In a completely randomized experimental design involving five treatments, 13 observations were recorded for each of the five treatments. The following information is provided.
SSTR = 200 (Sum Square Between Treatments)
SST = 800 (Total Sum Square)
The mean square within treatments (MSE) is _____.
a. 10
b. 600
c. 50
d. 200

Answers

Answer 1

Answer:

[tex]MSE = 10[/tex]

Step-by-step explanation:

Given

[tex]SSTR = 200[/tex]

[tex]SST = 800[/tex]

Required

Determine MSE

This is calculated as:

[tex]MSE = \frac{1}{ddf} * SSE[/tex]

Where:

[tex]SSE = SST - SSTR[/tex]

[tex]ddf \to[/tex] denominator df

So, we have:

[tex]SSE = 800 - 200[/tex]

[tex]SSE = 600[/tex]

To calculate the df, we have:

[tex]r = 13[/tex] --- observations

[tex]n = 5[/tex] treatments

So:

[tex]ddf = Total\ df - Numerator\ df[/tex]

[tex]Total = n*r-1 = 5*13 -1 = 64[/tex]

[tex]Numerator =n - 1 = 5 - 1 =4[/tex]

[tex]ddf =64-4=60[/tex]

So, we have:

[tex]MSE = \frac{1}{ddf} * SSE[/tex]

[tex]MSE = \frac{1}{60} * 600[/tex]

[tex]MSE = 10[/tex]


Related Questions

Shawn has 4 times as many candies as Jason, who has a third as many candies as
lan. If Shawn has 64 candies, how many candies does Ian have?

Answers

Ian has 48 candies. hope that helps!
Ian has 4 candies...........

Can someone do #4 and #5

Answers

Answer:

First, find two points on the graph:

(x₁, y₁) = (0, 2)(x₂, y₂) = (2, 8)

Slope = [tex]\frac{y_{2}-y_{1} }{x_{2}-x_{1}} = \frac{8-2}{2-0} =\frac{6}{2}=3[/tex]

16 + (-3) = 16 - 3 = 13

2(4×+2)=10
[tex]6 \times + 4 = 10 \\ \\ 6 \times = 10 - 4 \\ \\ 6 \times = 6 \\ \\ [/tex]
that is the answer

Answers

Answer:

x = 3/4

Step-by-step explanation:

2(4x + 2) = 10           Remove the brackets

8x + 4 = 10               Subtract 4 from both sides

8x = 6                       Divide by 8

x = 6/8

x = 3/4

Check

2(4*3/4 + 2) =?10

2( 3 + 2) = 10

2*5 = 10

10 = 10

Find the greatest rational number r such that the ratios 8/15 ÷ r and 18/35 ÷ r are whole numbers?

Answers

The answer is "[tex]\bold{\frac{2}{105}}[/tex]", and the further calculation can be defined as follows:

When the "r" is the greatest common divisor for the two fractions.

So, we will use Euclid's algorithm:  

[tex]\to \bold{(\frac{8}{15}) -(\frac{188}{35})}\\\\\to \bold{(\frac{8}{15} -\frac{188}{35})}\\\\\to \bold{(\frac{56-54}{105})}\\\\\to \bold{(\frac{2}{105})}\\\\[/tex]

this is  [tex]\bold{(\frac{8}{15}) \ \ mod \ \ (\frac{18}{35})}[/tex]

we can conclude that the GCD for [tex]\bold{\frac{54}{105}}[/tex], when divided by [tex]\bold{\frac{2}{105}}[/tex], will be the remainder is 0.  Rational numbers go from [tex]\bold{\frac{2}{105}}[/tex] with the latter being the highest.

So, the final answer is "[tex]\bold{\frac{2}{105}}[/tex]".

Learn more:

greatest rational number:brainly.com/question/16660879

Triangle ABL is an isosceles triangle in circle A with a radius of 11, PL = 16, and ∠PAL = 93°. Find the area of the circle enclosed by line PL and arc PL. Show all work and round your answer to two decimal places.

