The statement that is TRUE is: "Vinegar is moderate to highly acidic."
Vinegar has a pH of about 2-3, which indicates that it is an acidic substance. pH scale ranges from 0 to 14, where pH 0 is the most acidic.
What is a Vinegar ?Vinegar is a liquid consisting mainly of acetic acid and water. It is typically made through a fermentation process where sugar is first converted to alcohol by yeast and then further oxidized to acetic acid by bacteria.
Vinegar has been used for thousands of years as a condiment, preservative, and for medicinal purposes. It is commonly used in cooking, food preservation, and as a cleaning agent. Different types of vinegar can be made from various sources such as grapes, apples, rice, malted barley, and many others, and each type has a unique flavor and acidity level. Some popular types of vinegar include white vinegar, red wine vinegar, apple cider vinegar, and balsamic vinegar.
To know more about Vinegar visit :
https://brainly.com/question/15934865
#SPJ1
how many moles of CaO will form if 10.0 moles of CO2 are produced
FILL IN THE BLANK. Use the Gizmo to find the freezing, melting, and boiling points of water at 5,000 meters (16,404 feet). Write these values below. Freezing point: _______ Melting point: _______ Boiling point: _______
If we use the Gizmo to find the freezing, melting, and boiling points of water at 5,000 meters (16,404 feet) then,
Freezing point: 32 ºF (0ºC)
Melting point: 32 ºF (0ºC)
Boiling point: 203°F (95°C)
The freezing point is defined as the temperature at which a liquid becomes a solid. Increased pressure usually raises the freezing point with the melting point of the solid. The boiling point of a pure substance is defined as the temperature at which the substance transitions from a liquid to the gaseous phase. At the boiling point the vapor pressure of the liquid is equal to the applied pressure on the liquid. The melting point of a substance is defined as the temperature at which the substance changes from a solid to a liquid.
Melting occurs at a single temperature for the pure substances. The normal and average melting point and boiling point of water at 1 atmospheric pressure are 0°C and 100°C respectively. Decreasing the pressure under 1 atm. will lower the boiling point since the external pressure will be lower so it will become equal with the vapor pressure at a lower temperature.
To learn more about Freezing point
https://brainly.com/question/40140
#SPJ4
Consider the following silica gel TLC plate of compounds A, B, and C developed in hexanes:
Consider the following silica gel TLC plate of com
a) Determine the R f values of compounds A, B, and C run on a silica gel TLC plate using hexanes as the solvent
b) Which compound, A, B, or C, is the most polar?
c) What would you expect to happen to the R f values if you used acetone instead of hexanes as the eluting solvent? (Think polarity of solvents)
The R f values for compounds A, B, and C on a silica gel TLC plate developed in hexanes would be determined by measuring the distance each compound traveled compared to the distance the solvent traveled.
a) There is a 4 cm gap between the origin and the solvent front. The Rf value for spot A is[tex]\frac{1.5}{4}= 0.375[/tex], because it travelled 1.5 cm. Due to the 3.5 cm movement of Spot B, its Rf is[tex]\frac{3.5}{4} = 0.875[/tex]. Spot C shifted 3 cm, making its Rf [tex]\frac{3}{4} = 0.75[/tex].
b)Due to its shorter travel distance than the other two compounds, compound A is the most polar. Recall that polar substances adhere to the adsorbent more readily, move less, and have a lower Rf value.
c)Hexanes is less polar than acetone as a solvent. Each of the three compounds would move more quickly if the same method were employed to elute them.The chemicals can be removed from the polar adsorbent more effectively with a more polar eluting solvent. Each compound would have a higher Rf value if acetone were used to elute the TLC plate as opposed to hexanes because each compound travels more quickly.
learn more about Rf value Refer:brainly.com/question/17796724
#SPJ1
An emission spectrum has a line in the blue region. How does this occur in the atom?
A. An electron ABSORBS a photon as it goes from a HIGHER TO LOWER energy level.
B. An electron EMITS a photon as it goes from a HIGHER TO LOWER energy level.
C. An electron EMITS a photon as it goes from a LOWER TO HIGHER energy level.
D. An electron ABSORBS a photon as it goes from a LOWER TO HIGHER energy level.
The correct response is B. An electron EMITS a photon as it goes from a HIGHER TO LOWER energy level.
What is electron?A subatomic particle with a negative electric charge is called an electron. Together with protons and neutrons, it is one of the fundamental particles that make up an atom.
When an atom is excited, its electrons have the ability to transition from one energy level to another. These stimulated electrons will eventually revert to their initial lower energy levels since they are unstable. They do this by releasing energy in the form of particular wavelength photons. Each element has a distinct set of energy levels, which leads to the emission of photons at a certain wavelength and the formation of a distinct emission spectrum.
