James placed an online order for an item that costs US$75 via the Internet. Shipping and handling costs were charged at US$39. Given the exchange rate of US$1.00 to S$1.65, how much, in Singapore dollars, would James have to pay altogether?​

Answers

Answer 1

James wοuld have tο pay a tοtal οf 188.10 Singapοre dοllars fοr the item and shipping and handling cοsts.

What is prοbability?

Prοbability is a measure οf the likelihοοd οf an event οccurring. It is a numerical value between 0 and 1, where 0 means the event is impοssible and 1 means the event is certain tο οccur. Fοr example, the prοbability οf flipping a fair cοin and getting heads is 1/2 οr 0.5.

Tο calculate the tοtal cοst in Singapοre dοllars, we need tο cοnvert the US dοllars tο Singapοre dοllars using the given exchange rate, and then add the twο cοsts tοgether.

The cοst οf the item in Singapοre dοllars is:

75 USD * 1.65 SGD/USD = 123.75 SGD

The shipping and handling cοst in Singapοre dοllars is:

39 USD * 1.65 SGD/USD = 64.35 SGD

The tοtal cοst in Singapοre dοllars is the sum οf these twο cοsts:

Tοtal cοst = 123.75 SGD + 64.35 SGD = 188.10 SGD

Therefοre, James wοuld have tο pay a tοtal οf 188.10 Singapοre dοllars fοr the item and shipping and handling cοsts.

Learn more about Probability

https://brainly.com/question/29381779

#SPJ1


Related Questions

Work out the size of angle x. 79°) 35​

Answers

Answer: 66

Step-by-step explanation:

all 3 of them should equal to 180

so 79+35 is 114

180-114 will give us the answer which is 66

What does the point (5, 10) represent on the
graph?

Answers

Answer:

It means the point x = 5 and y = 10

Answer: The place 5 units right and 10 units up from the center of the graph (the origin).

Step-by-step explanation:

Starting at the origin, the 5 represents moving right 5, and the 10 represents going up 5.

f(x)
g(x)
=6x−4
=3x
2
−2x−10
Escribe (g∘f)(x) como una expresión en términos de x.

Answers

Answer:

g(x)

=6x−4

=3x

2

−2x−10

Escribe (g∘f)(x) como una expresión en términos de x.

Step-by-step explanation:

Primero necesitamos conocer la función f(x). Luego podemos sustituir f(x) en g(x) para obtener (g∘f)(x).

Como la función f(x) no se proporcionó en la pregunta, asumiré que f(x) es:

f(x) = x^2 - 2x + 1

Entonces, podemos sustituir f(x) en g(x) de la siguiente manera:

g(f(x)) = 6f(x) - 4

= 6(x^2 - 2x + 1) - 4 (sustituyendo f(x))

= 6x^2 - 12x + 2

Por lo tanto, (g∘f)(x) = 6x^2 - 12x + 2.

your friend claims the geometric mean of 4 and 9 is 6, and then labels the triangle, as shown. is your friend correct? explain your reasoning.

Answers

The correct option is -C: No, 6 is the geometric mean of 4 and 9, however if the altitude is 6, then the hypotenuse is the geometric mean of the two segments.

Explain about the geometric mean?

An average technique multiplies several values and determines the number's root is known as the geometric mean. You locate the nth root for their product for a collection of n numbers. This descriptive statistic can be used to sum up your data.

Mean Geometric The square root of the product of two numbers is the geometric mean amongst them. The geometric mean of two positive numbers an as well as b is the positive number x as in percentage Cross multiplication results in x² = ab,.

For the given question.

geometric mean of a and b :

From the drawn diagram.

a = 4

b = 9

x = √ab

x = √9*4

x = 6

geometric mean: 6

Applying the altitude rule:

h² = x.y

6² = 9*4

36 = 36

Thus, the geometric mean calculated by friend is correct but the marking on the diagram is wrong.

