How do I solve h(x)=2x+5;find h(2)

Answers

Answer 1

Step-by-step explanation:

hrer do it this way

it is correct

How Do I Solve H(x)=2x+5;find H(2)

Related Questions

Jonas has bought three t-shirts. Each t-shirt was the same price. After using a 10% off coupon the total charge was 95 what was the cost of each t-shirt

Answers

Answer:

35 5/27

Step-by-step explanation:

You just have to set up an equation:

0.9/95 = 1/x

And if you cross-multiply, you get:

0.9x=95

Which means x is 95/0.9 which is 105 5/9. So, if all three t-shirts costed 105 5/9, and they all costed the same, then one t-shirt costs 35 5/27.

What is the quotient of 3.55 x 106 and 7.1 x 102 expressed in scientific notation?
PLEASE HELP THIS IS FOR A TEST

Answers

Answer:

[tex]5\times10^3[/tex]

Step-by-step explanation:

[tex]3.55\times10^6 \div 7.1 \times 10^2[/tex]

Exponents are positive:

[tex]3.5.5.0.0.0.0. = 3550000[/tex]

[tex]7.1.0.=710[/tex]

[tex]3550000 \div 710 = 5000[/tex]

Convert back into scientific notation:

[tex]5000 = 5 \times 10^3[/tex]

[tex]= 5 \times10^3[/tex]

Hope this helps.

Answer: 5 x 10^3

Step-by-step explanation:

I Need Help! but please take your time to get the correct answer

Answers

Sal can make 10 bracelets

Which expression is undefined?

Answers

Answer:

D

Reasoning:

Anything that is divided by zero is undefined.

6p - 5 =13
3
-3
12
15

Answers

Answer:

6p=13+5

6p=18

p=18/6

p=3

Triangle R S T is shown. Angle R S T is a right angle. The length of R S is 10, the length of R T is 26, and the length of S T is 24. Use the diagram and side lengths of triangle RST to determine the angles used for the trigonometric ratios. sin( ) = Twelve-thirteenths tan( ) = Five-twelfths

Answers

Answer:

sin(R) = 12/13tan(T) = 5/12

Step-by-step explanation:

The mnemonic SOH CAH TOA is intended to remind you of the relationship between sides of a right triangle and trig functions of the acute angles. It tells you ...

  Sin = Opposite/Hypotenuse

  sin(R) = 24/26 = 12/13

and ...

  Tan = Opposite/Adjacent

  tan(T) = 10/24 = 5/12

Answer: SIN = R and TAN = T

which expression is equavilent to 4/5x+(-2)+(-6)-1/5x​

Answers

Answer:

3/5x - 8

Step-by-step explanation:

4/5x + (-2) + (-6) - 1/5x

4/5x - 1/5x = 3/5x

(-2) + (-6) = -8

3/5x - 8 is the answer

thats what i got

A rocket is launched from a tower. The height of the rocket, y in feet, is related to the
time after launch, x in seconds, by the given equation. Using this equation, find the
time that the rocket will hit the ground, to the nearest 100th of second.
y = –16x2 + 119x + 57

Answers

Answer:

7.89 seconds

Step-by-step explanation:

using the quadratic formula (-b+-√(b^2-4ac))/2a

a=-16 b=119 c=57

x=-0.451

and

x=7.889

time cant be negative so use the positive x

Time required for the rocket to hit the ground would be 7.9 s.

What is a quadratic equation?

A quadratic equation is the second-order degree algebraic expression in a variable. the standard form of this expression is  ax² + bx + c = 0 where a. b are coefficients and x is the variable and c is a constant.

We are given the quadratic equation as;

-16x² + 119x + 57 = 0

By using the quadratic formula,

x = [-b ± √b² - 4ac]/2a

Here, a = -16, b = 119 and c = 57

b² - 4ac = (119 )² - 4(-16)(57)

= 14161 + 3648

= 17809

So, x = [-(119) ± √17809]/ 16(2)

= (-119 ± 133.4)/32

Therefore, the time is 7.9 s.

