Rewrite the fraction in the sentence below as a percentage. From 125 yards away, a marksman hit 11/20 of the targets last year.

Answer: $100

Step-by-step explanation:

Considering 50 + 50 = 100

This means that the amount of money is $100

Answer:

[tex]\frac{98p^{6}}{q}[/tex]

Step-by-step explanation:

Distribute the exponents

[tex](\frac{(7^{-2}p^{-6}q^{-8})}{2q^{-9}} )^{-1}[/tex]

[tex](\frac{q}{98p^{6}} )^{-1}[/tex]

Distribute the -1

[tex]\frac{98p^{6}}{q}[/tex]

Answer:

5 a) Total = 20.83 hrs = 20 hrs and 50 mins  (1250mins total)

5 b) Total = 96 meters. = 0.096km in 8 hrs.

Step-by-step explanation:

1km = 1000 meters

5 mins = 4 meters

1000/4 = 250 multiplier

250 x 5mins = 1250 minutes

1250/60 = 20hrs + 50 minutes

50 / 60 =  0.83 = 20.83hrs

b)  8 hrs = 8 x 60 = 480 minutes

480/5 = 24 multiplier of 4 meters

24 x 4 = 96 meters

Answer:

5(5x-3)

Step-by-step explanation:

The common factor in this expression is 5 so divide 5 to all the values

25/5=5

-15/5= -3

Put these values into parenthesis and leave the 5 on the left side and out of the parenthesis

5(5x-3)

Answer:

5(5x - 3)

Step-by-step explanation:

The greatest common factor here is 5. Divide each term by 5 and simplify.

25x/5 = 5x

15/5 = 3

Therefore, the answer is 5(5x - 3).

Answer:

3 years

Step-by-step explanation:

4 inches per year on average

1 foot = 12 inches

12 divided by 4 equals 3

therefore it is 3 years

9514 1404 393

Answer:

Youngest to oldest:

Step-by-step explanation:

At 9% interest per year, the present value of 1 at age 20 is ...

  p(a) = 1.09^(a-20)

Adding the present values for the different ages, we get a total of about 2.35528984846. Dividing the inheritance by that amount gives the multiplier for each of the present value numbers. The result is the list of shares shown above. At age 20, each brother will inherit about 636,864.29.

__

Additional comment

This is the sort of question that suggests the use of a graphing calculator or spreadsheet for doing the tedious number crunching.

(We assume the bank pays 9% per year, rather than charges 9% per year.)

Answer:

x = 3/4

Step-by-step explanation:

2(4x + 2) = 10           Remove the brackets

8x + 4 = 10               Subtract 4 from both sides

8x = 6                       Divide by 8

x = 6/8

x = 3/4

Check

2(4*3/4 + 2) =?10

2( 3 + 2) = 10

2*5 = 10

10 = 10

Answer:

FH ≈ 6.0

Step-by-step explanation:

Using the sine ratio in the right triangle

sin49° = [tex]\frac{opposite}{hypotenuse}[/tex] = [tex]\frac{FH}{FG}[/tex] = [tex]\frac{FH}{8}[/tex] ( multiply both sides by 8 )

8 × sin49° = FH , then

FH ≈ 6.0 ( to the nearest tenth )

Answer:

6

Step-by-step explanation:

sin = opposite/hypotenuse

opposite = sin * hypotenuse

sin (49) = 0,75471

opposite = 0,75471 * 8 = 6,037677 = 6

Answer:

9/20

Step-by-step explanation:

450/1000

this is not the answer, because it is not simplified

so here we have to find common factor and simplifying

________________________________________________

450/1000 is simplified to 9/20, and it can no longer be simplified.

Answer:

18.84 feet.  let me know if you have ay other questions.

Step-by-step explanation:

The way to find the formula for circumference is kinda complicated so it is best to ust memorize the formula, which is 2πr.  or 2 times pi times the radius.  

Your problem gives you the formula, but instead of 2 and r in it you have d, which is the diameter.

The diameter of the circle is 2 times the radius, so that's why it is replaced.

the radius is the distance from the center fo the circle to one edge, and the diameter is the distance through the circle passing through its center.  so it's the center to one end plus the center to another end.  or r+r which is also 2r.

So d = 2r, so in this problem d =6 feet.

