Answer: B
Explanation: Apex
An electron configuration be used to predict relative atomic size because the larger the highest energy level number, the larger the atomic
radius.
The electron configuration of an element shows the arrangement of electrons in atoms of that element.
As more sublevels are added, repulsion between electrons occupying shells increases causing a greater shielding and consequent increase in the size of the atom.
Hence, the larger the highest energy level number, the larger the atomic
radius.
Learn more: https://brainly.com/question/238050
please help :) How can scientists ensure that their data are reliable? A) by making a single observation B) by recording values without units C) by keeping the results private D) by repeating trials during an experiment
Answer:
D. by repeating trials during an experiment
Explanation:
chile its actually d
Explanation:
why is an element considered a pure substance
Answer:
Because they cannot be separated into more then one type of substance.
Explanation:
Answer:
Elements are made of only one kind of atom. The particles can be a single atom or a molecule made of only one kind of atom. There is no physical change that can separate elements into more than one kind of substance. This makes an element a pure substance.An element is made up of only one type of atom. An element cannot be broken down into a simpler form.
In the image above the ruler is measuring in centimeters. The blue cylinder falls somewhere between 2.7cm and 2.8cm according to the ruler. Since we can estimate the last digit I would say that the length of the cylinder is 2.76cm. Since I am estimating any number 2.72cm or 2.78cm could also be correct.
Why would 2.755 not be a correct measurement according to estimating the last digit?
Answer:
The answer is below
Explanation:
Resolution is the smallest unit of measurement that can be measured by a measuring instrument. Each point on the ruler is 0.1 cm and the difference between any two points, about 0.01 cm cam be measured. The minimum measurement (resolution) that can be measured by the ruler is 0.01 cm (two decimals), therefore it cannot measure up to three decimal places such as numbers like 2.755.
Increasing temperature can
What is the complete ionic equation for this reaction?
2KOH(aq) + H2SO4(aq) → 2H20(1) + K2SO4(aq)
O A. 2K+ + OH + H2SO4 → OH + 2H+ + K2SO4
B. OH + 2H+ + 2H20()
C. 2KOH + H2SO4 → 2H20 + K2SO4
D. 2K+ + OH + 2H+ + SO42- → 2H20() + 2K+ + SO42-
SUBMIT
Answer:
The answer is "Option D".
Explanation:
The entire ionic equation for all the substances, which are ionic compounds but are available in an aquatic is represented in the form with ions in the full ionic equation.
In the Net ionic equation, it doesn't have the particulate matter throughout the net ionic equations throughout the equations.
In the Spectator ions, it doesn't participate in interactions mostly on reaction and the material hand. From both sides, the very same ions are present.
The evenly balanced chemical formula is,
[tex]2KOH (aq)+ H_2SO_4(aq) \longrightarrow 2H_2O(l) + K_2SO_4[/tex]
It is the separate organic compound that full ion formula will match the choice D.
For the set of ionic compounds, CaSO4, CaCO3, Ca(OH)2, choose the correct characterization of their solubilities in water from the response list. Group of answer choices None of the three salts are soluble. All three salts are soluble. Two of the three salts are soluble. One of the three salts is soluble.
Answer:
None of the three salts are soluble.
Explanation:
According to the solubility rule, the carbonates and sulphates of group two elements are insoluble in water.
All three substances mentioned possess very low solubility in water and can be said to be slightly soluble in water. If we compare them with other ionic substances that dissolve readily in water, we can rightly say that they are insoluble in water.
Hence all three substances are insoluble in water.
Chemical change example
Answer: burning paper
Explanation:
The paper burns in air to form smoke and ash. which makes it a chemical change.
The table describes how some substances were formed.
Substance
P.
Q
Description
Formed by boiling pure water
Formed by combining three hydrogen atoms to every nitrogen atom
Formed by adding 5 g of sugar to 1 L of water
Formed by compressing carbon under high pressure
R
S
Based on the given descriptions, which substance is most likely a mixture?
P
Q
R
S
Explanation:
Which is a pure substance?
1. soda
2. gasoline
3. salt water
4. carbon dioxide
carbon dioxide
Bromine, a liquid at room temperature, has a boiling point of 58°C and a melting point of -7.2°C. Bromine can be classified as a
1. compound.
2. impure substance.
3. mixture.
4. pure substance.
pure substance.
Answer:
the answer is
Explanation:
Sugar and water make a homogeneous mixture (the same proportions of its components throughout any given sample).
which statement is true about this reaction 14/7n + 1/1h ------> 15/8o
A. it is a practical source of energy on earth
B.it occurs only outside the solar system
C.its product is heavier than each of its reactants
D.it shows the critical mass of an element
Answer: answer is C
Explanation:
Its product is heavier than each of its reactants is true about this ₇N¹⁴ + ₁H¹ → ₈O¹⁵ reaction
What is Nuclear reaction ?A nuclear reaction is a reaction in which one or more than one nuclides are generate and it collides between two atomic nuclei or one atomic nucleus.