Learn more about quadratic equations;

brainly.com/question/17177510

#SPJ2

In each bouquet of flowers, there are 2 roses and 5 white carnations. Complete the table to find how many roses and carnations there are in 4 bouquets of flowers.

Answers

Answer:

28roses 70carnations

Step-by-step explanation:

4+6+8+10=28

10+15+20+25=70

Maybe i think

which rotation about its center will carry a regular hexagon onto itself

Answers

There are 6 angles between neighbour vertices, they all are equal (because a hexagon is regular) and their sum is 360°. Thus each angle has a measure of 360°/6=60°. Each subsequent rotation by 60° also maps a hexagon onto itself.

help.....................

Answers

Answer:

Answers in Explanation

Step-by-step explanation:

First Question:

[tex]\sqrt{100}[/tex] + [18 ÷ 3 x 4 - 15] - (60 - 7^2 - 1)

[tex]\sqrt{100}[/tex] + [24 - 15]  - (60 - 49 - 1)

[tex]\sqrt{100}[/tex] + 9 - 10

10 + 9 - 10

Answer = 9

Second Question:

5x + 2x = 7x

5x^2 + 3x^2 = 8x^2

2x + 3x - x = 4x

2x + 3y + x + y = 3x + 4y

9x - 6x = 3x

-7y + 3x + 4x + 3y = 7x - 4y

-7x^2 + 2x^2 + 9x^2 = 8x^2

(3x^2 + 5x + 4) - (-1 + x^2) = 2x^2 + 5x + 5

(3 + 2x - x^2) + (x^2 + 8x + 5) = 10x + 8

(3x - 4) - (5x + 2) = -2x - 6

(2x^2 + 5x + 3) - (x^2 - 2x + 3) = x^2 + 7x

(3x^2 + 2x - 5) - (2x^2 - x - 4) = x^2 + 3x - 1

Third Question:

17x + 2y

(5x + 12y) + (3x + y) = 8x + 13y

17x - 8x = 9x

2y - 13y = -11y

Answer: 9x - 11y

A number greater than 50 that has exactly 2 factors...
fata

Answers

Answer:

10 or 25

Step-by-step explanation:

25 is a factor of 50

Find the perimeter of a rectangle whose length is 12 longer than its width
with an area of 45 square feet. To earn 5 points write the mathematical
sentence, the value of Length, width and perimeter

Answers

Answer:

l = 21

w = 9

P = 60

Step-by-step explanation:

l = 12 + w

A = l*w = 45

substitute l = 12 +w

45 = (12 + w) * w

45 = 12w + w^2

w^2 + 12w - 45 = 0

w^2 + 2*6*w +36 = 45 + 36 (added 36 on both sides 6^2)

(w + 6) ^2 = 45+36 = 81

w + 6 = +-9

As width cannot be negative w = 9

so l = 12 + 9

= 21

Perimeter = P = 2 (l + b)

= 2 ( 21 + 9)

= 2 (30)

= 60

HELP ME OUT PLEASE!!!
WILL GIVE BRAINLIEST!!!

Answers

Answer:

-4 9/10, -4 3/4, -4.2

Step-by-step explanation:

A. -4.9

B. -4.75

C. -4.2

ANSWER:

-4 9

10

-4 3

10

-4.2

Step-by-step explanation:

HOPE IT HELPSSSS

Save
A car rental agency advertised renting
drive on a $100 budget?
car for $28.95 per day and $0.25 per mile. If Shawn rents this car for 3 days, how many whole miles can he
miles solve

Answers

Answer:

He could drive 52.006 miles

Step-by-step explanation:

Multiply 28.95 by 3. You get 86.85Subtract 86.85 from 100. You get 13.15Divide 13.15 by 0.25. You get 52.006

what's the slope (3,-1) and (-2,5)

Answers

Answer:

slope = - [tex]\frac{6}{5}[/tex]

Step-by-step explanation:

Calculate the slope m using the slope formula

m = [tex]\frac{y_{2}-y_{1} }{x_{2}-x_{1} }[/tex]

with (x₁, y₁ ) = (3, - 1 ) and (x₂, y₂ ) = (- 2, 5 )

m = [tex]\frac{5-(-1)}{-2-3}[/tex] = [tex]\frac{5+1}{-5}[/tex] = [tex]\frac{6}{-5}[/tex] = - [tex]\frac{6}{5}[/tex]

Determine if the ordered pairs (1. - 2) and (-4,2) are solutions of the following linear inequality in two variables.
-X<-y
.
Is the ordered pair (1. - 2) a solution of the linear inequality?