Answers

The area bounded by a chord and arc it intercepts is known as a segment of a circle segment of a circle

The area of the circle enclosed by line PL and arc PL is approximately 37.62 square units

The reason the above value is correct is as follows:

The given parameters in the question are;

The radius of the circle, r = 11

The length of the chord PL = 16

The measure of angle ∠PAL = 93°

Required:

The area of part of the circle enclosed by chord PL and arc PL

Solution:

The shaded area of the given circle is the minor segment of the circle enclosed by line PL and arc PL

The area of a segment of a circle is given by the following formula;

Area of segment = Area of the sector - Area of the triangle

Area of segment = Area of minor sector APL - Area of triangle APL

Area of minor sector APL:

Area of a sector = (θ/360)×π·r²

Where;

r = The radius of the circle

θ = The angle of the sector of the circle

Plugging in the the values of r and θ, we get;

Area of the minor sector APL = (93°/360°) × π × 11² 98.2 square units

Area of Triangle APL:

Area of a triangle = (1/2) × Base length × Height

Therefore;

The area of ΔAPL = (1/2) × 16 × 11 × cos(93°/2) ≈ 60.58 square units

Required shaded area enclosed by line PL and arc PL:

Therefore, the area of shaded segment enclosed by line PL and arc PL is found as follows;

Area of the required segment PL (98.2 - 60.58) square units = 37.62 square units

The area of the circle enclosed by line PL and arc PL ≈ 37.62 square units

Learn more about the finding the area of a segment can be found here:

https://brainly.com/question/22599425

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

The calculation of the area between line segment PL and circle arc PL is described below:

1) Calculation of the area of the circle arc.

2) Calculation of the area of the triangle.

3) Subtracting the area found in 2) from the area found in 1).

Step 1:

The area of a circle arc is determined by the following formula:

[tex]A_{ca} = \frac{\alpha\cdot \pi\cdot r^{2}}{360}[/tex] (1)

Where:

[tex]A_{ca}[/tex] - Area of the circle arc.

[tex]\alpha[/tex] - Arc angle, in sexagesimal degrees.

[tex]r[/tex] - Radius.

If we know that [tex]\alpha = 93^{\circ}[/tex] and [tex]r = 11[/tex], then the area of the circle arc is:

[tex]A_{ca} = \frac{93\cdot \pi\cdot 11^{2}}{360}[/tex]

[tex]A_{ca} \approx 98.201[/tex]

Step 2:

The area of the triangle is determined by Heron's formula:

[tex]A_{t} = \sqrt{s\cdot (s-l)\cdot (s-r)^{2}}[/tex] (2)

[tex]s = \frac{l + 2\cdot r}{2}[/tex]

Where:

[tex]A_{t}[/tex] - Area of the triangle.

[tex]r[/tex] - Radius.

[tex]l[/tex] - Length of the line segment PL.

If we know that [tex]l = 16[/tex] and [tex]r = 11[/tex], then the area of the triangle is:

[tex]s = \frac{16+2\cdot (11)}{2}[/tex]

[tex]s = 19[/tex]

[tex]A_{t} = \sqrt{19\cdot (19-16)\cdot (19-11)^{2}}[/tex]

[tex]A_{t} \approx 60.399[/tex]

Step 3:

And the area between the line segment PL and the circle arc PL is:

[tex]A_{s} = A_{ca}-A_{t}[/tex]

[tex]A_{s} = 98.201 - 60.399[/tex]

[tex]A_{s} = 37.802[/tex]

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

Your parents deposit 2 50-dollar bills at the bank.
How much money did they deposit?

Answers

$100 is what they deposited!!

Answer: $100

Step-by-step explanation:

Considering 50 + 50 = 100

This means that the amount of money is $100

Where r is the radius of the cylinder and h is the height of the cylinder.
Find the surface area when r is 7 inches and h is 9 inches.