So now the formula πd = 3.14*6 feet = 18.84 feet

Answer:

no

Step-by-step explanation:

if two numbers are co-prime that is not necessary that one of them must be a prime number

Answer:

The slope will be negative

Step-by-step explanation:

The slope of the regression line tells us about the relationship or behavior of the dependent and independent variables. In the scenario above, where the weight is being compared with the number of days elapsed. What is expected of the weight and quantity of a bar soap each time it is used for a shower is that it will decrease in weight. Therefore, as the number of days increases, and hence, number of showers rise, the weight of soap will decrease. Hence, we'll obtain a negative slope, one in which the increase in a variable leads to decrease in the other.

Answer:

[tex]P(x \le 3) = 0.9920[/tex]

Step-by-step explanation:

Given

[tex]p = 6\%[/tex] --- proportion of drivers that had accident

[tex]n = 14[/tex] -- selected drivers

Required

[tex]P(x \le 3)[/tex]

The question is an illustration of binomial probability, and it is calculated using:

[tex]P(x ) = ^nC_x * p^x * (1 - p)^{n-x}[/tex]

So, we have:

[tex]P(x \le 3) = P(x = 0) +P(x = 1) +P(x = 2) +P(x = 3)[/tex]

[tex]P(x=0 ) = ^{14}C_0 * (6\%)^0 * (1 - 6\%)^{14-0} = 0.42052319017[/tex]

[tex]P(x=1 ) = ^{14}C_1 * (6\%)^1 * (1 - 6\%)^{14-1} = 0.37578668057[/tex]

[tex]P(x=2 ) = ^{14}C_2 * (6\%)^2 * (1 - 6\%)^{14-2} = 0.15591149513[/tex]

[tex]P(x=3 ) = ^{14}C_3 * (6\%)^3 * (1 - 6\%)^{14-3} = 0.03980719024[/tex]

So, we have:

[tex]P(x \le 3) = 0.42052319017+0.37578668057+0.15591149513+0.03980719024[/tex]

[tex]P(x \le 3) = 0.99202855611[/tex]

[tex]P(x \le 3) = 0.9920[/tex] -- approximated

Answer:

[tex]( {p - q}^{3} ) \\ = {p}^{2} - 3 {p}^{2} q + 3p {q}^{2} - {q}^{3} [/tex]

Answer:

A

Step-by-step explanation:

c and d out of the question

b has its circle filled in meaning it could be 15lbs, which it's not

A correct answer by default

Answer:b

Step-by-step explanation: it has a filled in diamond which mean it's that...

The area bounded by a chord and arc it intercepts is known as a segment of a circle segment of a circle

The area of the circle enclosed by line PL and arc PL is approximately 37.62 square units

The reason the above value is correct is as follows:

The given parameters in the question are;

The radius of the circle, r = 11

The length of the chord PL = 16

The measure of angle ∠PAL = 93°

Required:

The area of part of the circle enclosed by chord PL and arc PL

Solution:

The shaded area of the given circle is the minor segment of the circle enclosed by line PL and arc PL

The area of a segment of a circle is given by the following formula;

Area of segment = Area of the sector - Area of the triangle

Area of segment = Area of minor sector APL - Area of triangle APL

Area of minor sector APL:

Area of a sector = (θ/360)×π·r²

Where;

r = The radius of the circle

θ = The angle of the sector of the circle

Plugging in the the values of r and θ, we get;

Area of the minor sector APL = (93°/360°) × π × 11² ≈ 98.2 square units

Area of Triangle APL:

Area of a triangle = (1/2) × Base length × Height

Therefore;

The area of ΔAPL = (1/2) × 16 × 11 × cos(93°/2) ≈ 60.58 square units

Required shaded area enclosed by line PL and arc PL:

Therefore, the area of shaded segment enclosed by line PL and arc PL is found as follows;

Area of the required segment PL ≈ (98.2 - 60.58) square units = 37.62 square units

The area of the circle enclosed by line PL and arc PL ≈ 37.62 square units

Learn more about the finding the area of a segment can be found here:

https://brainly.com/question/22599425

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

The calculation of the area between line segment PL and circle arc PL is described below:

1) Calculation of the area of the circle arc.

2) Calculation of the area of the triangle.

3) Subtracting the area found in 2) from the area found in 1).

