Answer:
OPTION C is correct
3.86 x 10-19 J
Explanation:
Energy of the line can be calculated using below formula
E= h ν.................(1)
Where E= energy
h= plank constant= 6.626 10-34 J s
c=speed of light=3 x 108 m/s
But we know that Velocity V= = c / λ
Then substitute into equation (1) we have
E = h c / λ.............(2)
We can calculate our( hc ) in nm for unit consistency
h c =( 6.626 ×10^-34)x(3×108)
h c = (1.986 x 10-16 )
hc = 1.986 x 10-16 J nm then since our (hc) and λ are in the same unit , were good to go then substitute into equation(2)
E = h c / λ = (1.986 x 10-16) / 515
E = 3.86 x 10-19 J
Therefore, the Energy is 3.86 x 10-19 J
write the balanced nuclear equation for the radioactive decay of radium-226 to give radon-222, and determine the type of decay
Answer:
226Ra88→222Rn86+4He2
Explanation:
An α-particle usually consists of a helium nucleus which indicates the type of decay that was undergone in this radioactive process.
During α-decay(alpha decay), an atomic nucleus emits an alpha particle.
Using the standard reduction potentials Ni2+(aq) + 2 e‑Ni(s) ‑0.25 volt Fe3+(aq) + e‑Fe2+(aq) +0.77 volt Calculate the value of E°cell for the cell with the following reaction. Ni2+(aq) + 2 Fe2+(aq) →Ni(s) + 2 Fe3+(aq)
Answer:
The correct answer is - 1.02 V
Explanation:
From the reduction-oxidation reaction:
Ni²⁺(aq) + 2 Fe²⁺(aq) → Ni(s) + 2 Fe³⁺(aq)
Ni²⁺ is reduced to Ni(s) while Fe²⁺ is oxidized to Fe³⁺. Thus, the half reactions are:
Reduction (cathode) : Ni²⁺(aq) + 2 e‑ → Ni(s) Eº= ‑0.25 V
Oxidation (anode) : 2 x (Fe²⁺ → Fe³⁺ + e-)(aq) Eº= -0.77 V
-------------------------------------
Ni²⁺(aq) + 2 Fe²⁺(aq) → Ni(s) + 2 Fe³⁺(aq)
In order to calculate the Eºcell, we have to add the reduction potential of the reaction in cathode (reduction) to the oxidation potential of the anode (oxidation):
Eºcell= Eºr + Eºo= (-0.25 V) + (-0.77 V) = - 1.02 V
Predict the most likely bond type for the following.
a. Cu (Copper)
b. KCl (Potassium Chloride)
c. Si (Silicon)
d. CdTe (Cadmium Telluride)
e. ZnTe (Zinc Telluride)
Answer:
The three major types of bond are ionic, polar covalent, and covalent bonds. Ionic occurs majorly between metals and non-metals, which allows sharing of electrons to form an ionic compound. Whereas covalent bonding calls for complete transfer of electrons between atoms. Polar covalent bonds have unequaly shared electron-pair between two atoms.
Explanation:
a. Cu (Copper)- ionic bonding
b. KCl (Potassium Chloride) - ionic bonding
c. Si (Silicon) - covalent bonding
d. CdTe (Cadmium Telluride) - polar covalent bonding
e. ZnTe (Zinc Telluride)- polar covalent bonding
In which list are the three compounds above correctly listed in order of increasing boiling point? A) lowest b.p.... isopropanol < isobutane < acetone ...highest b.p. B) lowest b.p.... isobutane < acetone < isopropanol ...highest b.p. C) lowest b.p.... isobutane < isopropanol < acetone ...highest b.p. D) lowest b.p.... acetone < isobutane < isopropanol ...highest b.p. E) lowest b.p.... acetone < isopropanol < isobutane ...highest b.p.
Answer:
The correct answer is - option B - lowest b.p.... isobutane < acetone < isopropanol ...highest b.p.
Explanation:
Isobutane has lowest boiling point due to no hydrogen bonding and no diole to dipole interaction found in them. Isobutane only shows weak dispersion force.