In this instance, the existence of a line in the emission spectrum's blue section shows that an electron has released a photon with a certain wavelength that corresponds to the region's blue color. A photon with an energy equal to the difference between the two levels is released when an excited electron returns from a higher energy level to a lower energy level.
To know more about electron, visit:
https://brainly.com/question/1255220
#SPJ1
A 106 mL solution of a dilute acid is added to 157 mL of a base solution in a coffee-cup calorimeter. The temperature of the solution increases from 22.94 oC to 27.29 oC. Assuming the mixture has the same specific heat (4.184J/goC) and density (1.00 g/cm3) as water, calculate the heat (in J) transferred to the surroundings, qsurr.
Answer:
4897 J
Explanation:
The heat transferred to the surroundings, q_surr, can be calculated using the equation:
q_surr = -q_rxn = -CmΔT
where C is the specific heat capacity of the mixture (assumed to be the same as water, 4.184 J/g°C), m is the mass of the mixture (which we can calculate using the density, assuming that the volumes are additive), and ΔT is the change in temperature (in Celsius).
First, let's calculate the mass of the mixture:
density of water = 1.00 g/cm^3
volume of mixture = volume of acid + volume of base = 106 mL + 157 mL = 263 mL = 0.263 L
mass of mixture = density of water x volume of mixture = 1.00 g/cm^3 x 0.263 L = 263 g
Next, let's calculate the change in temperature:
ΔT = final temperature - initial temperature = 27.29°C - 22.94°C = 4.35°C
Now we can calculate the heat transferred to the surroundings:
q_surr = -CmΔT
q_surr = -(4.184 J/g°C) x (263 g) x (4.35°C)
q_surr = -4897 J
Note that the negative sign indicates that heat is lost by the system to the surroundings. Therefore, the heat transferred to the surroundings, q_surr, is 4897 J.
Calculate the buffer ratio (base/acid) required for a buffer of pH = 5.68 that is prepared by mixing sodium hydrogen oxalate and sodium oxalate. A table of pKa values can be found here. Report your answer to 2 significant figures in scientific notation. Calculate the pH (to two decimal places) of the buffer solution after the addition of 7.77 g of sodium hydrogen carbonate (NaHOCOO) to the buffer solution above. Assume 5% approximation is valid and that the volume of solution does not change.
122.5 grams of oxalic add dihydrate (MW = 126.07 g/mole) and disodium oxalate (MW = 133.99 g/mole) were required to prepare this buffer if the total oxalate concentration is 0.115 M.
Weak acids are defined as acids that don't completely dissociate in solution. It can be explained as any acid that is not a strong acid. The strength of a weak acid depends on how much it gets dissociates and the more it dissociates, the stronger the acid. The mass of the weak acid in a solution of a certain pH can be determined by calculating the original concentration of the acid after calculating the concentration of the hydrogen ions with the help of the pH value of the solution.
The Concentration of oxalate ion is 0.115 M.
pKa1 is 1.250.
pKa2 is 4.266.
pH is 5.193.
Molarity = (mass / molar mass) / 1 / volume in liter
The molar mass is 126.07g/mole.
Mass = Molarity × molar mass × Volume in liter
Mass=0.972 M × 126.07 g/mole × 1.00 L
= 122.5 gram
To learn more about concentration
https://brainly.com/question/17206790
#SPJ4
The complete question is,
A buffer prepared by dissolving oxalic add dihydrate (H2C2O4⋅2H2O) and disodium oxalate (Na2C2O4) in 1.00 L of water has a pH of 5.193. How many grams of oxalic add dihydrate (MW = 126.07 g/mole) and disodium oxalate (MW = 133.99 g/mole) were required to prepare this buffer if the total oxalate concentration is 0.115 M? Oxalic acid has pKa values of 1.250 (pKa1) and 4.266 (pKa2).
Look at the picture below
The claim was correct . All elements have same number of particles in one mole and have different number of particles in a mole based on atomic number .
What is mole ?In the International System of Units, the mole (symbol mol) is the unit of substance amount (SI). The amount of substance is a measurement of how many elementary entities of a given substance are present in an object or sample. An elementary entity can be an atom, a molecule, an ion, an ion pair, or a subatomic particle such as an electron, depending on the substance. For example, despite having different volumes and masses, 10 moles of water (a chemical compound) and 10 moles of mercury (a chemical element) contain equal amounts of substance, and the mercury contains exactly one atom for each molecule of water.
to know more about mole , visit ;
brainly.com/question/26416088
#SPJ1
!!!50 points!!!
Problem 1. What masses of 15% and 20% solutions are needed to prepare 200 g of 17% solution?
