Answer:
C2H3O3
Explanation:
Empirical formula is the simplest whole number ratio of moles of atoms that you can find in a molecule.
In combustion analysis all Carbon reacts producing CO2 and all hydrogen reacts producing H2O. With the differences in masses we can find the mass of oxygen and their moles:
Moles CO2 = Moles C:
14.08g * (1mol/44.01g) = 0.3199 moles C * (12.01g/mol) = 3.8423g C
Moles H2O:
4.32g H2O * (1mol/18.01g) = 0.2399 moles H2O * (2mol H / 1molH2O) = 0.4797moles H = 0.4797g H
Mass O:
12.01g = Mass O + 3.8423g C + 0.4797g H
Mass O = 7.688g O
Moles O:
7.688g O * (1mol/16g) = 0.48 moles O
The ratio of atoms (Dividing in the moles of C that are the lower number of moles):
O: 0.48moles O / 0.3199 moles C = 1.50
C: 0.3199 moles C / 0.3199 moles C = 1
H: 0.4797 moles H / 0.3199 moles C = 1.50
As empirical formula requires whole numbers:
O: 1.50* 2 = 3
C: 1*2 = 2
H: 1.50*2 = 3
The empirical formula is:
C2H3O3what is the machine used to check melting point called?
Answer:
Melting-point apparatus
For the following reaction, 11.6 grams of sulfur are allowed to react with 23.8 grams of carbon monoxide .
sulfur(s) + carbon monoxide(g) sulfur dioxide(g) + carbon(s)
What is the maximum amount of sulfur dioxide that can be formed?
What is the formula for the limiting reagent?
What amount of the excess reagent remains after the reaction is complete?
Answer:
S + 2CO = SO2 + 2C
First, look for the amount of substance of sulfur:
n(S) = m / M
n(S) = 14.8 g/32 g / mol = 0.4625 mol
n(CO) = m (CO) / M (CO)
M(CO) = 12 + 16 = 28 g/mol
n(CO) = 19.9 g/28 g/mol = 0.71 mol
S in excess, so for calculating we take CO:
n(SO2) = n(CO)/2 = 0.71 mol/2 = 0.355 mol
m(SO2) = M(SO2)*n(SO2)
M(SO2) = 32 + 16*2 = 64 g/mol
m(SO2) = 64 g/mol * 0.355 mol = 22.74 g
#6 and #7. How many carbon atoms are in a mixture of 7.00 mol c2F2 and 0.400 mol carbon dioxide and also #7
Answer:
#6 8.67x10²⁴ atoms
#7
1. Atom
2. Formula unit
3. Molecule
4. Ion
Explanation:
#6 First we calculate how many carbon moles are there in 7.00 moles of C₂F₂, keeping in mind that there are 2 C moles per C₂F₂ mol:
7.00 mol C₂F₂ * 2 = 14.00 mol CAs for carbon dioxide, there are 0.400 C moles in 0.400 moles of CO₂.
We calculate the total number of C moles:
14.00 mol + 0.400 mol = 14.4 mol CFinally we calculate the number of atoms in 14.4 C moles, using Avogadro's number:
14.4 mol * 6.023x10²³ atoms/mol = 8.67x10²⁴ atoms#7
1. Radon - Atom (Ra)2. Formula unit (It is a crystalline solid, BaBr₂)3. Molecule (NH₃)4. Ion (It has a formal charge, +2)What change would increase the amount of solid solute able to be dissolved in liquid water?
Decreasing rate of stirring
Decreasing surface area
Increasing pressure
Increasing temperature
Answer:
D: Increasing temperature
Explanation:
From collision theory, we know that the more the increase in collisions, the faster the rate of the chemical reaction.
Now, the amount of solid solute in a solvent will change with a corresponding change in temperature. What we mean is that, the higher the temperature increases, the higher the number of collisions between the solvent molecules as well as leading to an increase in the solute particles which will mean an increase in the amount of the solid solute dissolved. The correct answer is option D.
Answer:
Increasing temperature.