The reaction is
₇N¹⁴ + ₁H¹ → ₈O¹⁵
Now equating the mass number of both sides
14 + 1 = 15 + a
a = 0
Equating atomic number of both sides
7 + 1 = 8 + x
x = 0
Thus, we can say that its product is heavier than each of its reactants is true about this reaction
Hence, option C is correct answer.
Learn more about Nuclear reaction here: https://brainly.com/question/25387647
#SPJ2
Examine the given reaction. NH4NO3(s) → NH4+(aq) + NO3–(aq) ΔH° = 25.45 kJ/mol ΔS° = 108.7 J/mol·K Which of the given is correct about the ΔG° at 25 °C?
A)+4,360 J
B)−6,942 J
C)−4,360 J
D)+6,942 J
Answer:
B)−6,942 J /mol
Explanation:
At constant temperature and pressure, you cand define the change in Gibbs free energy, ΔG, as:
ΔG = ΔH - TΔS
Where ΔH is enthalpy, T absolute temperature and ΔS change in entropy.
Replacing (25°C = 273 + 25 = 298K; 25.45kJ/mol = 25450J/mol):
ΔG = ΔH - TΔS
ΔG = 25450J/mol - 298K×108.7J/molK
ΔG = -6942.6J/mol
Right solution is:
B)−6,942 J /molWhat is the product of the reaction of pentanoic acid with ethanol in the presence of a strong acid?
Answer:
ethylpentanoate
Explanation:
Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.
The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;
CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)
The name of the compound formed is ethylpentanoate.
Lab Safety Rule #3 says to always add acids or bases to the solvent and NEVER the other way around true or false?
Answer:
true
Explanation:
The standard laboratory rule is to always add acids or bases to solvent and not the other way round.
The dissolution of concentrated acids/bases in solvents (water) generates heat energy. Thus, if the solvent is added to them, a layer of hot weak acid or base will be formed and this will boil and spray around, causing an explosion.
On the other hand, if acid/base is added to solvents, they flow into the solvents and get diluted immediately without any boiling taking place. Hence, it is safe to add acid/base to solvents and not the other way round.
Di- Ethyl zinc is a chemical used in the library to protect books from worms, its composition is 53% Zinc, 38.9% Carbon, and 8.1% Hydrogen (At mass of Zn=65.4, C=12, H=1). Find the empirical formula of a compound
Answer:
ZnC4H10
Explanation:
The empirical formula of a compound refers to the formula that gives the simplest whole number ratio of each atoms of the elements in the compound.
The empirical formula is calculated thus:
The given percentages in the question represent the mass in grams of each element in the compound.
Zinc= 53%, C= 38.9%, H= 8.1% which represents 53g, 38.9g and 8.1g of each element respectively.
Molar Mass of Zn= 65.4 g/mol
Molar Mass of C= 12 g/mol
Molar Mass of H= 1 g/mol
Step 1: Divide the mass of each element by the molar mass given to convert to moles:
Zn= 53/65.4 = 0.81moles
C= 38.9/12 = 3.24moles
H= 8.1/1 = 8.1moles
Step 2: Divide each mole value by the smallest number of moles calculated, which is 0.81moles:
Zn= 0.81/0.81 = 1
C= 3.24/0.81 = 4
H= 8.1/0.81= 10
This is the mole ratio represented in the subscript of each element in the empirical formula:
That is, Zn (1) C (4) H (10)
Empirical formula= ZnC4H10
Describe the reaction of an acid with an alkali.?
Your question has been heard loud and clear.
The reaction of an acid with an alkali is neutralization reaction. It is a neutralization reaction because , they both neutralize each other (means it makes them chemically inactive after reacting) and produce a salt , and maybe water too.
An example: hydrochloric acid + sodium hydroxide → sodium chloride + water
Thank you
it will neutralise because if you add both of them together with a matching Ph such as 5 and 9 equally then it will neutralise and have a Ph of 7
could you please make me brainliest
Write down the dissolution equation for nickel(II) perchlorate dissolving in water. (Perchlorate is a polyatomic ion with the formula ClO41-.) If four moles of the ionic compound are dissolved, then how many moles of the ANION are present in the solution?
Answer:
Ni(ClO₄)₂(aq) ⇒ Ni²⁺(aq) + 2 ClO₄⁻(aq)
8 mol ClO₄⁻
Explanation:
Let's consider the dissolution equation for nickel(II) perchlorate dissolving in water.
Ni(ClO₄)₂(aq) ⇒ Ni²⁺(aq) + 2 ClO₄⁻(aq)
The molar ratio of Ni(ClO₄)₂ to ClO₄⁻ is 1:2. If 4 moles of Ni(ClO₄)₂ are dissolved, the moles of ClO₄⁻ formed are:
4 mol Ni(ClO₄)₂ × (2 mol ClO₄⁻/ 1 mol Ni(ClO₄)₂) = 8 mol ClO₄⁻
Which of the following is not an antioxidant _________
1) Sodium benzoate 2) Sulphur dioxide 3) Sulphite salts 4) Citric acid
Answer: 1. Sodium Benzoate
Explanation: An anti-oxidant is a substance that can help prevent or stop the damage done by free radicals. Examples include; Sulphur Dioxide, Sulphite Salts, Citric Acid, e.t.c
Sodium benzoate is a pure preservative.
what’s the answer to this?
what is mean by stakeholder
Answer:
a stakeholder is a party that has an interest in a company and can either effect or be affected by the business. the primary stakeholder in a typical corporation are its investors , employees, customers and supplies.The primary function of a scuba regulator is to: Reduce high-pressure gas in the scuba cylinder to a more breathable intermediate pressure. Reduce high-pressure gas in the scuba cylinder to ambient (surrounding) pressure. Provide a diver with a continuous flow of oxygenated air. None of the above.