Know more about the geometric mean

https://brainly.com/question/3336179

#SPJ1

spinner is divided into seven equal sections numbered 1 through 7 If the spinner is spun twice, what is the theoretical probability that it lands on 2 and then an odd number?
A) 1/49
B) 4/49
C) 1/7
D) 4/7

Answers

Answer:

B is correct

Step-by-step explanation:

If it is spun twice then the probability of it landing on 2 and then an odd number is:

Pr(2,1) or Pr(2,3) or Pr(2,5) or Pr(2,7)

1/49 * 4

4/49

The table shows some points on the graph of exponential function g(x)
0 1 2 3 4 g(x) 1 3 9 27 81 What is the range of g?

Answers

the range of g is all positive numbers greater than or equal to 1. In set-builder notation, we can write the range of g as {g(x) | g(x) ≥ 1}.

How to solve and what is graph?

The range of a function refers to the set of all possible output values. Looking at the table, we can see that the output values of g(x) increase rapidly as x increases.

In fact, the output values of g(x) are the result of raising 3 to the power of x, which means that g(x) can never be negative. Therefore, the range of g is all positive numbers greater than or equal to 1. In set-builder notation, we can write the range of g as {g(x) | g(x) ≥ 1}.

A graph is a visual representation of data or mathematical functions. It is a diagram made up of points, lines, and curves that show the relationship between different variables or data points.

Graphs are used to display and analyze data, to illustrate trends and patterns, and to communicate complex information in an easily understandable way. There are many different types of graphs, including bar graphs, line graphs, pie charts, scatter plots, and more, each suited to different types of data and analysis.

To know more about Graph related questions, visit:

https://brainly.com/question/17267403

#SPJ1

What gravitational force does the moon produce on the Earth if their centers are 3.88x108 m apart and the moon has a mass of 7.34x1022 kg?

Answers

The gravitational force that the moon produces on the Earth is approximately [tex]1.98 \times 10^{20}\ \mathrm{N}$.[/tex]

What is gravitational force?

Gravitational force is the force of attraction that exists between any two objects in the universe with mass. This force is directly proportional to the masses of the objects and inversely proportional to the square of the distance between their centers.

The gravitational force that the moon produces on the Earth can be calculated using the formula:

[tex]F = G \cdot \frac{m_1 \cdot m_2}{r^2}[/tex]

where:

[tex]G$ = gravitational constant = $6.67430 \times 10^{-11}\ \mathrm{N(m/kg)^2}$[/tex]

[tex]m_1$ = mass of the moon = $7.34 \times 10^{22}\ \mathrm{kg}$[/tex]

[tex]m_2$ = mass of the Earth = $5.97 \times 10^{24}\ \mathrm{kg}$ (approximate)[/tex]

[tex]r$ = distance between the centers of the Earth and the moon = $3.88 \times 10^8\ \mathrm{m}$[/tex]

Substituting these values into the formula, we get:

[tex]F &= 6.67430 \times 10^{-11} \cdot \frac{7.34 \times 10^{22} \cdot 5.97 \times 10^{24}}{(3.88 \times 10^8)^2} \&= 1.98 \times 10^{20}\ \mathrm{N}[/tex]

Therefore, the gravitational force that the moon produces on the Earth is approximately [tex]1.98 \times 10^{20}\ \mathrm{N}$.[/tex]

To learn more about gravitational force visit:

https://brainly.com/question/29328661

#SPJ1

A candy store owner used a cylindrical wooden log as a bench in their store. The height
of that log was 2
feet. The diameter of its base was 1.25
feet. If it costs $7.20
per square foot to paint that log at every side, how much approximately will it cost the
store owner? The total surface area of the right circular cylinder is 2nrh+2rr2
, where, r
is the radius of the base of the cylinder and, h
is the height of the cylinder

Answers

Answer:

Step-by-step explanation:

its 60

The graph of y = 5x2 is

Answers

Answer:

................................

locate the absolute extrema of the function
on the closed interval

Answers

Answer:

To find the integral of f(x) = 2x + 5/3 over the interval [0, 5], we can use the definite integral formula:

∫[a,b] f(x) dx = F(b) - F(a)

where F(x) is the antiderivative of f(x).

