Use the Law of Cosines to solve the problem. You must solve for BC first. Solve this order

A ship travels due west for 94 miles. It then travels in a northwest direction for 119 miles and ends up 173 miles from its original position. To the nearest tenth of a degree, how many degrees north of west (x) did it turn when it changed direction? Show you Work.

Use The Law Of Cosines To Solve The Problem. You Must Solve For BC First. Solve This OrderA Ship Travels

Answers

Answer 1

answer: 175

Step-by-step explanation:

Answer 2

Answer:

71.9 degrees

Step-by-step explanation:

The find the value of x on the given diagram, we must first find the included angle between the two line segments labelled 94 mi and 119 mi in the triangle. To do this, we can use the Law of Cosines.

[tex]\boxed{\begin{minipage}{6 cm}\underline{Law of Cosines} \\\\$c^2=a^2+b^2-2ab \cos C$\\\\where:\\ \phantom{ww}$\bullet$ $a, b$ and $c$ are the sides.\\ \phantom{ww}$\bullet$ $C$ is the angle opposite side $c$. \\\end{minipage}}[/tex]

The values to substitute into the formula are:

a = 119b = 94c = 173

Solving for the angle C:

[tex]\begin{aligned}173^2&=119^2+94^2-2(119)(94)\cos C\\\\29929&=14161+8836-22372\cos C\\\\29929&=22997-22372\cos C\\\\6932&=-22372\cos C\\\\-\dfrac{6932}{22372}&=\cos C\\\\C&=\cos^{-1}\left(-\dfrac{6932}{22372}\right)\\\\C&=108.0502874...^{\circ}\end{aligned}[/tex]

As angles on a straight line sum to 180°, the value of x can be calculated by subtracting the found value of C from 180°:

[tex]x=180^{\circ}-108.0502874...^{\circ}[/tex]

[tex]x=71.9497125...^{\circ}[/tex]

[tex]x=71.9^{\circ}\; \sf (nearest\;tenth)[/tex]

Therefore, the ship turned 71.9 degrees north of west when it changed direction.

Use The Law Of Cosines To Solve The Problem. You Must Solve For BC First. Solve This OrderA Ship Travels

Related Questions

Find the measures of angles 1 through 5 in the figure shown !

Answers

Answer:

55 degrees angles on a rights angle triangle. 1 and 3 they are equal cause they are vertical opp angles 55 degrees

Find the value of Tan 15 without using a table or calcutator​

Answers

Answer:

Step-by-step explanation:

JOIN SHOBHIT NIRWAN NOW

factorise completely[tex]3x²-12xy

Answers

Answer:

3x(x - 4y)

Step-by-step explanation:

3x² - 12xy ← factor out 3x from each term

= 3x(x- 4y)

What is the probability that someone who does not take vitamins is a female? Round to three decimal places.
Female
Male
Total
(1 point)
O 0.374
O 0.139
O 0.080
O 0.626
Takes vitamins
248
145
193
Does not take vitamins
40
67
107
Total
288
212
500

Answers

Answer:

A)  0.374

Step-by-step explanation:

Let event A be that the person is female.

Let event B be that the person does not take vitamins.

[tex]\boxed{\sf Probability\:of\:an\:event\:occurring = \dfrac{Number\:of\:ways\:it\:can\:occur}{Total\:number\:of\:possible\:outcomes}}[/tex]

Therefore, from the given table:

   [tex]\sf P(A) = \dfrac{288}{500}=0.576[/tex]

   [tex]\sf P(B) = \dfrac{107}{500}=0.214[/tex]

   [tex]\sf P(A \cap B)=\dfrac{40}{500}=0.08[/tex]

To calculate the probability that someone is female (Event A), given that they do not take vitamins (Event B), use the conditional probability formula for A given B:

[tex]\boxed{\begin{minipage}{5 cm}\underline{Conditional Probability formula}\\\\A given B:\\\\$\sf P(A|B)=\dfrac{P(A \cap B)}{P(B)}$\\\end{minipage}}[/tex]

[tex]\sf \implies P(A|B)=\dfrac{0.08}{0.214}=0.374\;(3\;s.f.)[/tex]

true/false. all of the following are things you can do when faced with any ethical dilemma as a managerial accountant except: always contact the board of directors first.