Sa of cylinder= 2(pi)rh + 2(pi)r squared

Answers

Answer:

703.7 in²

Step-by-step explanation:

SA = 2πrh+2πr²

= 2×π×7×9+2×π×7²

= 224π

= 703.7 in² (rounded to the nearest tenth)

Answer:

224π

in²

Step-by-step explanation:

This graph represents which of these expressions?

Answers

Answer:

x > 43

Step-by-step explanation:

Open circle at 43, which means it is not equal to 43

Line goes to the right, which means x is greater than

x > 43

Answer:

B

Step-by-step explanation:

12/1,000 into decimal​

Answers

0.012 is the answer!

I hope this helps you out! :D

[tex]\\ \sf\longmapsto \dfrac{12}{1000}[/tex]

1000 has 3zeros hence decimal will go 3 points left

[tex]\\ \sf\longmapsto 0.012[/tex]

More:-

[tex]\\ \sf\longmapsto \dfrac{1}{10}=0.1[/tex]

[tex]\\ \sf\longmapsto \dfrac{1}{100}=0.01[/tex]

Complete the table for the given rule.
Rule: y is 0.75 greater than x
x y
0
3
9

Answers

The complete table is

x    y

0    0.75

3     3.75

9     9.75

What is equation?

An equation is a mathematical statement that is made up of two expressions connected by an equal sign.

What is substitution?

Substitution means putting numbers in place of letters to calculate the value of an expression or equation.

According to the given question.

We have values of x.

Also, one rule that y is 0.75 greater than x.

So, we have a equation for finding the value of y  i.e.

[tex]y = x + 0.75..(i)[/tex]

For finding the value of y

At x = 0, substitute x = 0 in equation (i)

[tex]y = 0 + 0.75\\\implies y = 0.75[/tex]

At x = 3, substitute x = 3 in equation (i)

[tex]y = 3+0.75\\\implies y = 3.75[/tex]

At x = 9, substitute x = 9 in equation (i)

[tex]y = 9+0.75\\\implies y = 9.75[/tex]

Hence, the complete table is

x    y

0    0.75

3     3.75

9     9.75

Find out more information about equation and substitution here:

https://brainly.com/question/10852714

#SPJ2

write your answer as an integer or as a decimal rounded to the nearest tenth​

Answers

Answer:

FH ≈ 6.0

Step-by-step explanation:

Using the sine ratio in the right triangle

sin49° = [tex]\frac{opposite}{hypotenuse}[/tex] = [tex]\frac{FH}{FG}[/tex] = [tex]\frac{FH}{8}[/tex] ( multiply both sides by 8 )

8 × sin49° = FH , then

FH ≈ 6.0 ( to the nearest tenth )

Answer:

6

Step-by-step explanation:

sin = opposite/hypotenuse

opposite = sin * hypotenuse

sin (49) = 0,75471

opposite = 0,75471 * 8 = 6,037677 = 6

The segments shown below could form a triangle.
A
C
7
9
12
B
А
a
A. True
B. False

Answers

Answer:

TRUE

Step-by-step explanation:

I SEEN SOME ONE ELSE WIT 5 STARS SAY SO(:

The given segment can form triangle. Therefore, the given statement is true.

What is triangle?

A polygon has three edges as well as three vertices is called a triangle. It's one of the fundamental geometric shapes. In Euclidean geometry, each and every three points that are not collinear produce a distinct triangle and a distinct plane. In other words, every triangle was contained in a plane, and there is only single plane that encompasses that triangle.

All triangles are enclosed in a single plane if all of geometry is the Euclidean plane, however this is no longer true in higher-dimensional Euclidean spaces. Unless when otherwise specified, this article discusses triangles within Euclidean geometry, namely the Euclidean plane. The given segment can form triangle.

Therefore, the given statement is true.

