students add 22+5 and the anwser is 27

Add.



45+3110



Enter the sum in the box as a mixed number in simplest form.

Answers

Answer:

3110+45=3155

Step-by-step explanation:

just add them to

Can someone please help me?

Answers

You are right correct

100.000.000x30

Kaçtır?

Answers

Answer:

the answer is 3000000000

Steve bicycles 3 mi to school everyday at 15 mph. If school starts at 8:30 am and he needs 15 min to lock his bike and get to his desk then what time should he leave his house

Answers

Answer:

8:03

Step-by-step explanation:

time=speedxdistance

t=1/15x3

t=3/15hr

t=.2hr

t=12 mins

plus 15 mins to lock up bike, 27 mins

27 mins before 8:30 is 8:03

pls mark branliest

A group of ten people includes six men and four women. If five of these people are randomly selected to fill out a questionnaire, how many different samples of five people are possible?

Answers

20 different samples


Please help me ASAP

Answers

Answer:

New points:

N: (4,-5)

X: (2,-3)

B: (-1,-4)

Step-by-step explanation:

Rotate about the origin (0,0) counter clockwise 90 degrees

A store manager is marking down cameras from $300 to $150. What percentage is the discount?

Write your answer using a percent sign (%).

Answers

Answer:

the discount is 50% the previous price

hard one wat is 500-45=


good luck​

Answers

Answer:

EASY the awnser is about 15

Answer:

455

Step-by-step explanation:

Suppose you invest 18,400.00 into an account earning an interest rate of 2.991% compounded continuously for 2 year(s) and thereafter earning an interest rate of 4.192%compounded yearly. How much money is in the account after 9 years?

Answers

[tex]~~~~~~ \stackrel{\textit{for the first 2 years}}{\textit{Continuously Compounding Interest Earned Amount}} \\\\ A=Pe^{rt}\qquad \begin{cases} A=\textit{accumulated amount}\\ P=\textit{original amount deposited}\dotfill & \$18400\\ r=rate\to 2.991\%\to \frac{2.991}{100}\dotfill &0.02991\\ t=years\dotfill &2 \end{cases} \\\\\\ A = 18400e^{0.02991\cdot 2}\implies A = 18400e^{0.05982}\implies A\approx 19534.276[/tex]

now let's grab that amount and invest it for the remaining 7 years at 4.192% compounded.

[tex]~~~~~~ \stackrel{\textit{for the last 7 years}}{\textit{Compound Interest Earned Amount}}\\\\A=P\left(1+\frac{r}{n}\right)^{nt}\quad\begin{cases}A=\textit{accumulated amount}\\P=\textit{original amount deposited}\dotfill &\$19534.276\\r=rate\to 4.192\%\to \frac{4.192}{100}\dotfill &0.04192\\n=\begin{array}{llll}\textit{times it compounds per year}\\\textit{yearly meaning once}\end{array}\dotfill &\\t=years\dotfill &7\end{cases}[/tex]

[tex]A=19534.276\left(1+\frac{0.04192}{1} \right)^{1\cdot 7}\implies \boxed{A\approx 26039.82}[/tex]

Write the slope of the line passing through the two points: (7,8) and (0,5)

Answers

Answer:

3/7

Step-by-step explanation:

slope = [tex]\frac{y2 - y1}{x2 - x1}[/tex] = [tex]\frac{5-8}{0-7}[/tex] = -3/-7 = 3/7

Can someone please help me thank you

Answers

36 is the answer, hope this helps.

Choose the correct answers.
Jane Dilford gets a student rate of $30.00 a month for health Insurance. There is a $250 deductible, but no coinsurance
payment. She recently recelved treatment for a covered condition. The bill was $2,550.00 Jane's Insurance company
provided payment of 80% of the bill less the deductible.
What was the company's payment? $2,040 or $1,840
V
What was Jane's total cost (not including monthly premium)? $510 or 710

Answers

Answer:

1840 amd 710

Step-by-step explanation:

Given ABCD, what is the measure of

Answers

Answer:

srry dude this isn't rly a quesiton

Can someone help please

Answers

Answer:

0.3 miles per hour

Step-by-step explanation:

Speed is distance divided by time so your equation is 45 divided by 150. 45 divided by 60 plus 60 plus 30 = 150 45 divided by 150= 0.3

8 2/3 and 10 23/32 in its simplest form

Answers

8 2/3 is 26/3 and 10 23/32 is 342/32

A pound of fertilizer covers 39 square feet lawn.Vivian Bulgakov lawn measures 7072.7 square feet,How much fertilizer,to the nearest tenth of a pound does she need to buy?