First, we find the antiderivative of f(x):

F(x) = x^2 + (5/3)x + C

where C is the constant of integration.

Next, we evaluate F(5) and F(0):

F(5) = 5^2 + (5/3)(5) + C = 25 + (25/3) + C

F(0) = 0^2 + (5/3)(0) + C = 0 + 0 + C

Subtracting F(0) from F(5), we get:

∫[0,5] f(x) dx = F(5) - F(0)

= 25 + (25/3) + C - C

= 25 + (25/3)

= 100/3

Therefore, the definite integral of f(x) = 2x + 5/3 over the interval [0, 5] is 100/3.

Question 13 (2 points)
Suppose you flip a coin and then roll a die. You record your result. What is the
probability you flip heads or roll a 3?
1/2
3/4
7/12
1

Answers

Step-by-step explanation:

a probability is always the ratio

desired cases / totally possible cases

we have 2 possible cases for the coin and 6 possible cases for the die.

so, we have 2×6 = 12 combined possible cases :

heads, 1

heads, 2

heads, 3

heads, 4

heads, 5

heads, 6

tails, 1

tails, 2

tails, 3

tails, 4

tails, 5

tails, 6

out of these 12 cases, which ones (how many) are desired ?

all first 6 plus (tails, 3) = 7 cases

so, the correct probability is

7/12

formally that is calculated :

1/2 × 6/6 + 1/2 × 1/6 = 6/12 + 1/12 = 7/12

the probability to get heads combined with the probability to roll anything on the die, plus the probability to get tails combined with the probability to roll 3.

How do you write 0.38 as a percentage?

Write your answer using a percent sign (%).

Answers

Answer:

38%

Step-by-step explanation:

I learned in class on Friday.

Multiply both numerator and denominator by 100. We do this to find an equivalent fraction having 100 as the denominator.

[tex]0.38\times \dfrac{100}{100}[/tex]

[tex]= (0.38 \times 100) \times \dfrac{1}{100} =\dfrac{38}{100}[/tex]

Write in percentage notation: 38%

if the area to the left of x in a normal distribution is 0.123, what is the area to the right of x? [1 point]

Answers

The area to the right of x is 0.877.

In a normal distribution, the entire area under the curve is identical to 1. The area to the left of a specific value of x represents the possibility of observing a value largely lesser than or same tox.

However, we're capable to discover the area to the right of x with the aid of abating the left area from 1, If the place to the left of x is given.

In this case, the area to the left of x is 0.123. thus, the place to the right of x is

1-0.123 = 0.877

Thus, the area is 0.877 to the right of x.

Learn more about Normal Distribution:-

https://brainly.com/question/23418254

#SPJ4

How many proper subsets are in {2,4,6,8...100}

Answers

Answer:

159 proper subsets.

Step-by-step explanation:

Given a set {2, 4, 6, 8...100}, how many proper subsets are there?

First, find how many subsets there are in 2 - 10:

That's 16.

Then because there are 10 10s in 100, multiply by 10:

16 x 10 = 160

Finally, because it says proper subsets, subtract by 1:

160 - 1 = 159 proper subsets.

Therefore, there are 159 proper subsets in {2, 4, 6, 8...100}

please help with finding the answer

Answers

The answer of the given question based on the  transformation from its parent function the explanation part is given below and The equation of the function is y = -2(x+3)².

What is Function?

In mathematics,  function is  relation between  set of inputs and  set of possible outputs with  property that each input is related to exactly one output. It is  rule that assigns to each input value exactly one output value. Functions can be represented in various ways, like algebraic expressions, graphs, tables, and words. They are used to model relationships between variables, to describe how one quantity depends on another, and to make predictions about future values. Functions are  important concept in many fields of mathematics, as well as in science, engineering, economics, and other areas where quantitative analysis is used.

a. The graph appears to be a reflection of the parent function f(x) = x² over the x-axis followed by a vertical stretch by a factor of 2 and a horizontal shift to the left by 3 units.

b. The equation of the function is y = -2(x+3)².

