SECONDARY MATH III // MODULE 5

MODELING WITH GEOMETRY - 5.5

Answers

Answer 1

Answer:

Its Spring break pls relax

Step-by-step explanation:


Related Questions

What is y in this equation

Answers

Answer:

y = 88

Step-by-step explanation:

y + 53 + 39 = 180

y + 92 = 180

y = 88

Y = 88
Explanation/ none

What is the product of -8 and -7

Answers

Answer:56

Step-by-step explanation: -8x-7=56

Answer: -15

Step-by-step explanation: it will just give you a higher negative number it is literally the opposite from positive equations if u have to negative numbers u add them if there is a negative AND a positive then you substract them :)

A fair coin is tossed two times in succession. The set of equally likely outcomes is {HH, HT, TH, TT). Find the probability of getting exactly two heads.
The probability of getting two heads is
(Type an integer or a simplified fraction.)

Answers

Answer:

1/4

Step-by-step explanation:

Two Heads = HH,

From four options one of them is HH,

So likely the answer is 1/4,

Hope this helps!

Alex finds a remnant of landscaping fabric at a garden store . The fabric is the standard width , with length 9.7 m . Alex needs twelve 0.85 - m pieces for a garden patio . a ) Will Alex have more fabric than she needs ? If so , how much more ? b ) Will Alex need more fabric ? If so , how much more ?

Answers

Answer:

Kindly check explanation

Step-by-step explanation:

Given that:

Length of remnant fabric = 9.7m

Number of 0.85m length needed for patio = 12

Total length needed = (0.85 * 12) = 10.2m

The length of fabric needed is more than the length of remnant fabric found ;

10.2 m - 9.7m = 0.5m

Hence, Alex will need 0.5m more fabric

Which number has a greater value than |-2.6|?
A. -2.9
B. -|7|
C. -2.6
D. |-6|

Answers

Answer:

B (7)

Step-by-step explanation:

If you put a number in absolute value bars,

B which is right because it is

2. The area of the bottom of a shoe box is 28 square inches. If the
height of the shoe box is 3 inches, what is the volume the box

Answers

Answer:

Echo stop DELeting MY Stuff

Step-by-step explanation:

If the length of a rectangle is 12 times the width and the area is 48 square feet, what are the
dimensions?

Answers

Answer:

dimensions are 2 ft, 24ft

Step-by-step explanation:

width = w

length = 12w

Area of rectangle = 48 square feet

length * width = 48

12w * w = 48

12w² = 48           {Divide both side by 12}

w² = 48/12

w² = 4 =2²

w =2 ft

l = 12*2 = 24ft

Answer:

Solution :-

Let the width be w and Length will be 12w

So,

Area = lw

48 = 12w × w

48/12 = w²

4 = w²

√4 = √w²

2 = 2

Length = 12(2) = 24 cm

Breadth = 2 cm

[tex] \\ [/tex]

The rabbit population at the city park increases by 14% per year. If there are intially 481 rabbits in the city park.

Write a model for the population (y) in terms of years (t).
y =

Find the population in 17 years.

Answers

Answer:

y = 0.14t + 481

Population in 17 years: 483.38

Step-by-step explanation:

y = (m) (x) + b

y = (slope) (x) + starting value

Find all missing angles in the diagram

Answers

Angle 3 is 95, angle 2 and 4 is 85, angle 1 is 15, angle 7 144, angle 5 and 6 are 36

alex, bella, cara share £90; work how much each of them have if:
alex has £x
bella has 3 times as much as alex
cara has £10 less than alex​

Answers

Step-by-step explanation:

given,

alex = x

bella = 3x

cara = x - 10

and also given,

[tex]x + 3x + (x - 10) = 90 \\ x + 3x + x - 10 = 90 \\ 5x - 10 = 90 \\ 5x = 90 + 10 \\ 5x = 100 \\ x = 100 \div 5 \\ = 20[/tex]

Given x = £20,

Alex = £x = £20

Bella = £3x = £3x20 = £60

Cara = £(x-10) =£(20-10) =£10

What would be the first step you would take in solving the equation 3 - 2x = 4(x + 15) ?​

Answers

The first step would be x+15
I think

Answer:

Distribute the 4

Step-by-step explanation:

You should always distribute first then you should add the 2x. Then combine like terms. Then subtract 15 then divide by six. Then you get the answer x = -2.

A group consisting of 126 students and 7 chaperones is going on a field trip. Which of the following groups does not have the same ratio of students to chaperones?