Answers

The statement " all of the following are things you can do when faced with any ethical dilemma as a managerial accountant except: always contact the board of directors first" is false because contacting the board of directors is not always necessary or appropriate when faced with an ethical dilemma as a managerial accountant

Contacting the board of directors is not always necessary or appropriate when faced with an ethical dilemma as a managerial accountant. While the board of directors may need to be informed in some situations, there are other steps that can be taken depending on the specific circumstances. For example, seeking guidance from a supervisor, consulting with a professional organization, or seeking legal advice may be more appropriate in some cases. The appropriate course of action will depend on the specific situation and ethical principles involved.

Learn more about ethical dilemma here

brainly.com/question/13015186

#SPJ4

find an ordered pair (x, y) that is a solution to the equation. -x+6y=7

Answers

Step-by-step explanation:

(-1, 1) is a solution.

because

-(-1) + 6×1 = 7

1 + 6 = 7

7 = 7

correct.

every ordered pair of x and y values that make the equation true is a solution.

(5, 2) would be another solution. and so on.

PLEASE HELP!!!!!!!!!

△DEF is similar to △YZX

A) which side corresponds to ED? (this one is already answered)

B) write a proportion that you could use to find XZ

C) what is XZ?

Answers

Step-by-step explanation:

B) 20:23

C) 6,0375

hope this helps

WILL MARK AS BRAINLIEST!!!!!!!!!!!!!!!!!!
The point on the parabola y=x^2 that is closest to the point (1,0) is (_______,_______). The distance between the two points is ________.

you can use Newtons's Method or Bisection to help but you don't have to.

Answers

Answer:Approximately

(0.58975,0.34781)

Step-by-step explanation:

If (x,y) is a point on the parabola, then the distance between (x,y) and (1,0) is:

√(x−1)2+(y−0)2=√x4+x2−2x+1

To minimize this, we want to minimize

f(x)=x4+x2−2x+1

The minimum will occur at a zero of:

f'(x)=4x3+2x−2=2(2x3+x−1)

graph{2x^3+x-1 [-10, 10, -5, 5]}

Using Cardano's method, find

x=3√14+√8736+3√14−√8736≅0.58975

y=x2≅0.34781

The breadth of a rectangular playground is 5m shorter than its length. If its perimeter is 130m,find ids length and breadth.

Answers

Answer:

Length is 35 m and breadth is 30 m

Step-by-step explanation:

Given,

The breadth of a rectangular playground is 5m shorter than its length.Perimeter is 130 m

Let length be x and breadth (x - 5).

Perimeter of rectangle is calculated by :

[tex] \: \: \boxed{ \pmb{ \sf{Perimeter_{(rectangle)} = 2(l + b)}}} \\ [/tex]

On substituting the values we get :

[tex]\dashrightarrow \: \: 130 = 2(x + x - 5) \\ [/tex]

[tex]\dashrightarrow \: \: 130 = 2(2x - 5) \\ [/tex]

[tex]\dashrightarrow \: \dfrac{130}{2} = (2x - 5) \\ [/tex]

[tex]\dashrightarrow \: \: 65 = 2x - 5 \\ [/tex]

[tex]\dashrightarrow \: \: 65 + 5 = 2x \\ [/tex]

[tex]\dashrightarrow \: \: 70 = 2x \\ [/tex]

[tex]\dashrightarrow \: \: \frac{70}{2} = x \\ [/tex]

[tex]\dashrightarrow \: \: 35 = x \\ [/tex]

Hence,

Length = x = 35 m.Breadth = x -5 = (35 -5) = 30 m

the solution set is
5r+20/10=3r-6/3

Answers

Answer:

r = -2

Step-by-step explanation:

5r + 20/10 = 3r -6/3

5r + 2 = 3r - 2

2r + 2 = -2

2r = -4

r = -2

Answer: r = -2

Step-by-step explanati

Can someone solve this
Note: in dark pen is the questions to solve in light pencil is my answer probably are wrong​

Answers

The open circle at 3 indicates that 3 is not included in the solution set. This inequality can be read as "X is less than 5" or "X is strictly less than 5."

What is expression?

In mathematics, an expression is a combination of numbers, symbols, and operators that represents a value. Expressions can be as simple as a single number or variable, or they can be complex combinations of mathematical operations. For example, 2 + 3 is a simple expression that represents the value 5, while (2 + 3) x 4 - 1 is a more complex expression that represents the value 19. Expressions can be evaluated or simplified using the rules of arithmetic and algebra.