Is the ordered pair (-4,2) a solution of the linear inequality?

Answers

Answer:

First is, second is not.

Step-by-step explanation:

Start plugging them!

[tex]-(1) < -(-2) \rightarrow -1 < 2 \\ \\- (-4) < -(2) \rightarrow 4 < -2[/tex]

First one is true, so the pair is a solution.

Second is false, (4 is obviously bigger!) so it's not a solution.

If you end up having to check multiple values, your best bet is to draw the solutions on a convenient plane and see where the points lay

What is the EQUATION of the line PERPENDICULAR to y=-2x+5 and passing through the point (0,2)?

Answers

[tex]▪▪▪▪▪▪▪▪▪▪▪▪▪  {\huge\mathfrak{Answer}}▪▪▪▪▪▪▪▪▪▪▪▪▪▪[/tex]

The required equation is ~

[tex] \boxed{ \sf{y = \frac{x}{2} + 2 }}[/tex]

[tex] \large \boxed{ \mathfrak{Step\:\: By\:\:Step\:\:Explanation}}[/tex]

Let's find the slope of given line ~

[tex]y = - 2x + 5[/tex]

comparing it with general slope - intercept form of line (y = mx + c) we get, m = -2 (that is slope of the line)

let the slope of the required line be n

And, now since the required line Is perpendicular to the given line. the product of their slopes is -1

that is ~

[tex] - 2 \times n = - 1[/tex]

[tex]n = \dfrac{ - 1}{ - 2} [/tex]

[tex]n = \dfrac{1}{2} [/tex]

slope of required line is ~ 1/2

now, let's use the point - slope form of line to find the equation of required (perpendicular) line (using point (0 , 2) ~

that is ~

[tex]y - y_1 = m(x - x_ 1)[/tex]

here, m = slope ~

[tex] y - 2 = \dfrac{1}{2} (x - 0)[/tex]

[tex]y - 2 = \dfrac{x}{2} [/tex]

[tex]y = \dfrac{x}{2} + 2[/tex]

I hope it helps ~

Kendra rides her bike to school each day. It takes her 10 minutes to ride 30 blocks. What unit rate would express the speed of Kendra's bike ride? (4 points)

Group of answer choices

2 blocks per minute

10 blocks per minute

3 blocks per minute

4 blocks per minute

Answers

Answer:

3 blocks a minute

Step-by-step explanation:

so if she rides her bike 30 blocks in 10 minutes in means she rides at a pace of 3 blocks a minute

Help me this question is so hard i fried up my brain yesterday working on it for so long!!!!

Answers

Hello there! (:

The answer is 9.

3^4=3*3*3*3 (81)

3^2=9

81:9=9

So the answer is 9.

Hope it helps! If you have any question or query, feel free to ask! (:

~An excited gal

[tex]SparklingFlower[/tex]

Subtract using the number line.
[tex] - 1 \frac{1}{3} - \frac{1}{6} [/tex]

Answers

Answer:

- 1 2/6 - 1/6

- 1 3/6

-1 1/2

Step-by-step explanation:

Step-by-step explanation:

[tex] = - 1 \frac{1}{3} - \frac{1}{6} [/tex]

[tex] = - 1 + ( - \frac{1}{3} - \frac{1}{6} )[/tex]

[tex] = - 1 + ( - \frac{2}{6} - \frac{1}{6} )[/tex]

[tex] = - 1 - \frac{3}{6} [/tex]

[tex] = - 1 \frac{1}{2} [/tex]

Option → B

I need some help with this problem

Answers

B because the answer says 195 and remainder of 15 beet roots

Answer:

B is going to be our answer

Step-by-step explanation:

We said that we want each row to contain 40 beets

We divided and got 195 rows, with a remainder of 15.

This makes statement B true.