Answers

Answer:

c

Step-by-step explanation:

Here are the options

A 36 students and 2 chaperones B. 54 students and 3 chaperones O C 90 students and 4 chaperones D 108 students and 6 chaperones

We have to simply the ratio of students to chaperones to its lowest form .

126 : 7 = dividing number of students and chaperones by 7 gives :  18:1

36 : 2 = dividing number of students and chaperones by 2 gives : 18:1

54 : 3 = dividing number of students and chaperones by 3 gives : 18:1

90 : 4 = dividing number of students and chaperones by 4 gives : 22.5 : 1

108 : 6 = dividing number of students and chaperones by 6 gives : 18:1

It can be seen that it is only 90:4 that does not have the same ratio as that given in the question

Ms. Smith allows her students to choose the mean, median, or mode of their set of test scores to be their final grade. Which measure of center should Erica use to get the highest average if her scores are 80, 90, 70, 60, 90?

Answers

Answer:

Mode

Step-by-step explanation:

because 90 is the grade that shows up the most!

I hope I helped :)

Measure of center that Erica should use is mode to get the highest average on her scores.

What is Mean, Median and Mode?

For a set of data, mean is the average of all the elements in the data set.

Median is the element in the exact middle when numbers are arranged from smallest to largest or largest to smallest.

Mode is the element which is most repeated.

The given data set is,

80, 90, 70, 60, 90

Mean = (80 + 90 + 70 + 60 + 90) / 5 = 78

To find median, firstly arrange the numbers in order.

60, 70, 80, 90, 90

The middle element is the element in the third place, 80 which is the median.

90 is the only element which appears more than once. So mode is 90.

Mode gives the highest score.

Hence Erica should use mode as the measure of center to get the highest average.

Learn more about Measures of Central Tendency here :

https://brainly.com/question/29252918

#SPJ2

2. Rosa made a mosaic wall mural using 15 black tiles, 60 blue tiles, and 25 red tiles. Write a percent to represent the number of red tiles that were used in the mural.

Answers

9514 1404 393

Answer:

  25%

Step-by-step explanation:

The ratio of red tiles to all tiles is ...

  25/(15 +60 +25) = 25/100 = 25%

25% of the tiles were red tiles.

_____

Additional comment

It is often useful to think of the % symbol as being equivalent to /100, and vice versa.

Can anyone help me please i already did one but I am begging for help

Answers

Answer:

#5)  

     Figure 1: 4

     Figure 2: 9

     Total: 13

#6)

     Figure 1: 10

     Figure 2: 30

     Total: 40

#7)

     Figure 1: 36

     Figure 2: 36

     Total: 72

#8)

     Figure 1: 12

     Figure 2: 28

     Total: 40

     (The numbers in the image are incorrect)

In Exercises 1-4, the sample size n, probability of success p, and probability of
failure q are given for a binomial experiment. Determine whether you can use a
normal distribution to approximate the distribution of x.
1. n = 24, p = 0.85, 9 = 0.15
2. n = 15, p = 0.70, q = 0.30
3. n = 18, p = 0.90, q = 0.10
4. n = 20, p = 0.65, q = 0.35

Answers

Answer:

1. No

2. No

3. No

4. Yes

Step-by-step explanation:

Binomial approximation to normal.

The binomial probability distribution has parameters n, p and q.

If

[tex]np \geq 5[/tex] and [tex]nq \geq 5[/tex], you can use the normal approximation.

1. n = 24, p = 0.85, q = 0.15

[tex]np = 24*0.85 = 20.4 > 5[/tex]

[tex]nq = 24*0.15 = 3.6 < 5[/tex]

So no.

2. n = 15, p = 0.70, q = 0.30

[tex]np = 15*0.7 = 10.5 > 5[/tex]

[tex]nq = 15*0.3 = 4.5 < 5[/tex]

So no.

3. n = 18, p = 0.90, q = 0.10

[tex]np = 18*0.9 = 16.2 > 5[/tex]

[tex]nq = 18*0.1 = 1.8 < 5[/tex]

No

4. n = 20, p = 0.65, q = 0.35

[tex]np = 20*0.65 = 13 > 5[/tex]

[tex]nq = 20*0.35 = 7 > 5[/tex]

Yes

can u tell me is this test important or not

Answers

Answer:

Yes, indeed it is one of the most important examinations.