To know more about Variable visit:

https://brainly.com/question/2466865

#SPJ1

Three dice are rolled. What is the probability of getting the sum as 13?

Answers

When three dices are rolled.

Total number of outcomes =  = 216

Sum of 13 can be achieved in the following ways:

From the digits 6,4,3

So, there are 3! ways =  = 6

From the digits 6,2,5

So, there are 3! ways =  = 6

From the digits 5,4,4

So, there are  ways = 3

From the digits 6,6,1

So, there are  ways = 3

From the digits 3,5,5

So, there are  ways = 3

So, total numbers whose sum is 13=

So, Probability = .

Therefore, the probability of getting sum as 21 on rolling three dice =   .

Which of the following is true regarding cross-sectional data sets? Check all that apply. The data consist of a sample of multiple individuals. It can be assumed that the data were obtained through a random sampling of the underlying population. These data require attention to the frequency at which they are collected (weekly, monthly, yearly, etc.). The data are collected at approximately the same point in time.

Answers

The correct options are:

The data contain a sample of multiple individuals.

The data are collected  are approximately at  the same point in time.

Cross-sectional data sets are a type of research design used in statistical analysis. They consist of a sample of multiple individuals or entities observed at a single point in time. One of the characteristics of cross-sectional data sets is that they do not involve any observation or measurement over time, making them different from longitudinal or time-series data sets.

One advantage of cross-sectional data sets is that they are relatively easy and inexpensive to collect. It can be assumed that the data were obtained through a random sampling of the underlying population, making them representative of the larger population. However, these data require attention to the frequency at which they are collected (weekly, monthly, yearly, etc.), as the timing of data collection can impact the results.

Overall, cross-sectional data sets can provide a snapshot of a population or phenomenon at a specific point in time, making them useful for a wide range of research questions in social, economic, and political sciences.

Find out more about Cross-sectional data

at brainly.com/question/14364178

#SPJ4

the circumference of a circle is 4.8m. Calculate the area of the circle​

Answers

Answer:

A≈1.83m²

Step-by-step explanation:

Using the formulas

A=πr2C=2πr

Solving forAA=C24π=4.824·π≈1.83346m²

Answer:

1.83 (approximate)

Step-by-step explanation:

First, we need to find the radius of the circle.

Using the formula:

[tex]C=2 \pi r[/tex]

We have to reorganize terms:

[tex]r=\frac{C}{2\pi}[/tex]

[tex]\frac{4.8}{2 \times \pi}[/tex]

r ≈ 0.76

Now we have the radius and the circumference in order to find the area.

Use the formulas:

[tex]A= \pi r^2[/tex]

[tex]C=2 \pi r[/tex]

A = C^2/4[tex]\pi[/tex]  = 4.8^2 / 4 * pi = 1.83

PLEASE HELP FAST!!
Find the slope of a line perpendicular to the line whose equation is
4x−6y=−24. Fully simplify your answer.

Answers

Answer: -3/2

Step-by-step explanation:

FIrst rearrange the equation in y = mx + b form.

4x - 6y = -24

-6y = -4x - 24

y = 2/3x + 4

If the line is perpendicular, the slope must be the negative reciprocal of the current line.

The negative reciprocal of 2/3 is -3/2.

Please answer the attached question

Answers

The values of e and f in the given equation are: e = 2√3 ± √(4√3), e = 2√3 ± 2√2, and f = 4√3.

How are radicals solved?

Equations containing radicals can be made simpler by solving the resultant equation after squaring both sides of the equation to remove the radical. Nonetheless, caution must be exercised to guarantee that any solutions found are reliable and adhere to any variables' limitations.

The given equation is [tex](e - 2\sqrt{3} )^2[/tex] = f - 20√3.