To know more about triangle, here:

https://brainly.com/question/14712269

#SPJ7

According to this diagram, what is tan 62°?
62°
17
18
280
90°
15
O A.
8
17
OB.끝
O c. 1
8
15
D.
15
8
O
E.
17
15
F.
15
17

Answers

Answer:

15/8

Step-by-step explanation:

tan(62)=P/B

tan(62)=15/8

> There are 14 books on a shelf. 6 of these books are new. The rest of them are used (a) What is the ratio of new books to used books? (b) What is the ratio of used books to all books on the shelf ​

Answers

Answer:

a) 6:8

Because you have 14 books total if you substract 14 - 6= 8, so now you have

14 Books total

6 New Books

8 Used Books.

So, the ratio of new books to used books is 6:8 or if you simplified is 3:4.

b) 8:14

Because you have 8 used books compare to 14 books total. If you simplified your fraction you'll have 4:7

Step-by-step explanation:

prove that 2^n+1>(n+2).sin(n)​

Answers

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

5 A machine puts tar on a road at the rate of 4 metres in 5 minutes.
a) How long does it take to cover 1 km of road
b) How many metres of road does it cover in 8 hours?​

Answers

Answer:

5 a) Total = 20.83 hrs = 20 hrs and 50 mins  (1250mins total)

5 b) Total = 96 meters. = 0.096km in 8 hrs.

Step-by-step explanation:

1km = 1000 meters

5 mins = 4 meters

1000/4 = 250 multiplier

250 x 5mins = 1250 minutes

1250/60 = 20hrs + 50 minutes

50 / 60 =  0.83 = 20.83hrs

b)  8 hrs = 8 x 60 = 480 minutes

480/5 = 24 multiplier of 4 meters

24 x 4 = 96 meters

A well-known brokerage firm executive claimed that 60% of investors are currently confident of meeting their investment goals. An XYZ Investor Optimism Survey, conducted over a two week period, found that in a sample of 100 people, 69% of them said they are confident of meeting their goals. Test the claim that the proportion of people who are confident is larger than 60% at the 0.01 significance level.
The null and alternative hypothesis would be:________
a. H0:μ=0.6H0:μ=0.6
H1:μ≠0.6H1:μ≠0.6
b. H0:μ=0.6H0:μ=0.6
H1:μ<0.6H1:μ<0.6
c. H0:μ=0.6H0:μ=0.6
H1:μ>0.6H1:μ>0.6
d. H0:p=0.6H0:p=0.6
H1:p≠0.6H1:p≠0.6
e. H0:p=0.6H0:p=0.6
H1:p>0.6H1:p>0.6
f. H0:p=0.6H0:p=0.6
H1:p<0.6H1:p<0.6
The test is:________
a. two-tailed
b. left-tailed
c. right-tailed
The test statistic is:_______ (to 3 decimals)
The p-value is:_______ (to 4 decimals)
Based on this we:________
a. Fail to reject the null hypothesis
b. Reject the null hypothesis

Answers

We are testing a hypothesis. So, first we identify the null and the alternative hypothesis, then we find the test statistic, and with the test statistic, the p-value is found.

Null and alternative hypothesis:

Claim the the proportion is of 60%, thus, the null hypothesis is:

[tex]H_0: p = 0.6[/tex]

Test if the proportion is greater than 60%, thus, the alternative hypothesis is:

[tex]H_1: p > 0.6[/tex]

And the answer to the first question is given by option c.

Classification:

We are testing if the proportion is greater than a value, so it is a right-tailed test.

Test statistic:

[tex]z = \frac{X - \mu}{\frac{\sigma}{\sqrt{n}}}[/tex]

In which X is the sample mean, [tex]\mu[/tex] is the value tested at the null hypothesis, [tex]\sigma[/tex] is the standard deviation and n is the size of the sample.

0.6 is tested at the null hypothesis:

This means that [tex]\mu = 0.6, \sigma = \sqrt{0.4*0.6}[/tex]

Survey, conducted over a two week period, found that in a sample of 100 people, 69% of them said they are confident of meeting their goals.