Problem 2. What masses of 18% and 5% solutions are needed to prepare 300 g of 7% solution?
Problem 3. 200 g of 15% and 350 g of 20% solutions were mixed. Calculate mass percentage of final solution.
Problem 4. 300 g of 15% solution and 35 g of solute were mixed. Calculate mass percentage of final solution.
Problem 5. 400 g of 25% solution and 150 g of water were mixed. Calculate mass percentage of final solution.
Answer:
See Below.
Explanation:
Problem 1
Let x be the mass of 15% solution needed and y be the mass of 20% solution needed. Then, we have the following system of equations:
x + y = 200 (total mass of solution)
0.15x + 0.20y = 0.17(200) (total amount of solute)
Solving this system of equations gives:
x = 60 g (mass of 15% solution)
y = 140 g (mass of 20% solution)
Therefore, 60 g of 15% solution and 140 g of 20% solution are needed to prepare 200 g of 17% solution.
Problem 2
Let x be the mass of 18% solution needed and y be the mass of 5% solution needed. Then, we have the following system of equations:
x + y = 300 (total mass of solution)
0.18x + 0.05y = 0.07(300) (total amount of solute)
Solving this system of equations gives:
x = 120 g (mass of 18% solution)
y = 180 g (mass of 5% solution)
Therefore, 120 g of 18% solution and 180 g of 5% solution are needed to prepare 300 g of 7% solution.
Problem 3
The total mass of the final solution is
200 g + 350 g = 550 g
The total amount of solute in the final solution is:
0.15(200 g) + 0.20(350 g) = 95 g + 70 g = 165 g
Therefore, the mass percentage of the final solution is:
(mass of solute / total mass of solution) x 100% = (165 g / 550 g) x 100% = 30%
Therefore, the mass percentage of the final solution is 30%.
Problem 4
The total mass of the final solution is
300 g + 35 g = 335 g
The total amount of solute in the final solution is:
0.15(300 g) + 35 g = 75 g + 35 g = 110 g
Therefore, the mass percentage of the final solution is:
(mass of solute / total mass of solution) x 100% = (110 g / 335 g) x 100% = 32.8%
Therefore, the mass percentage of the final solution is 32.8%.
Problem 5
The total mass of the final solution is
400 g + 150 g = 550 g
The total amount of solute in the final solution is
0.25(400 g) = 100 g
Therefore, the mass percentage of the final solution is
(mass of solute / total mass of solution) x 100% = (100 g / 550 g) x 100% = 18.2%
Therefore, the mass percentage of the final solution is 18.2%.
How many electrons can occupy the following sub-shells: (a) 1s, (b) 3p, (c) 3d, and (d) 6g?
The maximum number of electrons that can occupy the 1s sub-shell is 2, the 3p sub-shell is 6, the 3d sub-shell is 10, and the 6g sub-shell is 32.
For the 1s sub-shell, due to the Pauli Exclusion Principle, two electrons of opposite spin can exist in the same orbital. This means that there is a maximum of two electrons that can occupy the 1s sub-shell. For the 3p sub-shell, three orbitals exist with a maximum of two electrons each. Since two electrons of opposite spin can occupy each orbital, there is a maximum of six electrons that can occupy the 3p sub-shell. For the 3d sub-shell, five orbitals exist with a maximum of two electrons each. Since two electrons of opposite spin can occupy each orbital, there is a maximum of 10 electrons that can occupy the 3d sub-shell. Finally, for the 6g sub-shell, seven orbitals exist with a maximum of two electrons each. Since two electrons of opposite spin can occupy each orbital, there is a maximum of 32 electrons that can occupy the 6g sub-shell.
To learn more about Electrons ;
https://brainly.com/question/11316046
#SPJ11
How many moles are 2.96 x 1020 atoms of iron?
Answer: There are 3019.2 atoms of iron.
Answer:
Explanation:
Iron is a ductile, malleable, silver-white metallic element, scarcely known in a pure condition, but much used in its crude or impure carbon-containing forms for making tools, implements, machinery, etc. Symbol: Fe; atomic weight: 55.847; atomic number: 26; specific gravity 7.86 at 20°C.
1 mol contains [tex]=6.02\times10^{23}[/tex] particles, whether it be atoms, ions, molecules or whatever (Avogadro's number).
So you just divide:
[tex]\frac{2.96\times10^{20}}{6.02\times10^{23}}[/tex] = = 4.9169435215947 × 10^-4
1. Choose the atom with the smaller atomic size.
Select one:
a. Nitrogen
b. Bismuth
2. Choose the atom with the smaller atomic size.
Select one:
a. Arsenic
b. Bromine
Its atomic radius increases form top to bottom inside a group, then decreases from left and right across a period. As a result, francium is indeed the largest element while helium is the smallest.