Step 1:

The area of a circle arc is determined by the following formula:

[tex]A_{ca} = \frac{\alpha\cdot \pi\cdot r^{2}}{360}[/tex] (1)

Where:

[tex]A_{ca}[/tex] - Area of the circle arc.

[tex]\alpha[/tex] - Arc angle, in sexagesimal degrees.

[tex]r[/tex] - Radius.

If we know that [tex]\alpha = 93^{\circ}[/tex] and [tex]r = 11[/tex], then the area of the circle arc is:

[tex]A_{ca} = \frac{93\cdot \pi\cdot 11^{2}}{360}[/tex]

[tex]A_{ca} \approx 98.201[/tex]

Step 2:

The area of the triangle is determined by Heron's formula:

[tex]A_{t} = \sqrt{s\cdot (s-l)\cdot (s-r)^{2}}[/tex] (2)

[tex]s = \frac{l + 2\cdot r}{2}[/tex]

Where:

[tex]A_{t}[/tex] - Area of the triangle.

[tex]r[/tex] - Radius.

[tex]l[/tex] - Length of the line segment PL.

If we know that [tex]l = 16[/tex] and [tex]r = 11[/tex], then the area of the triangle is:

[tex]s = \frac{16+2\cdot (11)}{2}[/tex]

[tex]s = 19[/tex]

[tex]A_{t} = \sqrt{19\cdot (19-16)\cdot (19-11)^{2}}[/tex]

[tex]A_{t} \approx 60.399[/tex]

Step 3:

And the area between the line segment PL and the circle arc PL is:

[tex]A_{s} = A_{ca}-A_{t}[/tex]

[tex]A_{s} = 98.201 - 60.399[/tex]

[tex]A_{s} = 37.802[/tex]

The area of the circle enclosed by line segment PL and circle arc PL is 37.80 square units.

9514 1404 393

Answer:

  19 years

Step-by-step explanation:

The compound interest formula tells you the future value of principal P invested at annual rate r compounded n times per year for t years is ...

  A = P(1 +r/n)^(nt)

Solving for t, we get ...

  t = log(A/P)/(n·log(1 +r/n))

Using the given values, we find t to be ...

  t = log(2.13022)/(4·log(1 +0.04/4)) ≈ 19.000

The investment will be worth $213,022 after 19 years.

Answer:

m<1=145

m<2=35

m<3=35

Step-by-step explanation:

measure one is supplementary(the angles add to 180) to measure four.

so we do 180-35=145

measure 2 is congruent to measure four because they are corresponding angles

so measure 2=35

and measure 3 is also congruent to measure 4 because the are corresponding angles

so m<3=35

Answer:

201.1 km²

Step-by-step explanation:

Surface area of a sphere= 4πr², where r = radius

so,

4πr²

= 4×π×4²

= 64π

= 201.1 km² (rounded to the nearest tenth)

The complete table is

x    y

0    0.75

3     3.75

9     9.75

An equation is a mathematical statement that is made up of two expressions connected by an equal sign.

Substitution means putting numbers in place of letters to calculate the value of an expression or equation.

According to the given question.

We have values of x.

Also, one rule that y is 0.75 greater than x.

So, we have a equation for finding the value of y  i.e.

[tex]y = x + 0.75..(i)[/tex]

For finding the value of y

At x = 0, substitute x = 0 in equation (i)

[tex]y = 0 + 0.75\\\implies y = 0.75[/tex]

At x = 3, substitute x = 3 in equation (i)

[tex]y = 3+0.75\\\implies y = 3.75[/tex]

At x = 9, substitute x = 9 in equation (i)

[tex]y = 9+0.75\\\implies y = 9.75[/tex]

Hence, the complete table is

x    y

0    0.75

3     3.75

9     9.75

Find out more information about equation and substitution here:

https://brainly.com/question/10852714

#SPJ2

Answer:

First, find two points on the graph:

Slope = [tex]\frac{y_{2}-y_{1} }{x_{2}-x_{1}} = \frac{8-2}{2-0} =\frac{6}{2}=3[/tex]

16 + (-3) = 16 - 3 = 13

Answer:

The 99% confidence interval for the true population mean turtle weight is between 77.76 and 82.24 ounces.