This means that [tex]n = 100, X = 0.69[/tex]

Value of the test statistic:

[tex]z = \frac{X - \mu}{\frac{\sigma}{\sqrt{n}}}[/tex]

[tex]z = \frac{0.69 - 0.6}{\frac{\sqrt{0.4*0.6}}{\sqrt{100}}}[/tex]

[tex]z = 1.837[/tex]

The test statistic is z = 1.837.

p-value:

The p-value of the test is the probability of finding a sample proportion above 0.69, which is 1 subtracted by the p-value of z = 1.837.

Looking at the z-table, z = 1.837 has a p-value of 0.9669.

1 - 0.9669 = 0.0331

The p-value is 0.0331.

Decision:

The p-value of the test is 0.0331 > 0.01, and thus:

a. Fail to reject the null hypothesis

For another example of a problem of a test of hypothesis, you can take a look at:

https://brainly.com/question/24166849

Please help me with this on the picture

Answers

9514 1404 393

Answer:

  (-5, 4)

Step-by-step explanation:

The inside corner moves from (2, -2) to (-3, 2). That is 5 is subtracted from the x-coordinate, and 4 is added to the y-coordinate. (x, y) ⇒ (x -5, y +4)

The translation vector can be written horizontally as (-5, 4), or vertically as ...

  [tex]\displaystyle\binom{-5}{4}[/tex]

Simplify the following expression

Answers

Answer:

[tex]\frac{98p^{6}}{q}[/tex]

Step-by-step explanation:

Distribute the exponents

[tex](\frac{(7^{-2}p^{-6}q^{-8})}{2q^{-9}} )^{-1}[/tex]

[tex](\frac{q}{98p^{6}} )^{-1}[/tex]

Distribute the -1

[tex]\frac{98p^{6}}{q}[/tex]

factorize : ( p- q ) cube​

Answers

Answer:

[tex]( {p - q}^{3} ) \\ = {p}^{2} - 3 {p}^{2} q + 3p {q}^{2} - {q}^{3} [/tex]

Hope my answer helped u :)

What is an explicit formula for the geometric sequence -64,16,-4,1,... where the first term should be f(1).

Answers

Answer:

[tex]a_{n} = -64(-\frac{1}{4})^{n-1}[/tex]

it seems like the first term is -64, so lets write the formula accordingly:

a_n = a1(r)^(n-1)

where 'n' is the number of terms

a1 is the first term of the sequence

'r' is the ratio

the ratio is [tex]-\frac{1}{4}[/tex] because -64 * [tex]-\frac{1}{4}[/tex] = 16 and so on...

the explicit formula is :

[tex]a_{n}[/tex] = [tex]-64(-\frac{1}{4} )^{n-1}[/tex]

A number is equal to twice a smaller number plus 3. The same number is equal to twice the sum of the smaller number and 1. How many solutions are possible for this situation?
* Infinitely many solutions exist because the two situations describe the same line.
* Exactly one solution exists because the situation describes two lines that have different slopes and different y-intercepts.
* No solutions exist because the situation describes two lines that have the same slope and different y-intercepts.
* Exactly one solution exists because the situation describes two lines with different slopes and the same y-intercept.

Answers

Answer:

There is no solution to this.

Explanation :

We have a double system of equation to solve. Let x be the big number and let y be the smaller number, such that y < x.

x is equal to twice a smaller number plus 3, which translates into : x = 2y + 3

and x is equal to twice the sum of the smaller number and 1 : x = 2 * (y + 1)

We get this system to solve : [tex]\left \{{{x=2y+3} \atop {x=2(y+1)}} \right. \left \{{{x-2y=3} \atop {x-2y=2}} \right.[/tex]

It's either x minus 2y equals 3, or x minus 2y = 2 but it can't be both. No solutions exist because the situation describes two lines that have the same slope and different y-intercepts

look at the image below

Answers

Answer:

201.1 km²

Step-by-step explanation:

Surface area of a sphere= 4πr², where r = radius

so,

4πr²

= 4×π×4²

= 64π

= 201.1 km² (rounded to the nearest tenth)

please helpppp i need it by tonight its very important

Answers

Answer:

m<1=145

m<2=35

m<3=35

Step-by-step explanation:

measure one is supplementary(the angles add to 180) to measure four.

so we do 180-35=145

measure 2 is congruent to measure four because they are corresponding angles

so measure 2=35

and measure 3 is also congruent to measure 4 because the are corresponding angles

so m<3=35

terms are there. Divide 51 into three parts in AP so that the largest exceeds the smallest by 10.​

Answers

The first three terms of the Arithmetic Progression are 12, 17 and 22.