Expanding the left side of the equation we have:

[tex](e - 2\sqrt{3} )^2[/tex] = (e - 2√3)(e - 2√3)

= [tex]e^2[/tex] - 2e√3 - 2e√3 + 12

= [tex]e^2[/tex] - 4e√3 + 12

Substituting back in the function

[tex]e^2[/tex] - 4e√3 + 12 = f - 20√3

[tex]e^2[/tex] - 4e√3 - f + 20√3 - 12 = 0

Using the quadratic formula:

e = [4√3 ± √(16*3 + 4(f - 20√3 + 12))] / 2

e = [4√3 ± √(4f - 64√3)] / 2

e = 2√3 ± √(f - 16√3)

Now for,

(e - 2√3)² = f - 20√3

(2√3 + √(f - 16√3) - 2√3)² = f - 20√3

f - 20√3 = f - 16√3

f = 4√3

Hence, the values of e and f in the given equation are: e = 2√3 ± √(4√3), e = 2√3 ± 2√2, and f = 4√3.

Learn more about radicals here:

brainly.com/question/1369233

#SPJ1

can someone help me? please
evalute the following function h(x)=3x2+ax-1 for h(3) and find the value for a.​

Answers

Answer:

Step-by-step explanation:

[tex]h(3)=3\times 3^2+3a-1 \rightarrow h(3)=26+3a[/tex]

But we cannot find [tex]a[/tex] unless we are told what [tex]h(3)[/tex] equals.

State if the triangles in each pair are similar

Answers

Answer:

They are similar

Step-by-step explanation:

It's because 27/18 = 12/8

27/18 = 1.5

12/8 = 1.5

what is the answer?
?
No, there is not enough information
Yes, because of the intermediate value theorem

Answers

Because g(x) is continuous on the interval, we can see that the correct option is the last one (counting from the top)

Does the value c exists in the given interval?

Here we have the function g(x), and we know that it is continuous on the interval [1, 6], and that:

g(1) = 18

g(6) = 11

If it is continuous, then g(x) covers all the values between 18 and 11 in the given interval, this means that there must exist a value c in the given interval such that when we evaluat g(x) in that value c, we get the outcome 12, and we know this by the intermediate value theorem.

So the correct optionis the last one.

Learn more about continuous functions at

https://brainly.com/question/18102431

#SPJ1

TRUE/FALSE. Let B.C be ordered bases for R" and & the standard basis for R". Suppose T:R" Ris a linear transformation. If Ic.B = Tç, e then B = E = C.

Answers

Let B.C be ordered bases for R" and & the standard basis for R". Suppose T:R" R is a linear transformation. If Ic.B = Tç, e then B = E = C.

The above statement is True.

In mathematics, and more specifically in linear algebra, a linear map (also called a linear map, a linear transformation, a vector space homomorphism, or in some cases a linear function) is a map between two vector spaces V → W, which performs the conservation of operations on vectors. Addition and scalar multiplication. The same names and definitions are also used for the more general case of modules over rings; see the homomorphism of modules.

A linear map is called a linear isomorphism if it is a bijection. In the case V=W, the linear map is called linear automorphism. Sometimes the term linear operator refers to this case, but the term "linear operator" can have different meanings for different conventions: for example, it can be used to emphasize that V and W are real vector spaces (not necessarily that V = W, where V is the space of functions, which is a common convention in functional analysis.

Sometimes the term linear function has the same meaning as linear map, but not in analysis.

Learn more about Linear Transformation:

https://brainly.com/question/30822858

#SPJ4

Help pleaseeee!!


On January 1, 2014, the federal minimum wage was $7.25 per hour. Which graph has a slope that best represents this rate?

Answers

The horizontal line at $7.25 on the y-axis of the graph is the one with a slope that most accurately depicts the federal minimum wage of $7.25 per hour as of January 1, 2014.

Which federal minimum wage was the highest?

Although it varies from state to state, the federally mandated minimum wage in the United States is $7.25 per hour. The District of Columbia had the highest minimum wage in the US as of January 1, 2023, at 16.50 dollars per hour.

How are minimum wages determined?