Which atomic size has the smaller diameter?Atomic radii inside the periodic table decrease across a row form left to right and increase across a column from top to bottom. Due to these two patterns, the periodic table's lower left and upper right corners, respectively, contain the largest and smallest atoms.
Which atom is the smallest?The atomic radius grows form top to bottom inside a group and decreases form left to right during a period, as seen in the images below. As a result, francium is indeed the largest element while helium is the smallest.
To know more about francium visit:
https://brainly.com/question/28617076
#SPJ1
a. The atom with the smaller atomic size is: Nitrogen
a. The atom with the smaller atomic size is: Arsenic.
How is atomic size of elements calculated?Atomic size, also known as atomic radius, is the distance between the nucleus of an atom and its outermost electrons. It is typically measured in picometers (pm) or angstroms (Å). The atomic size of an element can be calculated by finding the distance between the nucleus and the outermost electron shell of an atom of that element. This distance can be determined using various methods, including X-ray diffraction and spectroscopy. The atomic size of elements generally decreases from left to right across a period and increases from top to bottom down a group in the periodic table.
To know more about spectroscopy, visit:
https://brainly.com/question/28523860
#SPJ1
Please help me. Thank you
The standard change in Gibbs energy at 25 degree Celsius is 490.6 °C. for given equilibrium partial pressure .
What is Gibbs energy ?The Gibbs energy is the thermodynamic potential that is minimized when a system reaches chemical equilibrium at constant pressure and temperature when not driven by an applied electrolytic voltage. Its derivative with respect to the reaction coordinate of the system then vanishes at the equilibrium point.
Using the formula
ΔG° = - R × T ln K
WHERE R= 8.3144598 J⋅mol⁻¹⋅K⁻¹.
T = 298 K
K = 0.82
SOLVING ,
The standard change in Gibbs energy at 25 degree Celsius is 490.6 °C.
To know more about Gibbs energy , visit ;
brainly.com/question/20358734
#SPJ1
Which equation is a correctly written thermochemical equation?
OC3H8 (g) +502 (g) → 3CO2 (g) + 4H₂O (1), AH= -2,220 kJ/mol
OFe (s) + O2 (g) → Fe₂O3 (s), AH= -3,926 kJ
ONH₂Cl → NH₂ + + Cl
O2C8H18 + 250216CO2 + 18H₂O, AH=-5,471 kJ/mol
Answer:
The correctly written thermochemical equation is:
C3H8 (g) + 5O2 (g) → 3CO2 (g) + 4H2O (l), ΔH = -2,220 kJ/mol
This equation represents the combustion of propane (C3H8) in the presence of oxygen (O2) to produce carbon dioxide (CO2) and water (H2O), with a heat release of -2,220 kJ/mol. The state symbols (g) for gases and (l) for liquids indicate the physical state of each substance at standard conditions.
Explanation:
ABOVE
How many calories are required to raise the temperature of a 35.0 g sample from 35 °C to 85 °C? The sample has a specific heat of 0.108 cal/g °C.
Answer:
First, we need to calculate the change in temperature:
ΔT = final temperature - initial temperature
ΔT = 85 °C - 35 °C
ΔT = 50 °C
Next, we can use the following formula to calculate the heat energy required:
Q = m·C·ΔT
where Q is the heat energy in calories, m is the mass of the sample in grams, C is the specific heat in cal/g °C, and ΔT is the change in temperature in °C.
Plugging in the given values, we get:
Q = 35.0 g · 0.108 cal/g °C · 50 °C
Q = 189.0 calories
Therefore, 189.0 calories are required to raise the temperature of the sample from 35 °C to 85 °C
Can some please help with the picture below
The completed table of maximum moles of water, limiting reactant and excess reactant is as follows:
Q: 6 moles, O₂, 1 mole H₂
R: 6 moles, O₂, 2 moles H₂
S: 5 moles, none, none
T: 5 moles, H₂, 2.5 moles O₂
U: 8 moles, H₂, 2 moles O₂
What is the mole ratio of the reaction of hydrogen and oxygen to form water?The mole ratio of the reaction of hydrogen and oxygen to form water is obtained from the equation of the reaction.
The equation of the reaction is given below:
2 H₂ + O₂ --> 2 H₂O
The mole ratio of hydrogen to oxygen is 2:1 in both the water molecule and the reactants, hydrogen gas (H2) and oxygen gas, as can be seen from the balanced equation (O2).
Learn more about mole ratio at: https://brainly.com/question/30632038
#SPJ1
which of the following statements may be true regarding a biochemical oxidation-reduction (redox) reaction?
A few statements may be true regarding a biochemical oxidation-reduction (redox) reaction. The statements are as follows: A redox reaction occurs when there is a transfer of electrons between molecules or atoms.