Here,

1. Simplify:

3(4x-2)+ 7X (2-1) + 4 (6+4)+(-8)

Multiplying inside the parentheses first:

12x - 6 + 7x + 4 + 40 - 8

Combining like terms:

19x + 30

Final answer: 19x + 30

2. Graph:

3 > X

This is a simple inequality in one variable (X). To graph it on a number line, we first draw a dot at 3 (since the inequality is strict), and then shade all values less than 3:

<=========o---

The open circle at 3 indicates that 3 is not included in the solution set.

3. Write the inequality:

X < 5

This is a simple inequality in one variable (X). The inequality sign is "less than," and the number on the right-hand side is 5. This inequality can be read as "X is less than 5" or "X is strictly less than 5."

4. Solve for x:

3x - 7 = 42

Adding 7 to both sides to isolate the variable:

3x = 49

Dividing both sides by 3 to solve for x:

x = 16.33 (rounded to two decimal places)

Final answer: x = 16.3

5. Find 32% of $542.50:

To find 32% of $542.50, we can use the formula:

percent * amount = part

where "percent" is the percentage expressed as a decimal, "amount" is the whole amount, and "part" is the result we're looking for.In this case, we have:

0.32 * $542.50 = part

Multiplying:

$173.60 = part

Final answer: $173.60

To know more about expression,

https://brainly.com/question/30091997

#SPJ1

find all real numbers k for which there exists a nonzero 2 dimensional vector bold v such that begin bmatrix 2

Answers

Answer:

We can write the given system of equations as a matrix equation:

$\begin{bmatrix} 2 & 4 \ 4 & k \end{bmatrix} \begin{bmatrix} x \ y \end{bmatrix} = \begin{bmatrix} 0 \ 0 \end{bmatrix}$

To find nontrivial solutions (i.e., $x$ and $y$ not both equal to zero), the coefficient matrix must be singular, which means its determinant must be zero:

$\det\begin{bmatrix} 2 & 4 \ 4 & k \end{bmatrix} = 2k - 16 = 2(k - 8) = 0$

Thus, $k = 8$ is the only value for which there exists a nonzero 2-dimensional vector $\boldsymbol{v} = \begin{bmatrix} x \ y \end{bmatrix}$ satisfying the given system of equations. For $k \neq 8$, the only solution is the trivial one, $\boldsymbol{v} = \boldsymbol{0}$.


I hope this us helpful

Decide if the function is an exponential growth function or exponential decay function, and describe its end behavior using
limits.

Y=(1/6) ^-x

Answers

Answer:

The given function is an exponential growth function, not an exponential decay function because as the exponent x increases, the value of y also increases instead of decreasing.

To describe its end behavior using limits, we need to find the limit of the function as x approaches infinity and as x approaches negative infinity.

As x approaches infinity, the exponent -x approaches negative infinity, and the base (1/6) is raised to increasingly larger negative powers, causing the function to approach zero. So, the limit as x approaches infinity is 0.

As x approaches negative infinity, the exponent -x approaches infinity, and the base (1/6) is raised to increasingly larger positive powers, causing the function to approach infinity. So, the limit as x approaches negative infinity is infinity.

Therefore, the end behavior of the function is that it approaches zero as x approaches infinity and approaches infinity as x approaches negative infinity.

2 cities are 210 miles apart. If the distance on the map is 3 1/4 inches, find the scale of the map

Answers

The scale of the map = 682.5.

How would you define distance in one sentence?

We kept a safe distance and followed them. She perceives a separation between her and her brother that wasn't there before. Although they were previously close friends, there was now a great deal of gap between them.

We must calculate the ratio of the distance shown on the map to the real distance between the cities in order to ascertain the scale of the map.

We are aware that there are 210 miles separating the two cities. Let x represent the precise location of this distance on the map. From that, we may establish the ratio:

Actual distance / Map Distance = 210 / x

The distance on the map is indicated as 3 1/4 inches, which is also known as 13/4 inches. When we enter this into the percentage, we obtain:

Actual distance divided by (13/4) = 210 / x

We can cross-multiply and simplify to find x's value:

Actual distance: 682.5 = x * 210 x = 3.25 when 210 * (13/4) Equals x.

Consequently, 3.25 inches on the map represent the actual distance between the cities. We can write: To determine the map's scale:

Actual distance divided by 1 inch on the chart equals 210 miles.