Acetone has dipole dipole interaction but due to lack of Hydrogen bonding they have low boiling point than isopropanol but higher than isobutanol.
Isopropanol is the compound that has ability to form hydrogen bonding with other molecule its boiling point is maximum among all three.
Thus, the correct answer is - option B - lowest b.p.... isobutane < acetone < isopropanol ...highest b.p.
How are animals used in vaccine development?
Answer:
Animals whose certain organs closely match those of humans or have similar genetic makeup are used in vaccine tests because the results can closely resemble those same results on humans.
Explanation:
Answer:
they use them to test the effectiveness of the vaccine.
Explanation:
Acetonitrile (CH3CN) is an important industrial chemical. Among other things, it is used to make plastic moldings, which have multiple uses, from car parts to Lego bricks. Which one of the following statements about acetonitrile is not correct?a. Acetonitrile has 16 valence electrons in its Lewis structure. b. Acetonitrile has one triple bond. c. Acetonitrile has one pair of nonbonding electrons. d. All atoms satisfy the octet rule in acetonitrile. e. One carbon atom and the nitrogen atom have nonzero formal charges.
Answer:
One carbon atom and the nitrogen atom have nonzero formal charges.
Explanation:
The compound Acetonitrile has sixteen valence electrons as is easily San from its structure. It contains a carbon nitrogen triple bond with a lone pair of electrons on nitrogen. All atoms satisfy the octet rule and there is no hyper valent atom in the molecule.
The formal charge an carbon and nitrogen is calculated as follows;
No. of valence electron on atom - [non bonded electrons + no. of bonds]
Therefore, for carbon and nitrogen, we have;
formal charge on carbon = 4 - (0 + 4) = 0
formal charge on nitrogen = 5 - (2 + 3) = 0
Hence carbon and nitrogen both possess zero formal charges.
What is buffers and mention its importance?
Answer:
Buffer is the chemical substance that addition of acids and bases, maintaining constant environment,its called Buffer.
Explanation:
Buffers are use in the system to maintain the value of pH, and the contain the pH value is not to change.Buffer maintain the body of pH for the optimal activity,and they are solution of pH constant.Buffer in used in the lab and that to maintain growth of the micro tissues and the culture media.Buffer are used in maintain necessary optimal reaction activity,determine the indicator of solution with pH.Buffer capacity is that concentration to the buffering agent, is the very small increase,buffer capacity to the pH is 32% , of the maximum value of pH.Buffers in a acid regions to the desired of that value to the particular buffer agent.Buffers can be made from that a mixture of the base and acid, buffer can be a wide range of the obtained.Buffers that the pH calculation and they required to performed in the critic acid that the overlap over the buffer range.For the following set of volume/temperature data, calculate the missing quantity after the change is made. Assume that the pressure and the amount of gas remain constant.
V=2.91 L at 23.0 °C
V= 4.20 L at ? °C
Answer:
155 °C
Explanation:
Step 1: Given data
Initial volume (V₁): 2.91 LInitial temperature (T₁): 23.0°CFinal volume (V₂): 4.20 LFinal temperature (T₂): ?Step 2: Convert the initial temperature to Kelvin
We will use the following expression.
K = °C + 273.15 = 23.0°C + 273.15 = 296.2 K
Step 3: Calculate the final temperature
Assuming an ideal gas behavior, we can calculate the final temperature using Charles' law.
V₁/T₁ = V₂/T₂
T₂ = V₂ × T₁/V₁
T₂ = 4.20 L × 296.2 K/2.91 L
T₂ = 428 K
Step 4: Convert the final temperature to Celsius
We will use the following expression.
°C = K - 273.15 = 428 - 273.15 = 155 °C
A sample of argon gas (molar mass 40 g) is at four times the absolute temperature of a sample of hydrogen gas (molar mass 2 g). Find the ratio of the rms speed of the argon molecules to that of the hydrogen. Assume hydrogen molecule has only translational degree of freedom.