The electron donor becomes oxidized, and the electron acceptor is reduced, causing a transfer of energy. A redox reaction produces ATP, which is the primary energy currency of the cell. Oxidation and reduction are complementary reactions that occur simultaneously in the same reaction, resulting in the release of energy. Redox reactions are vital in metabolic pathways, and the electron carriers NAD+ and FAD+ are essential in these reactions. Oxygen is frequently used as a final electron acceptor in redox reactions. Redox reactions can also occur in non-cellular environments, such as photosynthesis, respiration, and combustion. The significance of redox reactions is enormous, and they play an essential role in sustaining life on earth. They help in generating energy, breaking down complex molecules, synthesizing molecules, and many other cellular processes.
To learn more about Oxidation-reduction :
https://brainly.com/question/13892498
#SPJ11
How Scandium affects the government
bababoy jijijijajdiwhrjfofhebdlodvebfif
please answer for brainliest
Using the formula M1V1 = M2V2 , you have a 0.5 M MgSO4 stock solution available. Calculate the volume of the stock solution needed to make 2.0 L of 0.20M MgSO4.
Question 2 options:
4.0 L
0.9 L
0.8 L
0.5 L
Answer:
0.8 L
Explanation:
The volume of the stock solution needed to make 2.0 L of 0.20M MgSO4 is 0.8 L.
According to Table F, which substance is least soluble?
NaNO3
BaSO4
KCl
KSO4
write a balanced equation for the redox reaction between calcium metal and oxygen gas
a balanced equation for the redox reaction: 2 Ca(s) + O2(g) → 2 CaO(s)
What is a redox reaction?A redox reaction is a type of chemical reaction that involves the transfer of electrons between species. One species undergoes oxidation (loses electrons) while another species undergoes reduction (gains electrons).
Which species is being oxidized and which species is being reduced in the reaction between calcium metal and oxygen gas?In the reaction between calcium metal and oxygen gas, the calcium metal is being oxidized (loses electrons) and the oxygen gas is being reduced (gains electrons). This can be seen in the balanced equation where the calcium atoms go from having an oxidation state of 0 to +2, while the oxygen atoms go from having an oxidation state of 0 to -2.
Learn more about redox reaction here:
https://brainly.com/question/13293425
#SPJ1
Which of the following is the major organic product of the condensation of ammonia or a primary amine with the carbonyl group of an aldehyde or ketone?
Imine
The major organic product of the condensation of ammonia or a primary amine with the carbonyl group of an aldehyde or ketone is an imine.
A functional group or organic substance with a carbon-nitrogen double bond (C=N) is known as an imine. A hydrogen atom or an organic group may be joined to the nitrogen atom. (R). The carbon atom is connected to two more single bonds. Imines are present in numerous processes and are frequently found in manufactured and naturally occurring chemicals.
The five core atoms for ketimines and aldimines, C2C=NX and C(H)C=NX, respectively, are coplanar. The sp2-hybridization of the mutually double-bonded nitrogen and carbon atoms yields planarity. For nonconjugated imines, the C=N distance is 1.29-1.31, whereas for conjugated imines, it is 1.35. The C-N distances in amines and nitriles, on the other hand, are 1.47 and 1.16, respectively. Slow rotation occurs around the C=N bond. E- and Z-isomers were detected using NMR spectroscopy of aldimines have been detected. Owing to steric effects, the E isomer is favored.
An imine is formed when a primary amine reacts with a carbonyl group (C=O) of an aldehyde or ketone to form a new C-N bond. This reaction is known as a condensation reaction, as it involves the loss of a small molecule (e.g. water) to form the product.
For more such questions on condensation reaction , Visit:
https://brainly.com/question/1361341
#SPJ11
The correct questions is :
What is the major organic product of the condensation of ammonia or a primary amine with the carbonyl group of an aldehyde or ketone?
Chemistry Help Please! It's worth a lot of points
1.Write the equilibrium expression for the following reactions
a. H2SO4(aq) + H2O(L) ⇆ HSO4-(aq) + H3O+(aq)
b. 4NH3(g) + 5O2(g) ⇆ 4NO(g) + 6H2O(g)
c. NH4Cl(s) ⇆ NH3(g) + HCl(g)
d. N2O4(g) ⇆ 2NO2(g)
2. The following reaction has a K value of 0.050. What does that mean about the concentrations of the reactants as compared to the products? Be specific in your answer.
N2(g) + 3H2(g) ⇆ 2NH3(g)
3. The following reaction has a K value of 6.8 x 103. What does that mean about the concentrations of the reactants as compared to the products? Be specific in your answer.