When we replace the values we discovered earlier, we obtain:

1 / 210 = 3.25 / scale

If we solve for the scale, we obtain:

scale = 682.5.

To know more about Distance visit:

brainly.com/question/15256256

#SPJ1

You have a map that is missing a scale. The distance from Point A to Point B is
five inches on the map, and after driving it, you know it is 250 miles in reality.

Answers

The scale of the map in the question is 1 inch = 50 miles.

What is the scale of the map?

A scale in a map is a relation that tells us how many units each unit in the map represents. In this case, we know that the distance between two points A and B on the map is 5 inches, while the actual distance between these two places is 250 miles.

Then we start with the relation:

5 inches = 250 miles.

But to get the scale of the map we need to see how many miles one inch represents in the map, then we can divide both sides of the equation by 5 to geT:

5 in = 250 mi

1 in = 250mi/5

1 in = 50 mi

The scale of the map is 1 inch to 50 miles.

Learn more about maps and scales at:

https://brainly.com/question/105644

#SPJ1

In an examination,x pupils take the history paper and 3x take the mathematics paper. A. illustrate the data on a venn diagram indicating the number of pupils I'm each region​.
B. if the number of pupils taken the examination is 46, find the value of x

Answers

If we round up, we get x = 12, which means that 12 students took history and 36 students took mathematics.

What is venn diagram?

A Venn diagram is a graphical representation of sets, often used to show relationships between different sets of data. It consists of one or more circles, where each circle represents a set. The circles are usually overlapping to show the relationships between the sets. The region where the circles overlap represents the elements that belong to both sets. The non-overlapping parts of each circle represent the elements that belong to only one of the sets.

Here,

A. To illustrate the data on a Venn diagram, we need to draw two overlapping circles, one for history and one for mathematics. We can label the regions as follows:

The region where the circles overlap represents the students who took both history and mathematics.

The region outside both circles represents the students who did not take either history or mathematics.

The region within the history circle but outside the mathematics circle represents the students who took history but not mathematics.

The region within the mathematics circle but outside the history circle represents the students who took mathematics but not history.

In this diagram, let's assume that x students took history and 3x students took mathematics. Then the total number of students who took the examination is x + 3x = 4x. We can label the regions on the diagram accordingly:

The region where the circles overlap represents the students who took both history and mathematics. Since there are 3x students who took mathematics, and all of them are included in the overlap region, the number of students who took both is 3x.

The region outside both circles represents the students who did not take either history or mathematics. Since there are 46 students in total, and 4x of them took the examination, the number of students who did not take either is 46 - 4x.

The region within the history circle but outside the mathematics circle represents the students who took history but not mathematics. Since x students took history, and 3x took mathematics, the number of students who took history but not mathematics is x - 3x = -2x. However, since we cannot have a negative number of students, we can assume that this region is empty.

The region within the mathematics circle but outside the history circle represents the students who took mathematics but not history. Since there are 3x students who took mathematics, and some of them also took history, the number of students who took mathematics but not history is 3x - 3x = 0. Therefore, this region is also empty.

B. We know that the total number of students who took the examination is 46. Therefore, we have:

x + 3x = 46

4x = 46

x = 11.5

However, since x represents the number of students who took history, it must be a whole number. Therefore, we can round x up or down to the nearest whole number. If we round down, we get x = 11, which means that 11 students took history and 33 students took mathematics.

To know more about venn diagram,

https://brainly.com/question/29301560

#SPJ1

Which of the ten basic functions in
our toolkit have all real numbers for
their range?

Answers

The functions that have all real numbers for their range are the ones in the option B.

Which set of ten basic functions has all real numbers for their range?

Remember that for a function y = f(x), we define the range as the set of possible outputs of the function, that is, possible values of y.

Here we can see a lot of functions, first, the option with the absolute value function can be discarded because we know that:

|x| ≥ 0

So it never takes negative values.

We also can discardthe option with the sine and cosine, because the range of these two functions is [-1, 1].

The only remaining option is B, and the range of these 3 functions is (-∞, ∞), so that is the correct option in this case.

Learn more about range at:

https://brainly.com/question/10197594

#SPJ1

Find the generating functions and the associated sequences of: (x+4) ^ 4

Answers

Using binomial theorem, the generating function is G(x) = x^4 + 16x^3 + 96x^2 + 256x + 256 while the associated sequence of (x+4)^4 is {1, 16, 96, 256, 256}.