For an ARITHMETIC PROGRESSION, AP ;

First term = a

Second term = a + d

Third term = a + 2d

Where, d = common difference ;

If third term exceeds smallest by 10 ;

Third term - first term

a + 2d - a = 10

2d = 10

d = 10/2

d = 5

Sum of the three terms :

a + (a + d) + a + 2d = 51

3a + 3d = 51

d = 5

3a + 3(5) = 51

3a + 15 = 51

3a = 51 - 15

3a = 36

a = 12

The AP would be:

First term, a = 12

Second term, a + d = 12 + 5 = 17

Third term = a + 2(d) = 12 + 10 = 22

Therefore , the first three terms of the AP are :

12, 17 and 22

Learn more about ARITHMETIC PROGRESSION :

https://brainly.com/question/12006170

Jack’s backpack weighs 15 pounds. Fernando’s backpack weighs less than Jack’s. Which graph shows how much Fernando’s backpack can weigh?

Answers

Answer:

A

Step-by-step explanation:

c and d out of the question

b has its circle filled in meaning it could be 15lbs, which it's not

A correct answer by default

Answer:b

Step-by-step explanation: it has a filled in diamond which mean it's that...

Convert 0.450 to a proper fraction

Answers

Answer:

9/20

Step-by-step explanation:

450/1000

this is not the answer, because it is not simplified

so here we have to find common factor and simplifying

________________________________________________

450/1000 is simplified to 9/20, and it can no longer be simplified.

A car insurance company has determined that6% of all drivers were involved in a car accident last year. If14drivers are randomly selected, what is the probability of getting at most 3 who were involved in a car accidentlast year

Answers

Answer:

[tex]P(x \le 3) = 0.9920[/tex]

Step-by-step explanation:

Given

[tex]p = 6\%[/tex] --- proportion of drivers that had accident

[tex]n = 14[/tex] -- selected drivers

Required

[tex]P(x \le 3)[/tex]

The question is an illustration of binomial probability, and it is calculated using:

[tex]P(x ) = ^nC_x * p^x * (1 - p)^{n-x}[/tex]

So, we have:

[tex]P(x \le 3) = P(x = 0) +P(x = 1) +P(x = 2) +P(x = 3)[/tex]

[tex]P(x=0 ) = ^{14}C_0 * (6\%)^0 * (1 - 6\%)^{14-0} = 0.42052319017[/tex]

[tex]P(x=1 ) = ^{14}C_1 * (6\%)^1 * (1 - 6\%)^{14-1} = 0.37578668057[/tex]

[tex]P(x=2 ) = ^{14}C_2 * (6\%)^2 * (1 - 6\%)^{14-2} = 0.15591149513[/tex]

[tex]P(x=3 ) = ^{14}C_3 * (6\%)^3 * (1 - 6\%)^{14-3} = 0.03980719024[/tex]

So, we have:

[tex]P(x \le 3) = 0.42052319017+0.37578668057+0.15591149513+0.03980719024[/tex]

[tex]P(x \le 3) = 0.99202855611[/tex]

[tex]P(x \le 3) = 0.9920[/tex] -- approximated

Which two shapes make up the digital camera below?

Answers

Rectangular prism and cylinder

Rectangular prism and cylinder make up a camera.

What is rectangular prism and cylinder?

A cube is a rectangular prism with all of its sides being the same length, a triangular prism has a triangle as its base, and a rectangular prism has a rectangle as its foundation. Another form of right prism that has a circle as its basis is a cylinder.