Answers

Answer: 275835.5

because 7072.7 times 39

30 percent of a number is 48 what is 50 percent of the same number

Answers

0.3x = 48

So x is 48/0.3

Therefore, 0.5 times 48/0.3 is the answer

The length of a rectangle is 3 in longer than its width.
If the perimeter of the rectangle is 42 in, find its area

Answers

Answer:

The first task in a word problem is to translate it into symbols.

First, give a name to each quantity:

Let w be the width of the rectangle

Notice the length = w+3

Let a be the area of the rectangle

Let p be the perimeter of the rectangle

Next, write down formulas relating the quantities

Step-by-step explanation:

a = w * (w+3)

p = 2w + 2(w+3)

We know p = 42, so

42 = 2w + 2(w+3)

im sure you know how to simplify and solve for w:

42 = 4w + 6

4w = 36

w = 9

now you’re ready to attack the area

a = w * (w+3) = 9 * (9+3)

can you take it from there?

1.25 is closer to 1.04 or not ?
plz heelp

Answers

Answer:

Yes 1.25 is closer to 1.04

Step-by-step explanation:

Hope this helps!

Answer:

1.25 is not closer to 1.04 because it's like, 1 dollar and 4 cents; compared to 1 dollar and 25 cents. Obviously 25 cents is more than 4 cents.

1.25 rounded:

1.30

1.04 rounded:

1.00

Dina and masha started out on a 12 mi bike path at the same time. when dina reached the end of the 12 mi, masha still had 4 mi left to bike. if dina's biking speed is 10 mph, find masha's biking speed. HELP NOWWW

Answers

Answer:

Dina took 12/8 = 3/2 hrs

So, if Masha's speed was x

3/2 x = 12-3

x = 6 mi/hr

Answer:

Step-by-step explanation:

Dina finished in a time of

12 mi / 10 mi/hr = 1.2 hr  

Masha's speed is (12 - 4 mi) / 1.2 hr = 6⅔ mph

What are the slope and y-intercept of the line?

Answers

slope = -170. y-intercept = 1020

Step-by-step explanation:

Let [tex]P_1(0, 1020)[/tex] and [tex]P_2(6, 0).[/tex] The slope can be calculated as

[tex]m = \dfrac{0 - 1020}{6 - 0} = -170\:\text{m/hr}[/tex]

So the equation can be written as

[tex]y = -170x + b[/tex]

To solve for b, let's use the values for P2:

[tex]0 = -170(6) + b \Rightarrow b = 1020[/tex]

Therefore,

[tex]y = -170x + 1020[/tex]

To find the y-intercept, let x = 0. then the y-intercept is

[tex]y = -170(0) + 1020[/tex]

or

[tex](0, 1020).[/tex]



i need help with 32

Answers

Answer: See the drawing below

Explanation:

The region to the left of x = -3 has f(x) > 0, aka f(x) is positive. This is due to the sign chart indicating this with a + sign. The same applies from the region between x = -3 and x = -2. The graph will show f(x) above the x axis for these two regions.

When -2 < x < 0, f(x) is now negative and below the x axis. It goes above the x axis for the interval 0 < x < 2. Then it dips back down below the x axis again once it passes x = 2.

The graph below visually summarizes everything talked about. Keep in mind that there are infinitely many ways to draw a graph like this. There's not enough info to pin down one exact answer.