The variable dearness allowance (VDA) component, which takes into account inflationary trends, such as an increase or fall in the Consumer Price Index (CPI), and, if applicable, the housing rent, are included in the computation of the monthly minimum salary.

To know more about graph visit:-

https://brainly.com/question/17267403

#SPJ1

Below is the graph of a trigonometric function. It has a minimum point at

(1, 1.5) and an amplitude of 1.5. What is the midline equation of the function?

Answers

The midline equation of the function is y = 1.5.

What is amplitude of trigonometric functions?

The gap between a trigonometric function's highest and least values is known as its amplitude. The difference between the greatest and minimum numbers is, in other words, divided by two. For instance, the amplitude is A in the equation y = A sin(Bx) + C. The amplitude, also known as the average value of the function across a period, denotes the "height" of the function above and below the midline. It gauges the magnitude or intensity of the oscillation of the function's representation of. The oscillation is more prominent and subtler depending on the amplitude, which ranges from higher to lower values.

Given that, the function has minimum point at (1, 1.5) and an amplitude of 1.5.

Using the definition of the amplitude the midline is the given amplitude.

Hence, the midline equation of the function is y = 1.5.

Learn more about amplitude here:

https://brainly.com/question/9124856

#SPJ1

Answer:

3

Step-by-step explanation:

Khan Academy

A company manufactures rubber balls. The mean diameter of a ball is 12 cm with a standard deviation of 0.2 cm. Define the random variable X in words. X = ______________.

Answers

A company manufactures rubber balls, random variable X in words is diameter of the rubber ball, standard deviation is -1.5 and z-score of the x = 2 is 2.123.

A random variable is a variable with an unknown value or a function that gives values to each of the results of an experiment. Random variables are frequently identified by letters and fall into one of two categories: continuous variables, which can take on any value within a continuous range, or discrete variables, which have specified values.

In probability and statistics, random variables are used to measure outcomes of a random event, and hence, can take on various values. Real numbers are often used as random variables since they must be quantifiable.

1) X denotes the diameter of the rubber ball.

So the correct option was A. (option A)

Therefore,  the random variable X in words is diameter of the rubber ball.

2) For 1.5 Standard deviations left to the mean , Z score will be -1.5

option(A)

So, standard deviation to the left of the mean is -1.5.

3) [tex]Z=\frac{(x-\mu)}{\sigma}[/tex]

x=2

sigma = √2

Z = 2-(-1)/ √2

Z = 3/√2

Z = 2.123

Hence, the z-score of the x = 2 is 2.123.

Learn more about Random variable:

https://brainly.com/question/16106278

#SPJ4

Complete question:

A company manufactures rubber balls. The mean diameter of a rubber ball is 12 cm with a standard deviation of 0.2 cm. Define the random variable X in words. X

diameter of a rubber ball

rubber balls

mean diameter of a rubber ball

12 cm

Question 2 What is the z-score of x=9, if it is 1.5 standard deviations to the left of the mean? Hint: the z-score of the mean is =0 −1.5 1.5 9 Question 3 Suppose X∼N(−1,2). What is the z-score of x=2 ? Hint: z=(x−μ)/σ 1.5 −1.5 0.2222

What is the end behavior of the polynomial function?

Answers

Answer: D. As x → -∞, y → -∞.

Step-by-step explanation:

The graph shows the function approaching negative infinity on the x-axis (left side).  When the x-axis is decreasing, the y-axis is also decreasing towards negative infinity.

Which construction is shown in the diagram below?

Answers

Answer:

Step-by-step explanation:

i think it B

Let f(x) = x? - 6x + 8 and g (x) = x - 5.
Find (f + g) (x) and (f - g) (x) .

Answers

Answer:

(f + g)(x) = x^2 - 5x + 3.

(f - g)(x) = x^2 - 7x + 13

Step by step explanation:

To find (f + g)(x), we add the functions f(x) and g(x) together:

(f + g)(x) = f(x) + g(x) = (x^2 - 6x + 8) + (x - 5)

Combining like terms, we get:

(f + g)(x) = x^2 - 5x + 3

Therefore, (f + g)(x) = x^2 - 5x + 3.