What is the generating functions and associated sequences of the function

To find the generating function of (x+4)^4, we expand it using the binomial theorem:

[tex](x+4)^4 = C(4,0)x^4 + C(4,1)x^3(4) + C(4,2)x^2(4^2) + C(4,3)x(4^3) + C(4,4)(4^4)[/tex]

where C(n,k) denotes the binomial coefficient "n choose k".

Simplifying the terms, we get:

[tex](x+4)^4 = x^4 + 16x^3 + 96x^2 + 256x + 256[/tex]

Therefore, the generating function of (x+4)^4 is:

[tex]G(x) = x^4 + 16x^3 + 96x^2 + 256x + 256[/tex]

The associated sequence can be read off by finding the coefficients of each power of x:

The coefficient of x^k is the k-th term of the sequence.In this case, the sequence is given by the coefficients of G(x):a₀ = 256a₁ = 256a₂ = 96a₃ = 16a₄ = 1

To find the generating function of (x+4)^4, we expand it using the binomial theorem:

(x+4)^4 = C(4,0)x^4 + C(4,1)x^3(4) + C(4,2)x^2(4^2) + C(4,3)x(4^3) + C(4,4)(4^4)

where C(n,k) denotes the binomial coefficient "n choose k".

Simplifying the terms, we get:

(x+4)^4 = x^4 + 16x^3 + 96x^2 + 256x + 256

Therefore, the generating function of (x+4)^4 is:

G(x) = x^4 + 16x^3 + 96x^2 + 256x + 256

The associated sequence can be read off by finding the coefficients of each power of x:

The coefficient of x^k is the k-th term of the sequence.

In this case, the sequence is given by the coefficients of G(x):

a₀ = 256

a₁ = 256

a₂ = 96

a₃ = 16

a₄ = 1

Therefore, the associated sequence of (x+4)^4 is {1, 16, 96, 256, 256}.

Learn more on binomial theorem here;

https://brainly.com/question/24756209

#SPJ1

Solve for the short leg of the 30-60-90 triangle.

Answers

Answer:

2

Step-by-step explanation:

The basic 30-60-90 triangle ratio is:

     Side opposite the 30° angle: x

     Side opposite the 60° angle: x√3

     Side opposite the 90° angle: 2x

Here, the side opposite the 90° angle is 4.

This means that 2x = 4 and, thus, x = 2.

Since b is the side opposite the 30° angle, b = x, so it is 2.

WILL GIVE BRAINLIEST NEED ANSWERS FAST!!!

Find the missing length indicated

Answers

Step-by-step explanation:

4)

based on similar triangles and the common ratio for all pairs of corresponding sides we know

LE/LM = LD/LK = DE/EM

because E and D are the midpoints of the longer sides, all of these ratios are 1/2.

1/2 = DE/8

8/2 = 4 = DE

5)

same principle as for 4)

BQ/BA = BR/BC = QR/AC

again, Q and R are the midpoints, so all these ratios are 1/2.

1/2 = QR/10

QR = 10/2 = 5

Use the parabola tool to graph the quadratic function f(x) = -√² +7.
Graph the parabola by first plotting its vertex and then plotting a second point on the parabola HELP ME PLEASEEE

Answers

Using the two points you have plotted, draw the parabola. It should look like a downward-facing curve opening at the vertex (0, 7).

What is parabola?

A parabola is a symmetrical, U-shaped curve that is formed by the graph of a quadratic function.

Assuming you meant [tex]f(x) = -x^2 + 7[/tex], here's how you can graph the parabola using the parabola tool:

Find the vertex

The vertex of the parabola is located at the point (-b/2a, f(-b/2a)), where a is the coefficient of the [tex]x^2[/tex] term and b is the coefficient of the x term. In this case, a = -1 and b = 0, so the vertex is located at the point (0, 7).

Plot the vertex

Using the parabola tool, plot the vertex at the point (0, 7).

Plot a second point

To plot a second point, you can choose any x value and find the corresponding y value using the quadratic function. For example, if you choose x = 2, then [tex]f(2) = -2^2 + 7 = 3[/tex]. So the second point is located at (2, 3).

Therefore, Using the two points you have plotted, draw the parabola. It should look like a downward-facing curve opening at the vertex (0, 7).