2SO3(g) ⇆ 2SO2(g) + O2(g)
4. When dissolving substances in water, the degree of solubility of a substance is often represented as the solubility product constant (Ksp). The solubility product constant is the same thing as the equilibrium constant for the dissolving reaction. Two substances that dissociate in water are shown below alone with the Ksp.
NaCl(s) ⇆ Na+(aq) + Cl-(aq) Ksp = 36
BaSO4(s) ⇆ Ba2+(aq) + SO42-(aq) Ksp = 1.1 x 10-16
5. Identify and label the Brønsted-Lowry acid, its conjugate base, the Brønsted-Lowry base, and its conjugate acid in each of the following equations:
a. HNO3 + H2O ⟶ H3O+ + NO3−
b. CN− + H2O ⟶ HCN + OH−
c. H2SO4 + Cl− ⟶ HCl + HSO4−
d. HSO4− + OH− ⟶ SO42− + H2O
e. O2− + H2O ⟶2OH−
6. What is the conjugate acid of each of the following? What is the conjugate base of each of the following?
a. OH-
b. H2O
c. HCO3-
d. NH3
e. HSO4-
7. The following acids are shown with their equilibrium constants (also known as the acid dissociation constant). Rank these acids from strongest to weakest. Explain your ranking.
HCN(aq) + H2O(L) ⇆ H3O+(aq) + CN-(aq) K = 6.2 x 10-10
HC2H3O2(aq) + H2O(L) ⇆ H3O+(aq) + C2H3O-(aq) K = 1.75 x 10-5
H2CO3(aq) + H2O(L) ⇆ H3O+(aq) + HCO3-(aq) K = 4.5 x 10-7
HIO4(aq) + H2O(L) ⇆ H3O+(aq) + IO4-(aq) K = 2.3 x 10-2
8. Calculate the pH and the pOH of each of the following solutions.
a. 0.200 M HCl
b. 0.0143 M NaOH
c. 3.0 M HNO3
d. 0.0031 M Ca(OH)2
9. Wine has a pH of 3.6. What are the hydronium and hydroxide ion concentrations?
10. The hydroxide ion concentration in household ammonia is 3.2 x 10-3 M. What is the concentration of hydronium ions?
Answer:
1. Equilibrium expressions:
a. K = [HSO4-][H3O+]/[H2SO4][H2O]
b. K = [NO]^4[H2O]^6/[NH3]^4[O2]^5
c. K = [NH3][HCl]/[NH4Cl]
d. K = [NO2]^2/[N2O4]
2. Since K = 0.050, the concentrations of the reactants (N2 and H2) are larger than the concentrations of the products (NH3).
3. Since K = 6.8 x 10^3, the concentrations of the products (SO2 and O2) are larger than the concentrations of the reactant (SO3).
4. The Ksp expression for each of the reactions is:
a. Ksp = [Na+][Cl-]
b. Ksp = [Ba2+][SO42-]
5. Brønsted-Lowry acids and bases:
a. Acid: HNO3; Conjugate base: NO3-; Base: H2O; Conjugate acid: H3O+
b. Acid: HCN; Conjugate base: CN-; Base: H2O; Conjugate acid: HCN
c. Acid: H2SO4; Conjugate base: HSO4-; Base: Cl-; Conjugate acid: HCl
d. Acid: NH3; Conjugate base: NH2-; Base: H2O; Conjugate acid: NH4+
e. Acid: H2O; Conjugate base: OH-; Base: O2-; Conjugate acid: OH-
6. Conjugate acids and bases:
a. Acid: H2O; Conjugate base: OH-
b. Acid: H3O+; Conjugate base: H2O
c. Acid: H2CO3; Conjugate base: HCO3-
d. Acid: NH4+; Conjugate base: NH3
e. Acid: HSO4-; Conjugate base: SO42-
7. The strongest acid is HIO4 (highest K value), followed by HCN, HC2H3O2, and H2CO3 (lowest K value). The K values represent the degree to which the acids dissociate in solution. HIO4 is a strong acid, meaning it dissociates almost completely in solution, while H2CO3 is a weak acid, meaning it only dissociates partially.
8. pH and pOH calculations:
a. pH = -log[H3O+] = -log(0.200) = 0.699; pOH = -log[OH-] = -log(1.0 x 10^-14/0.200) = 12.301
b. pOH = -log[OH-] = -log(0.0143) = 1.844; pH = 14.000 - pOH = 12.156
c. pH = -log[H3O+] = -log(3.0) = 0.522; pOH = 13.478
d. pOH = -log[OH-] = -log(0.0062) = 2.206; pH = 14.000 - pOH = 11.794
9. Hydronium and hydroxide ion concentrations:
pH = 3.6; hydronium ion concentration = 10^-pH = 3.98 x 10^-4 M; hydro
(Please could you kindly mark my answer as brainliest you could also follow me so that you could easily reach out to me for any other questions)
2. Hydrogen bromide reacts with propene to form either 1-bromopropane or 2-bromopropane. Explain why
2-bromopropane is the major product.