Explanation:
Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol
Answer:
Draw structures corresponding to the following IUPAC names:(a) (Z)-2-Ethyl-2-buten-1-ol (b) 3-Cyclohexen-1-ol(c) trans-3-Chlorocycloheptanol (d) 1,4-Pentanediol(e) 2,6-Dimethylphenol (f ) o-(2-Hydroxyethyl)phenol
Explanation:
According to IUPAC rules, the name of a compound is:
Prefix+root word+suffix
1) Select the longest carbon chain and it gives the root word.
2) The substituents give the prefix.
3) The functional group gives the secondary suffix and the type of carbon chain gives the primary suffix.
The structure of the given compounds are shown below:
(S)-CH3CH(N3)CH2CH2CH3 can be synthesized by an SN2 reaction. Draw the structures of the alkyl chloride and nucleophile that will give this compound in highest yield.
Answer:
See explanation and image attached
Explanation:
Let us recall that the reaction in question is expected to happen by SN2 mechanism. This is because, the reaction occurs at secondary carbon atom and the attacking nucleophile (N3^-) is a good nucleophile.
The reaction occurs via a backside attack of the N3^- ion on (R)-2-chloropentane. This backside attack leads to inversion of configuration at the reaction centre to yield (S)-CH3CH(N3)CH2CH2CH3.
The images of the alkyl halide and nucleophile are shown in the image attached to this answer.
A student dropped a piece of silver metal into a solution of HCl(aq). He observed the formation of gas bubbles and collected the gas into another test tube. The student performed a splint test and observed that the splint produced a popping sound when he placed the splint into the test tube of the gas. What can be said about the results of this students experiment?
a. The student performed the splint test incorrectly. He should of observed the splint flare up when the splint was placed in the test tube.
b. The student completed the experiment correctly and there were no errors in the experiment.
c. The experiment was performed incorrectly. Silver doesn't react with HCl. Therefore, the student picked up the wrong metal when conducting the experiment.
d. The student performed the splint test incorrectly. He should of observed the flame being extinguished when the splint was placed in the test tube.
Answer:
The student completed the experiment correctly and there were no errors in the experiment.
Explanation:
When a pea size amount of Ag is dropped into a solution of HCl, the following reaction occurs;
Ag(s) + 2HCl(aq) ----> AgCl(aq) + H2(g)
The gas H2 burns with a pop sound. The gas obtained does not react to litmus. The products of the reaction are expected.
Hence, the experiment was properly conducted and the student completed the experiment correctly and there were no errors in the experiment.
Identify the possible quantitative analysis you can do using only the 28.02 g/mol as a unit factor. Select one or more:
Answer:
Calculate the moles of N2 molecules in 3.94 grams of nitrogen.
Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules.
Explanation:
Calculate the moles of N2 molecules in 4.73 liters of nitrogen gas. FALSE. You can't make this conversion using only the conversion factor with units of g/mol. To convert liters to moles are necessaries pressure, temperature and volume of the gas to use PV = nRT
Calculate the grams of N2 in 10.58 liters of nitrogen gas. FALSE. As explained, you need, P,V and T to find the moles of the gas. With the moles you can find the mass using the conversion factor of 28.02g/mol
Calculate the moles of N2 molecules in 3.94 grams of nitrogen. TRUE. You can find the moles of N2 as follows:
3.94g N2 * (1mol/28.02g) = 0.14 moles of N2 molecules
Calculate the grams of N2 in 5.03 x 1020 moles of nitrogen molecules. TRUE. The mass in 5.03x10²⁰ moles of nitrogen molecules is:
5.03x10²⁰ moles * (28.02g/mol) = 1.4x10²²g of nitrogen.
Post-Lab Questions
1. A beverage company is having trouble with the production of the dye in their drinks. The color of their drink mix is supposed to be a pale green color, but they often get different results. For each unwanted result, choose the most plausible explanation to help the company improve the formula.