Answer:
Ratio of Vrms of argon to Vrms of hydrogen = 0.316 : 1
Explanation:
The root-mean-square speed measures the average speed of particles in a gas, and is given by the following formula:
Vrms = [tex]\sqrt{3RT/M}[/tex]
where R is molar gas constant = 8.3145 J/K.mol, T is temperature in kelvin, M is molar mass of gas in Kg/mol
For argon, M = 40/1000 Kg/mol = 0.04 Kg/mol, T = 4T , R = R
Vrms = √(3 * R *4T)/0.04 = √300RT
For hydrogen; M = 1/1000 Kg/mol = 0.001 Kg/mol, T = T, R = R
Vrms = √(3 * R *T)/0.001 = √3000RT
Ratio of Vrms of argon to that of hydrogen = √300RT / √3000RT = 0.316
Ratio of Vrms of argon to that of hydrogen = 0.316 : 1
What are the products in the following chemical reaction Pb(NO3)+KCI
Answer:
The products are KNO3 + PbCl2.....
Espero que te sirva.
A 2.87g sample of carbon reacts with hydrogen to form 3.41g of car fuel. What is the empirical formula of the car fuel?
Answer:
The empirical formulae for the car fuel is C4H9
Predict the reactants of this chemical reaction. That is, fill in the left side of the chemical equation. Be sure the equation you submit is balanced.
_______ → Ba(ClO)2 + H2O(l)
Answer:
2HClO(aq) + Ba(OH)₂(aq) → Ba(ClO)₂(aq) + 2H₂O(l)
Explanation:
The reaction corresponds to a neutralization reaction between an acid and a base, as follows:
2HClO(aq) + Ba(OH)₂(aq) → Ba(ClO)₂(aq) + 2H₂O(l)
From the equation above we have that the acid HClO reacts with the base Ba(OH)₂ to obtain a salt Ba(ClO)₂ and water.
In the balanced reaction, we have that 2 moles of HClO react with 1 mol of Ba(OH)₂ to produce 1 mol of Ba(ClO)₂ and 2 moles of water.
I hope it helps you!
Which of the following is a salt that could be generated by combining a weak acid and a weak base? Select the correct answer below:
a) NaCl
b) Na2SO4
c) NH4NO3
d) NH4F
Answer:
d) NH4F
Explanation:
Hello,
In this case, the base resulting from mixing a weak acid and a weak base is d) NH4F since ammonium hydroxide is a wear base and hydrofluoric acid is a weak acid.
Ammonium hydroxide is a weak base since it is not completely ionized in ammonium and hydroxyl ions:
[tex]NH_4OH\rightarrow NH_4^++OH^-[/tex]
Moreover, hydrofluoric acid is a weak acid since it is not completely ionized in hydrogen and fluoride ions:
[tex]HF\rightleftharpoons H^++F^-[/tex]
For the both of the substances, the limit is established by the basic and the acid dissociation constant respectively.
Regards.
How do covalent bonds form? A Sharing valence electrons between atoms. B Donating and receiving valence electrons between atoms. C Opposite slight charges attract each other between compounds. D Scientists are still not sure how they form.
Answer:
A. Sharing valence electrons between atoms.
Explanation:
This is the definition of a covalent bond. Option B describes ionic bonds, Option C describes intermolecular forces, and Option D is wrong because then there wouldn't be any mention of them in our high school chemistry textbooks :).
Calculate the molar solubility of CaF2 at 25°C in a solution that is 0.010 M in Ca(NO3)2. The Ksp for CaF2 is 3.9 x 10-11.
Answer:
[tex]Molar \ solubility=3.12x10^{-5}M[/tex]
Explanation:
Hello,
In this case, for the dissociation of calcium fluoride:
[tex]CaF_2(s)\rightleftharpoons Ca^{2+}+2F^-[/tex]
The equilibrium expression is:
[tex]Ksp=[Ca^{2+}][F^-]^2[/tex]
In such a way, via the ICE procedure, including an initial concentration of calcium of 0.01 M (due to the calcium nitrate solution), the reaction extent [tex]x[/tex] is computed as follows:
[tex]3.9x10^{-11}=(0.01+x)(2*x)^2\\\\x=0.0000312M[/tex]
Thus, the molar solubility equals the reaction extent [tex]x[/tex], therefore:
[tex]Molar \ solubility=3.12x10^{-5}M[/tex]
Regards.