Will give brainliest and 50 points to who ever gives me the answer and not a link

Find the surface area of the
triangular prism.
10 ft.
3 ft.
ft.
3 ft.
[?] sq ft.

Answers

Calculate the area of the triangular ends
Area = 1/2bh = 1/2 x 3 x 2 = 3
Now calculate the area of the rectangular surfaces
Area = lw = 3 x 10 = 30

Add 2 triangle and 3 rectangles
Total area = 3 + 3 + 30 + 30 + 30 = 96 sqft

I need help with math asap ​

Answers

um where’s the question?

Find the perimeter of the polygon with the vertices G(2, 4), H(2,−3), J(−2,−3), and K(−2, 4).

Answers

Answer:

22 units

Step-by-step explanation:

Graphed to solve.

Width:

The distance between points K and G, and points J and H is both 4 units. So for both distances between the set of points will be 8 units total.

Length:

The distance between points G and H, and points J and K is both 7 units. So for both distances between the sets of points will be 14 units total.

14 + 8 = 22

PLEASE ANSWER ASAP GIVING 15 POINTS AND PLEASE NO LINK FILE AND PLEASE ANSWER WHAT I'AM SUPPOSE TO DO WITH THIS ANSWER FOR PART B! I'M ALMOST OUT OF TIME

Answers

1.5 / 1
A 1has to be the denominator so for example, 100 yards / 1 minute of jogging

Study each equation, then solve.

18) 5 + r = 6 - r

Answers

Answer:

5+r=6-r

-5 -5

r=1-r

+r +r

2r=1

÷2 ÷2

r=1/2

BC
Round your answer to the nearest hundredth.
А
50°
?
3
B

Answers

Use the sine function.

sine = opposite side of triangle divided by the hypotenuse.

Here is the set up:

sin(50°) = BC/3

sin(50°)/3 = BC

Use your calculator to simply left side.

Take it from here.

Marcie baked several pies. She used 4 cups of flour for the dough. How many pints of flour did she use?
I have to turn this is Immediately please ​

Answers

Answer:

well if several means 3 then she used 12 pints.

Step-by-step explanation:

3X4=12

4X4=16

5X4=20 and so on.

find the value for x

Answers

Answer:

x = 6°

Step-by-step explanation:

Rule of vertical angles claims that the opposite angles ar the same

19x - 4 would be the opposite to 110

and 19x - 4 would equal 110

Lets form an equation

19x - 4 = 110

Evaluating

19x - 4+4 = 110 + 4

19x = 114

x = 114/19

x = 6

If my answer is incorrect, pls correct me!

If you like my answer and explanation, mark me as brainliest!

-Chetan K

A quality-conscious disk manufacturer wishes to know the fraction of disks his company makes which are defective. Step 2 of 2: Suppose a sample of 1536 floppy disks is drawn. Of these disks, 1383 were not defective. Using the data, construct the 98% confidence interval for the population proportion of disks which are defective. Round your answers to three decimal places.

Answers

Answer:

The 98% confidence interval for the population proportion of disks which are defective is (0.082, 0.118).

Step-by-step explanation:

In a sample with a number n of people surveyed with a probability of a success of [tex]\pi[/tex], and a confidence level of [tex]1-\alpha[/tex], we have the following confidence interval of proportions.

[tex]\pi \pm z\sqrt{\frac{\pi(1-\pi)}{n}}[/tex]

In which

z is the zscore that has a pvalue of [tex]1 - \frac{\alpha}{2}[/tex].

Suppose a sample of 1536 floppy disks is drawn. Of these disks, 1383 were not defective.

1536 - 1383 = 153

This means that [tex]n = 1536, \pi = \frac{153}{1536} = 0.1[/tex]

98% confidence level

So [tex]\alpha = 0.02[/tex], z is the value of Z that has a pvalue of [tex]1 - \frac{0.02}{2} = 0.99[/tex], so [tex]Z = 2.327[/tex].

The lower limit of this interval is:

[tex]\pi - z\sqrt{\frac{\pi(1-\pi)}{n}} = 0.1 - 2.327\sqrt{\frac{0.1*0.9}{1536}} = 0.082[/tex]

The upper limit of this interval is:

[tex]\pi + z\sqrt{\frac{\pi(1-\pi)}{n}} = 0.1 + 2.327\sqrt{\frac{0.1*0.9}{1536}} = 0.118[/tex]

The 98% confidence interval for the population proportion of disks which are defective is (0.082, 0.118).