Answer:
Reduce high-pressure gas in the scuba cylinder to ambient (surrounding) pressure.
Explanation:
The primary function of a scuba regulator would be to reduce high-pressure gas in the scuba cylinder to ambient pressure.
A scuba regulator is a structure found attached to the scuba cylinder usually carried by scuba divers. The structure regulates the pressure of the breathing gas in the cylinder to a safe level before the gas becomes available for the breathing process of divers.
Usually, the gas in a scuba cylinder is at a high level. Hence, what the regulator does is to bring it down to a level that would be safe for the breathing of the diver.
3. why are fire tornadoes rare ?
Answer in the correct significant figures: 35.6 + 56.27 *
Answer:
101.87
Explanation:
that's the answer
When a substance's particles are packed together tightly and have a definite shape and
volume...it is said to be in what state?
solid
gas
plasma
liquid
Answer:
solid
Explanation:
Sulphur dioxide is a common pollutant from burning coal.State two effects caused by this pollutant and also write the chemical equation.
Heya!
Sulfur dioxide - ( SO2 )
Answer:
Sulfur dioxide is a common pollutant caused due to the burning of coal,Is very harmful for the environment and health.Effects:
Health effects-Sulfur dioxide effects the respiratory system which includes the functioning of lungs,respiratory track and causes infections,can also effect and irritate the eyes and causes aggravating conditions such as asthma and chronic bronchitis.As most sulfur dioxide air pollution comes from the burning of coal and oil in power plants. It is a emitted by trains, large ships and other diesel objects that burns alota sulfur fuel so this also effects the environment like plants and others as the air lacks oxygen ,but with more sulfur dioxide.Hope this helps!
Have a nice day!:)
Which of these is true about electrons? posses a positive electrical charge of one (+1) have a negative electrical charge of one (-1) indicates the number of protons in each atom equals the sum of protons plus neutrons in each atom
Answer:
have a negative electrical charge of one (-1)
Explanatio
Electrons have an electrical charge of negative one. When you think electron, always think -1
which state of matter is Na OH(s)
Explanation:
SOLID
Sodium hydroxide exists in the solid phase at room temperature. You would find it in the lab as hemispherical white solid pellets. The phase of a substance depends on temperature and pressure. As you heat a solid, it will melt and change to the liquid phase.
What is the molarity of a 50.0ml aqueous solution containing 10.0 grams of hydrogen peroxide H2O2
Molarity= No of moles of solute * 1000 / vol solution in ml
No of moles= Given mass / Molar mass
Given Mass of solute (H2O2)= 10g
Molar mass of H2O2=34gmol^-1
No of moles= 10/34= 0.294 moles
Volume of solution=50ml
Molarity = 0.294*1000 / 50
Molarity = 5.8M
It requires work to _____. A. stretch a spring only B. compress a spring only C. stretch or compress a spring
Answer:
C.
Explanation:
It requires work to stretch or compress a spring.
Answer:the answer is c
Explanation: i say that because with work you can do both of those things
how many primary carbon are in 2,3 dimethylpentane
Answer:
There are 7 carbons in 2,3 dimethylpentane
Explanation:
Because 2,3-dimethlypentane is an organic compound of carbon and hydrogen with formula C7H16
Os subníveis mais energéticos de um dado átomo são: ...4s2 3d10 4p5 a) indique o seu número atomico b) quantos electrões de valência apresenta esse átomo c) a que família pertence?
Answer:
A. 35
B. 7
C. halogênios
Explanation:
Aqui, para responder a essa pergunta, precisaremos conhecer o elemento particular em questão.
..... 4s ^ 2 3d ^ 10 4p ^ 5 significa que está a cinco elétrons da configuração eletrônica do último elemento na primeira camada dos metais pesados.
O último elemento da 1ª série do elemento de transição é o zinco, portanto, como está a apenas 5 elementos de distância, o átomo de que estamos falando é o átomo de Bromo de Bromo.
A. O zinco tem um número atômico 30 e como o bromo está a 5 elementos de distância, seu número atômico é 35
B. Uma vez que pertence ao grupo halogênio, tem 7 elétrons de valência como o resto da família
C. Pertence à família dos halogênios
what are the efficient things needed for a village
Answer:
Those aspects which are something a village needs are specified beneath.
Explanation:
Things being equally necessary to make living simpler and therefore more enjoyable. The government has promised to continue providing basic facilities to either an unpopulated location, including such roads, drinkable water, as well as electric power. Therefore, throughout the village, certain things accessible with maximum variety and quality that have become the basic requirements for this human existence.