The molar solubility of Calcium fluoride has been calculated as [tex]3.12\;\times\;10^-^5\;\rm M[/tex].
The dissociation of calcium fluoride has been given by:
[tex]\rm CaF_2\;\rightarrow\;Ca^2^+\;+\;2\;F^-[/tex]
The solubility constant, ksp has been given as:
[tex]ksp=\rm[Mg^2^+]\;[F^-]^2[/tex]
From the dissociation of Calcium nitrate, the concentration of Ca ion in the solution has been 0.01 M.
The dissociation of Calcium fluoride x M has been resulted in x M Ca and 2x M F ions.
The concentration of Ca in the solution has been resulted as x + 0.01 M.
The solubility product can be given as:
[tex]3.9\;\times\;10^-^1^1=[x+0.01]\;[2x]^2\\3.9\;\times\;10^-^1^1=[x+0.01]\;4x^2\\x=3.12\;\times\;10^-^5[/tex]
The molar solubility of Calcium fluoride has been calculated as [tex]3.12\;\times\;10^-^5\;\rm M[/tex].
For more information about molar solubility, refer to the link:
https://brainly.com/question/7141822
Candle wax melts low temperature, it is not conductive to electricity, it is insoluble in water and partially soluble in solvents nonpolar, like gasoline. Than type of links are present in the candle wax?
A. Electrostatics.
B. Apolar.
C. lónicos.
D. Hydrogen bridges.
electrostatic and ionic are definitely not the answer because they have high melting point
hydrogen bonds are too weak and not permanent.
so the answer is apolar as it is soluble in polar solvents (water)
Answer:
B. Nonpolar
Explanation:
The low melting point tells you the compound is not ionic, metallic, or a network solid.
It is almost certainly a molecular solid.
It does not conduct electricity, so it is not metallic (which we have already ruled out).
It is insoluble in polar solvents (water) and soluble in nonpolar solvents (gasoline).
Since like dissolves like, the molecule is nonpolar.
The type of links must be nonpolar.
Based on relative bond strengths, classify these reactions as endothermic (energy absorbed) or exothermic (energy released).
Strongest Bond
A-B
A-A
B-B
C-C
B-C
A-C
1. A2 + C2 rightarrow 2AC
2. B2 + C2 rightarrow 2BC
3. A + BC rightarrow AB + C
4. A2 + B2 rightaarrow 2AB
5. AB + C rightarrow AC + B
a. endothermic
b. exothermic
Answer:
1. Exothermic 2. Exothermic 3. Endothermic 4. Endothermic 5. Exothermic.
Explanation:
1. An A-A and a C-C bond results in 2 A-C bonds which are lower than the A-A and C-C bonds so this reaction is exothermic.
2. A B-B bond and a C-C bond results in 2 B-C bonds which are lower than the first 2 bonds so this reaction is also exothermic.
3. There is no bond for single A, a single B-C bond results in a A-B bond and a C molecule. A-B bond is stronger than the B-C bond so the reaction absorbed energy along the way. This shows that it is endothermic.
4. An A-A bond and a B-B bond results in 2 A-B bonds which are stronger than the first two bonds so this reaction is also endothermic.
5. An A-B bond and a C molecule result in an A-C bond and a B molecule. A-C bond is weaker than the A-B bond so there is energy released. This reaction is exothermic.
I hope this answer helps.
If an individual proton has mass 1.007825 amu, and an individual neutron has mass 1.008665 amu, what's the calculated mass of a neptunium-236 nucleus? options: A) 237.92482 amu B) 236.99873 amu C) 237.96682 amu D) 237.04817 amu
Answer:
C) 237.96682 amu
Explanation:
The symbol for neptunium-236 is given as;
²³⁶₉₃Np
This element has 93 protons and (236 - 93 = 143) neutrons.