A rectangular prism includes a total of 6 faces, 12 sides, and eight vertices. Like a cuboid, it contains three dimensions- the base width, the height, and the length. The top and base of the rectangular prism exist rectangular. The pairs of opposite faces of a rectangular prism exist as identical or congruent.

A cylinder contains traditionally been a three-dimensional solid, one of the most essential curvilinear geometric shapes. Geometrically, it includes been regarded as a prism with a circle as its base.

Hence, Rectangular prism and cylinder make up a camera.

To learn more about rectangular prisms and cylinders refer to:

https://brainly.com/question/15594686

#SPJ2

Starting with a fresh bar of soap, you weigh the bar each day after you take a shower. Then you find the regression line for predicting weight from number of days elapsed. The slope of this line will be:__________.

Answers

Answer:

The slope will be negative

Step-by-step explanation:

The slope of the regression line tells us about the relationship or behavior of the dependent and independent variables. In the scenario above, where the weight is being compared with the number of days elapsed. What is expected of the weight and quantity of a bar soap each time it is used for a shower is that it will decrease in weight. Therefore, as the number of days increases, and hence, number of showers rise, the weight of soap will decrease. Hence, we'll obtain a negative slope, one in which the increase in a variable leads to decrease in the other.

Other Questions
What was the major goal of the political reforms enacted during the Progressive Era (1900-1920)?1.expanding citizen participation in government2.lowering the legal voting age3.discouraging the formation of new political parties4.providing public funding of campaigns IN C++A. Create an abstract base class called Currency with two integer attributes, both of which are non-public. The int attributes will represent whole part (or currency note value) and fractional part (or currency coin value) such that 100 fractional parts equals 1 whole part. B. Create one derived class - Money - with two additional non-public string attributes which will contain the name of the currency note (Dollar) and currency coin (Cent) respectively. DO NOT add these attributes to the base Currency class.C. In your base Currency class, add public class (C++ students are allowed to use friend methods as long as a corresponding class method is defined as well) methods for the following, where appropriate:Default Construction (i.e. no parameters passed)Construction based on parameters for all attributes - create logical objects only, i.e. no negative value objects allowedCopy Constructor and/or Assignment, as applicable to your programming language of choiceDestructor, as applicable to your programming language of choiceSetters and Getters for all attributesAdding two objects of the same currencySubtracting one object from another object of the same currency - the result should be logical, i.e. negative results are not allowedComparing two objects of the same currency for equality/inequalityComparing two objects of the same currency to identify which object is larger or smallerPrint method to print details of a currency objectAll of the above should be instance methods and not static.The add and subtract as specified should manipulate the object on which they are invoked. It is allowed to have overloaded methods that create ane return new objects.D. In your derived Money class, add new methods or override inherited methods as necessary, taking care that code should not be duplicated or duplication minimized. Think modular and reusable code.E. Remember -Do not define methods that take any decimal values as input in either the base or derived classes. Only the print method(s) in the classes should print anything to console.Throw String (or equivalent) exceptions from within the classes to ensure that invalid objects cannot be created.F. In your main:Declare a primitive array of 5 Currency references (for C++ programmers, array of 5 Currency pointers).Ask the user for 5 decimal numbers to be input - for each of the inputs you will create one Money object to be stored in the array.Once the array is filled, perform the following five operations:Print the contents of the array of objects created in long form, i.e. if the user entered "2.85" for the first value, it should be printed as "2 Dollar 85 Cent".Add the first Money object to the second and print the resulting value in long form as above.Subtract the first Money object from the third and print the resulting value in long form as above.Compare the first Money object to the fourth and print whether both objects are equal or not using long form for object values.Compare the