3. Explain how the reaction with bromine can be used to test for an alkene. Include the mechanism for the reaction between hex-1-ene and bromine in your answer.
a) Describe the process of addition polymerisation.
b) Show the repeating unit of the polymer that is formed from the addition polymerisation of chloroethene monomers. Name and give at least one use for this polymer.
Answer:
Explanation:
2-bromopropane is the major product because the reaction mechanism involves the formation of the most stable carbocation intermediate. When hydrogen bromide reacts with propene, the hydrogen atom from HBr adds to the carbon atom of the double bond that has fewer hydrogen atoms attached, resulting in the formation of a carbocation intermediate. The intermediate can either form 1-bromopropane or 2-bromopropane depending on the position of the carbocation. The 2-bromopropane is the major product because the secondary carbocation formed in this case is more stable than the primary carbocation formed in the case of 1-bromopropane.
To test for an alkene, bromine water can be used. When an alkene reacts with bromine water, the bromine molecule adds across the double bond, forming a colorless dibromoalkane product. The mechanism for the reaction between hex-1-ene and bromine involves the formation of a cyclic bromonium ion intermediate, followed by the attack of water on the intermediate, resulting in the formation of the dibromoalkane product.
a) Addition polymerization is a process in which unsaturated monomers are joined together to form a polymer. The process involves breaking the double bond of the monomer and joining the monomers together to form a long-chain polymer. The process requires a catalyst to initiate the reaction.
b) The repeating unit of the polymer formed from the addition polymerization of chloroethene monomers is -CH2-CHCl-. This polymer is called polyvinyl chloride (PVC), and it has a wide range of uses, including pipes, electrical cables, and vinyl flooring.
1) what is the empirical formula of a molecule containing 65.5% carbon, 5.5% hydrogen, and 29% oxygen? worksheet
The empirical formula of a molecule containing 65.5% carbon, 5.5% hydrogen, and 29% oxygen is CH2O.
To calculate this, you need to first convert the percentage composition into mass composition. This is done by multiplying the percentages by the molecular weight of each element.
Carbon: 65.5% x 12 g/mol = 0.786 g/mol
Hydrogen: 5.5% x 1 g/mol = 0.055 g/mol
Oxygen: 29% x 16 g/mol = 0.464 g/mol
Now that you have the mass composition, you can calculate the moles of each element by dividing the mass of each element by its molar mass.
Carbon: 0.786 g/mol / 12 g/mol = 0.065 mol
Hydrogen: 0.055 g/mol / 1 g/mol = 0.055 mol
Oxygen: 0.464 g/mol / 16 g/mol = 0.029 mol
Finally, divide each element's moles by the smallest moles to get the empirical formula.
Carbon: 0.065 mol / 0.029 mol = 2.24 = 2 mol
Hydrogen: 0.055 mol / 0.029 mol = 1.90 = 1 mol
Oxygen: 0.029 mol / 0.029 mol = 1.00 = 1 mol
Therefore, the empirical formula of the molecule is CH2O.
For more such questions on empirical formula , Visit:
https://brainly.com/question/1603500
#SPJ11
There are 7.68 × 1025 atoms of phosphorous in how many moles of diphosphorous pentoxide?
Answer:
7.68 x 1025 atoms of phosphorous correspond to 1.06 mole of diphosphorous pentoxide. This can also be written as 1.06 mol of P2O5.
metals that have luster are usually called as______
Answer:
lusterous metal
Explanation:
ex gold, iron etc hope it helps
What is the pH of 0.335 M trimethylammonium chloride, (CH3)3NHCI? The Kb of trimethylamine, (CH3)3N, is 6.3 x 10-5. (value = 0.02)
The pH of 0.335 M trimethylammonium chloride, (CH3)3NHCI is approximately 5.676.
What is pH?
To find the pH of the solution, we need to first determine if (CH3)3NHCI acts as an acid or base. Since (CH3)3NHCI is a salt composed of a weak base, trimethylamine, and a strong acid, hydrochloric acid (HCI), it will undergo hydrolysis in water.
The hydrolysis reaction is given by:
(CH3)3NH+ (aq) + H2O (l) ⇌ (CH3)3N (aq) + H3O+ (aq)
The Kb expression for the equilibrium reaction is:
Kb = [ (CH3)3N ] [ H3O+ ] / [ (CH3)3NH+ ]
Since (CH3)3NH+ and HCl dissociate completely in water, the initial concentration of (CH3)3NH+ is equal to the concentration of (CH3)3NHCI, which is 0.335 M.