To find (f - g)(x), we subtract the function g(x) from f(x):

(f - g)(x) = f(x) - g(x) = (x^2 - 6x + 8) - (x - 5)

Again, combining like terms, we get:

(f - g)(x) = x^2 - 7x + 13

Therefore, (f - g)(x) = x^2 - 7x + 13.
Other Questions
Dear Mom,I think we should get a pet dog. Dogs make great pets because they are loyal.They help deter criminals, like thieves. They also help boost peoples moods becausethey are friendly and playful. Doctors have even found that owning a dog can improvea persons health. They reduce the risk of cardiovascular disease and they help preventallergies, asthma, and eczema in children! You might think that I am not responsibleenough to have a pet dog. But, I have demonstrated responsibility by making my bedevery morning and doing my homework every afternoon. I know that I would beresponsible for walking our pet dog and cleaning up after it. Getting a pet dog wouldbe good for our whole family!Love, Nataliearguments lang po How has social mediachanged how you learnabout, interpret, andderive conclusionsabout American politicstoday? Helppp how does technological change affect the per-worker production function? what is the common molecule involved in the catabolism of proteins, fats, and carbohydrates? many companies, called allied industries, do not sell food directly but are still deeply involved in the food industry. the dairy industry is a good example of an allied industry. which of the following was not a consequence of the american policy of raising tariffs sky-high in the 1920s? you have an rc circuit with a time constant of 5.35 s. if the total resistance in the circuit is 231.2 k , what is the capacitance of the circuit (in f)? don't type the units into the answer box. .the him manager tasked the coding manager to development a dashboard that shows the discharges pending final billing so that she can plan for staffing. because this data changes throughout the day, what analysis technique is needed? what is a moral & legalabligation?- what kind of a person do you think?-what moral a bligation do you fulfill in your community?-what you can do to/what you can do? true ior false once credit is established, most people should plan on having at least eight to ten credit cards at any given time Which one of the following compounds is a non-electrolyte when dissolved in water?Cu(NO3)2CaCl2HClNaCH3CO2CCl4 Smores, a Taste of Multivariate Normal Distribution Smores Company store makes chocolate (Xi), marshmallow (X2), and graham cracker (Xs). Assume that the profit (in millions) for selling these smores materials follow a multivariate uormal ditributim with parameters 1 0.3 0.3 and = 0.31 0 0.3 01 What is the probability that 1. the profit for selling chocolate is greater than 6 millions? 2. the profit for selling chocolate is greater than 6 millions, given the sales of marshmallow is 5 million and the sales of graham cracker is 5 mllion? 3. P(3X1-1X2 + 3X3 > 20)? suppose the temperature of the input reservoir does not change. as the sink temperature is lowered, the efficiency of the engine_____ g a random sample of 100 automobile owners in the state of alabama shows that an automobile is driven on average 23,500 miles per year with a standard deviation of 3900 miles. assume the distribution of measurements to be approximately normal. a) construct a 99% confidence interval for the average number of miles an automobile is driven annually in alabama. The Senate and House of Representatives together have how manymembers? inflation-indexed treasury bonds are intended for investors who wish to ensure that the returns on their investments keep up with the increase in prices over time. a. true b. false God The midwives refused to kill Hebrew babies. Onemidwife was named(1:15) a person recently was diagnosed with social anxiety disorder. a best guess is that the person is in school and is likely than average to have a close relative with social anxiety disorder. group of answer choices elementary; more high; more elementary; less high; less candidates who are behind in election polls often use as a way to gain momentum and make the race competitive. AA contestant on a game show has a 1 in 6 chance of winning for each try at a certain game. Which probability models can be used to simulate the contestants chances of winning?Select ALL of the models that can be used to simulate this event.A) a fair six-sided number cubeB) a fair coinC) a spinner with 7 equal sectionsD) a spinner with 6 equal sectionsE) a bag of 12 black chips and 60 red chips