Step-by-step explanation:

We have to find our [tex]\alpha[/tex] level, that is the subtraction of 1 by the confidence interval divided by 2. So:

[tex]\alpha = \frac{1 - 0.99}{2} = 0.005[/tex]

Now, we have to find z in the Z-table as such z has a p-value of [tex]1 - \alpha[/tex].

That is z with a p-value of [tex]1 - 0.005 = 0.995[/tex], so Z = 2.575.

Now, find the margin of error M as such

[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]

In which [tex]\sigma[/tex] is the standard deviation of the population and n is the size of the sample.

[tex]M = 2.575\frac{6.1}{\sqrt{49}} = 2.24[/tex]

The lower end of the interval is the sample mean subtracted by M. So it is 80 - 2.24 = 77.76 ounces.

The upper end of the interval is the sample mean added to M. So it is 80 + 2.24 = 82.24 ounces.

The 99% confidence interval for the true population mean turtle weight is between 77.76 and 82.24 ounces.

Rectangular prism and cylinder make up a camera.

A cube is a rectangular prism with all of its sides being the same length, a triangular prism has a triangle as its base, and a rectangular prism has a rectangle as its foundation. Another form of right prism that has a circle as its basis is a cylinder.

A rectangular prism includes a total of 6 faces, 12 sides, and eight vertices. Like a cuboid, it contains three dimensions- the base width, the height, and the length. The top and base of the rectangular prism exist rectangular. The pairs of opposite faces of a rectangular prism exist as identical or congruent.

A cylinder contains traditionally been a three-dimensional solid, one of the most essential curvilinear geometric shapes. Geometrically, it includes been regarded as a prism with a circle as its base.

Hence, Rectangular prism and cylinder make up a camera.

To learn more about rectangular prisms and cylinders refer to:

https://brainly.com/question/15594686

#SPJ2

Answer:

a) 0

b) 2,3,4,5,6,7

c)3,4,6,7

Step-by-step explanation:

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

Answer:

15/8

Step-by-step explanation:

tan(62)=P/B

tan(62)=15/8

Answer:

TRUE

Step-by-step explanation:

I SEEN SOME ONE ELSE WIT 5 STARS SAY SO(:

The given segment can form triangle. Therefore, the given statement is true.

A polygon has three edges as well as three vertices is called a triangle. It's one of the fundamental geometric shapes. In Euclidean geometry, each and every three points that are not collinear produce a distinct triangle and a distinct plane. In other words, every triangle was contained in a plane, and there is only single plane that encompasses that triangle.

All triangles are enclosed in a single plane if all of geometry is the Euclidean plane, however this is no longer true in higher-dimensional Euclidean spaces. Unless when otherwise specified, this article discusses triangles within Euclidean geometry, namely the Euclidean plane. The given segment can form triangle.

Therefore, the given statement is true.

To know more about triangle, here:

https://brainly.com/question/14712269

#SPJ7

Answer:

[tex](f-g)(x)[/tex]

[tex]f(x)-g(x)[/tex]

[tex]x^{2} -6x-27-x+9[/tex]

[tex]x^{2} -7x-18[/tex]

----------------------

[tex](f*g)(x)[/tex]

[tex]=f(x)g(x)[/tex]

[tex](x^{2} -6x-27)(x-9)[/tex]

[tex]=x^{3} -15x^{2}+27x+243[/tex]

----------------------

[tex]\frac{f}{g} (x)[/tex]

[tex]\frac{x^{2} -6x-27}{x-9}[/tex]

[tex]\frac{(x-9)(x+3)}{x-9}[/tex]

[tex]x+3[/tex]

-----------------------

[tex](f+g)(x)[/tex]

[tex]f(x)+g(x)[/tex]

[tex]=x^{2} -6x-27+x-9[/tex]

[tex]=x^{2} -5x-36[/tex]

------------------------

OAmalOHopeO

------------------------

Let missing side be x

If both polygons are similar

[tex]\\ \sf\longmapsto \dfrac{3}{4}=\dfrac{18}{x}[/tex]

[tex]\\ \sf\longmapsto 3x=4(18)[/tex]

[tex]\\ \sf\longmapsto 3x=72[/tex]

[tex]\\ \sf\longmapsto x=\dfrac{72}{3}[/tex]

[tex]\\ \sf\longmapsto x=24[/tex]