Mass Number =Total mass of Protons + Total mass of neutrons
Total Mass pf protons = 93 * 1.007825 amu, = 93.727725 amu
Total mass of Neutrons = 143 * 1.008665 amu = 144.239095 amu
Mass = 144.239095 + 93.727725 = 237.96682 amu
Correct option is option C.
Draw the structure of beeswax.beeswax is made from the esterfication of a saturated 16-carbon fatty acid and a 30 carbon straight chain primary alcohol.
Answer:
Triacontyl palmitate
Explanation:
In this case, we have a reaction between an acid and an alcohol. When we put together these kind of compounds an ester is produced. This reaction is called "esterification".
In our case, the alcohol is a structure with 30 carbon in which the "OH" group is bonded on carbon 1. The name of this compound is "n-triacontanol". The acid is a structure in which we have 16 carbon in which the "COOH" group is placed on carbon 1. The name of this compound is "palmitic acid". The ester produced by the acid and the alcohol is "Triacontyl palmitate".
See figure 1.
I hope it helps!
Determine the molarity for each of the following solutions A. 1.8×10^4mg of HCL in 0.075L of solutions
What's the concentration of hydronium ions if a water-base solution has a temperature of 25°C (Kw = 1.0×10–14), with a concentration of hydroxide ions of 2.21×10–6 M? answer options: A) 2.8×10–8 M B) 4.52 ×10–9 M C) 1.6×10–9 M D) 3.1×10–6 M
Answer:
ITS NOT D. ITS B. 4.52x10^-9 M
Explanation:
Answer:
4.52 ×10–9 M
Explanation:
Identify the term that matches each electrochemistry definition. The electrode where oxidation occurs Cathode The electrode where reduction occurs Choose... An electrochemical cell powered by a spontaneous redox reaction Choose... An electrochemical cell that takes in energy to carry out a nonspontaneous redox reaction Choose... A chemical equation showing either oxidation or reduction Choose...
Answer:
An electrochemical cell that takes in energy to carry out a nonspontaneous redox reaction
Consider the bond dissociation energies listed below in kcal/mol. CH3-Br 70 CH3CH2-Br 68 (CH3)2CH-Br 68 (CH3)3C-Br 65 These data show that the carbon-bromine bond is weakest when bromine is bound to a __________.
Answer:
The answer is "Tertiary carbon".
Explanation:
Accent to the results, the carbon-bromine bond is weak, whenever, the bromine is connected to tertiary carbon so, bonding energy is separation for methyl-carbon, which is connected to the bromine = 70 kcal/mol and for the primary energy to the secondary energy is= 68 kcal/mol, and for tertiary CO2 = 65 kcal/mol.
The stronger the energy dissociating connection and the weaker, its power dissociation connection and its weaker bond becomes connecting with a tertiary carbon, that's why "Tertiary carbon" is the correct answer.
A student is performing a Benedict’s test on an unknown substance. He adds the reagent (the chemical required to make a color change), and nothing happens. What can he conclude? A- The substance is glucose-based. B- The substance is not glucose-based. C- The test was inconclusive because he needed to also test with iodine or vinegar. D- The test was inconclusive because he forgot to add heat.
Answer:
The correct answer is : option D. The test was inconclusive because he forgot to add heat.
Explanation:
Benedict's test is a test that is used to confirm the presence of the simple carbohydrates (mono saccharides and some disaccharides). It is a reagent made by mixture of solution of CuSO4 with sodium citrate and Na2CO3.
Benedict's reagent is added to the substance to test and then heated if it turns yellow to orange or red the presence of simple sugar is confirmed.
Thus, the correct answer is : option D. The test was inconclusive because he forgot to add heat.
Answer:
The test was inconclusive because the student forgot to add heat.
Explanation:
If the test revealed it was not glucose, then the student could run these tests. The student, however, does not need these substances to run the glucose test properly.