(1pts)
The color of the drink is too pale after adding the dye to the drink because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
The color of the dye is appearing as red, instead of green because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
The drink started out the correct color but it is getting darker over time, even though nothing has been added to the drink, because
Choose...too much dye was added to the drink.the water in the drink is evaporating.not enough dye was added to the drink.the wrong dye was added to the drink.
(1pts)
2. Beer's Law states that A=εbc, where A is the absorbance, ε is the molar absorptivity of the solute, b is the path length, and c is the concentration. Identify the experimental evidence from the activity that you have for the dependence of absorbance on each variable.
The evidence for the dependence of absorbance on the variable ε is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
The evidence for the dependence of absorbance on the variable b is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
The evidence for the dependence of absorbance on the variable c is
increasing the cuvette width increases the absorbance.
changing the compound changes the absorbance behavior.
adding more water decreases the absorbance.
Choose...ABC
(1pts)
3. Describe how you could use the Beer's Law simulation to experimentally determine the best wavelength at which to perform an experiment.
Measure the absorbance for solutions of multiple different solutes and find the minimum absorbance.
Measure the absorbance for solutions with different concentrations and find the slope of the trendline.
Measure the absorbance for the same solution at different wavelengths and find the maximum absorbance.
Measure the absorbance for the same solution in different cuvette sizes and find the y-intercept.
Answer:
1. not enough dye was added to the drink.
The wrong dye was added to the drink
the water in the drink is evaporating
2. Changing the compound changes the absorbance behavior.
3. Measure the absorbance for the same solution in different cuvette sizes and find the y-intercept.
Explanation:
When the beverage company adds dye to the drink, there should be standard quantity added to the drink so that the color of the drink remains constant. When too much dye is added to the drink, the color will get dark brown or black. When the color of drink get lighter than green this means dye is not added in required quantity.
Identify the options below that are results of adding a catalyst to a chemical system.
The reaction rates are increased.
The reaction quotient is unaffected.
The reaction quotient decreases.
The equilibrium constant is unaffected.
Answer:
The correct options are a, b and d
Explanation:
A catalyst is a substance that increases the rate of a chemical reaction by reducing the activation energy. Le Catelier's principle explains how a substance or an "action" can affect a reaction in equilibrium.
The principle states that when a change is made to the conditions of a reacting system at equilibrium, the position of the equilibrium moves to counteract the change made. These changes are change in temperature, pressure, volume and/or concentration. These changes will either cause the equilibrium to shift forward or backward.
However, the presence of a catalyst DOES NOT affect a chemical equilibrium/equilibrium constant nor does it affect the reaction quotient because the same amount of reactants and products are available just as in uncatalyzed reaction except that the reaction proceeds faster (which does not affect equilibrium).
The rate of reaction is given as the time required by the reactant to convert into the product. The addition of catalyst increases the rate of reaction, while the reaction quotient and the equilibrium remain unaffected.
What is a catalyst?A catalyst is a chemical or compound that adds to the reaction and lowers the activation energy by providing an alternative path to the reaction.
The catalyst takes part in the reaction but did not consume in the chemical reaction.
The equilibrium and the reaction quotient are dependent on the conversion of the reactant to the product. The catalyst is not used in the reaction and thus did not affect the reaction quotient or the equilibrium.
Hence, options A, B, and D are correct for the use of catalysts in the chemical reaction.
Learn more about catalysts, here:
https://brainly.com/question/17052831
Name the compound CuI2
Answer:
Copper iodide. I think
Answer:
copper iodide(Cul2)hope it helps
stay safe healthy and happy..Choose the substance with the higher entropy in each pair. Assume constant temperature, except in part (5)
(i) 1 mol of SO2(g) or 1 mol of SO3(g)
(ii) 1 mol of CO2(s) or 1 mol of CO2(g)
(iii) 3 mol of O2(g) or 2 mol of O3(g)
(iv) 1 mol of KBr(s) or 1 mol of KBr(aq)
(v) Seawater at 2°C or at 23°C
(vi) 1 mol of CF4(g) or 1 mol of CCl4(g)
Answer:
I) 1 mol of SO3(g)
2) 1 mol of CO2(g)
3) 3 mol of O2(g)
4) 1 mol of KBr(aq)
5) Seawater at 23°C
6) 1 mol of CCl4(g)
Explanation:
In molecules having greater numbers of atoms, there is an increase the number of ways by which the molecule vibrates thereby leading to a higher number of possible microstates and overall increase in entropy of the system. Hence, 1 mol of SO3(g) has a higher entropy than 1 mol of SO2.