Which expression is equal to 3x/x+3+x−2/x

Answers

Answer: 6+x−2/x

Step-by-step explanation:

3x/x+3+x−2/x

3+3+x−2/x

6+x−2/x

================

Or, if you love crazy fractions:

3x/x+3+x−2/x

3x/x−2/x+3+x

(1/x)(3x−2)+3+x

21. A square park has an area of 120 m2

a) What are the dimensions of the park? Give your answer to the nearest metre.
b) If fencing costs $18.50/m, how much would it cost to install a fence around the park?
Show your work

plsss help me quick :((

Answers

Answer:

120m2

$6.25

$4.50

85

57

12

12

32

54

69

87

89

12

34

58

solve pls brainliest

Answers

Answer:

[tex]18 {m}^{2} [/tex]

Step-by-step explanation:

[tex]area \: = 6m \times 4m \\ = 24 {m}^{2} \\ \\ grass \: area = 3m \times 2m \\ = 6 {m}^{2} \\ \\ cement \: area \: = 24 {m}^{2} - 6 {m}^{2} \\ = 18 {m}^{2} [/tex]

Answer:

18 m^2

Step by step explanation:

In these types of math problems, we have two ways to solve.

1) Directly find the area of the shaded area.

2)Find the unshaded area and then minus that from the total area.

In this case, I will use the second way.

The grass area (unshaded) is 3 x 2 = 6 m^2 ( 6 square meters )

The total area (grass + cement) is 4 x 6 = 24 m^2 ( 24 square meters )

Now, we want the area of the cement part but the grass's area is also in the total.

So, we minus 6m^2 from 24m^2.

Then we get 18m^2.

And that is the answer.

I hope it helps.

(Note : because this problem is easy, you can use both ways but most use the second way. There may also be problems where we can use only the first or second way.)

please help
15 marks

Answers

Step-by-step explanation:

12a. y-y1=m(x-x1)

y-5=(2-5)/(1--3)(x--3)

y-5=-3/4(x+3)

4y-20=-3x-9

4y=-3x-9+20

4y=-3x+11

y=-¾x+11/4

12b.

Perpendicular lines have the product of their gradient equal to -1

For L1,the gradient is 3

For L2,we express in slope-intercept form

6y=1-2x

y=1/6-⅓x

The slope is -⅓

Now product of both slopes 3×-⅓=-1,thus the lines are perpendicular

What is 8 times larger than 3

Answers

8 x 3 = 24 for should be 24

Only because 8 times larger than three seems like a multiplication problem..

I hope this helps if it is correct!

Answer:

(8+1) x 3 = 27

Step-by-step explanation:

this is correct rather than 8 x 3 = 24 because both sides of 8x3=24 are equal rather than the sum being greater than the statement.

Evaluate the expression.

2−[(2+10(−1)÷2)+1]

What is the value of the expression?

Answers

Answer:

4

Step-by-step explanation:

Review

To evaluate the expression, lets use BODMAS. Before we get to the solving part, lets revise BODMAS.

=> B in BODMAS is brackets. This means that whatever operations are inside a bracket, we must solve that first.

=> O in BODMAS is Orders. The O is used very rarely, there is a possibility that there is no powers, exponents.

=> D in BODMAS is Division. This means that whatever division is occurring in the expression must be done first (Unless if there is a bracket).

=> M in BODMAS is Multiplication. This means that whatever multiplication is occurring in the expression must be done next.

=> A in BODMAS is Addition. This means that whatever addition is occurring in the expression must be done then.

=> S in BODMAS is Subtraction. This means that whatever subtraction is occurring in the expression must be done last.

Solution:

Now, lets get to the point. We need to find the expression '2−[(2+10(−1)÷2)+1]'. Using the help of BODMAS, we can solve it.

Step 1: Simplify the innermost bracket.

2 − [( 2 + 10(−1)÷2)+1]

=> 2-[(2-10÷2)+1]

Note: Since in the innermost bracket there is no operation, we can open the innermost bracket and get along with the second inner bracket.

Step 2: Simplify the second inner bracket.