To learn more about parabola from the given link:

https://brainly.com/question/21685473

#SPJ1

Complete Question:

Use the parabola tool to graph the quadratic function.

f(x) = -√² +7

Graph the parabola by first plotting its vertex and then plotting a second point on the parabola.

A bank requires that the Dotkoms pay their homeowner's insurance, property taxes, and
mortgage in one monthly payment to the bank. If their monthly mortgage payment is $1,711.22,
their semi-annual property tax bill is $3,239, and their annual homeowner's insurance bill is
$980, how much do they pay the bank each month?

Answers

Answer: $2,162.06

Step-by-step explanation:

To calculate the total monthly payment to the bank, we need to add up the monthly mortgage payment, the monthly portion of the semi-annual property tax bill, and the monthly portion of the annual homeowner's insurance bill.

First, we need to find the monthly portion of the semi-annual property tax bill. To do this, we divide the semi-annual property tax bill by 6 (since there are 6 months in half a year):

Monthly property tax payment = Semi-annual property tax bill / 6

Monthly property tax payment = $3,239 / 6

Monthly property tax payment = $539.83

Next, we need to find the monthly portion of the annual homeowner's insurance bill. To do this, we divide the annual homeowner's insurance bill by 12 (since there are 12 months in a year):

Monthly homeowner's insurance payment = Annual homeowner's insurance bill / 12

Monthly homeowner's insurance payment = $980 / 12

Monthly homeowner's insurance payment = $81.67

Now we can add up the monthly mortgage payment, the monthly property tax payment, and the monthly homeowner's insurance payment to find the total monthly payment to the bank:

Total monthly payment = Monthly mortgage payment + Monthly property tax payment + Monthly homeowner's insurance payment

Total monthly payment = $1,711.22 + $539.83 + $81.67

Total monthly payment = $2,332.72

Therefore, the Dotkoms pay the bank $2,332.72 each month.

Answer:

Step-by-step explanation:

Using proportions, it is found that they pay the bank $2332.72 each month.

What is a proportion?

A proportion is a fraction of a total amount.

Using proportions, it is found that they pay the bank $2332.72 each month.

What is a proportion?

A proportion is a fraction of a total amount.

Their payments are given by:

Monthly mortgage of $1,711.22.

Semi-annual property tax bill is $3,239, that is, it is paid every 6 months, hence 3239/6 = $539.83.

I will mark you brainiest!

If the triangles above are reflections of each other, then ∠D ≅ to:
A) ∠F.
B) ∠E.
C) ∠C.
D) ∠A.
E) ∠B.

Answers

Answer:

D I believe

Step-by-step explanation:

Write a quadratic inequality represented by the graph.

Answers

Using the concept of parabola, the quadratic inequality represented by the graph can be written as:

y = x² -2x +2.

Define parabola?

An equation of a curve that has a point on it that is equally spaced from a fixed point and a fixed line is referred to as a parabola.

The parabola's fixed point is referred to as the focus, and its fixed line is referred to as the directrix.

The general equation for a parabola is given as:

y = a(x-h) ² + k

Now here we have:

(x,y) = (2,5)

(h,k) = (1,1)

Putting these values in the equation,

5 = a (2-1) ² + 1

a = 5-1

=4

Substituting the values:

y = (x-1) + 1

y = x² -2x +2

Therefore, the quadratic inequality can be written as: y = x² -2x +2.

To know more about parabola, visit:

https://brainly.com/question/4074088

#SPJ1

mathematicians divide the world of numbers into at least seven subsets. list seven subsets and define each

Answers

Mathematicians divide the world of numbers into seven subsets, namely natural numbers, whole numbers, integers, rational numbers, irrational numbers, real numbers, and complex numbers.

Natural numbers: These are the counting numbers, starting from 1 and continuing indefinitely. They can also be denoted as "N" or "ℕ".

Whole numbers: These are the natural numbers, as well as zero. They can also be denoted as "W" or "ℤ⁺⁰".

Integers: These are the whole numbers, as well as their negative counterparts. They can also be denoted as "Z" or "ℤ".

Rational numbers: These are numbers that can be expressed as a fraction, where the numerator and denominator are integers (and the denominator is not zero). They can also be denoted as "Q" or "ℚ".

Irrational numbers: These are numbers that cannot be expressed as a fraction of two integers. They are often represented by decimal expansions that neither terminate nor repeat. Examples include π and the square root of 2.