Gases have a higher entropy than liquids and liquids have a higher entropy than gases.
Also, the greater the molecular weight of a molecule, the higher the entropy. Higher number of moles of a gas as well as the increase in temperature of a substance are also factors that lead to higher entropy.
once a recrystallization is completed and filtered, what solvent would be suitable for transferring the leftover solids to filtration funnel
Answer:
To transfer leftover solids to the filtration funnel and wash out crystals after recrystallization, ice cold methanol should be used (the mother liquor used for recrystallization).
Explanation:
Hope this helped
Would 1 pound of peanut butter occupy more or less space than 1 pound of water?
the force of attraction between non polar molecules are what
Answer:
dispersion force
Explanation:
Linoleic acid is a polyunsaturated fatty acid found, in ester form, in many fats and oils. Its doubly allylic hydrogens are particularly susceptible to abstraction by radicals, a process that can lead to the oxidative degradation of the fat or oil.
a. True
b. Flase
Answer:
True.
Explanation:
The information presented in the question above regarding linoleic acid is true. Linoleic acid is, in fact, found in many oils and fats in the ester form. In addition, linoleic acid is considered a polyunsaturated fatty acid, due to the presence of two unsaturations in its composition. Its chemical formula is CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7COOH and it is an essential fatty acid for the human body, as it is essential in the composition of arachidonic acid that is responsible for building muscle, managing body fat thermogenesis, and regulating core protein synthesis.
The metal tantalum becomes superconducting at temperatures below 4.483 K. Calculate the temperature at which tantalum becomes superconducting in degrees Celsius.
Answer:
The correct answer is "-268.667°C".
Explanation:
Given:
Temperature,
= 4.483 K (below)
Now,
The formula of temperature conversion will be:
⇒ [tex]T(^{\circ} C)=T(K)-273.15[/tex]
By putting the values, we get
⇒ [tex]=4.483-273.15[/tex]
⇒ [tex]=-268.667^{\circ} C[/tex]
Thus the above is the correct answer.
the force of attraction between non polar molecules are what (a)electrovalent bond (b)covalent bond (c)Hydrogen bond (d)Van der waals forces
Answer:
d. van der waals force
Explanation:
Van der Waals force :
the weakest intermolecular forceand consist of dipole-dipole force and dispersion force.
Rank each of the following gases in order of increasing urms assuming equivalent amounts and all gases are at the same temperature and pressure where 1 has the lowest urms and 4 has the highest urms.
a. Gas 1 : H2S
b. Gas: He
c. Gas 3: NF3
d. Gas 4: H2O
The Urms refers to the root mean square speed of the gas. The order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.
What is the Urms?The Urms refers to the root mean square speed of the gas. This is ultimately dependent on the relative molecular mass of the gases when they are maintained at the same temperature.
Now, let us look at the order of increasing Urms for the gases shown in the question; NF3 < H2S < H2O < He.
Learnmore about Urms: https://brainly.com/question/365923
Given the following list of densities, which materials would float in a molten vat of lead provided that they do not themselves melt? Densities (g/mL): lead = 11.4, glass = 2.6, gold = 19.3, charcoal = 0.57, platinum = 21.4.
a. gold and platinum
b. glass and charcoal
c. gold, platinum, glass and coal
d. gold and charcoal
e. None of these
Answer:
b. glass and charcoal
Explanation:
Step 1: Given data
Density of Pb: 11.4 g/mLDensity of Glass: 2.6 g/mLDensity of Au: 19.3 g/mLDensity of charcoal: 0.57 g/mLDensity of platinum: 21.4 g/mLStep 2: Determine which material will float in molten lead
Density is an intrinsic property of matter. Less dense materials float in more dense materials. The materials whose density is lower than that of lead and will therefore float on it are glass and charcoal.