A voltaic cell is set up as follows: Anode: Zn electrode in a solution of 0.050 M Zn(NO 3 ) 2 Cathode: Pt electrode with 0.500 atm H 2 (g) in 0.010 M HNO 3 a) Write the overall balanced cell reaction.
Answer:
[tex]Zn(s) + 2H+(aq)\Rightarrow Zn^{2+}(aq) + H_{2}(g)[/tex]
Explanation:
Given that,
Anode : Zn electrode in a solution of 0.050 M Zn(NO₃)₂
Cathode : Pt electrode with 0.500 atm H₂(g) in 0.010 M HNO₃
Anode :
[tex]Zn(s)\Rightarrow Zn^{2+}(aq) + 2e^{-}[/tex]
Cathode :
[tex]2H+(aq)+2e^{-}\Rightarrow H_{2}(g)[/tex]
We need to write the overall balanced cell reaction
Using anode and cathode
[tex]Zn(s) + 2H+(aq)\Rightarrow Zn^{2+}(aq) + H_{2}(g)[/tex]
Hence, This is required answer.
The insoluble salts below are put into 0.10 M hydrochloric acid solution. Do you expect their solubility to be more, less, or about the same as in a pure water solution?
1. Zinc sulfide
2. Silver chloride
3. Lead iodide
4. Silver hydroxide
Answer:
1. Zinc sulfide : about the same solubility, no common ion is found.
2. Silver chloride : less solubility due to the presence of chloride ions provided by the 0.10 M hydrochloric acid.
3. Lead iodide : about the same solubility, no common ion is found.
4. Silver hydroxide : about the same solubility, no common ion is found.
Explanation:
Hello,
In this case, we first must remember that adding a common ion (which is related with the dissolving solid) decreases the solubility of the insoluble solid due to the fact Le Chatelier's principle states the reaction will shift leftwards (reactants) to reestablish equilibrium, therefore, we have:
1. Zinc sulfide : about the same solubility, no common ion is found.
2. Silver chloride : less solubility due to the presence of chloride ions provided by the 0.10 M hydrochloric acid.
3. Lead iodide : about the same solubility, no common ion is found.
4. Silver hydroxide : about the same solubility, no common ion is found.
Best regards.
Name the following compound from the concise formula:______.
CH3CH(CH3)CHCHCH(CH3)CH2CH3
A. 2,4-dimethyl-3-heptene
B. 2,5-dimethyl-3-heptene
C. 3,5-dimethyl-3-heptene
D. 2,5-dimethyl-4-heptene
Answer:
B. 2,5-dimethyl-3-heptene
Explanation:
Answer:
B. 2,5-dimethyl-3-heptene
Explanation:
Enter the complementary strand of this DNA strand. Give your answer as a string.
Answer:
atagcca
Explanation:
t goes with a, and c goes with g
atagcca matches with
ta tcggt
A runner can cover 2.0 miles in 31 minutes, how long would it take for this runner to cover 6.0 Km. Hint (1 mile= 1.609 Km)
The answer to this question is approximately equal to 57.8
The last group of elements on the periodic table are called _____. noble gases halogens metals noble solids
Answer:
The answer is noble gases
Explanation:
Here is your explanation The vertical columns are called groups. There are eighteen groups. The last group on the far right is called the noble, or inert gases. Elements in a group have similar chemical properties. For example, elements in the noble gas group are all gases under. This is the thing from the passege bye god bless you
The last group of elements on the periodic table are called "noble gases."
The noble gases are a group of elements located in Group 18 of the periodic table. They are also known as Group 0 or the "inert gases." The noble gases include helium (He), neon (Ne), argon (Ar), krypton (Kr), xenon (Xe), and radon (Rn).
The noble gases are unique because they have a full complement of valence electrons in their outermost energy level. This full electron configuration gives them exceptional stability, making them chemically unreactive or inert under normal conditions. In other words, noble gases are less likely to form chemical bonds with other elements.
Learn more about noble gases from the link given below.
https://brainly.com/question/19024000
#SPJ2