Real numbers: These are all the rational and irrational numbers, taken together. They can also be thought of as numbers that can be located on a number line. They are often denoted as "R" or "ℝ".

Complex numbers: These are numbers of the form a + bi, where a and b are real numbers and i is the imaginary unit (defined as the square root of -1). Complex numbers can be added, subtracted, multiplied, and divided, just like real numbers. They are often denoted as "C" or "ℂ".

Learn more about numbers here

brainly.com/question/17267103

#SPJ4

|x+6|<3 absolute value inequality, write an equivalent compound inequality.

Answers

An equivalent cοmpοund inequality is -9 < x < -3.

What is an absοlute value inequality?

An inequality with an absοlute value algebraic expressiοn and variables is knοwn as an absοlute value inequality. An expressiοn using absοlute functiοns and inequality signs is knοwn as an absοlute value inequality.

Here, we have

Given: |x+6|<3 is an absοlute value inequality.

Apply absοlute rule

if |u|<a, a>0 then -a<u<a

-3 < x+6 <3

x+6 > -3 and x+6 <3

x> -9 and x< -3

-9 < x < -3

Hence, an equivalent cοmpοund inequality is -9 < x < -3.

To learn more about the  absolute value inequality

https://brainly.com/question/30230997

#SPJ1

5. Which of these statistics is used in basketball as an all-in-one rating of how well a player performs per minute they play?
O A. Wins above replacement (WAR)
O B. Field goal percentage (FG%)
O C. Double doubles (DD2)
OD. Player efficiency rating (PER)

Answers

Answer:

Player Efficiency Rating (PER)

Step-by-step explanation:

The statistic used in basketball as an all-in-one rating of how well a player performs per minute they play is Player Efficiency Rating (PER).

The statistic used in basketball as an all-in-one rating of how well a player performs per minute they play is the Player Efficiency Rating (PER). So, correct option is D.

PER is a widely used metric that quantifies a player's overall performance by taking into account various statistical categories and normalizing them based on playing time.

PER evaluates a player's contributions in areas such as points, rebounds, assists, steals, blocks, and turnovers. It considers both positive and negative statistical events and provides a single numerical value that represents a player's efficiency on the court. A higher PER indicates a more productive player.

On the other hand, Wins Above Replacement (WAR) is a metric commonly used in baseball to estimate the number of wins a player contributes to their team compared to a replacement-level player.

Field Goal Percentage (FG%) measures the accuracy of a player's shooting by calculating the percentage of successful field goal attempts. Double doubles (DD2) count the number of games in which a player achieves double-digit totals in two statistical categories.

Among the options listed, Player Efficiency Rating (PER) is specifically designed to assess a player's overall performance per minute played in basketball.

So, correct option is D.

To learn more about statistics click on,

https://brainly.com/question/6976397

#SPJ2



What is the difference between the longest and
shortest pieces of scrap wood?

Answers

The difference in length between the two pieces of scrap wood is 7/8 inches.

What is the difference between the longest and shortest pieces of scrap wood?

To get the difference we just need to take the difference between the two lenghs.

Remember that we only have pieces of scraph wood if we have an "x" over the correspondent value in the line diagram.

By looking at it we can see that the longest pice measures 5 inches, while the shortest one (there are two of these) measure (4 + 1/8) inches.

The difference is:

5 - (4 + 1/8) = 7/8

The longest piece is 7/8 inches longer.

Learn more about differences at:

https://brainly.com/question/17695139

#SPJ1

Suppose the current cost of gasoline is ​$2.93 per gallon. Find the current price index​ number, using the 1975 price of 56.7 cents as the reference value.

Answers

Answer:

Step-by-step explanation:

To find the current price index number using the 1975 price of 56.7 cents as the reference value, we can use the formula:

Price Index = (Current Price / Base Price) x 100

Where "Current Price" is the current cost of gasoline, and "Base Price" is the 1975 price of 56.7 cents.

Substituting the values given in the problem, we get:

Price Index = ($2.93 / $0.567) x 100

Price Index = 516.899

Therefore, the current price index number, using the 1975 price of 56.7 cents as the reference value, is 516.899.

consider the funciton f given by f(t)=log49(t7). find values for a and b such that f(t)=a+logb(t).