The speed of light_____ meters per second
☛ 299,792,458 meters per second.
What is the molecular formula of the structure below?
Picture is attached pls help I’ll mark as brainliest for the right answer
Answer:
C₆H₆
Explanation:
Each border of the figure represents 1 atom of carbon. We have 6 borders = 6 atoms of carbon.
Each atom of carbon form 4 bonds. All the carbons are doing a double bond and a single bond with other carbons. That means are bonded 3 times. The other bond (That is not represented in the figure. See the image) comes from hydrogens. As we have 6 carbons that are bonded each 1 with one hydrogen. There are six hydrogens and the molecular formula is:
C₆H₆This structure is: Benzene
Calculate the individual percent recoveries of benzoic acid, naphthalene and 3-nitroaniline if you were able to collect 9.75 g of benzoic acid, 6.41 g of naphthalene, and 7.71 g of 3-nitroaniline from a set of extractions. The starting mass of the mixture was 26.24 g. (0.6 pt)
Answer:
Benzoic acid= 37.16%
Naphthalene = 24.43%
3-Nitroaniline= 29.38%
Explanation:
Data given:
percentage recovery of benzonic acid = 9.75/26.24 * 100 = 37.16%
Percentage recovery of napthalene = 6.41/26.24 * 100 = 24.43%
Percentage recovery of 3-nitroaniline = 7.71/26.24 * 100 = 29.38%
C3H8 is ________
A. unsaturated
B. saturated
write any two things that should be remembered while writing chemical equation
Answer:
the product and the reactant must be balanced
if u are required to give the mechanism if the reaction it must be written
A compound that contains only carbon, hydrogen, and oxygen is 58.8% C and 9.87% H by mass. What is the empirical formula of this substance
Answer: The empirical formula of the compound becomes [tex]C_5H_{10}O_2[/tex]
Explanation:
The empirical formula is the chemical formula of the simplest ratio of the number of atoms of each element present in a compound.
Let the mass of the compound be 100 g
Given values:
% of C = 58.8%
% of H = 9.87%
% of O = [100 - 58.8 - 9.87] = 31.33%
Mass of C = 58.8 g
Mass of H = 9.87 g
Mass of O = 31.33 g
The number of moles is defined as the ratio of the mass of a substance to its molar mass. The equation used is:
[tex]\text{Number of moles}=\frac{\text{Given mass}}{\text{Molar mass}}[/tex] ......(1)
To formulate the empirical formula, we need to follow some steps:
Step 1: Converting the given masses into moles.Molar mass of C = 12 g/mol
Molar mass of H = 1 g/mol
Molar mass of O = 16 g/mol
Putting values in equation 1, we get:
[tex]\text{Moles of C}=\frac{58.8g}{12g/mol}=4.9 mol[/tex]
[tex]\text{Moles of H}=\frac{9.87g}{1g/mol}=9.87 mol[/tex]
[tex]\text{Moles of O}=\frac{31.33g}{16g/mol}=1.96mol[/tex]
Step 2: Calculating the mole ratio of the given elements.Calculating the mole fraction of each element by dividing the calculated moles by the least calculated number of moles that is 1.96 moles
[tex]\text{Mole fraction of C}=\frac{4.9}{1.96}=2.5[/tex]
[tex]\text{Mole fraction of H}=\frac{9.87}{1.96}=5.03\approx 5[/tex]
[tex]\text{Mole fraction of O}=\frac{1.96}{1.96}=1[/tex]
Converting the mole fraction into whole numbers by multiplying them with 2.
[tex]\text{Mole fraction of C}=2.5\times 2=5[/tex]
[tex]\text{Mole fraction of H}=5\times 2=10[/tex]
[tex]\text{Mole fraction of O}=1\times 2=2[/tex]
Step 3: Taking the mole ratio as their subscripts.The ratio of C : H : O = 5 : 10 : 2
Hence, the empirical formula of the compound becomes [tex]C_5H_{10}O_2[/tex]
The empirical formula of the substance is[tex]C_5H_{10}O_2[/tex].