Using the Kb value given, we can solve for the concentration of H3O+:
Kb = 6.3 x [tex]10^{-5}[/tex] = [ (CH3)3N ] [ H3O+ ] / 0.335
[ H3O+ ] = Kb x (CH3)3NH+ / (CH3)3N
[ H3O+ ] = 6.3 x [tex]10^{-5}[/tex] x 0.335 / 1
[ H3O+ ] = 2.1095 x [tex]10^{-6}[/tex] M
Finally, we can calculate the pH using the expression:
pH = -log [H3O+]
pH = -log (2.1095 x [tex]10^{-6}[/tex])
pH = 5.676
Therefore, the pH of the solution is approximately 5.676.
To know more about pH, visit:
https://brainly.com/question/15289741
#SPJ1
Complete question is: The pH of 0.335 M trimethylammonium chloride, (CH3)3NHCI is approximately 5.676.
Menthol is composed of C, H, and O. A 0.1005g sample of menthol is combusted, producing 0.2829g of CO2 and 0.1159g H2O. What is the empirical and molecular formula for menthol?
The empirical formula, CH2O9(menthol) is multiplied by 5 to get the molecular formula, C10H20O.The empirical and molecular formula for menthol are CH2O and C10H20O, respectively.
The molecular formula for menthol is C5H10O.
This can be determined by dividing the molar mass of the empirical formula (156.26 g/mol) by the molar mass of CO2 (44.01 g/mol). This gives a ratio of 3.55, which is equal to the ratio of C atoms in the empirical formula, C10H20O.
Therefore, the molecular formula is C5H10O.
Given:
Menthol is composed of C, H, and O0.1005g sample of menthol is combusted and produces0.2829g of CO2 0.1159g H2O
1. Find: Empirical and molecular formula for menthol.
Let's first calculate the number of moles of CO2 produced. The balanced equation for combustion of menthol is:
C10H20O(s) + 12O2(g) → 10CO2(g) + 10H2O(l)
From the above equation, we can see that for 10 moles of CO2 produced 1 mole of menthol is required.
2. By taking the number of moles of CO2 produced, we can calculate the number of moles of menthol burned.
Moles of CO2 = 0.2829g / 44.01g/mol= 0.00643 mol
C10H20O(s) + 12O2(g) → 10CO2(g) + 10H2O(l)
From the balanced equation,1 mole of C10H20O requires 10 moles of CO2
Moles of C10H20O burned = 10 * 0.00643= 0.0643 mol
Next, we can calculate the number of moles of H2O produced.
Moles of H2O = 0.1159g / 18.015g/mol= 0.00643 mol
C10H20O(s) + 12O2(g) → 10CO2(g) + 10H2O(l)
From the balanced equation,1 mole of C10H20O requires 10 moles of H2O
Moles of C10H20O burned = 10 * 0.00643= 0.0643 mol
3. Now we can calculate the empirical formula of menthol. The empirical formula can be calculated as follows:
Empirical formula = CH2O (Divide all moles by smallest moles) The molecular weight of CH2O = 30 g/mol
The empirical formula mass of the compound is:
mass = (12.011 + 2*1.008 + 15.999) = 30.026
Empirical formula mass of CH2O is 30.026g/mol, and the given sample weighs 0.1005 g.
The number of empirical formula units in the sample is 0.1005 g / 30.026 g/mol = 0.003348Units.
Empirical formula = CH2OThe empirical formula weight of menthol is CH2O, which is equal to 30.026g/mol.
4. To find the molecular formula, we need to know the molecular weight of the menthol. We can calculate it as follows:
Molecular formula mass = Empirical formula mass x n
Where n = integer Molecular formula mass of menthol is 156 g/mol, and the empirical formula mass is 30.026 g/mol.
So, n = 156 g/mol ÷ 30.026 g/mol = 5.192
Thus the empirical formula, CH2O is multiplied by 5 to get the molecular formula, C10H20O.The empirical and molecular formula for menthol are CH2O and C10H20O, respectively.
For more such questions on empirical formula , Visit:
https://brainly.com/question/1603500
#SPJ11
Some metalloids are liquids at room temperature.
TRUE
FALSE
Answer:
Some metalloids are liquids at room temperature.
FALSEThey are all solid at room temperature.
Explanation:
You're welcome.
Determine the empirical formula for a compound that is composed of 0.953 mol Na, 0.322 mol Al, and 1.93 mol F.
Answer: NaAlF6
Explanation:
1) divide by the smallest number of moles
0.953/.322 =2.96 round to 3 Na
.322/.322 = 1 Al
1.93/.322 =5.99 round to 6 F
2) write in order numbers were give
NaAlF6