=> 2 - [(2 - 10 ÷ 2) + 1]

=> 2 - [(2 - 5) + 1]

=> 2 - [(-3) + 1]

=> 2 - [-3 + 1]

Step 3: Simplify the third inner bracket.

=> 2 - [-3 + 1]

=> 2 + 2

Step 4: Solve.

=>  2 + 2

=> 4

Final Answer.

Therefore, 4 is our answer after working on this problem.

Answer:

4

Step-by-step explanation:the answer is 4 because you have to 20 2-2+10 and that is ten. then minus one is 9 then 9/2=3 and then 3+1 equals 4

If given 5 miles is 8km convert 13.5 miles into km

Answers

Step-by-step explanation:

There are 2 ways we can do this. We can use our friend which we will call a special device or we could actually solve using formulas we already know. Today, I will be using a formula but you can easily just use the secret device.

Step 1: Knowing the formula which is multiply miles by 1.609 and then round to the nearest tenth or hundredth.

13.5 X 1.609 = 21.7215.

Round down to 21.7.

Final Answer: 21.7 Km is equal to 13.5 miles or vice versa.

pasagot po please
answer it please​

Answers

Answer:

24 I hope help you yieeeeeee

Answer:

ummmmmmmmmmm itsssssssss

Step-by-step explanation:

Other Questions
A store owner has 65.5 pounds of candy. If he splits the candy equally into 5 boxes, how many pounds of candy will each box contain? The year is 1930. You are a middle class man/woman living in New York City. Your savings bank has closed and your money is gone. You have lost your job. Describe your life in terms of economic, political and social welfare. Pls answer questions 1-4 on this pic (must include the math work)i will give brainlist for the most helpful answer How do I make my new hamster calm down she is trying to climb her tank walls, she doesnt have a wheel yet and it comes in on Saturday! A) (2x-10)(3x+1)B) (3x+2)(2x-5)C) (2x+5)(3+1)D) (2x+1)(3+5)E) None of the above. The quadratic f(x) = 6x] + 11X - 10would have which of the followingfactors? What two rivers supply water to the pampas and flow through four different countries? (choose two)Group of answer choicesAmazonParaguayParanaOrinoco Muscle cells serve as a reservoir for which of the following?A. O FructoseB. O GlucoseC. O GalactoseD. O Raffinose What number is furthest from 0 on a number line? 16 or 18? What did the Locarno agreements of 1925 address?O Border disputesO War guiltA common currencyO Reparations .Learning Task 2: Get the quotient of each item up to the nearest ten thousandths place. Then, round the decimals to their nearest thousandths. Number 1 is done for you. 1.458= 5.6250 -5.625------- example4.939 = _____ - ______2. 779 = _____ - ______5.88 7= _____ - ______3.817= _____ - ______6.558=_____ - ______sorry if the numbers is a bit confusing Lichens are not single organisms, but algae and fungi that function together. The algae use photosynthesis to make food for both organisms. The fungi produce digestive chemicals and absorb nutrients for both organisms.How does the biological activity of lichens cause weathering in rocks?Answer options with 4 optionsA. Lichens cause friction as they grow, which weathers the rocks.B. Lichens produce chemicals, which dissolve and weather the rocks.C. Lichens take in water, which freezes in cracks and weathers the rocks.D. Lichens absorb heat during photosynthesis, which weathers the rocks. please help me with this math problem Humans can opt against cosmetic surgery what does this mean? Finding slope from tables and Em uma avaliao que vale at 5 pontos, Joo tirou 4,2 pontos. Quanto Joo teria tirado caso a prova valesse 10 pontos? How does the line Black snake! Black snake! contribute to the structure of the poem "The Black Snake"? The algebraic form of an with no solution is?1. a = a2. x = a3. a = bWhich one is the answer? May somebody help me with this question? It is in the picture. In at least 150 words, describe the reasons why Berryman's "Homage to Mistress Bradstreet" would have caused him to be banished from early American settlements ACCURATE ANSWER=BRAINLIST The first four terms of a sequence are shown.7, 25, 43, 61, ...Which of the following expressions can be used to find the nth term of the sequence?Question 3 options:7+18n18+7n18+7(n1)7+18(n1)