Explanation:
Given:
A compound made up of 58.8% of carbon, 9.87% hydrogen, and oxygen.
To find:
The empirical formula of this substance.
Solution
The percentage of carbon in a given substance by mass = 58.8%
The percentage of hydrogen in a given substance by mass = 9.87%
The percentage of oxygen in a given substance by mass :
[tex]= 100\%-58.8\%- 9.87\%=31.33\%[/tex]
Consider 100 grams of a substance.
In 100 grams of substance:
The mass of carbon =58.8% of 100 g = 58.8 g
The mass of hydrogen = 9.87% of 100 g = 9.87 g
The mass of oxygen = 31.33% of 100 g= 31.33 g
The moles of carbon [tex]=\frac{58.8 g}{12.0107 g/mol}=4.90 mol[/tex]
The moles of hydrogen[tex]=\frac{9.87g}{1.00784g/mol}=9.79 mol[/tex]
The moles of oxygen[tex]=\frac{31.33g}{15.999g/mol}=1.96 mol[/tex]
let the empirical formula of the substance = [tex]C_xH_yO_z[/tex]
The value of subscript x:
[tex]=\frac{4.90 mol}{1.96 mol}=2.5[/tex]
The value of subscript y:
[tex]=\frac{9.79mol}{1.96 mol}=5[/tex]
The value of subscript z:
[tex]=\frac{1.96mol}{1.96 mol}=1[/tex]
The empirical formula of a substance :
[tex]C_{2.5}H_5O_1=C_{\frac{25}{10}}H_5O_1=C_{25}H_{50}O_{10}[/tex]
Reducing to the lowest whole numbers:
[tex]C_{25}H_{50}O_{10}=C_5H_{10}O_2[/tex]
The empirical formula of the substance is [tex]C_5H_{10}O_2[/tex].
Learn more about the empirical formula here:
brainly.com/question/1247523?referrer=searchResults
brainly.com/question/1363167?referrer=searchResults
In what kind of orbital do the lone-pair electrons on the nitrogen of dimethylacetamide reside, and is it in the same plane as the ch3 groups
Answer:
The lone pairs on nitrogen in dimethylacetamide reside in sp3 orbitals which are coplanar with the methyl groups
Explanation:
The compound dimethylacetamide consists of oxygen bearing two lone pairs of electrons and a nitrogen atom bearing a lone pair of electrons and has two methyl groups attached to the nitrogen atom.
The lone pair on the nitrogen atom is accommodated in an sp3 orbital of nitrogen as shown in the question. This sp3 orbital is coplanar with the two methyl groups.
Which statement is true about how scientists draw conclusions from data?
A. Scientists do not allow others to make conclusions about their data.
B. Teams of scientists never share their data to help other teams draw conclusions.
C. Any two scientists will always come to the same conclusion about a data set.
D. Two scientists may have different underlying assumptions that lead them to different conclusions about the same data.
Answer:
D. Two scientists may have different underlying assumptions that lead them to different conclusions about the same thing.
Explanation:
It's all about how a person analyzes data. Some do it mathmatically while others do it logically. By doing it different ways, you may still come to the same conclusion, despite working at the problem in a different way.
Please please help help please
which straight-chain alkane would you predict to be the most viscous? all are liquids exhbiting the general bonding pattern ch3-(ch2)n-ch3
The question is incomplete, the complete question his;
Which straight chain alkane below would you predict to be the most viscous? Why? All are liquids exhibiting the general bonding pattern CH3-(CH2)n-CH3
C9H20
C10H22
C5H12
C6H14
C12H26
Answer:
C12H26
Explanation:
Generally, the viscosity of a liquid increases with increase in molecular mass of the substance.
Liquids of high molecular mass do not flow easily. This means that they posses high viscosity.
Thus, since C12H26 has the highest molecular mass among the options given in the question, C12H26 exhibits the greatest viscosity.