Check all statements that are true.
a. Adding two integers and then taking the remainder produces the same result as taking their remainders first, then adding them, and then applying the remainder operation once more.
b. Saying that a divides b is the same as saying that b is a multiple of a.
c. Adding two integers and then taking the remainder produces the same result as taking their remainders first and then adding them.
d. When you perform division by 5 with remainder, the remainder is an integer from -5 to 5.
e. If an integer a divides a product of two integers b and c, then a must divide b or a must divide c.
f. If an integer divides two numbers, it also divides their difference.
g. If an integer divides two numbers, it also divides their sum.
h. When you perform division by 3 with remainder, the remainder is one of the integers 0,1,2.
i. If a and b are positive integers, and a = bq + r is the decomposition of a given by the division algorithm, then q can be found as the floor of a/b, and then r can be found as r = a - bq.
j. If an integer a divides an integer b, then a also divides any multiple of b.

Answers

Answer:

a. True

b. True

c. False

d. False

e. False

f. True

g. True

h. True

i. True

j. True

Step-by-step explanation:

When the integer divides the two number then their sum is also divisible by that integer. This is also the case in the subtraction when two number are divisible then their difference is also divisible. When there is division by 5 the number not necessarily can be 5 or -5. This statement is not correct.

PLEASE HELP! 20 POINTS!!

Answers

Answer:

15

Step-by-step explanation:

In this problem we need to use the numbers given. So in the problem it states that k = 20 and v = 10. We can replace the letters in the equation for the numbers that it equals so the equation can make sense so 25 - 20 + 10 because k is 20 and v is 10 I simply just replaced the letters with the numbers given in the problem. Then we can just subtract 25 - 20 which is 5 and add 10 which leaves you at a final answer of 15. Hope this helped!

Easy question look at photo

Answers

Answer:

I would go with yes, since we know BC=UV

Step-by-step explanation:

Find the measurements of the numbered angles in each kite.

Answers

Answer:

∠1 = 90°

∠2 = 26°

Step-by-step explanation:

Other Questions
50 points, help me out :)Read the excerpt from a letter.I would like to nominate my friend and colleague, Stephanie Mason, to be this years grand marshal of the spring parade. The grand marshal is supposed to be a citizen who strives for the betterment of the community, and that is what Stephanie does. She devotes her spare time gathering donated items to distribute to families in need. Her efforts have assisted over 700 families this year, and she intends to grow the program.Which greeting would most likely open this letter?Dear Friends in the Community,People in Charge:Attention, Nominating Committee:Hey, Nominators, please dont put any links or I'll report:( can you grade my expository essay and tell me what to change if needed.. If AABC = ADEC,ZB = 44 and ZE = 4xABEx = [?] Joe wants to rent a boat and spend less than $33. Boat cost $7 per hour, and Joe has a discount coupon for $9 off. What are the possible numbers of hours Joe could rent the boat? Use t for the number of hours. Write your answer as an inequality solved for t. can someone solve these for me? its factoring trinomials you can dm the answers on ig as well if you'd like HELP DUE IN 10 MINUTES How do toothed whales produce echolocating sounds? please help due in a few hours! plsssssssssssssssss help i need help on this one too sorry to ask much Write each expression as an algebraic (nontrigonometric) expression in u, u > 0.sin(2sec^-1 u/10) was the concept of the american dream in other countries C2H5OH(l)+3O2(g)2CO2(g)+3H2O(g)If 9.2g of C2H5OH(l) burns completely in the presence of excess O2(g) according to the equation, how many grams of CO2(g) are produced?A:0.40gB:8.8gC:9.2gD:18g Suppose you are working as an administrative assistant at a small law firm. Your boss has asked you to send an invitation out to all employees about the upcoming holiday party. You would like to spruce up the invitation with a few festive images and a fancy border. Which file format would allow you to create a visually appealing invitation that can easily be e-mailed?JPEGPDFSVGTIFF Help asap plsss no link or websites I think brainley has a bot problem An airplane flies with a constant speed of 760 km/h. How far can it travel in 2 1/2 hours? Distance = calculate the molecular mass of N2O3 Solve this question for brainlest HELL!IHL - IGK by Side-Angle-Side SimilarityIHL - IGK by Side-Side-Side SimilarityThe triangles are not similarIHL- IGK by Side-Angle-Side Similarity Complete the statement. Round to the nearest hundredth if necessary.6 lb = oz