A line has a rise of 3 and a run of 12. What is the slope?
4
1/4
1/3

Answers

Answer:

1/4

Step-by-step explanation:

Rise/run=3/12 divided by 3 = 1/4

Give an example of a function.
example:
Input 9 9 4 5 and output: 3 -3 2 -2

give examples plz
I will make the brainliest. ​

Answers

Jhhdcc C ffvtt he fhhjjmncfhnbcfgbnbvgghmnbjkmn

find DEC

pls give through explanation

Answers

[tex]\large{\rm{\underline{\underline{Answer:}}}}[/tex]

Angle AEB and Angle DEC are opposite angles which means they are equal in measure. Hence,

⇛ Angle AEB = Angle DEC

⇛ 9x + 8° = 3x + 42°

⇛ 9x - 3x = 42° - 8°

⇛ 6x = 34°

⇛ x = (34/6)°

To find: Angle DEC = 3(

34/6 °) + 42° = 59° (Ans)

Add the polynomials (-4x^3 + x^2y - xy^2), (3x^3 - xy^2 + 5x^2y) and (7xy^2 + 3y^3)

Answers

Answer:

4x³+x²

Step-by-step explanation:

to I was awesome and u too go to north and u too go home with he sister or talk

solve the equation 6= A/2 + 2

Answers

Answer:

A = 8

Step-by-step explanation:

A/2 + 2 = 6

subtract 2 from each side to get:

A/2 = 4

multiply each side by 2 to get:

A = 8

If XZ=8x-18 and RZ = 2x+5 find XR

Answers

Answer:

6x+23

Step-by-step explanation:

8x-18+2x+23

8x-2x+5+18

6x+23

Answer:

XR=19

Step-by-step explanation:

Since the entire thing of XZ equals 8x-18 and one side of the line equals 2x+5 we will need another half to get the entire thing.

8x-18=4x+10

4x=28

x=7

Now we have to plug the x in

2(7)+5

=19

Other Questions
Ms. Baranek buys trophies for field day each trophie cost $3.95 she pays $138.25 for all the trophies how many trophies does ms baranek buy Lichens are not single organisms, but algae and fungi that function together. The algae use photosynthesis to make food for both organisms. The fungi produce digestive chemicals and absorb nutrients for both organisms.How does the biological activity of lichens cause weathering in rocks?Answer options with 4 optionsA. Lichens cause friction as they grow, which weathers the rocks.B. Lichens produce chemicals, which dissolve and weather the rocks.C. Lichens take in water, which freezes in cracks and weathers the rocks.D. Lichens absorb heat during photosynthesis, which weathers the rocks. please help me with this math problem Humans can opt against cosmetic surgery what does this mean? 9.(7 +1) Line I 9.7 +9.1 Line 2 The expression was rewritten using the Distributive Property 9. (7 + 1) equals 9. 7 which equals 63 9.7+ 9.1 equals 7 + 1 which equals 63. Submit Answer attempt 1 out of Privacy Policy Terms of Service why are fleas lice wingless? how many roots does the following equation have? x5+x4+x3+x2+x=0? What is the concentration of H+ in a 2.5 M HCl solution? Finding slope from tables and 50 preguntas rapidas Durante la pelicula Em uma avaliao que vale at 5 pontos, Joo tirou 4,2 pontos. Quanto Joo teria tirado caso a prova valesse 10 pontos? How does the line Black snake! Black snake! contribute to the structure of the poem "The Black Snake"? it takes Cynthia 12 hours to proof a chapter of Hawkes Learning Systems' Intermediate Algebra book and it takes Phillip 3 hours. How long would it take them working together? (Round your answer to two decimal places.) .................... ayuda The algebraic form of an with no solution is?1. a = a2. x = a3. a = bWhich one is the answer? May somebody help me with this question? It is in the picture. In at least 150 words, describe the reasons why Berryman's "Homage to Mistress Bradstreet" would have caused him to be banished from early American settlements I need help with this No links plis you can help me ACCURATE ANSWER=BRAINLIST The first four terms of a sequence are shown.7, 25, 43, 61, ...Which of the following expressions can be used to find the nth term of the sequence?Question 3 options:7+18n18+7n18+7(n1)7+18(n1)