Answers

The values for a and b such that f(t) = a + logb(t) are,

a = log(1/log(49))

b = 49

Therefor

We can start by simplifying the expression for f(t)

f(t) = log49(t7)

f(t) = log(t7)/log(49) [Using the change of base formula]

Now we can rewrite f(t) as:

f(t) = log(t)/log(b) + a [Using the logarithmic properties log(ab) = log(a) + log(b)]

Comparing this expression with f(t) = a + logb(t), we can see that:

a = log(1/log(49)) [since log(b) = 1/log(49)]

b = t

Therefore, we have

f(t) = log(t7)/log(49) = log(t)/log(b) + log(1/log(49))

= log(t)/log(49) + log(1/log(49))

= log(1/log(49)) + log(t)/log(49)

So, a = log(1/log(49)) and b = 49.

Learn more about logarithmic property here

brainly.com/question/30226560

#SPJ4

Other Questions
Dear Mom,I think we should get a pet dog. Dogs make great pets because they are loyal.They help deter criminals, like thieves. They also help boost peoples moods becausethey are friendly and playful. Doctors have even found that owning a dog can improvea persons health. They reduce the risk of cardiovascular disease and they help preventallergies, asthma, and eczema in children! You might think that I am not responsibleenough to have a pet dog. But, I have demonstrated responsibility by making my bedevery morning and doing my homework every afternoon. I know that I would beresponsible for walking our pet dog and cleaning up after it. Getting a pet dog wouldbe good for our whole family!Love, Nataliearguments lang po How has social mediachanged how you learnabout, interpret, andderive conclusionsabout American politicstoday? Helppp how does technological change affect the per-worker production function? what is the common molecule involved in the catabolism of proteins, fats, and carbohydrates? many companies, called allied industries, do not sell food directly but are still deeply involved in the food industry. the dairy industry is a good example of an allied industry. which of the following was not a consequence of the american policy of raising tariffs sky-high in the 1920s? you have an rc circuit with a time constant of 5.35 s. if the total resistance in the circuit is 231.2 k , what is the capacitance of the circuit (in f)? don't type the units into the answer box. .the him manager tasked the coding manager to development a dashboard that shows the discharges pending final billing so that she can plan for staffing. because this data changes throughout the day, what analysis technique is needed? what is a moral & legalabligation?- what kind of a person do you think?-what moral a bligation do you fulfill in your community?-what you can do to/what you can do? true ior false once credit is established, most people should plan on having at least eight to ten credit cards at any given time Which one of the following compounds is a non-electrolyte when dissolved in water?Cu(NO3)2CaCl2HClNaCH3CO2CCl4 Smores, a Taste of Multivariate Normal Distribution Smores Company store makes chocolate (Xi), marshmallow (X2), and graham cracker (Xs). Assume that the profit (in millions) for selling these smores materials follow a multivariate uormal ditributim with parameters 1 0.3 0.3 and = 0.31 0 0.3 01 What is the probability that 1. the profit for selling chocolate is greater than 6 millions? 2. the profit for selling chocolate is greater than 6 millions, given the sales of marshmallow is 5 million and the sales of graham cracker is 5 mllion? 3. P(3X1-1X2 + 3X3 > 20)? suppose the temperature of the input reservoir does not change. as the sink temperature is lowered, the efficiency of the engine_____ g a random sample of 100 automobile owners in the state of alabama shows that an automobile is driven on average 23,500 miles per year with a standard deviation of 3900 miles. assume the distribution of measurements to be approximately normal. a) construct a 99% confidence interval for the average number of miles an automobile is driven annually in alabama. The Senate and House of Representatives together have how manymembers? inflation-indexed treasury bonds are intended for investors who wish to ensure that the returns on their investments keep up with the increase in prices over time. a. true b. false God The midwives refused to kill Hebrew babies. Onemidwife was named(1:15) a person recently was diagnosed with social anxiety disorder. a best guess is that the person is in school and is likely than average to have a close relative with social anxiety disorder. group of answer choices elementary; more high; more elementary; less high; less candidates who are behind in election polls often use as a way to gain momentum and make the race competitive. AA contestant on a game show has a 1 in 6 chance of winning for each try at a certain game. Which probability models can be used to simulate the contestants chances of winning?Select ALL of the models that can be used to simulate this event.A) a fair six-sided number cubeB) a fair coinC) a spinner with 7 equal sectionsD) a spinner with 6 equal sectionsE) a bag of 12 black chips and 60 red chips