first Money object to the fifth and print which object value is greater than the other object value in long form.All operations in the main should be performed on Currency objects demonstrating polymorphism. Remember to handle exceptions appropriately.There is no sample output - you are allowed to provide user interactivity as you see fit. HELP ASAP!!!!!!!PLEASE SHOW WORK!!!!!! Picture with the question is posted. Please help Warby Parker, an online retailer for prescription eyewear, offers a free, try-on at home program for its customers. Customers browse frames on Warby Parkers website and select five pairs they would like to try on before buyingor not. Warby Parker handles all the shipping costs and provides all the return packaging. This relates to the________ of its products. Multiple Choicea. relative advantageb. complexityc. observabilityd. compatibilitye. trialability Can someone help me with this math homework please! A person who is abusing the drug heroin most likelyA. received a prescription for heroin from a doctor at first but then started abusing it as time went onB. started using heroin before any other drugs but will progress to more serious drug abuseC. tried Fentanyl but wanted something that was not as strong to use recreationallyD. used at least three other drugs before or while using heroin What is the energy change when 78.0 g of Hg melt at 38.8C From a random sample of 20 bars selected at random from those produced, calculations gave a mean weight of = 52.46 grams and standard deviation of s = 0.42 grams. Assuming t distribution is followed, construct a 90% confidence interval for the mean weight of bars produced, giving the limits to two decimal places. Find the factorization of the polynomal below 64x^2 + 48x + 9 Model a desert community where 60% is houses, 10% is shops, and 30% is parks. The global surface water area is 361, 132,000 square metres. Calculate the volume of water needed to cause a 3mm in sea level. Mr. Fischer, a bilingual teacher, teaches a mathematics class composed of native English speakers and English language learners (ELLs). He has introduced a new topic with new vocabulary words in which he presented the vocabulary words with several examples. Which of the following strategies should Mr. Fischer use next to check each student's understanding of the vocabulary words?a. having students look up the definition online to see if it matches what Mr. Fischer told themb. having students copy down the definition for each word that Mr. Fischer wrote on the board in Englishc. placing students in groups so each student can explain the vocabulary terms to their peers in Englishd. having students write a definition for each term in their own words in their native language Read the following sentence and identify its type.ResetCTVpleROSince it was the first class, the teacher made the students interact with eachother and get to know about one another.QuComplex sentenceCompound sentenceCompound-complex sentenceO Simple sentence Many Asian Americans ______ when they drink which may curb excessive alcohol intake and reduce their risk of developing alcoholism. Match the organelle (1-4) with the correct description (5-8). 1) mitochondrion 5) synthesizing molecules 2) centriole 6) liquid in cell 3) endoplasmic reticulum 7) provides cell with energy 4) cytosol 8) aids the formation of the spindle apparatusA) 1 and 5, 2 and 6, 3 and 7, 4 and 8 B) 1 and 7, 2 and 6, 3 and 8, 4 and 5 C) 1 and 7, 2 and 8, 3 and 5, 4 and 6 D) 1 and 8,2 and 5, 3 and 6, 4 and7 E) 1 and 6, 2 and 8, 3 and 5, 4 and7 Alice is walking home from school when she notices a change in the weather. She hears thunder in the distance, sees lightning and dark clouds approaching, feels the wet breeze of an approaching storm, and even smells the difference in the wind from the storm. Alice is able to organize all of these sensory cues into a meaningful idea due to her powers of ________. After reading the article "The Privacy Debate," what are threebenefits of people having access to your private life? Bluebean Inc. produces two lines of coffee cups: espresso coffee cups and travel coffee mugs. The unit cost information is shown here. The company uses a traditional volume-based costing system and believes that the number of labor hours is the appropriate cost driverActivity Cost Pool Espresso Coffee Cups Travel Coffee Mugs Selling price $20 $25 Direct materials $6 $8 Direct labor $2 $5 Units produced 10,000 units 4,000 units Direct labor hours 10,000 hours 6,000 hours Estimated total overhead costs $80,000Item Espresso coffee cups Travel coffee mugsPre-determined overhead rate Total manufacturing overhead allocated Manufacturing cost per unit Gross profit unit in what wat did WW1 represent a turning point in modern world history